Skip to content

biothings/bte_trapi_query_graph_handler

Folders and files

NameName
Last commit message
Last commit date

Latest commit

b0732af · Nov 13, 2024
Aug 8, 2024
Oct 21, 2024
Sep 6, 2024
Nov 7, 2024
Oct 18, 2023
Mar 11, 2021
Aug 20, 2021
Oct 20, 2023
Oct 6, 2023
Mar 12, 2021
Jun 30, 2022
Nov 5, 2024
Mar 22, 2024
Mar 11, 2021

Repository files navigation

BioThings Explorer TRAPI Query Graph Handler

A on-the-fly query engine for BioThings Explorer based on TRAPI Query Graph.

Test in workspace codecov

Install

pnpm i @biothings-explorer/query_graph_handler

Usage

Making a single hop query

const handler = require("@biothings-explorer/query_graph_handler");
const queryHandler = new handler.TRAPIQueryHandler();
const oneHopQuery = {
    "workflow": [
        {"id": "lookup"}
    ],
    "message": {
        "query_graph": {
            "edges": {
                "e00": {
                    "object": "n01",
                    "subject": "n00",
                    "predicates": ["biolink:functional_association"]
                }
            },
            "nodes": {
                "n00": {
                    "categories": ["biolink:Gene"],
                    "ids": ["ENSEMBL:ENSG00000123374"]
                },
                "n01": {
                    "categories": ["biolink:BiologicalProcess"]
                }
            }
        }
    }
};
queryHandler.setQueryGraph(OneHopQuery);
await queryHandler.query();
console.log(queryHandler.getResponse())
Example Result
{
    "workflow": [
        {"id": "lookup"}
    ],
    "message": {
        "query_graph": {
            "edges": {
                "e00": {
                    "object": "n01",
                    "subject": "n00",
                    "predicate": "biolink:enables"
                }
            },
            "nodes": {
                "n00": {
                    "category": "biolink:Gene",
                    "id": "ENSEMBL:ENSG00000123374"
                },
                "n01": {
                    "category": "biolink:BiologicalProcess"
                }
            }
        },
        "knowledge_graph": {
            "nodes": {
                "NCBIGene:1017": {
                    "category": "biolink:Gene",
                    "name": "CDK2",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:1017",
                                "name:cyclin dependent kinase 2",
                                "SYMBOL:CDK2",
                                "UMLS:C1332733",
                                "UMLS:C0108855",
                                "HGNC:1771",
                                "UniProtKB:P24941",
                                "ENSEMBL:ENSG00000123374",
                                "OMIM:116953"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "GO:0000082": {
                    "category": "biolink:BiologicalProcess",
                    "name": "G1/S transition of mitotic cell cycle",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "GO:0000082",
                                "name:G1/S transition of mitotic cell cycle"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "GO:0000086": {
                    "category": "biolink:BiologicalProcess",
                    "name": "G2/M transition of mitotic cell cycle",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "GO:0000086",
                                "name:G2/M transition of mitotic cell cycle"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "GO:0006260": {
                    "category": "biolink:BiologicalProcess",
                    "name": "DNA replication",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "GO:0006260",
                                "name:DNA replication"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "GO:0006281": {
                    "category": "biolink:BiologicalProcess",
                    "name": "DNA repair",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "GO:0006281",
                                "name:DNA repair"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "GO:0006468": {
                    "category": "biolink:BiologicalProcess",
                    "name": "protein phosphorylation",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "GO:0006468",
                                "name:protein phosphorylation"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "GO:0006977": {
                    "category": "biolink:BiologicalProcess",
                    "name": "DNA damage response, signal transduction by p53 class mediator resulting in cell cycle arrest",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "GO:0006977",
                                "name:DNA damage response, signal transduction by p53 class mediator resulting in cell cycle arrest"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "GO:0007099": {
                    "category": "biolink:BiologicalProcess",
                    "name": "centriole replication",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "GO:0007099",
                                "name:centriole replication"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "GO:0007165": {
                    "category": "biolink:BiologicalProcess",
                    "name": "signal transduction",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "GO:0007165",
                                "name:signal transduction"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "GO:0007265": {
                    "category": "biolink:BiologicalProcess",
                    "name": "Ras protein signal transduction",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "GO:0007265",
                                "name:Ras protein signal transduction"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "GO:0008284": {
                    "category": "biolink:BiologicalProcess",
                    "name": "positive regulation of cell population proliferation",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "GO:0008284",
                                "name:positive regulation of cell population proliferation"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "GO:0010389": {
                    "category": "biolink:BiologicalProcess",
                    "name": "regulation of G2/M transition of mitotic cell cycle",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "GO:0010389",
                                "name:regulation of G2/M transition of mitotic cell cycle"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "GO:0010468": {
                    "category": "biolink:BiologicalProcess",
                    "name": "regulation of gene expression",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "GO:0010468",
                                "name:regulation of gene expression"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "GO:0016572": {
                    "category": "biolink:BiologicalProcess",
                    "name": "histone phosphorylation",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "GO:0016572",
                                "name:histone phosphorylation"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "GO:0018105": {
                    "category": "biolink:BiologicalProcess",
                    "name": "peptidyl-serine phosphorylation",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "GO:0018105",
                                "name:peptidyl-serine phosphorylation"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "GO:0031145": {
                    "category": "biolink:BiologicalProcess",
                    "name": "anaphase-promoting complex-dependent catabolic process",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "GO:0031145",
                                "name:anaphase-promoting complex-dependent catabolic process"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "GO:0031571": {
                    "category": "biolink:BiologicalProcess",
                    "name": "mitotic G1 DNA damage checkpoint",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "GO:0031571",
                                "name:mitotic G1 DNA damage checkpoint"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "GO:0051298": {
                    "category": "biolink:BiologicalProcess",
                    "name": "centrosome duplication",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "GO:0051298",
                                "name:centrosome duplication"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "GO:0051301": {
                    "category": "biolink:BiologicalProcess",
                    "name": "cell division",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "GO:0051301",
                                "name:cell division"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "GO:0051321": {
                    "category": "biolink:BiologicalProcess",
                    "name": "meiotic cell cycle",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "GO:0051321",
                                "name:meiotic cell cycle"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "GO:0060968": {
                    "category": "biolink:BiologicalProcess",
                    "name": "regulation of gene silencing",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "GO:0060968",
                                "name:regulation of gene silencing"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "GO:0071732": {
                    "category": "biolink:BiologicalProcess",
                    "name": "cellular response to nitric oxide",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "GO:0071732",
                                "name:cellular response to nitric oxide"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "GO:1901796": {
                    "category": "biolink:BiologicalProcess",
                    "name": "regulation of signal transduction by p53 class mediator",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "GO:1901796",
                                "name:regulation of signal transduction by p53 class mediator"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                }
            },
            "edges": {
                "NCBIGene:1017-GO:0000082-MyGene.info API-entrez": {
                    "predicate": "biolink:enables",
                    "subject": "NCBIGene:1017",
                    "object": "GO:0000082",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "entrez",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "MyGene.info API",
                            "type": "bts:api"
                        },
                        {
                            "name": "evidence",
                            "value": "IBA",
                            "type": "bts:evidence"
                        },
                        {
                            "name": "term",
                            "value": "G1/S transition of mitotic cell cycle",
                            "type": "bts:term"
                        },
                        {
                            "name": "publications",
                            "value": [
                                "PMID:21873635"
                            ],
                            "type": "biolink:publications"
                        }
                    ]
                },
                "NCBIGene:1017-GO:0000086-MyGene.info API-entrez": {
                    "predicate": "biolink:enables",
                    "subject": "NCBIGene:1017",
                    "object": "GO:0000086",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "entrez",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "MyGene.info API",
                            "type": "bts:api"
                        },
                        {
                            "name": "evidence",
                            "value": "NAS",
                            "type": "bts:evidence"
                        },
                        {
                            "name": "term",
                            "value": "G2/M transition of mitotic cell cycle",
                            "type": "bts:term"
                        },
                        {
                            "name": "publications",
                            "value": [
                                "PMID:1653904"
                            ],
                            "type": "biolink:publications"
                        }
                    ]
                },
                "NCBIGene:1017-GO:0006260-MyGene.info API-entrez": {
                    "predicate": "biolink:enables",
                    "subject": "NCBIGene:1017",
                    "object": "GO:0006260",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "entrez",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "MyGene.info API",
                            "type": "bts:api"
                        },
                        {
                            "name": "evidence",
                            "value": "TAS",
                            "type": "bts:evidence"
                        },
                        {
                            "name": "term",
                            "value": "DNA replication",
                            "type": "bts:term"
                        },
                        {
                            "name": "publications",
                            "value": [
                                "PMID:19238148"
                            ],
                            "type": "biolink:publications"
                        }
                    ]
                },
                "NCBIGene:1017-GO:0006281-MyGene.info API-entrez": {
                    "predicate": "biolink:enables",
                    "subject": "NCBIGene:1017",
                    "object": "GO:0006281",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "entrez",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "MyGene.info API",
                            "type": "bts:api"
                        },
                        {
                            "name": "evidence",
                            "value": "IEA",
                            "type": "bts:evidence"
                        },
                        {
                            "name": "term",
                            "value": "DNA repair",
                            "type": "bts:term"
                        }
                    ]
                },
                "NCBIGene:1017-GO:0006468-MyGene.info API-entrez": {
                    "predicate": "biolink:enables",
                    "subject": "NCBIGene:1017",
                    "object": "GO:0006468",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "entrez",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "MyGene.info API",
                            "type": "bts:api"
                        },
                        {
                            "name": "evidence",
                            "value": "IBA",
                            "type": "bts:evidence"
                        },
                        {
                            "name": "term",
                            "value": "protein phosphorylation",
                            "type": "bts:term"
                        },
                        {
                            "name": "publications",
                            "value": [
                                "PMID:21873635"
                            ],
                            "type": "biolink:publications"
                        }
                    ]
                },
                "NCBIGene:1017-GO:0006977-MyGene.info API-entrez": {
                    "predicate": "biolink:enables",
                    "subject": "NCBIGene:1017",
                    "object": "GO:0006977",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "entrez",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "MyGene.info API",
                            "type": "bts:api"
                        },
                        {
                            "name": "evidence",
                            "value": "TAS",
                            "type": "bts:evidence"
                        },
                        {
                            "name": "term",
                            "value": "DNA damage response, signal transduction by p53 class mediator resulting in cell cycle arrest",
                            "type": "bts:term"
                        }
                    ]
                },
                "NCBIGene:1017-GO:0007099-MyGene.info API-entrez": {
                    "predicate": "biolink:enables",
                    "subject": "NCBIGene:1017",
                    "object": "GO:0007099",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "entrez",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "MyGene.info API",
                            "type": "bts:api"
                        },
                        {
                            "name": "evidence",
                            "value": "IMP",
                            "type": "bts:evidence"
                        },
                        {
                            "name": "term",
                            "value": "centriole replication",
                            "type": "bts:term"
                        },
                        {
                            "name": "publications",
                            "value": [
                                "PMID:26297806"
                            ],
                            "type": "biolink:publications"
                        }
                    ]
                },
                "NCBIGene:1017-GO:0007165-MyGene.info API-entrez": {
                    "predicate": "biolink:enables",
                    "subject": "NCBIGene:1017",
                    "object": "GO:0007165",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "entrez",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "MyGene.info API",
                            "type": "bts:api"
                        },
                        {
                            "name": "evidence",
                            "value": "IBA",
                            "type": "bts:evidence"
                        },
                        {
                            "name": "term",
                            "value": "signal transduction",
                            "type": "bts:term"
                        },
                        {
                            "name": "publications",
                            "value": [
                                "PMID:21873635"
                            ],
                            "type": "biolink:publications"
                        }
                    ]
                },
                "NCBIGene:1017-GO:0007265-MyGene.info API-entrez": {
                    "predicate": "biolink:enables",
                    "subject": "NCBIGene:1017",
                    "object": "GO:0007265",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "entrez",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "MyGene.info API",
                            "type": "bts:api"
                        },
                        {
                            "name": "evidence",
                            "value": "IEP",
                            "type": "bts:evidence"
                        },
                        {
                            "name": "term",
                            "value": "Ras protein signal transduction",
                            "type": "bts:term"
                        },
                        {
                            "name": "publications",
                            "value": [
                                "PMID:9054499"
                            ],
                            "type": "biolink:publications"
                        }
                    ]
                },
                "NCBIGene:1017-GO:0008284-MyGene.info API-entrez": {
                    "predicate": "biolink:enables",
                    "subject": "NCBIGene:1017",
                    "object": "GO:0008284",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "entrez",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "MyGene.info API",
                            "type": "bts:api"
                        },
                        {
                            "name": "evidence",
                            "value": "IBA",
                            "type": "bts:evidence"
                        },
                        {
                            "name": "term",
                            "value": "positive regulation of cell population proliferation",
                            "type": "bts:term"
                        },
                        {
                            "name": "publications",
                            "value": [
                                "PMID:21873635"
                            ],
                            "type": "biolink:publications"
                        }
                    ]
                },
                "NCBIGene:1017-GO:0010389-MyGene.info API-entrez": {
                    "predicate": "biolink:enables",
                    "subject": "NCBIGene:1017",
                    "object": "GO:0010389",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "entrez",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "MyGene.info API",
                            "type": "bts:api"
                        },
                        {
                            "name": "evidence",
                            "value": "IBA",
                            "type": "bts:evidence"
                        },
                        {
                            "name": "term",
                            "value": "regulation of G2/M transition of mitotic cell cycle",
                            "type": "bts:term"
                        },
                        {
                            "name": "publications",
                            "value": [
                                "PMID:21873635"
                            ],
                            "type": "biolink:publications"
                        }
                    ]
                },
                "NCBIGene:1017-GO:0010468-MyGene.info API-entrez": {
                    "predicate": "biolink:enables",
                    "subject": "NCBIGene:1017",
                    "object": "GO:0010468",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "entrez",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "MyGene.info API",
                            "type": "bts:api"
                        },
                        {
                            "name": "evidence",
                            "value": "IBA",
                            "type": "bts:evidence"
                        },
                        {
                            "name": "term",
                            "value": "regulation of gene expression",
                            "type": "bts:term"
                        },
                        {
                            "name": "publications",
                            "value": [
                                "PMID:21873635"
                            ],
                            "type": "biolink:publications"
                        }
                    ]
                },
                "NCBIGene:1017-GO:0016572-MyGene.info API-entrez": {
                    "predicate": "biolink:enables",
                    "subject": "NCBIGene:1017",
                    "object": "GO:0016572",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "entrez",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "MyGene.info API",
                            "type": "bts:api"
                        },
                        {
                            "name": "evidence",
                            "value": "IDA",
                            "type": "bts:evidence"
                        },
                        {
                            "name": "term",
                            "value": "histone phosphorylation",
                            "type": "bts:term"
                        },
                        {
                            "name": "publications",
                            "value": [
                                "PMID:11746698"
                            ],
                            "type": "biolink:publications"
                        }
                    ]
                },
                "NCBIGene:1017-GO:0018105-MyGene.info API-entrez": {
                    "predicate": "biolink:enables",
                    "subject": "NCBIGene:1017",
                    "object": "GO:0018105",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "entrez",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "MyGene.info API",
                            "type": "bts:api"
                        },
                        {
                            "name": "evidence",
                            "value": "IDA",
                            "type": "bts:evidence"
                        },
                        {
                            "name": "term",
                            "value": "peptidyl-serine phosphorylation",
                            "type": "bts:term"
                        },
                        {
                            "name": "publications",
                            "value": [
                                "PMID:23184662"
                            ],
                            "type": "biolink:publications"
                        }
                    ]
                },
                "NCBIGene:1017-GO:0031145-MyGene.info API-entrez": {
                    "predicate": "biolink:enables",
                    "subject": "NCBIGene:1017",
                    "object": "GO:0031145",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "entrez",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "MyGene.info API",
                            "type": "bts:api"
                        },
                        {
                            "name": "evidence",
                            "value": "TAS",
                            "type": "bts:evidence"
                        },
                        {
                            "name": "term",
                            "value": "anaphase-promoting complex-dependent catabolic process",
                            "type": "bts:term"
                        }
                    ]
                },
                "NCBIGene:1017-GO:0031571-MyGene.info API-entrez": {
                    "predicate": "biolink:enables",
                    "subject": "NCBIGene:1017",
                    "object": "GO:0031571",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "entrez",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "MyGene.info API",
                            "type": "bts:api"
                        },
                        {
                            "name": "evidence",
                            "value": "TAS",
                            "type": "bts:evidence"
                        },
                        {
                            "name": "term",
                            "value": "mitotic G1 DNA damage checkpoint",
                            "type": "bts:term"
                        },
                        {
                            "name": "publications",
                            "value": [
                                "PMID:21319273"
                            ],
                            "type": "biolink:publications"
                        }
                    ]
                },
                "NCBIGene:1017-GO:0051298-MyGene.info API-entrez": {
                    "predicate": "biolink:enables",
                    "subject": "NCBIGene:1017",
                    "object": "GO:0051298",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "entrez",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "MyGene.info API",
                            "type": "bts:api"
                        },
                        {
                            "name": "evidence",
                            "value": "TAS",
                            "type": "bts:evidence"
                        },
                        {
                            "name": "term",
                            "value": "centrosome duplication",
                            "type": "bts:term"
                        },
                        {
                            "name": "publications",
                            "value": [
                                "PMID:19238148"
                            ],
                            "type": "biolink:publications"
                        }
                    ]
                },
                "NCBIGene:1017-GO:0051301-MyGene.info API-entrez": {
                    "predicate": "biolink:enables",
                    "subject": "NCBIGene:1017",
                    "object": "GO:0051301",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "entrez",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "MyGene.info API",
                            "type": "bts:api"
                        },
                        {
                            "name": "evidence",
                            "value": "IEA",
                            "type": "bts:evidence"
                        },
                        {
                            "name": "term",
                            "value": "cell division",
                            "type": "bts:term"
                        }
                    ]
                },
                "NCBIGene:1017-GO:0051321-MyGene.info API-entrez": {
                    "predicate": "biolink:enables",
                    "subject": "NCBIGene:1017",
                    "object": "GO:0051321",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "entrez",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "MyGene.info API",
                            "type": "bts:api"
                        },
                        {
                            "name": "evidence",
                            "value": "TAS",
                            "type": "bts:evidence"
                        },
                        {
                            "name": "term",
                            "value": "meiotic cell cycle",
                            "type": "bts:term"
                        },
                        {
                            "name": "publications",
                            "value": [
                                "PMID:19238148"
                            ],
                            "type": "biolink:publications"
                        }
                    ]
                },
                "NCBIGene:1017-GO:0060968-MyGene.info API-entrez": {
                    "predicate": "biolink:enables",
                    "subject": "NCBIGene:1017",
                    "object": "GO:0060968",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "entrez",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "MyGene.info API",
                            "type": "bts:api"
                        },
                        {
                            "name": "evidence",
                            "value": "IDA",
                            "type": "bts:evidence"
                        },
                        {
                            "name": "term",
                            "value": "regulation of gene silencing",
                            "type": "bts:term"
                        },
                        {
                            "name": "publications",
                            "value": [
                                "PMID:20935635"
                            ],
                            "type": "biolink:publications"
                        }
                    ]
                },
                "NCBIGene:1017-GO:0071732-MyGene.info API-entrez": {
                    "predicate": "biolink:enables",
                    "subject": "NCBIGene:1017",
                    "object": "GO:0071732",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "entrez",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "MyGene.info API",
                            "type": "bts:api"
                        },
                        {
                            "name": "evidence",
                            "value": "TAS",
                            "type": "bts:evidence"
                        },
                        {
                            "name": "term",
                            "value": "cellular response to nitric oxide",
                            "type": "bts:term"
                        },
                        {
                            "name": "publications",
                            "value": [
                                "PMID:20079829"
                            ],
                            "type": "biolink:publications"
                        }
                    ]
                },
                "NCBIGene:1017-GO:1901796-MyGene.info API-entrez": {
                    "predicate": "biolink:enables",
                    "subject": "NCBIGene:1017",
                    "object": "GO:1901796",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "entrez",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "MyGene.info API",
                            "type": "bts:api"
                        },
                        {
                            "name": "evidence",
                            "value": "TAS",
                            "type": "bts:evidence"
                        },
                        {
                            "name": "term",
                            "value": "regulation of signal transduction by p53 class mediator",
                            "type": "bts:term"
                        }
                    ]
                }
            }
        },
        "results": [
            {
                "node_bindings": {
                    "n00": [
                        {
                            "id": "NCBIGene:1017"
                        }
                    ],
                    "n01": [
                        {
                            "id": "GO:0000082"
                        }
                    ]
                },
                "edge_bindings": {
                    "e00": [
                        {
                            "id": "NCBIGene:1017-GO:0000082-MyGene.info API-entrez"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n00": [
                        {
                            "id": "NCBIGene:1017"
                        }
                    ],
                    "n01": [
                        {
                            "id": "GO:0000082"
                        }
                    ]
                },
                "edge_bindings": {
                    "e00": [
                        {
                            "id": "NCBIGene:1017-GO:0000082-MyGene.info API-entrez"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n00": [
                        {
                            "id": "NCBIGene:1017"
                        }
                    ],
                    "n01": [
                        {
                            "id": "GO:0000086"
                        }
                    ]
                },
                "edge_bindings": {
                    "e00": [
                        {
                            "id": "NCBIGene:1017-GO:0000086-MyGene.info API-entrez"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n00": [
                        {
                            "id": "NCBIGene:1017"
                        }
                    ],
                    "n01": [
                        {
                            "id": "GO:0000086"
                        }
                    ]
                },
                "edge_bindings": {
                    "e00": [
                        {
                            "id": "NCBIGene:1017-GO:0000086-MyGene.info API-entrez"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n00": [
                        {
                            "id": "NCBIGene:1017"
                        }
                    ],
                    "n01": [
                        {
                            "id": "GO:0006260"
                        }
                    ]
                },
                "edge_bindings": {
                    "e00": [
                        {
                            "id": "NCBIGene:1017-GO:0006260-MyGene.info API-entrez"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n00": [
                        {
                            "id": "NCBIGene:1017"
                        }
                    ],
                    "n01": [
                        {
                            "id": "GO:0006281"
                        }
                    ]
                },
                "edge_bindings": {
                    "e00": [
                        {
                            "id": "NCBIGene:1017-GO:0006281-MyGene.info API-entrez"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n00": [
                        {
                            "id": "NCBIGene:1017"
                        }
                    ],
                    "n01": [
                        {
                            "id": "GO:0006468"
                        }
                    ]
                },
                "edge_bindings": {
                    "e00": [
                        {
                            "id": "NCBIGene:1017-GO:0006468-MyGene.info API-entrez"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n00": [
                        {
                            "id": "NCBIGene:1017"
                        }
                    ],
                    "n01": [
                        {
                            "id": "GO:0006468"
                        }
                    ]
                },
                "edge_bindings": {
                    "e00": [
                        {
                            "id": "NCBIGene:1017-GO:0006468-MyGene.info API-entrez"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n00": [
                        {
                            "id": "NCBIGene:1017"
                        }
                    ],
                    "n01": [
                        {
                            "id": "GO:0006468"
                        }
                    ]
                },
                "edge_bindings": {
                    "e00": [
                        {
                            "id": "NCBIGene:1017-GO:0006468-MyGene.info API-entrez"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n00": [
                        {
                            "id": "NCBIGene:1017"
                        }
                    ],
                    "n01": [
                        {
                            "id": "GO:0006977"
                        }
                    ]
                },
                "edge_bindings": {
                    "e00": [
                        {
                            "id": "NCBIGene:1017-GO:0006977-MyGene.info API-entrez"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n00": [
                        {
                            "id": "NCBIGene:1017"
                        }
                    ],
                    "n01": [
                        {
                            "id": "GO:0007099"
                        }
                    ]
                },
                "edge_bindings": {
                    "e00": [
                        {
                            "id": "NCBIGene:1017-GO:0007099-MyGene.info API-entrez"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n00": [
                        {
                            "id": "NCBIGene:1017"
                        }
                    ],
                    "n01": [
                        {
                            "id": "GO:0007165"
                        }
                    ]
                },
                "edge_bindings": {
                    "e00": [
                        {
                            "id": "NCBIGene:1017-GO:0007165-MyGene.info API-entrez"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n00": [
                        {
                            "id": "NCBIGene:1017"
                        }
                    ],
                    "n01": [
                        {
                            "id": "GO:0007265"
                        }
                    ]
                },
                "edge_bindings": {
                    "e00": [
                        {
                            "id": "NCBIGene:1017-GO:0007265-MyGene.info API-entrez"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n00": [
                        {
                            "id": "NCBIGene:1017"
                        }
                    ],
                    "n01": [
                        {
                            "id": "GO:0008284"
                        }
                    ]
                },
                "edge_bindings": {
                    "e00": [
                        {
                            "id": "NCBIGene:1017-GO:0008284-MyGene.info API-entrez"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n00": [
                        {
                            "id": "NCBIGene:1017"
                        }
                    ],
                    "n01": [
                        {
                            "id": "GO:0008284"
                        }
                    ]
                },
                "edge_bindings": {
                    "e00": [
                        {
                            "id": "NCBIGene:1017-GO:0008284-MyGene.info API-entrez"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n00": [
                        {
                            "id": "NCBIGene:1017"
                        }
                    ],
                    "n01": [
                        {
                            "id": "GO:0010389"
                        }
                    ]
                },
                "edge_bindings": {
                    "e00": [
                        {
                            "id": "NCBIGene:1017-GO:0010389-MyGene.info API-entrez"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n00": [
                        {
                            "id": "NCBIGene:1017"
                        }
                    ],
                    "n01": [
                        {
                            "id": "GO:0010468"
                        }
                    ]
                },
                "edge_bindings": {
                    "e00": [
                        {
                            "id": "NCBIGene:1017-GO:0010468-MyGene.info API-entrez"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n00": [
                        {
                            "id": "NCBIGene:1017"
                        }
                    ],
                    "n01": [
                        {
                            "id": "GO:0016572"
                        }
                    ]
                },
                "edge_bindings": {
                    "e00": [
                        {
                            "id": "NCBIGene:1017-GO:0016572-MyGene.info API-entrez"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n00": [
                        {
                            "id": "NCBIGene:1017"
                        }
                    ],
                    "n01": [
                        {
                            "id": "GO:0018105"
                        }
                    ]
                },
                "edge_bindings": {
                    "e00": [
                        {
                            "id": "NCBIGene:1017-GO:0018105-MyGene.info API-entrez"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n00": [
                        {
                            "id": "NCBIGene:1017"
                        }
                    ],
                    "n01": [
                        {
                            "id": "GO:0031145"
                        }
                    ]
                },
                "edge_bindings": {
                    "e00": [
                        {
                            "id": "NCBIGene:1017-GO:0031145-MyGene.info API-entrez"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n00": [
                        {
                            "id": "NCBIGene:1017"
                        }
                    ],
                    "n01": [
                        {
                            "id": "GO:0031571"
                        }
                    ]
                },
                "edge_bindings": {
                    "e00": [
                        {
                            "id": "NCBIGene:1017-GO:0031571-MyGene.info API-entrez"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n00": [
                        {
                            "id": "NCBIGene:1017"
                        }
                    ],
                    "n01": [
                        {
                            "id": "GO:0051298"
                        }
                    ]
                },
                "edge_bindings": {
                    "e00": [
                        {
                            "id": "NCBIGene:1017-GO:0051298-MyGene.info API-entrez"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n00": [
                        {
                            "id": "NCBIGene:1017"
                        }
                    ],
                    "n01": [
                        {
                            "id": "GO:0051301"
                        }
                    ]
                },
                "edge_bindings": {
                    "e00": [
                        {
                            "id": "NCBIGene:1017-GO:0051301-MyGene.info API-entrez"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n00": [
                        {
                            "id": "NCBIGene:1017"
                        }
                    ],
                    "n01": [
                        {
                            "id": "GO:0051321"
                        }
                    ]
                },
                "edge_bindings": {
                    "e00": [
                        {
                            "id": "NCBIGene:1017-GO:0051321-MyGene.info API-entrez"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n00": [
                        {
                            "id": "NCBIGene:1017"
                        }
                    ],
                    "n01": [
                        {
                            "id": "GO:0060968"
                        }
                    ]
                },
                "edge_bindings": {
                    "e00": [
                        {
                            "id": "NCBIGene:1017-GO:0060968-MyGene.info API-entrez"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n00": [
                        {
                            "id": "NCBIGene:1017"
                        }
                    ],
                    "n01": [
                        {
                            "id": "GO:0071732"
                        }
                    ]
                },
                "edge_bindings": {
                    "e00": [
                        {
                            "id": "NCBIGene:1017-GO:0071732-MyGene.info API-entrez"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n00": [
                        {
                            "id": "NCBIGene:1017"
                        }
                    ],
                    "n01": [
                        {
                            "id": "GO:1901796"
                        }
                    ]
                },
                "edge_bindings": {
                    "e00": [
                        {
                            "id": "NCBIGene:1017-GO:1901796-MyGene.info API-entrez"
                        }
                    ]
                }
            }
        ]
    },
    "logs": [
        {
            "timestamp": "2021-03-15T22:48:10.757Z",
            "level": "DEBUG",
            "message": "BTE identified 2 QNodes from your query graph",
            "code": null
        },
        {
            "timestamp": "2021-03-15T22:48:10.757Z",
            "level": "DEBUG",
            "message": "BTE identified 1 QEdges from your query graph",
            "code": null
        },
        {
            "timestamp": "2021-03-15T22:48:10.757Z",
            "level": "DEBUG",
            "message": "BTE identified your query graph as a 1-depth query graph",
            "code": null
        },
        {
            "timestamp": "2021-03-15T22:48:10.757Z",
            "level": "DEBUG",
            "message": "REDIS cache is not enabled.",
            "code": null
        },
        {
            "timestamp": "2021-03-15T22:48:10.797Z",
            "level": "DEBUG",
            "message": "BTE found 1 smartapi edges corresponding to e00. These smartaip edges comes from 1 unique APIs. They are MyGene.info API",
            "code": null
        },
        {
            "timestamp": "2021-03-15T22:48:10.808Z",
            "level": "DEBUG",
            "message": "BTE found 1 bte edges for this batch.",
            "code": null
        },
        {
            "timestamp": "2021-03-15T22:48:10.808Z",
            "level": "DEBUG",
            "message": "call-apis: Resolving ID feature is turned on",
            "code": null
        },
        {
            "timestamp": "2021-03-15T22:48:10.808Z",
            "level": "DEBUG",
            "message": "call-apis: Number of BTE Edges received is 1",
            "code": null
        },
        {
            "timestamp": "2021-03-15T22:48:10.828Z",
            "level": "DEBUG",
            "message": "call-apis: Succesfully made the following query: {\"url\":\"https://mygene.info/v3/query\",\"params\":{\"fields\":\"go.BP\"},\"data\":\"q=1017&scopes=entrezgene\",\"method\":\"post\",\"timeout\":50000}",
            "code": null
        },
        {
            "timestamp": "2021-03-15T22:48:10.839Z",
            "level": "DEBUG",
            "message": "call-apis: After transformation, BTE is able to retrieve 27 hits!",
            "code": null
        },
        {
            "timestamp": "2021-03-15T22:48:10.839Z",
            "level": "DEBUG",
            "message": "call-apis: Total number of results returned for this query is 27",
            "code": null
        },
        {
            "timestamp": "2021-03-15T22:48:10.857Z",
            "level": "DEBUG",
            "message": "call-apis: Query completes",
            "code": null
        }
    ]
}

Making a multi hop query

const handler = require("@biothings-explorer/query_graph_handler");
const queryHandler = new handler.TRAPIQueryHandler();
const multiHopQuery = {
    "workflow": [
        {"id": "lookup"}
    ],
    "message": {
        "query_graph": {
            "nodes": {
                "n0": {
                    "categories": ["biolink:Disease"],
                    "ids": ["MONDO:0005737"]
                },
                "n1": {
                    "categories": ["biolink:Gene"]
                },
                "n2": {
                    "categories": ["biolink:SmallMolecule"]
                }
            },
            "edges": {
                "e01": {
                    "subject": "n0",
                    "object": "n1"
                },
                "e02": {
                    "subject": "n1",
                    "object": "n2"
                }
            }
        }
    }
}
queryHandler.setQueryGraph(multiHopQuery);
await queryHandler.query();
console.log(queryHandler.getResponse())
Example Result
{
    "workflow": [
        {"id": "lookup"}
    ],
    "message": {
        "query_graph": {
            "nodes": {
                "n0": {
                    "category": "biolink:Disease",
                    "id": "MONDO:0005737"
                },
                "n1": {
                    "category": "biolink:Gene"
                },
                "n2": {
                    "category": "biolink:ChemicalSubstance"
                }
            },
            "edges": {
                "e01": {
                    "subject": "n0",
                    "object": "n1"
                },
                "e02": {
                    "subject": "n1",
                    "object": "n2"
                }
            }
        },
        "knowledge_graph": {
            "nodes": {
                "MONDO:0005737": {
                    "category": "biolink:Disease",
                    "name": "Ebola hemorrhagic fever",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "MONDO:0005737",
                                "DOID:4325",
                                "UMLS:C0282687",
                                "name:Ebola hemorrhagic fever",
                                "MESH:D019142",
                                "EFO:0007243",
                                "ORPHANET:319218",
                                "GARD:2035"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:116534309": {
                    "category": "biolink:Gene",
                    "name": "CD4",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:116534309",
                                "name:CD4 molecule",
                                "SYMBOL:CD4"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:539109": {
                    "category": "biolink:Gene",
                    "name": "MMP11",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:539109",
                                "name:matrix metallopeptidase 11",
                                "SYMBOL:MMP11",
                                "ENSEMBL:ENSBTAG00000006108"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:102448557": {
                    "category": "biolink:Gene",
                    "name": "GTPBP1",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:102448557",
                                "name:GTP binding protein 1",
                                "SYMBOL:GTPBP1",
                                "ENSEMBL:ENSPSIG00000004300"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:103074707": {
                    "category": "biolink:Gene",
                    "name": "CCL2",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:103074707",
                                "name:C-C motif chemokine ligand 2",
                                "SYMBOL:CCL2"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "ENSEMBL:ENSSPUG00000015633": {
                    "category": "biolink:Gene",
                    "name": "MAPRE3",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "name:microtubule associated protein RP/EB family member 3",
                                "SYMBOL:MAPRE3",
                                "ENSEMBL:ENSSPUG00000015633"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:115865406": {
                    "category": "biolink:Gene",
                    "name": "BST2",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:115865406",
                                "name:bone marrow stromal cell antigen 2",
                                "SYMBOL:BST2"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:110132571": {
                    "category": "biolink:Gene",
                    "name": "IL1B",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:110132571",
                                "name:interleukin 1 beta",
                                "SYMBOL:IL1B"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:101571570": {
                    "category": "biolink:Gene",
                    "name": "Ifih1",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:101571570",
                                "name:interferon induced with helicase C domain 1",
                                "SYMBOL:Ifih1",
                                "ENSEMBL:ENSODEG00000013586"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "ENSEMBL:ENSSMAG00000017984": {
                    "category": "biolink:Gene",
                    "name": "npc1",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "name:Niemann-Pick disease, type C1",
                                "SYMBOL:npc1",
                                "ENSEMBL:ENSSMAG00000017984"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:397686": {
                    "category": "biolink:Gene",
                    "name": "IFNA1",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:397686",
                                "name:interferon, alpha 1",
                                "SYMBOL:IFNA1",
                                "ENSEMBL:ENSSSCG00000050619"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:102892030": {
                    "category": "biolink:Gene",
                    "name": "ALB",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:102892030",
                                "name:albumin",
                                "SYMBOL:ALB"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:104045425": {
                    "category": "biolink:Gene",
                    "name": "HDX",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:104045425",
                                "name:highly divergent homeobox",
                                "SYMBOL:HDX"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:110137949": {
                    "category": "biolink:Gene",
                    "name": "CXCL10",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:110137949",
                                "name:C-X-C motif chemokine ligand 10",
                                "SYMBOL:CXCL10"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:105822820": {
                    "category": "biolink:Gene",
                    "name": "CXCL8",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:105822820",
                                "name:C-X-C motif chemokine ligand 8",
                                "SYMBOL:CXCL8",
                                "ENSEMBL:ENSPCOG00000024593"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:116479423": {
                    "category": "biolink:Gene",
                    "name": "CLEC4M",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:116479423",
                                "name:C-type lectin domain family 4 member M",
                                "SYMBOL:CLEC4M"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:103814882": {
                    "category": "biolink:Gene",
                    "name": "F3",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:103814882",
                                "name:coagulation factor III, tissue factor",
                                "SYMBOL:F3",
                                "ENSEMBL:ENSSCAG00000012591"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:101142722": {
                    "category": "biolink:Gene",
                    "name": "KPNA1",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:101142722",
                                "name:karyopherin subunit alpha 1",
                                "SYMBOL:KPNA1"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:104673720": {
                    "category": "biolink:Gene",
                    "name": "CTSL",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:104673720",
                                "name:cathepsin L",
                                "SYMBOL:CTSL",
                                "ENSEMBL:ENSRROG00000038398"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:116543050": {
                    "category": "biolink:Gene",
                    "name": "CTSB",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:116543050",
                                "name:cathepsin B",
                                "SYMBOL:CTSB"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:29798": {
                    "category": "biolink:Gene",
                    "name": "C2orf27A",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:29798",
                                "name:chromosome 2 open reading frame 27A",
                                "SYMBOL:C2orf27A",
                                "UMLS:C2681192",
                                "HGNC:25077",
                                "UniProtKB:P0DPF5"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:118012204": {
                    "category": "biolink:Gene",
                    "name": "STAT1",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:118012204",
                                "name:signal transducer and activator of transcription 1",
                                "SYMBOL:STAT1"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:103531663": {
                    "category": "biolink:Gene",
                    "name": "KPNA5",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:103531663",
                                "name:karyopherin subunit alpha 5",
                                "SYMBOL:KPNA5"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "ENSEMBL:ENSNVIG00000024389": {
                    "category": "biolink:Gene",
                    "name": "IFIT2",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "name:interferon induced protein with tetratricopeptide repeats 2",
                                "SYMBOL:IFIT2",
                                "ENSEMBL:ENSNVIG00000024389"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:104395366": {
                    "category": "biolink:Gene",
                    "name": "THBD",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:104395366",
                                "name:thrombomodulin",
                                "SYMBOL:THBD"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:100731608": {
                    "category": "biolink:Gene",
                    "name": "Isg15",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:100731608",
                                "name:ISG15 ubiquitin like modifier",
                                "SYMBOL:Isg15"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:108529797": {
                    "category": "biolink:Gene",
                    "name": "DDX58",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:108529797",
                                "name:DExD/H-box helicase 58",
                                "SYMBOL:DDX58",
                                "ENSEMBL:ENSRBIG00000040257"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:106971145": {
                    "category": "biolink:Gene",
                    "name": "IFNB1",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:106971145",
                                "name:interferon beta 1",
                                "SYMBOL:IFNB1"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "SYMBOL:GP2": {
                    "category": "biolink:Gene",
                    "name": "GP2",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "name:Polygalacturonase non-catalytic subunit AroGP2",
                                "SYMBOL:GP2"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:101443464": {
                    "category": "biolink:Gene",
                    "name": "GPT",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:101443464",
                                "name:glutamic--pyruvic transaminase",
                                "SYMBOL:GPT"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:102387082": {
                    "category": "biolink:Gene",
                    "name": "IRF7",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:102387082",
                                "name:interferon regulatory factor 7",
                                "SYMBOL:IRF7"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:109055884": {
                    "category": "biolink:Gene",
                    "name": "il6",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:109055884",
                                "name:interleukin 6 (interferon, beta 2)",
                                "SYMBOL:il6",
                                "ENSEMBL:ENSCCRG00000034667"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "ENSEMBL:ENSSBOG00000011322": {
                    "category": "biolink:Gene",
                    "name": "CD8A",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "name:CD8a molecule",
                                "SYMBOL:CD8A",
                                "ENSEMBL:ENSSBOG00000011322"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:117759282": {
                    "category": "biolink:Gene",
                    "name": "ace2",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:117759282",
                                "name:angiotensin I converting enzyme 2",
                                "SYMBOL:ace2"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:103562469": {
                    "category": "biolink:Gene",
                    "name": "TNF",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:103562469",
                                "name:tumor necrosis factor",
                                "SYMBOL:TNF"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:112648300": {
                    "category": "biolink:Gene",
                    "name": "IL10",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:112648300",
                                "name:interleukin 10",
                                "SYMBOL:IL10",
                                "ENSEMBL:ENSCAFG00020012434"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:105221759": {
                    "category": "biolink:Gene",
                    "name": "ERVW-1",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:105221759",
                                "name:endogenous retrovirus group W member 1, envelope",
                                "SYMBOL:ERVW-1"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:118335909": {
                    "category": "biolink:Gene",
                    "name": "irf3",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:118335909",
                                "name:interferon regulatory factor 3",
                                "SYMBOL:irf3"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:101674197": {
                    "category": "biolink:Gene",
                    "name": "CCL5",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:101674197",
                                "name:C-C motif chemokine ligand 5",
                                "SYMBOL:CCL5"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:103089296": {
                    "category": "biolink:Gene",
                    "name": "CCL3",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:103089296",
                                "name:C-C motif chemokine ligand 3",
                                "SYMBOL:CCL3"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:100136221": {
                    "category": "biolink:Gene",
                    "name": "ccl4",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:100136221",
                                "name:CCL4 protein",
                                "SYMBOL:ccl4",
                                "ENSEMBL:ENSOMYG00000026069"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:118023076": {
                    "category": "biolink:Gene",
                    "name": "FURIN",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:118023076",
                                "name:furin, paired basic amino acid cleaving enzyme",
                                "SYMBOL:FURIN"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:574217": {
                    "category": "biolink:Gene",
                    "name": "CCL4L1",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:574217",
                                "name:chemokine (C-C motif) ligand 4-like 1",
                                "SYMBOL:CCL4L1",
                                "UniProtKB:Q8HYQ2",
                                "ENSEMBL:ENSMMUG00000020102"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "UMLS:C1707151": {
                    "category": "biolink:Gene",
                    "name": "UMLS:C1707151",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "UMLS:C1707151"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "UMLS:C1707163": {
                    "category": "biolink:Gene",
                    "name": "UMLS:C1707163",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "UMLS:C1707163"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:3601": {
                    "category": "biolink:Gene",
                    "name": "IL15RA",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:3601",
                                "name:interleukin 15 receptor subunit alpha",
                                "SYMBOL:IL15RA",
                                "UMLS:C1416387",
                                "HGNC:5978",
                                "UniProtKB:Q13261",
                                "ENSEMBL:ENSG00000134470",
                                "OMIM:601070"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:5788": {
                    "category": "biolink:Gene",
                    "name": "PTPRC",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:5788",
                                "name:protein tyrosine phosphatase receptor type C",
                                "SYMBOL:PTPRC",
                                "UMLS:C1335285",
                                "HGNC:9666",
                                "UniProtKB:P08575",
                                "ENSEMBL:ENSG00000081237",
                                "ENSEMBL:ENSG00000262418",
                                "OMIM:151460"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:8030": {
                    "category": "biolink:Gene",
                    "name": "CCDC6",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:8030",
                                "name:coiled-coil domain containing 6",
                                "SYMBOL:CCDC6",
                                "UMLS:C1425774",
                                "HGNC:18782",
                                "UniProtKB:Q16204",
                                "ENSEMBL:ENSG00000108091",
                                "OMIM:601985"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:920": {
                    "category": "biolink:Gene",
                    "name": "CD4",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:920",
                                "name:CD4 molecule",
                                "SYMBOL:CD4",
                                "UMLS:C1332714",
                                "HGNC:1678",
                                "UniProtKB:P01730",
                                "ENSEMBL:ENSG00000010610",
                                "OMIM:186940"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:1514": {
                    "category": "biolink:Gene",
                    "name": "CTSL",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:1514",
                                "name:cathepsin L",
                                "SYMBOL:CTSL",
                                "UMLS:C1332807",
                                "UMLS:C0054871",
                                "HGNC:2537",
                                "UniProtKB:P07711",
                                "ENSEMBL:ENSG00000135047",
                                "OMIM:116880"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "UMLS:C1706438": {
                    "category": "biolink:Gene",
                    "name": "UMLS:C1706438",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "UMLS:C1706438"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "UMLS:C1367471": {
                    "category": "biolink:Gene",
                    "name": "UMLS:C1367471",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "UMLS:C1367471"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:3439": {
                    "category": "biolink:Gene",
                    "name": "IFNA1",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:3439",
                                "name:interferon alpha 1",
                                "SYMBOL:IFNA1",
                                "UMLS:C1415900",
                                "HGNC:5417",
                                "UniProtKB:P01562",
                                "ENSEMBL:ENSG00000197919",
                                "OMIM:147660"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "UMLS:C1708411": {
                    "category": "biolink:Gene",
                    "name": "UMLS:C1708411",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "UMLS:C1708411"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "UMLS:C0017337": {
                    "category": "biolink:Gene",
                    "name": "UMLS:C0017337",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "UMLS:C0017337"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "UMLS:C1335439": {
                    "category": "biolink:Gene",
                    "name": "UMLS:C1335439",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "UMLS:C1335439"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:3557": {
                    "category": "biolink:Gene",
                    "name": "IL1RN",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:3557",
                                "name:interleukin 1 receptor antagonist",
                                "SYMBOL:IL1RN",
                                "UMLS:C1416402",
                                "HGNC:6000",
                                "UniProtKB:P18510",
                                "ENSEMBL:ENSG00000136689",
                                "OMIM:147679"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "UMLS:C1705770": {
                    "category": "biolink:Gene",
                    "name": "UMLS:C1705770",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "UMLS:C1705770"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:1520": {
                    "category": "biolink:Gene",
                    "name": "CTSS",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:1520",
                                "name:cathepsin S",
                                "SYMBOL:CTSS",
                                "UMLS:C1413821",
                                "HGNC:2545",
                                "UniProtKB:P25774",
                                "ENSEMBL:ENSG00000163131",
                                "OMIM:116845"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:3806": {
                    "category": "biolink:Gene",
                    "name": "KIR2DS1",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:3806",
                                "name:killer cell immunoglobulin like receptor, two Ig domains and short cytoplasmic tail 1",
                                "SYMBOL:KIR2DS1",
                                "UMLS:C1416647",
                                "HGNC:6333",
                                "UniProtKB:Q14954",
                                "ENSEMBL:ENSG00000278120",
                                "ENSEMBL:ENSG00000283937",
                                "ENSEMBL:ENSG00000284120",
                                "ENSEMBL:ENSG00000284150",
                                "ENSEMBL:ENSG00000275921",
                                "ENSEMBL:ENSG00000276327",
                                "OMIM:604952"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:3808": {
                    "category": "biolink:Gene",
                    "name": "KIR2DS3",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:3808",
                                "name:killer cell immunoglobulin like receptor, two Ig domains and short cytoplasmic tail 3",
                                "SYMBOL:KIR2DS3",
                                "UMLS:C1416649",
                                "HGNC:6335",
                                "UniProtKB:Q14952",
                                "ENSEMBL:ENSG00000278306",
                                "ENSEMBL:ENSG00000274739",
                                "ENSEMBL:ENSG00000284039",
                                "OMIM:604954"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "UMLS:C1705846": {
                    "category": "biolink:Gene",
                    "name": "UMLS:C1705846",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "UMLS:C1705846"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:558": {
                    "category": "biolink:Gene",
                    "name": "AXL",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:558",
                                "name:AXL receptor tyrosine kinase",
                                "SYMBOL:AXL",
                                "UMLS:C0812237",
                                "HGNC:905",
                                "UniProtKB:P30530",
                                "ENSEMBL:ENSG00000167601",
                                "OMIM:109135"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "UMLS:C1705742": {
                    "category": "biolink:Gene",
                    "name": "UMLS:C1705742",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "UMLS:C1705742"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "UMLS:C0007428": {
                    "category": "biolink:Gene",
                    "name": "UMLS:C0007428",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "UMLS:C0007428"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "UMLS:C0017428": {
                    "category": "biolink:Gene",
                    "name": "UMLS:C0017428",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "UMLS:C0017428"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "UMLS:C0031727": {
                    "category": "biolink:Gene",
                    "name": "UMLS:C0031727",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "UMLS:C0031727"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "UMLS:C0298973": {
                    "category": "biolink:Gene",
                    "name": "UMLS:C0298973",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "UMLS:C0298973"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "UMLS:C0389995": {
                    "category": "biolink:Gene",
                    "name": "UMLS:C0389995",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "UMLS:C0389995"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "UMLS:C0699919": {
                    "category": "biolink:Gene",
                    "name": "UMLS:C0699919",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "UMLS:C0699919"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "UMLS:C1136352": {
                    "category": "biolink:Gene",
                    "name": "UMLS:C1136352",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "UMLS:C1136352"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "UMLS:C1704867": {
                    "category": "biolink:Gene",
                    "name": "UMLS:C1704867",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "UMLS:C1704867"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "UMLS:C1705766": {
                    "category": "biolink:Gene",
                    "name": "UMLS:C1705766",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "UMLS:C1705766"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:4864": {
                    "category": "biolink:Gene",
                    "name": "NPC1",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:4864",
                                "name:NPC intracellular cholesterol transporter 1",
                                "SYMBOL:NPC1",
                                "UMLS:C1417776",
                                "HGNC:7897",
                                "UniProtKB:O15118",
                                "ENSEMBL:ENSG00000141458",
                                "OMIM:607623"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "UMLS:C1704661": {
                    "category": "biolink:Gene",
                    "name": "UMLS:C1704661",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "UMLS:C1704661"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "UMLS:C1704799": {
                    "category": "biolink:Gene",
                    "name": "UMLS:C1704799",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "UMLS:C1704799"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "UMLS:C2985367": {
                    "category": "biolink:Gene",
                    "name": "UMLS:C2985367",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "UMLS:C2985367"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "UMLS:C1705581": {
                    "category": "biolink:Gene",
                    "name": "UMLS:C1705581",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "UMLS:C1705581"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "UMLS:C0044602": {
                    "category": "biolink:Gene",
                    "name": "UMLS:C0044602",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "UMLS:C0044602"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:324": {
                    "category": "biolink:Gene",
                    "name": "APC",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:324",
                                "name:APC regulator of WNT signaling pathway",
                                "SYMBOL:APC",
                                "UMLS:C0162832",
                                "HGNC:583",
                                "UniProtKB:P25054",
                                "ENSEMBL:ENSG00000134982",
                                "OMIM:611731"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "UMLS:C0287990": {
                    "category": "biolink:Gene",
                    "name": "UMLS:C0287990",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "UMLS:C0287990"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "UMLS:C0752243": {
                    "category": "biolink:Gene",
                    "name": "UMLS:C0752243",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "UMLS:C0752243"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "DRUGBANK:DB06241": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "Clenoliximab",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "DRUGBANK:DB06241",
                                "UMLS:C0909596",
                                "MESH:C121870",
                                "name:Clenoliximab",
                                "name:clenoliximab"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "DRUGBANK:DB12698": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "Ibalizumab",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "DRUGBANK:DB12698",
                                "name:Ibalizumab"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "DRUGBANK:DB00098": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "Antithymocyte immunoglobulin (rabbit)",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "DRUGBANK:DB00098",
                                "UMLS:C0021027",
                                "MESH:D007136",
                                "name:Antithymocyte immunoglobulin (rabbit)",
                                "name:Immunoglobulin",
                                "name:antithymocyte globulin"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                }
            },
            "edges": {
                "MONDO:0005737-NCBIGene:116534309-DISEASES API-DISEASES": {
                    "predicate": "biolink:related_to",
                    "subject": "MONDO:0005737",
                    "object": "NCBIGene:116534309",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "DISEASES",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "DISEASES API",
                            "type": "bts:api"
                        },
                        {
                            "name": "category",
                            "value": "textmining",
                            "type": "bts:category"
                        }
                    ]
                },
                "MONDO:0005737-NCBIGene:539109-DISEASES API-DISEASES": {
                    "predicate": "biolink:related_to",
                    "subject": "MONDO:0005737",
                    "object": "NCBIGene:539109",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "DISEASES",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "DISEASES API",
                            "type": "bts:api"
                        },
                        {
                            "name": "category",
                            "value": "textmining",
                            "type": "bts:category"
                        }
                    ]
                },
                "MONDO:0005737-NCBIGene:102448557-DISEASES API-DISEASES": {
                    "predicate": "biolink:related_to",
                    "subject": "MONDO:0005737",
                    "object": "NCBIGene:102448557",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "DISEASES",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "DISEASES API",
                            "type": "bts:api"
                        },
                        {
                            "name": "category",
                            "value": "textmining",
                            "type": "bts:category"
                        }
                    ]
                },
                "MONDO:0005737-NCBIGene:103074707-DISEASES API-DISEASES": {
                    "predicate": "biolink:related_to",
                    "subject": "MONDO:0005737",
                    "object": "NCBIGene:103074707",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "DISEASES",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "DISEASES API",
                            "type": "bts:api"
                        },
                        {
                            "name": "category",
                            "value": "textmining",
                            "type": "bts:category"
                        }
                    ]
                },
                "MONDO:0005737-ENSEMBL:ENSSPUG00000015633-DISEASES API-DISEASES": {
                    "predicate": "biolink:related_to",
                    "subject": "MONDO:0005737",
                    "object": "ENSEMBL:ENSSPUG00000015633",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "DISEASES",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "DISEASES API",
                            "type": "bts:api"
                        },
                        {
                            "name": "category",
                            "value": "textmining",
                            "type": "bts:category"
                        }
                    ]
                },
                "MONDO:0005737-NCBIGene:115865406-DISEASES API-DISEASES": {
                    "predicate": "biolink:related_to",
                    "subject": "MONDO:0005737",
                    "object": "NCBIGene:115865406",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "DISEASES",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "DISEASES API",
                            "type": "bts:api"
                        },
                        {
                            "name": "category",
                            "value": "textmining",
                            "type": "bts:category"
                        }
                    ]
                },
                "MONDO:0005737-NCBIGene:110132571-DISEASES API-DISEASES": {
                    "predicate": "biolink:related_to",
                    "subject": "MONDO:0005737",
                    "object": "NCBIGene:110132571",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "DISEASES",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "DISEASES API",
                            "type": "bts:api"
                        },
                        {
                            "name": "category",
                            "value": "textmining",
                            "type": "bts:category"
                        }
                    ]
                },
                "MONDO:0005737-NCBIGene:101571570-DISEASES API-DISEASES": {
                    "predicate": "biolink:related_to",
                    "subject": "MONDO:0005737",
                    "object": "NCBIGene:101571570",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "DISEASES",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "DISEASES API",
                            "type": "bts:api"
                        },
                        {
                            "name": "category",
                            "value": "textmining",
                            "type": "bts:category"
                        }
                    ]
                },
                "MONDO:0005737-ENSEMBL:ENSSMAG00000017984-DISEASES API-DISEASES": {
                    "predicate": "biolink:related_to",
                    "subject": "MONDO:0005737",
                    "object": "ENSEMBL:ENSSMAG00000017984",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "DISEASES",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "DISEASES API",
                            "type": "bts:api"
                        },
                        {
                            "name": "category",
                            "value": "textmining",
                            "type": "bts:category"
                        }
                    ]
                },
                "MONDO:0005737-NCBIGene:397686-DISEASES API-DISEASES": {
                    "predicate": "biolink:related_to",
                    "subject": "MONDO:0005737",
                    "object": "NCBIGene:397686",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "DISEASES",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "DISEASES API",
                            "type": "bts:api"
                        },
                        {
                            "name": "category",
                            "value": "textmining",
                            "type": "bts:category"
                        }
                    ]
                },
                "MONDO:0005737-NCBIGene:102892030-DISEASES API-DISEASES": {
                    "predicate": "biolink:related_to",
                    "subject": "MONDO:0005737",
                    "object": "NCBIGene:102892030",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "DISEASES",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "DISEASES API",
                            "type": "bts:api"
                        },
                        {
                            "name": "category",
                            "value": "textmining",
                            "type": "bts:category"
                        }
                    ]
                },
                "MONDO:0005737-NCBIGene:104045425-DISEASES API-DISEASES": {
                    "predicate": "biolink:related_to",
                    "subject": "MONDO:0005737",
                    "object": "NCBIGene:104045425",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "DISEASES",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "DISEASES API",
                            "type": "bts:api"
                        },
                        {
                            "name": "category",
                            "value": "textmining",
                            "type": "bts:category"
                        }
                    ]
                },
                "MONDO:0005737-NCBIGene:110137949-DISEASES API-DISEASES": {
                    "predicate": "biolink:related_to",
                    "subject": "MONDO:0005737",
                    "object": "NCBIGene:110137949",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "DISEASES",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "DISEASES API",
                            "type": "bts:api"
                        },
                        {
                            "name": "category",
                            "value": "textmining",
                            "type": "bts:category"
                        }
                    ]
                },
                "MONDO:0005737-NCBIGene:105822820-DISEASES API-DISEASES": {
                    "predicate": "biolink:related_to",
                    "subject": "MONDO:0005737",
                    "object": "NCBIGene:105822820",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "DISEASES",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "DISEASES API",
                            "type": "bts:api"
                        },
                        {
                            "name": "category",
                            "value": "textmining",
                            "type": "bts:category"
                        }
                    ]
                },
                "MONDO:0005737-NCBIGene:116479423-DISEASES API-DISEASES": {
                    "predicate": "biolink:related_to",
                    "subject": "MONDO:0005737",
                    "object": "NCBIGene:116479423",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "DISEASES",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "DISEASES API",
                            "type": "bts:api"
                        },
                        {
                            "name": "category",
                            "value": "textmining",
                            "type": "bts:category"
                        }
                    ]
                },
                "MONDO:0005737-NCBIGene:103814882-DISEASES API-DISEASES": {
                    "predicate": "biolink:related_to",
                    "subject": "MONDO:0005737",
                    "object": "NCBIGene:103814882",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "DISEASES",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "DISEASES API",
                            "type": "bts:api"
                        },
                        {
                            "name": "category",
                            "value": "textmining",
                            "type": "bts:category"
                        }
                    ]
                },
                "MONDO:0005737-NCBIGene:101142722-DISEASES API-DISEASES": {
                    "predicate": "biolink:related_to",
                    "subject": "MONDO:0005737",
                    "object": "NCBIGene:101142722",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "DISEASES",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "DISEASES API",
                            "type": "bts:api"
                        },
                        {
                            "name": "category",
                            "value": "textmining",
                            "type": "bts:category"
                        }
                    ]
                },
                "MONDO:0005737-NCBIGene:104673720-DISEASES API-DISEASES": {
                    "predicate": "biolink:related_to",
                    "subject": "MONDO:0005737",
                    "object": "NCBIGene:104673720",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "DISEASES",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "DISEASES API",
                            "type": "bts:api"
                        },
                        {
                            "name": "category",
                            "value": "textmining",
                            "type": "bts:category"
                        }
                    ]
                },
                "MONDO:0005737-NCBIGene:116543050-DISEASES API-DISEASES": {
                    "predicate": "biolink:related_to",
                    "subject": "MONDO:0005737",
                    "object": "NCBIGene:116543050",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "DISEASES",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "DISEASES API",
                            "type": "bts:api"
                        },
                        {
                            "name": "category",
                            "value": "textmining",
                            "type": "bts:category"
                        }
                    ]
                },
                "MONDO:0005737-NCBIGene:29798-DISEASES API-DISEASES": {
                    "predicate": "biolink:related_to",
                    "subject": "MONDO:0005737",
                    "object": "NCBIGene:29798",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "DISEASES",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "DISEASES API",
                            "type": "bts:api"
                        },
                        {
                            "name": "category",
                            "value": "textmining",
                            "type": "bts:category"
                        }
                    ]
                },
                "MONDO:0005737-NCBIGene:118012204-DISEASES API-DISEASES": {
                    "predicate": "biolink:related_to",
                    "subject": "MONDO:0005737",
                    "object": "NCBIGene:118012204",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "DISEASES",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "DISEASES API",
                            "type": "bts:api"
                        },
                        {
                            "name": "category",
                            "value": "textmining",
                            "type": "bts:category"
                        }
                    ]
                },
                "MONDO:0005737-NCBIGene:103531663-DISEASES API-DISEASES": {
                    "predicate": "biolink:related_to",
                    "subject": "MONDO:0005737",
                    "object": "NCBIGene:103531663",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "DISEASES",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "DISEASES API",
                            "type": "bts:api"
                        },
                        {
                            "name": "category",
                            "value": "textmining",
                            "type": "bts:category"
                        }
                    ]
                },
                "MONDO:0005737-ENSEMBL:ENSNVIG00000024389-DISEASES API-DISEASES": {
                    "predicate": "biolink:related_to",
                    "subject": "MONDO:0005737",
                    "object": "ENSEMBL:ENSNVIG00000024389",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "DISEASES",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "DISEASES API",
                            "type": "bts:api"
                        },
                        {
                            "name": "category",
                            "value": "textmining",
                            "type": "bts:category"
                        }
                    ]
                },
                "MONDO:0005737-NCBIGene:104395366-DISEASES API-DISEASES": {
                    "predicate": "biolink:related_to",
                    "subject": "MONDO:0005737",
                    "object": "NCBIGene:104395366",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "DISEASES",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "DISEASES API",
                            "type": "bts:api"
                        },
                        {
                            "name": "category",
                            "value": "textmining",
                            "type": "bts:category"
                        }
                    ]
                },
                "MONDO:0005737-NCBIGene:100731608-DISEASES API-DISEASES": {
                    "predicate": "biolink:related_to",
                    "subject": "MONDO:0005737",
                    "object": "NCBIGene:100731608",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "DISEASES",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "DISEASES API",
                            "type": "bts:api"
                        },
                        {
                            "name": "category",
                            "value": "textmining",
                            "type": "bts:category"
                        }
                    ]
                },
                "MONDO:0005737-NCBIGene:108529797-DISEASES API-DISEASES": {
                    "predicate": "biolink:related_to",
                    "subject": "MONDO:0005737",
                    "object": "NCBIGene:108529797",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "DISEASES",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "DISEASES API",
                            "type": "bts:api"
                        },
                        {
                            "name": "category",
                            "value": "textmining",
                            "type": "bts:category"
                        }
                    ]
                },
                "MONDO:0005737-NCBIGene:106971145-DISEASES API-DISEASES": {
                    "predicate": "biolink:related_to",
                    "subject": "MONDO:0005737",
                    "object": "NCBIGene:106971145",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "DISEASES",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "DISEASES API",
                            "type": "bts:api"
                        },
                        {
                            "name": "category",
                            "value": "textmining",
                            "type": "bts:category"
                        }
                    ]
                },
                "MONDO:0005737-SYMBOL:GP2-DISEASES API-DISEASES": {
                    "predicate": "biolink:related_to",
                    "subject": "MONDO:0005737",
                    "object": "SYMBOL:GP2",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "DISEASES",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "DISEASES API",
                            "type": "bts:api"
                        },
                        {
                            "name": "category",
                            "value": "textmining",
                            "type": "bts:category"
                        }
                    ]
                },
                "MONDO:0005737-NCBIGene:101443464-DISEASES API-DISEASES": {
                    "predicate": "biolink:related_to",
                    "subject": "MONDO:0005737",
                    "object": "NCBIGene:101443464",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "DISEASES",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "DISEASES API",
                            "type": "bts:api"
                        },
                        {
                            "name": "category",
                            "value": "textmining",
                            "type": "bts:category"
                        }
                    ]
                },
                "MONDO:0005737-NCBIGene:102387082-DISEASES API-DISEASES": {
                    "predicate": "biolink:related_to",
                    "subject": "MONDO:0005737",
                    "object": "NCBIGene:102387082",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "DISEASES",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "DISEASES API",
                            "type": "bts:api"
                        },
                        {
                            "name": "category",
                            "value": "textmining",
                            "type": "bts:category"
                        }
                    ]
                },
                "MONDO:0005737-NCBIGene:109055884-DISEASES API-DISEASES": {
                    "predicate": "biolink:related_to",
                    "subject": "MONDO:0005737",
                    "object": "NCBIGene:109055884",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "DISEASES",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "DISEASES API",
                            "type": "bts:api"
                        },
                        {
                            "name": "category",
                            "value": "textmining",
                            "type": "bts:category"
                        }
                    ]
                },
                "MONDO:0005737-ENSEMBL:ENSSBOG00000011322-DISEASES API-DISEASES": {
                    "predicate": "biolink:related_to",
                    "subject": "MONDO:0005737",
                    "object": "ENSEMBL:ENSSBOG00000011322",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "DISEASES",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "DISEASES API",
                            "type": "bts:api"
                        },
                        {
                            "name": "category",
                            "value": "textmining",
                            "type": "bts:category"
                        }
                    ]
                },
                "MONDO:0005737-NCBIGene:117759282-DISEASES API-DISEASES": {
                    "predicate": "biolink:related_to",
                    "subject": "MONDO:0005737",
                    "object": "NCBIGene:117759282",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "DISEASES",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "DISEASES API",
                            "type": "bts:api"
                        },
                        {
                            "name": "category",
                            "value": "textmining",
                            "type": "bts:category"
                        }
                    ]
                },
                "MONDO:0005737-NCBIGene:103562469-DISEASES API-DISEASES": {
                    "predicate": "biolink:related_to",
                    "subject": "MONDO:0005737",
                    "object": "NCBIGene:103562469",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "DISEASES",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "DISEASES API",
                            "type": "bts:api"
                        },
                        {
                            "name": "category",
                            "value": "textmining",
                            "type": "bts:category"
                        }
                    ]
                },
                "MONDO:0005737-NCBIGene:112648300-DISEASES API-DISEASES": {
                    "predicate": "biolink:related_to",
                    "subject": "MONDO:0005737",
                    "object": "NCBIGene:112648300",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "DISEASES",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "DISEASES API",
                            "type": "bts:api"
                        },
                        {
                            "name": "category",
                            "value": "textmining",
                            "type": "bts:category"
                        }
                    ]
                },
                "MONDO:0005737-NCBIGene:105221759-DISEASES API-DISEASES": {
                    "predicate": "biolink:related_to",
                    "subject": "MONDO:0005737",
                    "object": "NCBIGene:105221759",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "DISEASES",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "DISEASES API",
                            "type": "bts:api"
                        },
                        {
                            "name": "category",
                            "value": "textmining",
                            "type": "bts:category"
                        }
                    ]
                },
                "MONDO:0005737-NCBIGene:118335909-DISEASES API-DISEASES": {
                    "predicate": "biolink:related_to",
                    "subject": "MONDO:0005737",
                    "object": "NCBIGene:118335909",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "DISEASES",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "DISEASES API",
                            "type": "bts:api"
                        },
                        {
                            "name": "category",
                            "value": "textmining",
                            "type": "bts:category"
                        }
                    ]
                },
                "MONDO:0005737-NCBIGene:101674197-DISEASES API-DISEASES": {
                    "predicate": "biolink:related_to",
                    "subject": "MONDO:0005737",
                    "object": "NCBIGene:101674197",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "DISEASES",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "DISEASES API",
                            "type": "bts:api"
                        },
                        {
                            "name": "category",
                            "value": "textmining",
                            "type": "bts:category"
                        }
                    ]
                },
                "MONDO:0005737-NCBIGene:103089296-DISEASES API-DISEASES": {
                    "predicate": "biolink:related_to",
                    "subject": "MONDO:0005737",
                    "object": "NCBIGene:103089296",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "DISEASES",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "DISEASES API",
                            "type": "bts:api"
                        },
                        {
                            "name": "category",
                            "value": "textmining",
                            "type": "bts:category"
                        }
                    ]
                },
                "MONDO:0005737-NCBIGene:100136221-DISEASES API-DISEASES": {
                    "predicate": "biolink:related_to",
                    "subject": "MONDO:0005737",
                    "object": "NCBIGene:100136221",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "DISEASES",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "DISEASES API",
                            "type": "bts:api"
                        },
                        {
                            "name": "category",
                            "value": "textmining",
                            "type": "bts:category"
                        }
                    ]
                },
                "MONDO:0005737-NCBIGene:118023076-DISEASES API-DISEASES": {
                    "predicate": "biolink:related_to",
                    "subject": "MONDO:0005737",
                    "object": "NCBIGene:118023076",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "DISEASES",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "DISEASES API",
                            "type": "bts:api"
                        },
                        {
                            "name": "category",
                            "value": "textmining",
                            "type": "bts:category"
                        }
                    ]
                },
                "MONDO:0005737-NCBIGene:574217-DISEASES API-DISEASES": {
                    "predicate": "biolink:related_to",
                    "subject": "MONDO:0005737",
                    "object": "NCBIGene:574217",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "DISEASES",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "DISEASES API",
                            "type": "bts:api"
                        },
                        {
                            "name": "category",
                            "value": "textmining",
                            "type": "bts:category"
                        }
                    ]
                },
                "MONDO:0005737-UMLS:C1707151-SEMMED Disease API-SEMMED": {
                    "predicate": "biolink:affected_by",
                    "subject": "MONDO:0005737",
                    "object": "UMLS:C1707151",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "SEMMED",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "SEMMED Disease API",
                            "type": "bts:api"
                        },
                        {
                            "name": "publications",
                            "value": [
                                "PMID:27595844"
                            ],
                            "type": "biolink:publications"
                        }
                    ]
                },
                "MONDO:0005737-UMLS:C1707163-SEMMED Disease API-SEMMED": {
                    "predicate": "biolink:affected_by",
                    "subject": "MONDO:0005737",
                    "object": "UMLS:C1707163",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "SEMMED",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "SEMMED Disease API",
                            "type": "bts:api"
                        },
                        {
                            "name": "publications",
                            "value": [
                                "PMID:20466822"
                            ],
                            "type": "biolink:publications"
                        }
                    ]
                },
                "MONDO:0005737-NCBIGene:3601-SEMMED Disease API-SEMMED": {
                    "predicate": "biolink:affected_by",
                    "subject": "MONDO:0005737",
                    "object": "NCBIGene:3601",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "SEMMED",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "SEMMED Disease API",
                            "type": "bts:api"
                        },
                        {
                            "name": "publications",
                            "value": [
                                "PMID:27595844"
                            ],
                            "type": "biolink:publications"
                        }
                    ]
                },
                "MONDO:0005737-NCBIGene:5788-SEMMED Disease API-SEMMED": {
                    "predicate": "biolink:affected_by",
                    "subject": "MONDO:0005737",
                    "object": "NCBIGene:5788",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "SEMMED",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "SEMMED Disease API",
                            "type": "bts:api"
                        },
                        {
                            "name": "publications",
                            "value": [
                                "PMID:19683682"
                            ],
                            "type": "biolink:publications"
                        }
                    ]
                },
                "MONDO:0005737-NCBIGene:8030-SEMMED Disease API-SEMMED": {
                    "predicate": "biolink:affected_by",
                    "subject": "MONDO:0005737",
                    "object": "NCBIGene:8030",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "SEMMED",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "SEMMED Disease API",
                            "type": "bts:api"
                        },
                        {
                            "name": "publications",
                            "value": [
                                "PMID:25722412"
                            ],
                            "type": "biolink:publications"
                        }
                    ]
                },
                "MONDO:0005737-NCBIGene:920-SEMMED Disease API-SEMMED": {
                    "predicate": "biolink:affected_by",
                    "subject": "MONDO:0005737",
                    "object": "NCBIGene:920",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "SEMMED",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "SEMMED Disease API",
                            "type": "bts:api"
                        },
                        {
                            "name": "publications",
                            "value": [
                                "PMID:16002721"
                            ],
                            "type": "biolink:publications"
                        }
                    ]
                },
                "MONDO:0005737-NCBIGene:1514-SEMMED Disease API-SEMMED": {
                    "predicate": "biolink:affected_by",
                    "subject": "MONDO:0005737",
                    "object": "NCBIGene:1514",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "SEMMED",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "SEMMED Disease API",
                            "type": "bts:api"
                        },
                        {
                            "name": "publications",
                            "value": [
                                "PMID:20466822"
                            ],
                            "type": "biolink:publications"
                        }
                    ]
                },
                "MONDO:0005737-UMLS:C1706438-SEMMED Disease API-SEMMED": {
                    "predicate": "biolink:caused_by",
                    "subject": "MONDO:0005737",
                    "object": "UMLS:C1706438",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "SEMMED",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "SEMMED Disease API",
                            "type": "bts:api"
                        },
                        {
                            "name": "publications",
                            "value": [
                                "PMID:21857654"
                            ],
                            "type": "biolink:publications"
                        }
                    ]
                },
                "MONDO:0005737-UMLS:C1367471-SEMMED Disease API-SEMMED": {
                    "predicate": "biolink:caused_by",
                    "subject": "MONDO:0005737",
                    "object": "UMLS:C1367471",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "SEMMED",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "SEMMED Disease API",
                            "type": "bts:api"
                        },
                        {
                            "name": "publications",
                            "value": [
                                "PMID:21857654"
                            ],
                            "type": "biolink:publications"
                        }
                    ]
                },
                "MONDO:0005737-NCBIGene:3439-SEMMED Disease API-SEMMED": {
                    "predicate": "biolink:disrupted_by",
                    "subject": "MONDO:0005737",
                    "object": "NCBIGene:3439",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "SEMMED",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "SEMMED Disease API",
                            "type": "bts:api"
                        },
                        {
                            "name": "publications",
                            "value": [
                                "PMID:22958256"
                            ],
                            "type": "biolink:publications"
                        }
                    ]
                },
                "MONDO:0005737-UMLS:C1708411-SEMMED Disease API-SEMMED": {
                    "predicate": "biolink:disrupted_by",
                    "subject": "MONDO:0005737",
                    "object": "UMLS:C1708411",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "SEMMED",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "SEMMED Disease API",
                            "type": "bts:api"
                        },
                        {
                            "name": "publications",
                            "value": [
                                "PMID:26562011"
                            ],
                            "type": "biolink:publications"
                        }
                    ]
                },
                "MONDO:0005737-UMLS:C0017337-SEMMED Disease API-SEMMED": {
                    "predicate": "biolink:disrupted_by",
                    "subject": "MONDO:0005737",
                    "object": "UMLS:C0017337",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "SEMMED",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "SEMMED Disease API",
                            "type": "bts:api"
                        },
                        {
                            "name": "publications",
                            "value": [
                                "PMID:26562011"
                            ],
                            "type": "biolink:publications"
                        }
                    ]
                },
                "MONDO:0005737-UMLS:C1335439-SEMMED Disease API-SEMMED": {
                    "predicate": "biolink:disrupted_by",
                    "subject": "MONDO:0005737",
                    "object": "UMLS:C1335439",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "SEMMED",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "SEMMED Disease API",
                            "type": "bts:api"
                        },
                        {
                            "name": "publications",
                            "value": [
                                "PMID:26397100"
                            ],
                            "type": "biolink:publications"
                        }
                    ]
                },
                "MONDO:0005737-NCBIGene:3557-SEMMED Disease API-SEMMED": {
                    "predicate": "biolink:prevented_by",
                    "subject": "MONDO:0005737",
                    "object": "NCBIGene:3557",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "SEMMED",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "SEMMED Disease API",
                            "type": "bts:api"
                        },
                        {
                            "name": "publications",
                            "value": [
                                "PMID:26209680"
                            ],
                            "type": "biolink:publications"
                        }
                    ]
                },
                "MONDO:0005737-UMLS:C1705770-SEMMED Disease API-SEMMED": {
                    "predicate": "biolink:related_to",
                    "subject": "MONDO:0005737",
                    "object": "UMLS:C1705770",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "SEMMED",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "SEMMED Disease API",
                            "type": "bts:api"
                        },
                        {
                            "name": "publications",
                            "value": [
                                "PMID:16571833"
                            ],
                            "type": "biolink:publications"
                        }
                    ]
                },
                "MONDO:0005737-NCBIGene:1520-SEMMED Disease API-SEMMED": {
                    "predicate": "biolink:related_to",
                    "subject": "MONDO:0005737",
                    "object": "NCBIGene:1520",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "SEMMED",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "SEMMED Disease API",
                            "type": "bts:api"
                        },
                        {
                            "name": "publications",
                            "value": [
                                "PMID:19775255"
                            ],
                            "type": "biolink:publications"
                        }
                    ]
                },
                "MONDO:0005737-NCBIGene:3806-SEMMED Disease API-SEMMED": {
                    "predicate": "biolink:related_to",
                    "subject": "MONDO:0005737",
                    "object": "NCBIGene:3806",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "SEMMED",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "SEMMED Disease API",
                            "type": "bts:api"
                        },
                        {
                            "name": "publications",
                            "value": [
                                "PMID:20878400"
                            ],
                            "type": "biolink:publications"
                        }
                    ]
                },
                "MONDO:0005737-NCBIGene:3808-SEMMED Disease API-SEMMED": {
                    "predicate": "biolink:related_to",
                    "subject": "MONDO:0005737",
                    "object": "NCBIGene:3808",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "SEMMED",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "SEMMED Disease API",
                            "type": "bts:api"
                        },
                        {
                            "name": "publications",
                            "value": [
                                "PMID:20878400"
                            ],
                            "type": "biolink:publications"
                        }
                    ]
                },
                "MONDO:0005737-UMLS:C1705846-SEMMED Disease API-SEMMED": {
                    "predicate": "biolink:related_to",
                    "subject": "MONDO:0005737",
                    "object": "UMLS:C1705846",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "SEMMED",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "SEMMED Disease API",
                            "type": "bts:api"
                        },
                        {
                            "name": "publications",
                            "value": [
                                "PMID:27659453"
                            ],
                            "type": "biolink:publications"
                        }
                    ]
                },
                "MONDO:0005737-NCBIGene:558-SEMMED Disease API-SEMMED": {
                    "predicate": "biolink:related_to",
                    "subject": "MONDO:0005737",
                    "object": "NCBIGene:558",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "SEMMED",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "SEMMED Disease API",
                            "type": "bts:api"
                        },
                        {
                            "name": "publications",
                            "value": [
                                "PMID:17940958"
                            ],
                            "type": "biolink:publications"
                        }
                    ]
                },
                "MONDO:0005737-UMLS:C1705742-SEMMED Disease API-SEMMED": {
                    "predicate": "biolink:related_to",
                    "subject": "MONDO:0005737",
                    "object": "UMLS:C1705742",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "SEMMED",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "SEMMED Disease API",
                            "type": "bts:api"
                        },
                        {
                            "name": "publications",
                            "value": [
                                "PMID:26376249"
                            ],
                            "type": "biolink:publications"
                        }
                    ]
                },
                "MONDO:0005737-UMLS:C0007428-SEMMED Disease API-SEMMED": {
                    "predicate": "biolink:related_to",
                    "subject": "MONDO:0005737",
                    "object": "UMLS:C0007428",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "SEMMED",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "SEMMED Disease API",
                            "type": "bts:api"
                        },
                        {
                            "name": "publications",
                            "value": [
                                "PMID:19775255"
                            ],
                            "type": "biolink:publications"
                        }
                    ]
                },
                "MONDO:0005737-UMLS:C0017428-SEMMED Disease API-SEMMED": {
                    "predicate": "biolink:related_to",
                    "subject": "MONDO:0005737",
                    "object": "UMLS:C0017428",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "SEMMED",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "SEMMED Disease API",
                            "type": "bts:api"
                        },
                        {
                            "name": "publications",
                            "value": [
                                "PMID:26051281"
                            ],
                            "type": "biolink:publications"
                        }
                    ]
                },
                "MONDO:0005737-UMLS:C0031727-SEMMED Disease API-SEMMED": {
                    "predicate": "biolink:related_to",
                    "subject": "MONDO:0005737",
                    "object": "UMLS:C0031727",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "SEMMED",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "SEMMED Disease API",
                            "type": "bts:api"
                        },
                        {
                            "name": "publications",
                            "value": [
                                "PMID:27659453"
                            ],
                            "type": "biolink:publications"
                        }
                    ]
                },
                "MONDO:0005737-UMLS:C0298973-SEMMED Disease API-SEMMED": {
                    "predicate": "biolink:related_to",
                    "subject": "MONDO:0005737",
                    "object": "UMLS:C0298973",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "SEMMED",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "SEMMED Disease API",
                            "type": "bts:api"
                        },
                        {
                            "name": "publications",
                            "value": [
                                "PMID:27659453"
                            ],
                            "type": "biolink:publications"
                        }
                    ]
                },
                "MONDO:0005737-UMLS:C0389995-SEMMED Disease API-SEMMED": {
                    "predicate": "biolink:related_to",
                    "subject": "MONDO:0005737",
                    "object": "UMLS:C0389995",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "SEMMED",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "SEMMED Disease API",
                            "type": "bts:api"
                        },
                        {
                            "name": "publications",
                            "value": [
                                "PMID:25512227"
                            ],
                            "type": "biolink:publications"
                        }
                    ]
                },
                "MONDO:0005737-UMLS:C0699919-SEMMED Disease API-SEMMED": {
                    "predicate": "biolink:related_to",
                    "subject": "MONDO:0005737",
                    "object": "UMLS:C0699919",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "SEMMED",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "SEMMED Disease API",
                            "type": "bts:api"
                        },
                        {
                            "name": "publications",
                            "value": [
                                "PMID:16571833"
                            ],
                            "type": "biolink:publications"
                        }
                    ]
                },
                "MONDO:0005737-UMLS:C1136352-SEMMED Disease API-SEMMED": {
                    "predicate": "biolink:related_to",
                    "subject": "MONDO:0005737",
                    "object": "UMLS:C1136352",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "SEMMED",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "SEMMED Disease API",
                            "type": "bts:api"
                        },
                        {
                            "name": "publications",
                            "value": [
                                "PMID:11752702"
                            ],
                            "type": "biolink:publications"
                        }
                    ]
                },
                "MONDO:0005737-UMLS:C1704867-SEMMED Disease API-SEMMED": {
                    "predicate": "biolink:treated_by",
                    "subject": "MONDO:0005737",
                    "object": "UMLS:C1704867",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "SEMMED",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "SEMMED Disease API",
                            "type": "bts:api"
                        },
                        {
                            "name": "publications",
                            "value": [
                                "PMID:14645601"
                            ],
                            "type": "biolink:publications"
                        }
                    ]
                },
                "MONDO:0005737-UMLS:C1705766-SEMMED Disease API-SEMMED": {
                    "predicate": "biolink:treated_by",
                    "subject": "MONDO:0005737",
                    "object": "UMLS:C1705766",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "SEMMED",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "SEMMED Disease API",
                            "type": "bts:api"
                        },
                        {
                            "name": "publications",
                            "value": [
                                "PMID:28659436"
                            ],
                            "type": "biolink:publications"
                        }
                    ]
                },
                "MONDO:0005737-NCBIGene:4864-SEMMED Disease API-SEMMED": {
                    "predicate": "biolink:treated_by",
                    "subject": "MONDO:0005737",
                    "object": "NCBIGene:4864",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "SEMMED",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "SEMMED Disease API",
                            "type": "bts:api"
                        },
                        {
                            "name": "publications",
                            "value": [
                                "PMID:26698106"
                            ],
                            "type": "biolink:publications"
                        }
                    ]
                },
                "MONDO:0005737-UMLS:C1704661-SEMMED Disease API-SEMMED": {
                    "predicate": "biolink:treated_by",
                    "subject": "MONDO:0005737",
                    "object": "UMLS:C1704661",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "SEMMED",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "SEMMED Disease API",
                            "type": "bts:api"
                        },
                        {
                            "name": "publications",
                            "value": [
                                "PMID:25347780"
                            ],
                            "type": "biolink:publications"
                        }
                    ]
                },
                "MONDO:0005737-UMLS:C1704799-SEMMED Disease API-SEMMED": {
                    "predicate": "biolink:treated_by",
                    "subject": "MONDO:0005737",
                    "object": "UMLS:C1704799",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "SEMMED",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "SEMMED Disease API",
                            "type": "bts:api"
                        },
                        {
                            "name": "publications",
                            "value": [
                                "PMID:26900129"
                            ],
                            "type": "biolink:publications"
                        }
                    ]
                },
                "MONDO:0005737-UMLS:C2985367-SEMMED Disease API-SEMMED": {
                    "predicate": "biolink:treated_by",
                    "subject": "MONDO:0005737",
                    "object": "UMLS:C2985367",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "SEMMED",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "SEMMED Disease API",
                            "type": "bts:api"
                        },
                        {
                            "name": "publications",
                            "value": [
                                "PMID:17940975"
                            ],
                            "type": "biolink:publications"
                        }
                    ]
                },
                "MONDO:0005737-UMLS:C1705581-SEMMED Disease API-SEMMED": {
                    "predicate": "biolink:treated_by",
                    "subject": "MONDO:0005737",
                    "object": "UMLS:C1705581",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "SEMMED",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "SEMMED Disease API",
                            "type": "bts:api"
                        },
                        {
                            "name": "publications",
                            "value": [
                                "PMID:26740837"
                            ],
                            "type": "biolink:publications"
                        }
                    ]
                },
                "MONDO:0005737-UMLS:C0044602-SEMMED Disease API-SEMMED": {
                    "predicate": "biolink:treated_by",
                    "subject": "MONDO:0005737",
                    "object": "UMLS:C0044602",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "SEMMED",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "SEMMED Disease API",
                            "type": "bts:api"
                        },
                        {
                            "name": "publications",
                            "value": [
                                "PMID:28403145"
                            ],
                            "type": "biolink:publications"
                        }
                    ]
                },
                "MONDO:0005737-NCBIGene:324-SEMMED Disease API-SEMMED": {
                    "predicate": "biolink:treated_by",
                    "subject": "MONDO:0005737",
                    "object": "NCBIGene:324",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "SEMMED",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "SEMMED Disease API",
                            "type": "bts:api"
                        },
                        {
                            "name": "publications",
                            "value": [
                                "PMID:28659436"
                            ],
                            "type": "biolink:publications"
                        }
                    ]
                },
                "MONDO:0005737-UMLS:C0287990-SEMMED Disease API-SEMMED": {
                    "predicate": "biolink:treated_by",
                    "subject": "MONDO:0005737",
                    "object": "UMLS:C0287990",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "SEMMED",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "SEMMED Disease API",
                            "type": "bts:api"
                        },
                        {
                            "name": "publications",
                            "value": [
                                "PMID:25347780"
                            ],
                            "type": "biolink:publications"
                        }
                    ]
                },
                "MONDO:0005737-UMLS:C0752243-SEMMED Disease API-SEMMED": {
                    "predicate": "biolink:treated_by",
                    "subject": "MONDO:0005737",
                    "object": "UMLS:C0752243",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "SEMMED",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "SEMMED Disease API",
                            "type": "bts:api"
                        },
                        {
                            "name": "publications",
                            "value": [
                                "PMID:17229700"
                            ],
                            "type": "biolink:publications"
                        }
                    ]
                },
                "NCBIGene:116534309-DRUGBANK:DB06241-MyChem.info API-drugbank": {
                    "predicate": "biolink:physically_interacts_with",
                    "subject": "NCBIGene:116534309",
                    "object": "DRUGBANK:DB06241",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "drugbank",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "MyChem.info API",
                            "type": "bts:api"
                        }
                    ]
                },
                "NCBIGene:116534309-DRUGBANK:DB12698-MyChem.info API-drugbank": {
                    "predicate": "biolink:physically_interacts_with",
                    "subject": "NCBIGene:116534309",
                    "object": "DRUGBANK:DB12698",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "drugbank",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "MyChem.info API",
                            "type": "bts:api"
                        }
                    ]
                },
                "NCBIGene:116534309-DRUGBANK:DB00098-MyChem.info API-drugbank": {
                    "predicate": "biolink:physically_interacts_with",
                    "subject": "NCBIGene:116534309",
                    "object": "DRUGBANK:DB00098",
                    "attributes": [
                        {
                            "name": "provided_by",
                            "value": "drugbank",
                            "type": "biolink:provided_by"
                        },
                        {
                            "name": "api",
                            "value": "MyChem.info API",
                            "type": "bts:api"
                        }
                    ]
                }
            }
        },
        "results": [
            {
                "node_bindings": {
                    "n0": [
                        {
                            "id": "MONDO:0005737"
                        }
                    ],
                    "n1": [
                        {
                            "id": "NCBIGene:116534309"
                        }
                    ]
                },
                "edge_bindings": {
                    "e01": [
                        {
                            "id": "MONDO:0005737-NCBIGene:116534309-DISEASES API-DISEASES"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n0": [
                        {
                            "id": "MONDO:0005737"
                        }
                    ],
                    "n1": [
                        {
                            "id": "NCBIGene:539109"
                        }
                    ]
                },
                "edge_bindings": {
                    "e01": [
                        {
                            "id": "MONDO:0005737-NCBIGene:539109-DISEASES API-DISEASES"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n0": [
                        {
                            "id": "MONDO:0005737"
                        }
                    ],
                    "n1": [
                        {
                            "id": "NCBIGene:102448557"
                        }
                    ]
                },
                "edge_bindings": {
                    "e01": [
                        {
                            "id": "MONDO:0005737-NCBIGene:102448557-DISEASES API-DISEASES"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n0": [
                        {
                            "id": "MONDO:0005737"
                        }
                    ],
                    "n1": [
                        {
                            "id": "NCBIGene:103074707"
                        }
                    ]
                },
                "edge_bindings": {
                    "e01": [
                        {
                            "id": "MONDO:0005737-NCBIGene:103074707-DISEASES API-DISEASES"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n0": [
                        {
                            "id": "MONDO:0005737"
                        }
                    ],
                    "n1": [
                        {
                            "id": "ENSEMBL:ENSSPUG00000015633"
                        }
                    ]
                },
                "edge_bindings": {
                    "e01": [
                        {
                            "id": "MONDO:0005737-ENSEMBL:ENSSPUG00000015633-DISEASES API-DISEASES"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n0": [
                        {
                            "id": "MONDO:0005737"
                        }
                    ],
                    "n1": [
                        {
                            "id": "NCBIGene:115865406"
                        }
                    ]
                },
                "edge_bindings": {
                    "e01": [
                        {
                            "id": "MONDO:0005737-NCBIGene:115865406-DISEASES API-DISEASES"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n0": [
                        {
                            "id": "MONDO:0005737"
                        }
                    ],
                    "n1": [
                        {
                            "id": "NCBIGene:110132571"
                        }
                    ]
                },
                "edge_bindings": {
                    "e01": [
                        {
                            "id": "MONDO:0005737-NCBIGene:110132571-DISEASES API-DISEASES"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n0": [
                        {
                            "id": "MONDO:0005737"
                        }
                    ],
                    "n1": [
                        {
                            "id": "NCBIGene:101571570"
                        }
                    ]
                },
                "edge_bindings": {
                    "e01": [
                        {
                            "id": "MONDO:0005737-NCBIGene:101571570-DISEASES API-DISEASES"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n0": [
                        {
                            "id": "MONDO:0005737"
                        }
                    ],
                    "n1": [
                        {
                            "id": "ENSEMBL:ENSSMAG00000017984"
                        }
                    ]
                },
                "edge_bindings": {
                    "e01": [
                        {
                            "id": "MONDO:0005737-ENSEMBL:ENSSMAG00000017984-DISEASES API-DISEASES"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n0": [
                        {
                            "id": "MONDO:0005737"
                        }
                    ],
                    "n1": [
                        {
                            "id": "NCBIGene:397686"
                        }
                    ]
                },
                "edge_bindings": {
                    "e01": [
                        {
                            "id": "MONDO:0005737-NCBIGene:397686-DISEASES API-DISEASES"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n0": [
                        {
                            "id": "MONDO:0005737"
                        }
                    ],
                    "n1": [
                        {
                            "id": "NCBIGene:102892030"
                        }
                    ]
                },
                "edge_bindings": {
                    "e01": [
                        {
                            "id": "MONDO:0005737-NCBIGene:102892030-DISEASES API-DISEASES"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n0": [
                        {
                            "id": "MONDO:0005737"
                        }
                    ],
                    "n1": [
                        {
                            "id": "NCBIGene:104045425"
                        }
                    ]
                },
                "edge_bindings": {
                    "e01": [
                        {
                            "id": "MONDO:0005737-NCBIGene:104045425-DISEASES API-DISEASES"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n0": [
                        {
                            "id": "MONDO:0005737"
                        }
                    ],
                    "n1": [
                        {
                            "id": "NCBIGene:110137949"
                        }
                    ]
                },
                "edge_bindings": {
                    "e01": [
                        {
                            "id": "MONDO:0005737-NCBIGene:110137949-DISEASES API-DISEASES"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n0": [
                        {
                            "id": "MONDO:0005737"
                        }
                    ],
                    "n1": [
                        {
                            "id": "NCBIGene:105822820"
                        }
                    ]
                },
                "edge_bindings": {
                    "e01": [
                        {
                            "id": "MONDO:0005737-NCBIGene:105822820-DISEASES API-DISEASES"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n0": [
                        {
                            "id": "MONDO:0005737"
                        }
                    ],
                    "n1": [
                        {
                            "id": "NCBIGene:116479423"
                        }
                    ]
                },
                "edge_bindings": {
                    "e01": [
                        {
                            "id": "MONDO:0005737-NCBIGene:116479423-DISEASES API-DISEASES"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n0": [
                        {
                            "id": "MONDO:0005737"
                        }
                    ],
                    "n1": [
                        {
                            "id": "NCBIGene:103814882"
                        }
                    ]
                },
                "edge_bindings": {
                    "e01": [
                        {
                            "id": "MONDO:0005737-NCBIGene:103814882-DISEASES API-DISEASES"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n0": [
                        {
                            "id": "MONDO:0005737"
                        }
                    ],
                    "n1": [
                        {
                            "id": "NCBIGene:101142722"
                        }
                    ]
                },
                "edge_bindings": {
                    "e01": [
                        {
                            "id": "MONDO:0005737-NCBIGene:101142722-DISEASES API-DISEASES"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n0": [
                        {
                            "id": "MONDO:0005737"
                        }
                    ],
                    "n1": [
                        {
                            "id": "NCBIGene:104673720"
                        }
                    ]
                },
                "edge_bindings": {
                    "e01": [
                        {
                            "id": "MONDO:0005737-NCBIGene:104673720-DISEASES API-DISEASES"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n0": [
                        {
                            "id": "MONDO:0005737"
                        }
                    ],
                    "n1": [
                        {
                            "id": "NCBIGene:116543050"
                        }
                    ]
                },
                "edge_bindings": {
                    "e01": [
                        {
                            "id": "MONDO:0005737-NCBIGene:116543050-DISEASES API-DISEASES"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n0": [
                        {
                            "id": "MONDO:0005737"
                        }
                    ],
                    "n1": [
                        {
                            "id": "NCBIGene:29798"
                        }
                    ]
                },
                "edge_bindings": {
                    "e01": [
                        {
                            "id": "MONDO:0005737-NCBIGene:29798-DISEASES API-DISEASES"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n0": [
                        {
                            "id": "MONDO:0005737"
                        }
                    ],
                    "n1": [
                        {
                            "id": "NCBIGene:118012204"
                        }
                    ]
                },
                "edge_bindings": {
                    "e01": [
                        {
                            "id": "MONDO:0005737-NCBIGene:118012204-DISEASES API-DISEASES"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n0": [
                        {
                            "id": "MONDO:0005737"
                        }
                    ],
                    "n1": [
                        {
                            "id": "NCBIGene:103531663"
                        }
                    ]
                },
                "edge_bindings": {
                    "e01": [
                        {
                            "id": "MONDO:0005737-NCBIGene:103531663-DISEASES API-DISEASES"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n0": [
                        {
                            "id": "MONDO:0005737"
                        }
                    ],
                    "n1": [
                        {
                            "id": "ENSEMBL:ENSNVIG00000024389"
                        }
                    ]
                },
                "edge_bindings": {
                    "e01": [
                        {
                            "id": "MONDO:0005737-ENSEMBL:ENSNVIG00000024389-DISEASES API-DISEASES"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n0": [
                        {
                            "id": "MONDO:0005737"
                        }
                    ],
                    "n1": [
                        {
                            "id": "NCBIGene:104395366"
                        }
                    ]
                },
                "edge_bindings": {
                    "e01": [
                        {
                            "id": "MONDO:0005737-NCBIGene:104395366-DISEASES API-DISEASES"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n0": [
                        {
                            "id": "MONDO:0005737"
                        }
                    ],
                    "n1": [
                        {
                            "id": "NCBIGene:100731608"
                        }
                    ]
                },
                "edge_bindings": {
                    "e01": [
                        {
                            "id": "MONDO:0005737-NCBIGene:100731608-DISEASES API-DISEASES"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n0": [
                        {
                            "id": "MONDO:0005737"
                        }
                    ],
                    "n1": [
                        {
                            "id": "NCBIGene:108529797"
                        }
                    ]
                },
                "edge_bindings": {
                    "e01": [
                        {
                            "id": "MONDO:0005737-NCBIGene:108529797-DISEASES API-DISEASES"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n0": [
                        {
                            "id": "MONDO:0005737"
                        }
                    ],
                    "n1": [
                        {
                            "id": "NCBIGene:106971145"
                        }
                    ]
                },
                "edge_bindings": {
                    "e01": [
                        {
                            "id": "MONDO:0005737-NCBIGene:106971145-DISEASES API-DISEASES"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n0": [
                        {
                            "id": "MONDO:0005737"
                        }
                    ],
                    "n1": [
                        {
                            "id": "SYMBOL:GP2"
                        }
                    ]
                },
                "edge_bindings": {
                    "e01": [
                        {
                            "id": "MONDO:0005737-SYMBOL:GP2-DISEASES API-DISEASES"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n0": [
                        {
                            "id": "MONDO:0005737"
                        }
                    ],
                    "n1": [
                        {
                            "id": "NCBIGene:101443464"
                        }
                    ]
                },
                "edge_bindings": {
                    "e01": [
                        {
                            "id": "MONDO:0005737-NCBIGene:101443464-DISEASES API-DISEASES"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n0": [
                        {
                            "id": "MONDO:0005737"
                        }
                    ],
                    "n1": [
                        {
                            "id": "NCBIGene:102387082"
                        }
                    ]
                },
                "edge_bindings": {
                    "e01": [
                        {
                            "id": "MONDO:0005737-NCBIGene:102387082-DISEASES API-DISEASES"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n0": [
                        {
                            "id": "MONDO:0005737"
                        }
                    ],
                    "n1": [
                        {
                            "id": "NCBIGene:109055884"
                        }
                    ]
                },
                "edge_bindings": {
                    "e01": [
                        {
                            "id": "MONDO:0005737-NCBIGene:109055884-DISEASES API-DISEASES"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n0": [
                        {
                            "id": "MONDO:0005737"
                        }
                    ],
                    "n1": [
                        {
                            "id": "ENSEMBL:ENSSBOG00000011322"
                        }
                    ]
                },
                "edge_bindings": {
                    "e01": [
                        {
                            "id": "MONDO:0005737-ENSEMBL:ENSSBOG00000011322-DISEASES API-DISEASES"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n0": [
                        {
                            "id": "MONDO:0005737"
                        }
                    ],
                    "n1": [
                        {
                            "id": "NCBIGene:117759282"
                        }
                    ]
                },
                "edge_bindings": {
                    "e01": [
                        {
                            "id": "MONDO:0005737-NCBIGene:117759282-DISEASES API-DISEASES"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n0": [
                        {
                            "id": "MONDO:0005737"
                        }
                    ],
                    "n1": [
                        {
                            "id": "NCBIGene:103562469"
                        }
                    ]
                },
                "edge_bindings": {
                    "e01": [
                        {
                            "id": "MONDO:0005737-NCBIGene:103562469-DISEASES API-DISEASES"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n0": [
                        {
                            "id": "MONDO:0005737"
                        }
                    ],
                    "n1": [
                        {
                            "id": "NCBIGene:112648300"
                        }
                    ]
                },
                "edge_bindings": {
                    "e01": [
                        {
                            "id": "MONDO:0005737-NCBIGene:112648300-DISEASES API-DISEASES"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n0": [
                        {
                            "id": "MONDO:0005737"
                        }
                    ],
                    "n1": [
                        {
                            "id": "NCBIGene:105221759"
                        }
                    ]
                },
                "edge_bindings": {
                    "e01": [
                        {
                            "id": "MONDO:0005737-NCBIGene:105221759-DISEASES API-DISEASES"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n0": [
                        {
                            "id": "MONDO:0005737"
                        }
                    ],
                    "n1": [
                        {
                            "id": "NCBIGene:118335909"
                        }
                    ]
                },
                "edge_bindings": {
                    "e01": [
                        {
                            "id": "MONDO:0005737-NCBIGene:118335909-DISEASES API-DISEASES"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n0": [
                        {
                            "id": "MONDO:0005737"
                        }
                    ],
                    "n1": [
                        {
                            "id": "NCBIGene:101674197"
                        }
                    ]
                },
                "edge_bindings": {
                    "e01": [
                        {
                            "id": "MONDO:0005737-NCBIGene:101674197-DISEASES API-DISEASES"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n0": [
                        {
                            "id": "MONDO:0005737"
                        }
                    ],
                    "n1": [
                        {
                            "id": "NCBIGene:103089296"
                        }
                    ]
                },
                "edge_bindings": {
                    "e01": [
                        {
                            "id": "MONDO:0005737-NCBIGene:103089296-DISEASES API-DISEASES"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n0": [
                        {
                            "id": "MONDO:0005737"
                        }
                    ],
                    "n1": [
                        {
                            "id": "NCBIGene:100136221"
                        }
                    ]
                },
                "edge_bindings": {
                    "e01": [
                        {
                            "id": "MONDO:0005737-NCBIGene:100136221-DISEASES API-DISEASES"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n0": [
                        {
                            "id": "MONDO:0005737"
                        }
                    ],
                    "n1": [
                        {
                            "id": "NCBIGene:118023076"
                        }
                    ]
                },
                "edge_bindings": {
                    "e01": [
                        {
                            "id": "MONDO:0005737-NCBIGene:118023076-DISEASES API-DISEASES"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n0": [
                        {
                            "id": "MONDO:0005737"
                        }
                    ],
                    "n1": [
                        {
                            "id": "NCBIGene:574217"
                        }
                    ]
                },
                "edge_bindings": {
                    "e01": [
                        {
                            "id": "MONDO:0005737-NCBIGene:574217-DISEASES API-DISEASES"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n0": [
                        {
                            "id": "MONDO:0005737"
                        }
                    ],
                    "n1": [
                        {
                            "id": "UMLS:C1707151"
                        }
                    ]
                },
                "edge_bindings": {
                    "e01": [
                        {
                            "id": "MONDO:0005737-UMLS:C1707151-SEMMED Disease API-SEMMED"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n0": [
                        {
                            "id": "MONDO:0005737"
                        }
                    ],
                    "n1": [
                        {
                            "id": "UMLS:C1707163"
                        }
                    ]
                },
                "edge_bindings": {
                    "e01": [
                        {
                            "id": "MONDO:0005737-UMLS:C1707163-SEMMED Disease API-SEMMED"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n0": [
                        {
                            "id": "MONDO:0005737"
                        }
                    ],
                    "n1": [
                        {
                            "id": "NCBIGene:3601"
                        }
                    ]
                },
                "edge_bindings": {
                    "e01": [
                        {
                            "id": "MONDO:0005737-NCBIGene:3601-SEMMED Disease API-SEMMED"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n0": [
                        {
                            "id": "MONDO:0005737"
                        }
                    ],
                    "n1": [
                        {
                            "id": "NCBIGene:5788"
                        }
                    ]
                },
                "edge_bindings": {
                    "e01": [
                        {
                            "id": "MONDO:0005737-NCBIGene:5788-SEMMED Disease API-SEMMED"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n0": [
                        {
                            "id": "MONDO:0005737"
                        }
                    ],
                    "n1": [
                        {
                            "id": "NCBIGene:8030"
                        }
                    ]
                },
                "edge_bindings": {
                    "e01": [
                        {
                            "id": "MONDO:0005737-NCBIGene:8030-SEMMED Disease API-SEMMED"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n0": [
                        {
                            "id": "MONDO:0005737"
                        }
                    ],
                    "n1": [
                        {
                            "id": "NCBIGene:920"
                        }
                    ]
                },
                "edge_bindings": {
                    "e01": [
                        {
                            "id": "MONDO:0005737-NCBIGene:920-SEMMED Disease API-SEMMED"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n0": [
                        {
                            "id": "MONDO:0005737"
                        }
                    ],
                    "n1": [
                        {
                            "id": "NCBIGene:1514"
                        }
                    ]
                },
                "edge_bindings": {
                    "e01": [
                        {
                            "id": "MONDO:0005737-NCBIGene:1514-SEMMED Disease API-SEMMED"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n0": [
                        {
                            "id": "MONDO:0005737"
                        }
                    ],
                    "n1": [
                        {
                            "id": "UMLS:C1706438"
                        }
                    ]
                },
                "edge_bindings": {
                    "e01": [
                        {
                            "id": "MONDO:0005737-UMLS:C1706438-SEMMED Disease API-SEMMED"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n0": [
                        {
                            "id": "MONDO:0005737"
                        }
                    ],
                    "n1": [
                        {
                            "id": "UMLS:C1367471"
                        }
                    ]
                },
                "edge_bindings": {
                    "e01": [
                        {
                            "id": "MONDO:0005737-UMLS:C1367471-SEMMED Disease API-SEMMED"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n0": [
                        {
                            "id": "MONDO:0005737"
                        }
                    ],
                    "n1": [
                        {
                            "id": "NCBIGene:3439"
                        }
                    ]
                },
                "edge_bindings": {
                    "e01": [
                        {
                            "id": "MONDO:0005737-NCBIGene:3439-SEMMED Disease API-SEMMED"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n0": [
                        {
                            "id": "MONDO:0005737"
                        }
                    ],
                    "n1": [
                        {
                            "id": "UMLS:C1708411"
                        }
                    ]
                },
                "edge_bindings": {
                    "e01": [
                        {
                            "id": "MONDO:0005737-UMLS:C1708411-SEMMED Disease API-SEMMED"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n0": [
                        {
                            "id": "MONDO:0005737"
                        }
                    ],
                    "n1": [
                        {
                            "id": "UMLS:C0017337"
                        }
                    ]
                },
                "edge_bindings": {
                    "e01": [
                        {
                            "id": "MONDO:0005737-UMLS:C0017337-SEMMED Disease API-SEMMED"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n0": [
                        {
                            "id": "MONDO:0005737"
                        }
                    ],
                    "n1": [
                        {
                            "id": "UMLS:C1335439"
                        }
                    ]
                },
                "edge_bindings": {
                    "e01": [
                        {
                            "id": "MONDO:0005737-UMLS:C1335439-SEMMED Disease API-SEMMED"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n0": [
                        {
                            "id": "MONDO:0005737"
                        }
                    ],
                    "n1": [
                        {
                            "id": "NCBIGene:3557"
                        }
                    ]
                },
                "edge_bindings": {
                    "e01": [
                        {
                            "id": "MONDO:0005737-NCBIGene:3557-SEMMED Disease API-SEMMED"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n0": [
                        {
                            "id": "MONDO:0005737"
                        }
                    ],
                    "n1": [
                        {
                            "id": "UMLS:C1705770"
                        }
                    ]
                },
                "edge_bindings": {
                    "e01": [
                        {
                            "id": "MONDO:0005737-UMLS:C1705770-SEMMED Disease API-SEMMED"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n0": [
                        {
                            "id": "MONDO:0005737"
                        }
                    ],
                    "n1": [
                        {
                            "id": "UMLS:C1707163"
                        }
                    ]
                },
                "edge_bindings": {
                    "e01": [
                        {
                            "id": "MONDO:0005737-UMLS:C1707163-SEMMED Disease API-SEMMED"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n0": [
                        {
                            "id": "MONDO:0005737"
                        }
                    ],
                    "n1": [
                        {
                            "id": "NCBIGene:1520"
                        }
                    ]
                },
                "edge_bindings": {
                    "e01": [
                        {
                            "id": "MONDO:0005737-NCBIGene:1520-SEMMED Disease API-SEMMED"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n0": [
                        {
                            "id": "MONDO:0005737"
                        }
                    ],
                    "n1": [
                        {
                            "id": "NCBIGene:3439"
                        }
                    ]
                },
                "edge_bindings": {
                    "e01": [
                        {
                            "id": "MONDO:0005737-NCBIGene:3439-SEMMED Disease API-SEMMED"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n0": [
                        {
                            "id": "MONDO:0005737"
                        }
                    ],
                    "n1": [
                        {
                            "id": "NCBIGene:3557"
                        }
                    ]
                },
                "edge_bindings": {
                    "e01": [
                        {
                            "id": "MONDO:0005737-NCBIGene:3557-SEMMED Disease API-SEMMED"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n0": [
                        {
                            "id": "MONDO:0005737"
                        }
                    ],
                    "n1": [
                        {
                            "id": "NCBIGene:3806"
                        }
                    ]
                },
                "edge_bindings": {
                    "e01": [
                        {
                            "id": "MONDO:0005737-NCBIGene:3806-SEMMED Disease API-SEMMED"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n0": [
                        {
                            "id": "MONDO:0005737"
                        }
                    ],
                    "n1": [
                        {
                            "id": "NCBIGene:3808"
                        }
                    ]
                },
                "edge_bindings": {
                    "e01": [
                        {
                            "id": "MONDO:0005737-NCBIGene:3808-SEMMED Disease API-SEMMED"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n0": [
                        {
                            "id": "MONDO:0005737"
                        }
                    ],
                    "n1": [
                        {
                            "id": "UMLS:C1705846"
                        }
                    ]
                },
                "edge_bindings": {
                    "e01": [
                        {
                            "id": "MONDO:0005737-UMLS:C1705846-SEMMED Disease API-SEMMED"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n0": [
                        {
                            "id": "MONDO:0005737"
                        }
                    ],
                    "n1": [
                        {
                            "id": "NCBIGene:558"
                        }
                    ]
                },
                "edge_bindings": {
                    "e01": [
                        {
                            "id": "MONDO:0005737-NCBIGene:558-SEMMED Disease API-SEMMED"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n0": [
                        {
                            "id": "MONDO:0005737"
                        }
                    ],
                    "n1": [
                        {
                            "id": "UMLS:C1705742"
                        }
                    ]
                },
                "edge_bindings": {
                    "e01": [
                        {
                            "id": "MONDO:0005737-UMLS:C1705742-SEMMED Disease API-SEMMED"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n0": [
                        {
                            "id": "MONDO:0005737"
                        }
                    ],
                    "n1": [
                        {
                            "id": "UMLS:C0007428"
                        }
                    ]
                },
                "edge_bindings": {
                    "e01": [
                        {
                            "id": "MONDO:0005737-UMLS:C0007428-SEMMED Disease API-SEMMED"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n0": [
                        {
                            "id": "MONDO:0005737"
                        }
                    ],
                    "n1": [
                        {
                            "id": "UMLS:C0017428"
                        }
                    ]
                },
                "edge_bindings": {
                    "e01": [
                        {
                            "id": "MONDO:0005737-UMLS:C0017428-SEMMED Disease API-SEMMED"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n0": [
                        {
                            "id": "MONDO:0005737"
                        }
                    ],
                    "n1": [
                        {
                            "id": "UMLS:C0031727"
                        }
                    ]
                },
                "edge_bindings": {
                    "e01": [
                        {
                            "id": "MONDO:0005737-UMLS:C0031727-SEMMED Disease API-SEMMED"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n0": [
                        {
                            "id": "MONDO:0005737"
                        }
                    ],
                    "n1": [
                        {
                            "id": "NCBIGene:1514"
                        }
                    ]
                },
                "edge_bindings": {
                    "e01": [
                        {
                            "id": "MONDO:0005737-NCBIGene:1514-SEMMED Disease API-SEMMED"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n0": [
                        {
                            "id": "MONDO:0005737"
                        }
                    ],
                    "n1": [
                        {
                            "id": "UMLS:C0298973"
                        }
                    ]
                },
                "edge_bindings": {
                    "e01": [
                        {
                            "id": "MONDO:0005737-UMLS:C0298973-SEMMED Disease API-SEMMED"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n0": [
                        {
                            "id": "MONDO:0005737"
                        }
                    ],
                    "n1": [
                        {
                            "id": "UMLS:C0389995"
                        }
                    ]
                },
                "edge_bindings": {
                    "e01": [
                        {
                            "id": "MONDO:0005737-UMLS:C0389995-SEMMED Disease API-SEMMED"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n0": [
                        {
                            "id": "MONDO:0005737"
                        }
                    ],
                    "n1": [
                        {
                            "id": "UMLS:C0699919"
                        }
                    ]
                },
                "edge_bindings": {
                    "e01": [
                        {
                            "id": "MONDO:0005737-UMLS:C0699919-SEMMED Disease API-SEMMED"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n0": [
                        {
                            "id": "MONDO:0005737"
                        }
                    ],
                    "n1": [
                        {
                            "id": "UMLS:C1136352"
                        }
                    ]
                },
                "edge_bindings": {
                    "e01": [
                        {
                            "id": "MONDO:0005737-UMLS:C1136352-SEMMED Disease API-SEMMED"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n0": [
                        {
                            "id": "MONDO:0005737"
                        }
                    ],
                    "n1": [
                        {
                            "id": "UMLS:C1704867"
                        }
                    ]
                },
                "edge_bindings": {
                    "e01": [
                        {
                            "id": "MONDO:0005737-UMLS:C1704867-SEMMED Disease API-SEMMED"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n0": [
                        {
                            "id": "MONDO:0005737"
                        }
                    ],
                    "n1": [
                        {
                            "id": "UMLS:C1705766"
                        }
                    ]
                },
                "edge_bindings": {
                    "e01": [
                        {
                            "id": "MONDO:0005737-UMLS:C1705766-SEMMED Disease API-SEMMED"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n0": [
                        {
                            "id": "MONDO:0005737"
                        }
                    ],
                    "n1": [
                        {
                            "id": "NCBIGene:4864"
                        }
                    ]
                },
                "edge_bindings": {
                    "e01": [
                        {
                            "id": "MONDO:0005737-NCBIGene:4864-SEMMED Disease API-SEMMED"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n0": [
                        {
                            "id": "MONDO:0005737"
                        }
                    ],
                    "n1": [
                        {
                            "id": "UMLS:C1704661"
                        }
                    ]
                },
                "edge_bindings": {
                    "e01": [
                        {
                            "id": "MONDO:0005737-UMLS:C1704661-SEMMED Disease API-SEMMED"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n0": [
                        {
                            "id": "MONDO:0005737"
                        }
                    ],
                    "n1": [
                        {
                            "id": "UMLS:C1704799"
                        }
                    ]
                },
                "edge_bindings": {
                    "e01": [
                        {
                            "id": "MONDO:0005737-UMLS:C1704799-SEMMED Disease API-SEMMED"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n0": [
                        {
                            "id": "MONDO:0005737"
                        }
                    ],
                    "n1": [
                        {
                            "id": "UMLS:C2985367"
                        }
                    ]
                },
                "edge_bindings": {
                    "e01": [
                        {
                            "id": "MONDO:0005737-UMLS:C2985367-SEMMED Disease API-SEMMED"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n0": [
                        {
                            "id": "MONDO:0005737"
                        }
                    ],
                    "n1": [
                        {
                            "id": "UMLS:C1705581"
                        }
                    ]
                },
                "edge_bindings": {
                    "e01": [
                        {
                            "id": "MONDO:0005737-UMLS:C1705581-SEMMED Disease API-SEMMED"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n0": [
                        {
                            "id": "MONDO:0005737"
                        }
                    ],
                    "n1": [
                        {
                            "id": "UMLS:C0007428"
                        }
                    ]
                },
                "edge_bindings": {
                    "e01": [
                        {
                            "id": "MONDO:0005737-UMLS:C0007428-SEMMED Disease API-SEMMED"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n0": [
                        {
                            "id": "MONDO:0005737"
                        }
                    ],
                    "n1": [
                        {
                            "id": "UMLS:C0031727"
                        }
                    ]
                },
                "edge_bindings": {
                    "e01": [
                        {
                            "id": "MONDO:0005737-UMLS:C0031727-SEMMED Disease API-SEMMED"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n0": [
                        {
                            "id": "MONDO:0005737"
                        }
                    ],
                    "n1": [
                        {
                            "id": "UMLS:C0044602"
                        }
                    ]
                },
                "edge_bindings": {
                    "e01": [
                        {
                            "id": "MONDO:0005737-UMLS:C0044602-SEMMED Disease API-SEMMED"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n0": [
                        {
                            "id": "MONDO:0005737"
                        }
                    ],
                    "n1": [
                        {
                            "id": "NCBIGene:324"
                        }
                    ]
                },
                "edge_bindings": {
                    "e01": [
                        {
                            "id": "MONDO:0005737-NCBIGene:324-SEMMED Disease API-SEMMED"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n0": [
                        {
                            "id": "MONDO:0005737"
                        }
                    ],
                    "n1": [
                        {
                            "id": "UMLS:C0287990"
                        }
                    ]
                },
                "edge_bindings": {
                    "e01": [
                        {
                            "id": "MONDO:0005737-UMLS:C0287990-SEMMED Disease API-SEMMED"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n0": [
                        {
                            "id": "MONDO:0005737"
                        }
                    ],
                    "n1": [
                        {
                            "id": "UMLS:C0389995"
                        }
                    ]
                },
                "edge_bindings": {
                    "e01": [
                        {
                            "id": "MONDO:0005737-UMLS:C0389995-SEMMED Disease API-SEMMED"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n0": [
                        {
                            "id": "MONDO:0005737"
                        }
                    ],
                    "n1": [
                        {
                            "id": "UMLS:C0752243"
                        }
                    ]
                },
                "edge_bindings": {
                    "e01": [
                        {
                            "id": "MONDO:0005737-UMLS:C0752243-SEMMED Disease API-SEMMED"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n1": [
                        {
                            "id": "NCBIGene:116534309"
                        }
                    ],
                    "n2": [
                        {
                            "id": "DRUGBANK:DB06241"
                        }
                    ]
                },
                "edge_bindings": {
                    "e02": [
                        {
                            "id": "NCBIGene:116534309-DRUGBANK:DB06241-MyChem.info API-drugbank"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n1": [
                        {
                            "id": "NCBIGene:116534309"
                        }
                    ],
                    "n2": [
                        {
                            "id": "DRUGBANK:DB12698"
                        }
                    ]
                },
                "edge_bindings": {
                    "e02": [
                        {
                            "id": "NCBIGene:116534309-DRUGBANK:DB12698-MyChem.info API-drugbank"
                        }
                    ]
                }
            },
            {
                "node_bindings": {
                    "n1": [
                        {
                            "id": "NCBIGene:116534309"
                        }
                    ],
                    "n2": [
                        {
                            "id": "DRUGBANK:DB00098"
                        }
                    ]
                },
                "edge_bindings": {
                    "e02": [
                        {
                            "id": "NCBIGene:116534309-DRUGBANK:DB00098-MyChem.info API-drugbank"
                        }
                    ]
                }
            }
        ]
    },
    "logs": [
        {
            "timestamp": "2021-03-15T22:54:01.080Z",
            "level": "DEBUG",
            "message": "BTE identified 3 QNodes from your query graph",
            "code": null
        },
        {
            "timestamp": "2021-03-15T22:54:01.080Z",
            "level": "DEBUG",
            "message": "BTE identified 2 QEdges from your query graph",
            "code": null
        },
        {
            "timestamp": "2021-03-15T22:54:01.080Z",
            "level": "DEBUG",
            "message": "BTE identified your query graph as a 2-depth query graph",
            "code": null
        },
        {
            "timestamp": "2021-03-15T22:54:01.080Z",
            "level": "DEBUG",
            "message": "REDIS cache is not enabled.",
            "code": null
        },
        {
            "timestamp": "2021-03-15T22:54:01.160Z",
            "level": "DEBUG",
            "message": "BTE found 23 smartapi edges corresponding to e01. These smartaip edges comes from 7 unique APIs. They are MyDisease.info API,MGIgene2phenotype API,DISEASES API,SEMMED Disease API,Text Mining CO-OCCURRENCE API,TCGA Mutation Frequency KP API,BioLink API",
            "code": null
        },
        {
            "timestamp": "2021-03-15T22:54:01.297Z",
            "level": "DEBUG",
            "message": "BTE found 23 bte edges for this batch.",
            "code": null
        },
        {
            "timestamp": "2021-03-15T22:54:01.297Z",
            "level": "DEBUG",
            "message": "call-apis: Resolving ID feature is turned on",
            "code": null
        },
        {
            "timestamp": "2021-03-15T22:54:01.297Z",
            "level": "DEBUG",
            "message": "call-apis: Number of BTE Edges received is 23",
            "code": null
        },
        {
            "timestamp": "2021-03-15T22:54:01.321Z",
            "level": "DEBUG",
            "message": "call-apis: Succesfully made the following query: {\"url\":\"http://mydisease.info/v1/query\",\"params\":{\"fields\":\"disgenet.genes_related_to_disease\"},\"data\":\"q=C0282687&scopes=mondo.xrefs.umls, disgenet.xrefs.umls\",\"method\":\"post\",\"timeout\":50000}",
            "code": null
        },
        {
            "timestamp": "2021-03-15T22:54:01.325Z",
            "level": "DEBUG",
            "message": "call-apis: After transformation, BTE is able to retrieve 0 hits!",
            "code": null
        },
        {
            "timestamp": "2021-03-15T22:54:01.388Z",
            "level": "DEBUG",
            "message": "call-apis: Succesfully made the following query: {\"url\":\"https://biothings.ncats.io/DISEASES/query\",\"params\":{\"fields\":\"DISEASES.associatedWith\"},\"data\":\"q=DOID:4325&scopes=DISEASES.doid\",\"method\":\"post\",\"timeout\":50000}",
            "code": null
        },
        {
            "timestamp": "2021-03-15T22:54:01.397Z",
            "level": "DEBUG",
            "message": "call-apis: After transformation, BTE is able to retrieve 42 hits!",
            "code": null
        },
        {
            "timestamp": "2021-03-15T22:54:01.398Z",
            "level": "DEBUG",
            "message": "call-apis: Succesfully made the following query: {\"url\":\"https://biothings.ncats.io/text_mining_co_occurrence_kp/query\",\"params\":{\"fields\":\"subject,association\",\"q\":\"object.MONDO:\\\"MONDO:0005737\\\" AND subject.type:Gene\",\"size\":1000},\"method\":\"get\",\"timeout\":50000}",
            "code": null
        },
        {
            "timestamp": "2021-03-15T22:54:01.398Z",
            "level": "DEBUG",
            "message": "call-apis: After transformation, BTE is able to retrieve 0 hits!",
            "code": null
        },
        {
            "timestamp": "2021-03-15T22:54:01.398Z",
            "level": "DEBUG",
            "message": "call-apis: Succesfully made the following query: {\"url\":\"https://biothings.ncats.io/mgigene2phenotype/query\",\"params\":{\"fields\":\"_id\",\"size\":\"300\"},\"data\":\"q=DOID:4325&scopes=mgi.associated_with_disease.doid\",\"method\":\"post\",\"timeout\":50000}",
            "code": null
        },
        {
            "timestamp": "2021-03-15T22:54:01.398Z",
            "level": "DEBUG",
            "message": "call-apis: After transformation, BTE is able to retrieve 0 hits!",
            "code": null
        },
        {
            "timestamp": "2021-03-15T22:54:01.399Z",
            "level": "DEBUG",
            "message": "call-apis: Succesfully made the following query: {\"url\":\"https://biothings.ncats.io/tcga_mut_freq_kp/query\",\"params\":{\"fields\":\"association.freq_by_sample,subject.SYMBOL\",\"q\":\"object.id:\\\"MONDO:0005737\\\" AND association.freq_by_sample:>0.1\",\"size\":\"1000\",\"sort\":\"-association.freq_by_sample\"},\"method\":\"get\",\"timeout\":50000}",
            "code": null
        },
        {
            "timestamp": "2021-03-15T22:54:01.399Z",
            "level": "DEBUG",
            "message": "call-apis: After transformation, BTE is able to retrieve 0 hits!",
            "code": null
        },
        {
            "timestamp": "2021-03-15T22:54:01.399Z",
            "level": "DEBUG",
            "message": "call-apis: Succesfully made the following query: {\"url\":\"https://biothings.ncats.io/semmed/query\",\"params\":{\"fields\":\"caused_by\"},\"data\":\"q=C0282687&scopes=umls\",\"method\":\"post\",\"timeout\":50000}",
            "code": null
        },
        {
            "timestamp": "2021-03-15T22:54:01.400Z",
            "level": "DEBUG",
            "message": "call-apis: After transformation, BTE is able to retrieve 2 hits!",
            "code": null
        },
        {
            "timestamp": "2021-03-15T22:54:01.400Z",
            "level": "DEBUG",
            "message": "call-apis: Succesfully made the following query: {\"url\":\"https://biothings.ncats.io/semmed/query\",\"params\":{\"fields\":\"affected_by\"},\"data\":\"q=C0282687&scopes=umls\",\"method\":\"post\",\"timeout\":50000}",
            "code": null
        },
        {
            "timestamp": "2021-03-15T22:54:01.400Z",
            "level": "DEBUG",
            "message": "call-apis: After transformation, BTE is able to retrieve 7 hits!",
            "code": null
        },
        {
            "timestamp": "2021-03-15T22:54:01.401Z",
            "level": "DEBUG",
            "message": "call-apis: Succesfully made the following query: {\"url\":\"https://biothings.ncats.io/semmed/query\",\"params\":{\"fields\":\"affects\"},\"data\":\"q=C0282687&scopes=umls\",\"method\":\"post\",\"timeout\":50000}",
            "code": null
        },
        {
            "timestamp": "2021-03-15T22:54:01.401Z",
            "level": "DEBUG",
            "message": "call-apis: After transformation, BTE is able to retrieve 0 hits!",
            "code": null
        },
        {
            "timestamp": "2021-03-15T22:54:01.439Z",
            "level": "DEBUG",
            "message": "call-apis: Succesfully made the following query: {\"url\":\"https://biothings.ncats.io/text_mining_co_occurrence_kp/query\",\"params\":{\"fields\":\"object,association\",\"q\":\"subject.MONDO:\\\"MONDO:0005737\\\" AND object.type:Gene\",\"size\":1000},\"method\":\"get\",\"timeout\":50000}",
            "code": null
        },
        {
            "timestamp": "2021-03-15T22:54:01.628Z",
            "level": "DEBUG",
            "message": "call-apis: After transformation, BTE is able to retrieve 0 hits!",
            "code": null
        },
        {
            "timestamp": "2021-03-15T22:54:01.706Z",
            "level": "DEBUG",
            "message": "call-apis: Succesfully made the following query: {\"url\":\"https://api.monarchinitiative.org/api/bioentity/disease/MONDO:0005737/genes\",\"params\":{\"direct\":true,\"rows\":200,\"unselect_evidence\":true},\"method\":\"get\",\"timeout\":50000}",
            "code": null
        },
        {
            "timestamp": "2021-03-15T22:54:01.707Z",
            "level": "DEBUG",
            "message": "call-apis: After transformation, BTE is able to retrieve 0 hits!",
            "code": null
        },
        {
            "timestamp": "2021-03-15T22:54:01.709Z",
            "level": "DEBUG",
            "message": "call-apis: Succesfully made the following query: {\"url\":\"https://api.monarchinitiative.org/api/bioentity/disease/MONDO:0005737/genes\",\"params\":{\"direct\":true,\"rows\":200,\"unselect_evidence\":true},\"method\":\"get\",\"timeout\":50000}",
            "code": null
        },
        {
            "timestamp": "2021-03-15T22:54:01.709Z",
            "level": "DEBUG",
            "message": "call-apis: After transformation, BTE is able to retrieve 0 hits!",
            "code": null
        },
        {
            "timestamp": "2021-03-15T22:54:01.722Z",
            "level": "DEBUG",
            "message": "call-apis: Succesfully made the following query: {\"url\":\"https://biothings.ncats.io/semmed/query\",\"params\":{\"fields\":\"derives_from\"},\"data\":\"q=C0282687&scopes=umls\",\"method\":\"post\",\"timeout\":50000}",
            "code": null
        },
        {
            "timestamp": "2021-03-15T22:54:01.722Z",
            "level": "DEBUG",
            "message": "call-apis: After transformation, BTE is able to retrieve 0 hits!",
            "code": null
        },
        {
            "timestamp": "2021-03-15T22:54:01.723Z",
            "level": "DEBUG",
            "message": "call-apis: Succesfully made the following query: {\"url\":\"https://biothings.ncats.io/semmed/query\",\"params\":{\"fields\":\"disrupted_by\"},\"data\":\"q=C0282687&scopes=umls\",\"method\":\"post\",\"timeout\":50000}",
            "code": null
        },
        {
            "timestamp": "2021-03-15T22:54:01.723Z",
            "level": "DEBUG",
            "message": "call-apis: After transformation, BTE is able to retrieve 4 hits!",
            "code": null
        },
        {
            "timestamp": "2021-03-15T22:54:01.724Z",
            "level": "DEBUG",
            "message": "call-apis: Succesfully made the following query: {\"url\":\"https://biothings.ncats.io/semmed/query\",\"params\":{\"fields\":\"coexists_with\"},\"data\":\"q=C0282687&scopes=umls\",\"method\":\"post\",\"timeout\":50000}",
            "code": null
        },
        {
            "timestamp": "2021-03-15T22:54:01.724Z",
            "level": "DEBUG",
            "message": "call-apis: After transformation, BTE is able to retrieve 0 hits!",
            "code": null
        },
        {
            "timestamp": "2021-03-15T22:54:01.736Z",
            "level": "DEBUG",
            "message": "call-apis: Succesfully made the following query: {\"url\":\"https://biothings.ncats.io/semmed/query\",\"params\":{\"fields\":\"negatively_regulates\"},\"data\":\"q=C0282687&scopes=umls\",\"method\":\"post\",\"timeout\":50000}",
            "code": null
        },
        {
            "timestamp": "2021-03-15T22:54:01.736Z",
            "level": "DEBUG",
            "message": "call-apis: After transformation, BTE is able to retrieve 0 hits!",
            "code": null
        },
        {
            "timestamp": "2021-03-15T22:54:01.737Z",
            "level": "DEBUG",
            "message": "call-apis: Succesfully made the following query: {\"url\":\"https://biothings.ncats.io/semmed/query\",\"params\":{\"fields\":\"negatively_regulated_by\"},\"data\":\"q=C0282687&scopes=umls\",\"method\":\"post\",\"timeout\":50000}",
            "code": null
        },
        {
            "timestamp": "2021-03-15T22:54:01.737Z",
            "level": "DEBUG",
            "message": "call-apis: After transformation, BTE is able to retrieve 0 hits!",
            "code": null
        },
        {
            "timestamp": "2021-03-15T22:54:01.737Z",
            "level": "DEBUG",
            "message": "call-apis: Succesfully made the following query: {\"url\":\"https://biothings.ncats.io/semmed/query\",\"params\":{\"fields\":\"disrupts\"},\"data\":\"q=C0282687&scopes=umls\",\"method\":\"post\",\"timeout\":50000}",
            "code": null
        },
        {
            "timestamp": "2021-03-15T22:54:01.737Z",
            "level": "DEBUG",
            "message": "call-apis: After transformation, BTE is able to retrieve 0 hits!",
            "code": null
        },
        {
            "timestamp": "2021-03-15T22:54:01.749Z",
            "level": "DEBUG",
            "message": "call-apis: Succesfully made the following query: {\"url\":\"https://biothings.ncats.io/semmed/query\",\"params\":{\"fields\":\"physically_interacts_with\"},\"data\":\"q=C0282687&scopes=umls\",\"method\":\"post\",\"timeout\":50000}",
            "code": null
        },
        {
            "timestamp": "2021-03-15T22:54:01.749Z",
            "level": "DEBUG",
            "message": "call-apis: After transformation, BTE is able to retrieve 0 hits!",
            "code": null
        },
        {
            "timestamp": "2021-03-15T22:54:01.750Z",
            "level": "DEBUG",
            "message": "call-apis: Succesfully made the following query: {\"url\":\"https://biothings.ncats.io/semmed/query\",\"params\":{\"fields\":\"positively_regulates\"},\"data\":\"q=C0282687&scopes=umls\",\"method\":\"post\",\"timeout\":50000}",
            "code": null
        },
        {
            "timestamp": "2021-03-15T22:54:01.750Z",
            "level": "DEBUG",
            "message": "call-apis: After transformation, BTE is able to retrieve 0 hits!",
            "code": null
        },
        {
            "timestamp": "2021-03-15T22:54:01.750Z",
            "level": "DEBUG",
            "message": "call-apis: Succesfully made the following query: {\"url\":\"https://biothings.ncats.io/semmed/query\",\"params\":{\"fields\":\"positively_regulated_by\"},\"data\":\"q=C0282687&scopes=umls\",\"method\":\"post\",\"timeout\":50000}",
            "code": null
        },
        {
            "timestamp": "2021-03-15T22:54:01.750Z",
            "level": "DEBUG",
            "message": "call-apis: After transformation, BTE is able to retrieve 0 hits!",
            "code": null
        },
        {
            "timestamp": "2021-03-15T22:54:01.762Z",
            "level": "DEBUG",
            "message": "call-apis: Succesfully made the following query: {\"url\":\"https://biothings.ncats.io/semmed/query\",\"params\":{\"fields\":\"related_to\"},\"data\":\"q=C0282687&scopes=umls\",\"method\":\"post\",\"timeout\":50000}",
            "code": null
        },
        {
            "timestamp": "2021-03-15T22:54:01.763Z",
            "level": "DEBUG",
            "message": "call-apis: After transformation, BTE is able to retrieve 18 hits!",
            "code": null
        },
        {
            "timestamp": "2021-03-15T22:54:01.763Z",
            "level": "DEBUG",
            "message": "call-apis: Succesfully made the following query: {\"url\":\"https://biothings.ncats.io/semmed/query\",\"params\":{\"fields\":\"prevented_by\"},\"data\":\"q=C0282687&scopes=umls\",\"method\":\"post\",\"timeout\":50000}",
            "code": null
        },
        {
            "timestamp": "2021-03-15T22:54:01.763Z",
            "level": "DEBUG",
            "message": "call-apis: After transformation, BTE is able to retrieve 1 hits!",
            "code": null
        },
        {
            "timestamp": "2021-03-15T22:54:01.764Z",
            "level": "DEBUG",
            "message": "call-apis: Succesfully made the following query: {\"url\":\"https://biothings.ncats.io/semmed/query\",\"params\":{\"fields\":\"treated_by\"},\"data\":\"q=C0282687&scopes=umls\",\"method\":\"post\",\"timeout\":50000}",
            "code": null
        },
        {
            "timestamp": "2021-03-15T22:54:01.765Z",
            "level": "DEBUG",
            "message": "call-apis: After transformation, BTE is able to retrieve 14 hits!",
            "code": null
        },
        {
            "timestamp": "2021-03-15T22:54:01.765Z",
            "level": "DEBUG",
            "message": "call-apis: Total number of results returned for this query is 88",
            "code": null
        },
        {
            "timestamp": "2021-03-15T22:54:01.974Z",
            "level": "DEBUG",
            "message": "call-apis: Query completes",
            "code": null
        },
        {
            "timestamp": "2021-03-15T22:54:01.978Z",
            "level": "DEBUG",
            "message": "REDIS cache is not enabled.",
            "code": null
        },
        {
            "timestamp": "2021-03-15T22:54:01.997Z",
            "level": "DEBUG",
            "message": "BTE found 20 smartapi edges corresponding to e02. These smartaip edges comes from 7 unique APIs. They are OpenTarget API,MyChem.info API,SEMMED Gene API,BioThings DGIdb API,Text Mining Targeted Association API,Text Mining CO-OCCURRENCE API,Drug Response KP API",
            "code": null
        },
        {
            "timestamp": "2021-03-15T22:54:02.041Z",
            "level": "DEBUG",
            "message": "BTE found 7 bte edges for this batch.",
            "code": null
        },
        {
            "timestamp": "2021-03-15T22:54:02.041Z",
            "level": "DEBUG",
            "message": "call-apis: Resolving ID feature is turned on",
            "code": null
        },
        {
            "timestamp": "2021-03-15T22:54:02.041Z",
            "level": "DEBUG",
            "message": "call-apis: Number of BTE Edges received is 7",
            "code": null
        },
        {
            "timestamp": "2021-03-15T22:54:02.102Z",
            "level": "DEBUG",
            "message": "call-apis: Succesfully made the following query: {\"url\":\"https://biothings.ncats.io/text_mining_co_occurrence_kp/query\",\"params\":{\"fields\":\"subject,association\",\"q\":\"object.NCBIGene:\\\"116534309\\\" AND subject.type:ChemicalSubstance\",\"size\":1000},\"method\":\"get\",\"timeout\":50000}",
            "code": null
        },
        {
            "timestamp": "2021-03-15T22:54:02.102Z",
            "level": "DEBUG",
            "message": "call-apis: After transformation, BTE is able to retrieve 0 hits!",
            "code": null
        },
        {
            "timestamp": "2021-03-15T22:54:02.103Z",
            "level": "DEBUG",
            "message": "call-apis: Succesfully made the following query: {\"url\":\"https://biothings.ncats.io/text_mining_co_occurrence_kp/query\",\"params\":{\"fields\":\"object,association\",\"q\":\"subject.NCBIGene:\\\"116534309\\\" AND object.type:ChemicalSubstance\",\"size\":1000},\"method\":\"get\",\"timeout\":50000}",
            "code": null
        },
        {
            "timestamp": "2021-03-15T22:54:02.103Z",
            "level": "DEBUG",
            "message": "call-apis: After transformation, BTE is able to retrieve 0 hits!",
            "code": null
        },
        {
            "timestamp": "2021-03-15T22:54:02.104Z",
            "level": "DEBUG",
            "message": "call-apis: Succesfully made the following query: {\"url\":\"https://biothings.ncats.io/dgidb/query\",\"params\":{\"fields\":\"object.CHEMBL_COMPOUND,association.provided_by,association.pubmed\",\"size\":1000},\"data\":\"q=116534309&scopes=subject.NCBIGene\",\"method\":\"post\",\"timeout\":50000}",
            "code": null
        },
        {
            "timestamp": "2021-03-15T22:54:02.104Z",
            "level": "DEBUG",
            "message": "call-apis: After transformation, BTE is able to retrieve 0 hits!",
            "code": null
        },
        {
            "timestamp": "2021-03-15T22:54:02.104Z",
            "level": "DEBUG",
            "message": "call-apis: Succesfully made the following query: {\"url\":\"https://biothings.ncats.io/drug_response_kp/query\",\"params\":{\"fields\":\"association.context.disease.mondo,object.PUBCHEM,association.effect_size,association.pvalue\",\"q\":\"subject.NCBIGene:116534309 AND association.effect_size:<0 AND association.pvalue:<0.05\",\"size\":\"1000\",\"sort\":\"association.pvalue\"},\"method\":\"get\",\"timeout\":50000}",
            "code": null
        },
        {
            "timestamp": "2021-03-15T22:54:02.104Z",
            "level": "DEBUG",
            "message": "call-apis: After transformation, BTE is able to retrieve 0 hits!",
            "code": null
        },
        {
            "timestamp": "2021-03-15T22:54:02.109Z",
            "level": "DEBUG",
            "message": "call-apis: Succesfully made the following query: {\"url\":\"https://mychem.info/v1/query\",\"params\":{\"fields\":\"chembl.molecule_chembl_id\",\"size\":\"250\"},\"data\":\"q=CD4&scopes=drugcentral.bioactivity.uniprot.gene_symbol\",\"method\":\"post\",\"timeout\":50000}",
            "code": null
        },
        {
            "timestamp": "2021-03-15T22:54:02.109Z",
            "level": "DEBUG",
            "message": "call-apis: After transformation, BTE is able to retrieve 0 hits!",
            "code": null
        },
        {
            "timestamp": "2021-03-15T22:54:02.110Z",
            "level": "DEBUG",
            "message": "call-apis: Succesfully made the following query: {\"url\":\"https://mychem.info/v1/query\",\"params\":{\"fields\":\"drugbank.id\",\"size\":\"250\"},\"data\":\"q=CD4&scopes=drugbank.targets.gene_name\",\"method\":\"post\",\"timeout\":50000}",
            "code": null
        },
        {
            "timestamp": "2021-03-15T22:54:02.110Z",
            "level": "DEBUG",
            "message": "call-apis: After transformation, BTE is able to retrieve 3 hits!",
            "code": null
        },
        {
            "timestamp": "2021-03-15T22:54:02.112Z",
            "level": "DEBUG",
            "message": "call-apis: Succesfully made the following query: {\"url\":\"https://mychem.info/v1/query\",\"params\":{\"fields\":\"drugbank.id\",\"size\":\"250\"},\"data\":\"q=CD4&scopes=drugbank.enzymes.gene_name\",\"method\":\"post\",\"timeout\":50000}",
            "code": null
        },
        {
            "timestamp": "2021-03-15T22:54:02.112Z",
            "level": "DEBUG",
            "message": "call-apis: After transformation, BTE is able to retrieve 0 hits!",
            "code": null
        },
        {
            "timestamp": "2021-03-15T22:54:02.112Z",
            "level": "DEBUG",
            "message": "call-apis: Total number of results returned for this query is 3",
            "code": null
        },
        {
            "timestamp": "2021-03-15T22:54:02.181Z",
            "level": "DEBUG",
            "message": "call-apis: Query completes",
            "code": null
        }
    ]
}

Making a branched query

const handler = require("@biothings-explorer/query_graph_handler");
const queryHandler = new handler.TRAPIQueryHandler();
const branchedQuery = {
    "workflow": [
        {"id": "lookup"}
    ],
    "message": {
        "query_graph": {
            "nodes": {
                "n0": {
                    "categories": ["biolink:Disease"],
                    "ids": ["MONDO:0005737"]
                },
                "n1": {
                    "categories": ["biolink:Gene"]
                },
                "n2": {
                    "categories": ["biolink:SmallMolecule"]
                }
            },
            "edges": {
                "e01": {
                    "subject": "n0",
                    "object": "n1"
                },
                "e02": {
                    "subject": "n0",
                    "object": "n2"
                }
            }
        }
    }
}
queryHandler.setQueryGraph(branchedQuery);
await queryHandler.query();
console.log(queryHandler.getResponse())
Example Result
{
    "workflow": [
        {"id": "lookup"}
    ],
    "message": {
        "query_graph": {
            "nodes": {
                "n0": {
                    "category": "biolink:Disease",
                    "id": "MONDO:0005737"
                },
                "n1": {
                    "category": "biolink:Gene"
                },
                "n2": {
                    "category": "biolink:ChemicalSubstance"
                }
            },
            "edges": {
                "e01": {
                    "subject": "n0",
                    "object": "n1"
                },
                "e02": {
                    "subject": "n0",
                    "object": "n2"
                }
            }
        },
        "knowledge_graph": {
            "nodes": {
                "MONDO:0005737": {
                    "category": "biolink:Disease",
                    "name": "Ebola hemorrhagic fever",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "MONDO:0005737",
                                "DOID:4325",
                                "UMLS:C0282687",
                                "name:Ebola hemorrhagic fever",
                                "MESH:D019142",
                                "EFO:0007243",
                                "ORPHANET:319218",
                                "GARD:2035"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:116534309": {
                    "category": "biolink:Gene",
                    "name": "CD4",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:116534309",
                                "name:CD4 molecule",
                                "SYMBOL:CD4"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:539109": {
                    "category": "biolink:Gene",
                    "name": "MMP11",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:539109",
                                "name:matrix metallopeptidase 11",
                                "SYMBOL:MMP11",
                                "ENSEMBL:ENSBTAG00000006108"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:102448557": {
                    "category": "biolink:Gene",
                    "name": "GTPBP1",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:102448557",
                                "name:GTP binding protein 1",
                                "SYMBOL:GTPBP1",
                                "ENSEMBL:ENSPSIG00000004300"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:103074707": {
                    "category": "biolink:Gene",
                    "name": "CCL2",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:103074707",
                                "name:C-C motif chemokine ligand 2",
                                "SYMBOL:CCL2"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "ENSEMBL:ENSSPUG00000015633": {
                    "category": "biolink:Gene",
                    "name": "MAPRE3",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "name:microtubule associated protein RP/EB family member 3",
                                "SYMBOL:MAPRE3",
                                "ENSEMBL:ENSSPUG00000015633"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:115865406": {
                    "category": "biolink:Gene",
                    "name": "BST2",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:115865406",
                                "name:bone marrow stromal cell antigen 2",
                                "SYMBOL:BST2"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:110132571": {
                    "category": "biolink:Gene",
                    "name": "IL1B",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:110132571",
                                "name:interleukin 1 beta",
                                "SYMBOL:IL1B"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:101571570": {
                    "category": "biolink:Gene",
                    "name": "Ifih1",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:101571570",
                                "name:interferon induced with helicase C domain 1",
                                "SYMBOL:Ifih1",
                                "ENSEMBL:ENSODEG00000013586"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "ENSEMBL:ENSSMAG00000017984": {
                    "category": "biolink:Gene",
                    "name": "npc1",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "name:Niemann-Pick disease, type C1",
                                "SYMBOL:npc1",
                                "ENSEMBL:ENSSMAG00000017984"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:397686": {
                    "category": "biolink:Gene",
                    "name": "IFNA1",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:397686",
                                "name:interferon, alpha 1",
                                "SYMBOL:IFNA1",
                                "ENSEMBL:ENSSSCG00000050619"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:102892030": {
                    "category": "biolink:Gene",
                    "name": "ALB",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:102892030",
                                "name:albumin",
                                "SYMBOL:ALB"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:104045425": {
                    "category": "biolink:Gene",
                    "name": "HDX",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:104045425",
                                "name:highly divergent homeobox",
                                "SYMBOL:HDX"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:110137949": {
                    "category": "biolink:Gene",
                    "name": "CXCL10",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:110137949",
                                "name:C-X-C motif chemokine ligand 10",
                                "SYMBOL:CXCL10"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:105822820": {
                    "category": "biolink:Gene",
                    "name": "CXCL8",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:105822820",
                                "name:C-X-C motif chemokine ligand 8",
                                "SYMBOL:CXCL8",
                                "ENSEMBL:ENSPCOG00000024593"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:116479423": {
                    "category": "biolink:Gene",
                    "name": "CLEC4M",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:116479423",
                                "name:C-type lectin domain family 4 member M",
                                "SYMBOL:CLEC4M"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:103814882": {
                    "category": "biolink:Gene",
                    "name": "F3",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:103814882",
                                "name:coagulation factor III, tissue factor",
                                "SYMBOL:F3",
                                "ENSEMBL:ENSSCAG00000012591"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:101142722": {
                    "category": "biolink:Gene",
                    "name": "KPNA1",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:101142722",
                                "name:karyopherin subunit alpha 1",
                                "SYMBOL:KPNA1"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:104673720": {
                    "category": "biolink:Gene",
                    "name": "CTSL",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:104673720",
                                "name:cathepsin L",
                                "SYMBOL:CTSL",
                                "ENSEMBL:ENSRROG00000038398"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:116543050": {
                    "category": "biolink:Gene",
                    "name": "CTSB",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:116543050",
                                "name:cathepsin B",
                                "SYMBOL:CTSB"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:29798": {
                    "category": "biolink:Gene",
                    "name": "C2orf27A",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:29798",
                                "name:chromosome 2 open reading frame 27A",
                                "SYMBOL:C2orf27A",
                                "UMLS:C2681192",
                                "HGNC:25077",
                                "UniProtKB:P0DPF5"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:118012204": {
                    "category": "biolink:Gene",
                    "name": "STAT1",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:118012204",
                                "name:signal transducer and activator of transcription 1",
                                "SYMBOL:STAT1"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:101937382": {
                    "category": "biolink:Gene",
                    "name": "KPNA5",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:101937382",
                                "name:karyopherin subunit alpha 5",
                                "SYMBOL:KPNA5"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "ENSEMBL:ENSNVIG00000024389": {
                    "category": "biolink:Gene",
                    "name": "IFIT2",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "name:interferon induced protein with tetratricopeptide repeats 2",
                                "SYMBOL:IFIT2",
                                "ENSEMBL:ENSNVIG00000024389"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:104395366": {
                    "category": "biolink:Gene",
                    "name": "THBD",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:104395366",
                                "name:thrombomodulin",
                                "SYMBOL:THBD"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:100731608": {
                    "category": "biolink:Gene",
                    "name": "Isg15",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:100731608",
                                "name:ISG15 ubiquitin like modifier",
                                "SYMBOL:Isg15"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:108529797": {
                    "category": "biolink:Gene",
                    "name": "DDX58",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:108529797",
                                "name:DExD/H-box helicase 58",
                                "SYMBOL:DDX58",
                                "ENSEMBL:ENSRBIG00000040257"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:106971145": {
                    "category": "biolink:Gene",
                    "name": "IFNB1",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:106971145",
                                "name:interferon beta 1",
                                "SYMBOL:IFNB1"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "ENSEMBL:ENSCJAG00000047270": {
                    "category": "biolink:Gene",
                    "name": "GP2",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "name:glycoprotein 2",
                                "SYMBOL:GP2",
                                "ENSEMBL:ENSCJAG00000047270"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:101443464": {
                    "category": "biolink:Gene",
                    "name": "GPT",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:101443464",
                                "name:glutamic--pyruvic transaminase",
                                "SYMBOL:GPT"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:102387082": {
                    "category": "biolink:Gene",
                    "name": "IRF7",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:102387082",
                                "name:interferon regulatory factor 7",
                                "SYMBOL:IRF7"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:109055884": {
                    "category": "biolink:Gene",
                    "name": "il6",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:109055884",
                                "name:interleukin 6 (interferon, beta 2)",
                                "SYMBOL:il6",
                                "ENSEMBL:ENSCCRG00000034667"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "ENSEMBL:ENSSBOG00000011322": {
                    "category": "biolink:Gene",
                    "name": "CD8A",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "name:CD8a molecule",
                                "SYMBOL:CD8A",
                                "ENSEMBL:ENSSBOG00000011322"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:117759282": {
                    "category": "biolink:Gene",
                    "name": "ace2",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:117759282",
                                "name:angiotensin I converting enzyme 2",
                                "SYMBOL:ace2"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:103562469": {
                    "category": "biolink:Gene",
                    "name": "TNF",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:103562469",
                                "name:tumor necrosis factor",
                                "SYMBOL:TNF"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:112648300": {
                    "category": "biolink:Gene",
                    "name": "IL10",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:112648300",
                                "name:interleukin 10",
                                "SYMBOL:IL10",
                                "ENSEMBL:ENSCAFG00020012434"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:106483620": {
                    "category": "biolink:Gene",
                    "name": "ERVW-1",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:106483620",
                                "name:endogenous retrovirus group W member 1, envelope",
                                "SYMBOL:ERVW-1"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:118335909": {
                    "category": "biolink:Gene",
                    "name": "irf3",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:118335909",
                                "name:interferon regulatory factor 3",
                                "SYMBOL:irf3"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:101674197": {
                    "category": "biolink:Gene",
                    "name": "CCL5",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:101674197",
                                "name:C-C motif chemokine ligand 5",
                                "SYMBOL:CCL5"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:103089296": {
                    "category": "biolink:Gene",
                    "name": "CCL3",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:103089296",
                                "name:C-C motif chemokine ligand 3",
                                "SYMBOL:CCL3"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "ENSEMBL:MGP_SPRETEiJ_G0017727": {
                    "category": "biolink:Gene",
                    "name": "Ccl4",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "name:chemokine (C-C motif) ligand 4",
                                "SYMBOL:Ccl4",
                                "ENSEMBL:MGP_SPRETEiJ_G0017727"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:101998427": {
                    "category": "biolink:Gene",
                    "name": "Furin",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:101998427",
                                "name:furin, paired basic amino acid cleaving enzyme",
                                "SYMBOL:Furin",
                                "ENSEMBL:ENSMOCG00000010449"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:574217": {
                    "category": "biolink:Gene",
                    "name": "CCL4L1",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:574217",
                                "name:chemokine (C-C motif) ligand 4-like 1",
                                "SYMBOL:CCL4L1",
                                "UniProtKB:Q8HYQ2",
                                "ENSEMBL:ENSMMUG00000020102"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "UMLS:C1707151": {
                    "category": "biolink:Gene",
                    "name": "UMLS:C1707151",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "UMLS:C1707151"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "UMLS:C1707163": {
                    "category": "biolink:Gene",
                    "name": "UMLS:C1707163",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "UMLS:C1707163"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:3601": {
                    "category": "biolink:Gene",
                    "name": "IL15RA",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:3601",
                                "name:interleukin 15 receptor subunit alpha",
                                "SYMBOL:IL15RA",
                                "UMLS:C1416387",
                                "HGNC:5978",
                                "UniProtKB:Q13261",
                                "ENSEMBL:ENSG00000134470",
                                "OMIM:601070"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:5788": {
                    "category": "biolink:Gene",
                    "name": "PTPRC",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:5788",
                                "name:protein tyrosine phosphatase receptor type C",
                                "SYMBOL:PTPRC",
                                "UMLS:C1335285",
                                "HGNC:9666",
                                "UniProtKB:P08575",
                                "ENSEMBL:ENSG00000081237",
                                "ENSEMBL:ENSG00000262418",
                                "OMIM:151460"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:8030": {
                    "category": "biolink:Gene",
                    "name": "CCDC6",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:8030",
                                "name:coiled-coil domain containing 6",
                                "SYMBOL:CCDC6",
                                "UMLS:C1425774",
                                "HGNC:18782",
                                "UniProtKB:Q16204",
                                "ENSEMBL:ENSG00000108091",
                                "OMIM:601985"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:920": {
                    "category": "biolink:Gene",
                    "name": "CD4",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:920",
                                "name:CD4 molecule",
                                "SYMBOL:CD4",
                                "UMLS:C1332714",
                                "HGNC:1678",
                                "UniProtKB:P01730",
                                "ENSEMBL:ENSG00000010610",
                                "OMIM:186940"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:1514": {
                    "category": "biolink:Gene",
                    "name": "CTSL",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:1514",
                                "name:cathepsin L",
                                "SYMBOL:CTSL",
                                "UMLS:C1332807",
                                "UMLS:C0054871",
                                "HGNC:2537",
                                "UniProtKB:P07711",
                                "ENSEMBL:ENSG00000135047",
                                "OMIM:116880"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "UMLS:C1706438": {
                    "category": "biolink:Gene",
                    "name": "UMLS:C1706438",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "UMLS:C1706438"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "UMLS:C1367471": {
                    "category": "biolink:Gene",
                    "name": "UMLS:C1367471",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "UMLS:C1367471"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "MESH:C480354": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "BH30sucMan",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "UMLS:C1433528",
                                "MESH:C480354",
                                "name:BH30sucMan"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:134722": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "FAVIPIRAVIR",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEMBL.COMPOUND:CHEMBL221722",
                                "DRUGBANK:DB12466",
                                "PUBCHEM.COMPOUND:492405",
                                "CHEBI:134722",
                                "UMLS:C1138226",
                                "MESH:C462182",
                                "UNII:EW5GL2X7E0",
                                "INCHIKEY:ZCGNOVWYSGBHAU-UHFFFAOYSA-N",
                                "INCHI:InChI=1S/C5H4FN3O2/c6-2-1-8-5(11)3(9-2)4(7)10/h1H,(H2,7,10)(H,8,11)",
                                "name:FAVIPIRAVIR",
                                "name:Favipiravir",
                                "name:favipiravir"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "MESH:C517546": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "immucillin A",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "UMLS:C1870231",
                                "MESH:C517546",
                                "name:immucillin A",
                                "name:immucillin-A"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "MESH:C487484": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "K11777",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "UMLS:C1456738",
                                "MESH:C487484",
                                "name:K11777"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "MESH:C000606551": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "GS-5734",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "UMLS:C4279131",
                                "MESH:C000606551",
                                "name:GS-5734"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:29687": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "TEICOPLANIN",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEMBL.COMPOUND:CHEMBL2367892",
                                "DRUGBANK:DB06149",
                                "PUBCHEM.COMPOUND:73348316",
                                "PUBCHEM.COMPOUND:16131923",
                                "CHEBI:29687",
                                "UMLS:C0145106",
                                "MESH:D017334",
                                "UNII:4U3D3YY81M",
                                "INCHI:InChI=1S/C80H81Cl2N9O33/c1-26(95)84-59-65(104)62(101)50(23-92)120-78(59)123-69-31-6-10-45(40(82)16-31)118-49-19-33-18-48(70(49)124-79-60(85-27(2)96)66(105)63(102)51(24-93)121-79)117-44-9-3-28(11-39(44)81)12-41-71(108)87-56(32-13-34(97)20-36(14-32)116-46-17-29(4-8-43(46)100)54(83)72(109)86-41)74(111)89-57(33)75(112)88-55-30-5-7-42(99)37(15-30)53-38(58(77(114)115)90-76(113)61(69)91-73(55)110)21-35(98)22-47(53)119-80-68(107)67(106)64(103)52(25-94)122-80/h3-11,13-22,41,50-52,54-69,78-80,92-94,97-107H,12,23-25,83H2,1-2H3,(H,84,95)(H,85,96)(H,86,109)(H,87,108)(H,88,112)(H,89,111)(H,90,113)(H,91,110)(H,114,115)/t41-,50+,51+,52-,54-,55-,56+,57-,58+,59+,60+,61+,62-,63-,64-,65-,66-,67-,68+,69-,78+,79+,80+/m1/s1",
                                "name:TEICOPLANIN"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "NCBIGene:3439": {
                    "category": "biolink:Gene",
                    "name": "IFNA1",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "NCBIGene:3439",
                                "name:interferon alpha 1",
                                "SYMBOL:IFNA1",
                                "UMLS:C1415900",
                                "HGNC:5417",
                                "UniProtKB:P01562",
                                "ENSEMBL:ENSG00000197919",
                                "OMIM:147660"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "UMLS:C1708411": {
                    "category": "biolink:Gene",
                    "name": "UMLS:C1708411",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "UMLS:C1708411"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "UMLS:C0017337": {
                    "category": "biolink:Gene",
                    "name": "UMLS:C0017337",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "UMLS:C0017337"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "UMLS:C1335439": {
                    "category": "biolink:Gene",
                    "name": "UMLS:C1335439",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "UMLS:C1335439"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:50312": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:50312",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:50312"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:22658": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:22658",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:22658"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:33285": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:33285",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:33285"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:36876": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:36876",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:36876"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:76668": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:76668",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:76668"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:26082": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:26082",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:26082"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:19255": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:19255",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:19255"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:23523": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:23523",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:23523"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:27644": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHLORTETRACYCLINE",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEMBL.COMPOUND:CHEMBL404520",
                                "CHEMBL.COMPOUND:CHEMBL2146063",
                                "DRUGBANK:DB09093",
                                "PUBCHEM.COMPOUND:54708735",
                                "PUBCHEM.COMPOUND:54675777",
                                "CHEBI:27644",
                                "UMLS:C0008293",
                                "MESH:D002751",
                                "UNII:O1GX33ON8R",
                                "UNII:WCK1KIQ23Q",
                                "INCHIKEY:CYDMQBQPVICBEU-XRNKAMNCSA-N",
                                "INCHI:InChI=1S/C22H23ClN2O8/c1-21(32)7-6-8-15(25(2)3)17(28)13(20(24)31)19(30)22(8,33)18(29)11(7)16(27)12-10(26)5-4-9(23)14(12)21/h4-5,7-8,15,26,28-29,32-33H,6H2,1-3H3,(H2,24,31)/t7-,8-,15-,21-,22-/m0/s1",
                                "KEGG:C06571",
                                "name:CHLORTETRACYCLINE",
                                "name:Chlortetracycline",
                                "name:chlortetracycline"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:26004": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:26004",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:26004"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:47040": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "lipid A",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:47040",
                                "name:lipid A"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:18085": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:18085",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:18085"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:24610": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:24610",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:24610"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:32588": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "POTASSIUM CHLORIDE",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEMBL.COMPOUND:CHEMBL1200731",
                                "DRUGBANK:DB00761",
                                "PUBCHEM.COMPOUND:4873",
                                "CHEBI:32588",
                                "UMLS:C0032825",
                                "MESH:D011189",
                                "UNII:660YQ98I10",
                                "INCHIKEY:WCUXLLCKKVVCTQ-UHFFFAOYSA-M",
                                "INCHI:InChI=1S/ClH.K/h1H;/q;+1/p-1",
                                "name:POTASSIUM CHLORIDE",
                                "name:Potassium chloride",
                                "name:Potassium Chloride",
                                "name:potassium chloride"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:53662": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:53662",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:53662"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:26872": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:26872",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:26872"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:25527": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:25527",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:25527"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:18179": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:18179",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:18179"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:51475": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:51475",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:51475"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:76938": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:76938",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:76938"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:35785": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:35785",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:35785"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:6495": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:6495",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:6495"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:23521": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:23521",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:23521"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:37581": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "gamma-lactone",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:37581",
                                "name:gamma-lactone"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:36711": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:36711",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:36711"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:168396": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "MYCOPHENOLIC ACID",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEMBL.COMPOUND:CHEMBL866",
                                "CHEMBL.COMPOUND:CHEMBL2106643",
                                "DRUGBANK:DB01024",
                                "PUBCHEM.COMPOUND:446541",
                                "CHEBI:168396",
                                "UMLS:C0883242",
                                "UMLS:C0026933",
                                "MESH:D009173",
                                "UNII:HU9DX48N0T",
                                "INCHIKEY:HPNSFSBZBAHARI-RUDMXATFSA-N",
                                "INCHI:InChI=1S/C17H20O6/c1-9(5-7-13(18)19)4-6-11-15(20)14-12(8-23-17(14)21)10(2)16(11)22-3/h4,20H,5-8H2,1-3H3,(H,18,19)/b9-4+",
                                "name:MYCOPHENOLIC ACID",
                                "name:Mycophenolic acid",
                                "name:Mycophenolic Acid",
                                "name:mycophenolic acid"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:35284": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:35284",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:35284"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:36044": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:36044",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:36044"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:50313": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:50313",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:50313"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:76759": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:76759",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:76759"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:61296": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:61296",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:61296"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:73474": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "acetylenic compound",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:73474",
                                "name:acetylenic compound"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:18295": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "HISTAMINE",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEMBL.COMPOUND:CHEMBL90",
                                "CHEMBL.COMPOUND:CHEMBL535166",
                                "CHEMBL.COMPOUND:CHEMBL1200801",
                                "CHEMBL.COMPOUND:CHEMBL1533310",
                                "DRUGBANK:DB05381",
                                "PUBCHEM.COMPOUND:774",
                                "CHEBI:18295",
                                "UMLS:C0019588",
                                "MESH:D006632",
                                "UNII:3POA0Q644U",
                                "UNII:820484N8I3",
                                "INCHIKEY:NTYJJOPFIAHURM-UHFFFAOYSA-N",
                                "INCHI:InChI=1S/C5H9N3/c6-2-1-5-3-7-4-8-5/h3-4H,1-2,6H2,(H,7,8)",
                                "KEGG:C00388",
                                "name:HISTAMINE",
                                "name:Histamine",
                                "name:histamine"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:24261": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:24261",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:24261"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:22213": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:22213",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:22213"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:38166": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:38166",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:38166"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:33676": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:33676",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:33676"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:33308": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "carboxylic ester",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:33308",
                                "name:carboxylic ester"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:25693": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:25693",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:25693"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:32874": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "proline residue",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:32874",
                                "name:proline residue"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:35381": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:35381",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:35381"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:32535": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "histidine residue",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:32535",
                                "name:histidine residue"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:36807": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:36807",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:36807"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:48433": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:48433",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:48433"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:50047": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:50047",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:50047"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:29917": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "thiol group",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:29917",
                                "name:thiol group"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:30185": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "Zinc",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEMBL.COMPOUND:CHEMBL1201279",
                                "DRUGBANK:DB01593",
                                "PUBCHEM.COMPOUND:23994",
                                "CHEBI:30185",
                                "CHEBI:27363",
                                "UMLS:C0043481",
                                "MESH:D015032",
                                "UNII:J41CSQ7QDS",
                                "INCHIKEY:HCHKCACWOHOZIP-UHFFFAOYSA-N",
                                "INCHI:InChI=1S/Zn",
                                "KEGG:C00038",
                                "name:Zinc",
                                "name:ZINC",
                                "name:zinc",
                                "name:zinc(0)",
                                "name:zinc atom"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:67079": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:67079",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:67079"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:26738": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:26738",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:26738"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:2639": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "AMILORIDE",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEMBL.COMPOUND:CHEMBL945",
                                "CHEMBL.COMPOUND:CHEMBL1398126",
                                "DRUGBANK:DB00594",
                                "PUBCHEM.COMPOUND:16231",
                                "CHEBI:2639",
                                "UMLS:C0002502",
                                "MESH:D000584",
                                "UNII:7DZO8EB0Z3",
                                "INCHIKEY:XSDQTOBWRPYKKA-UHFFFAOYSA-N",
                                "INCHI:InChI=1S/C6H8ClN7O/c7-2-4(9)13-3(8)1(12-2)5(15)14-6(10)11/h(H4,8,9,13)(H4,10,11,14,15)",
                                "KEGG:C06821",
                                "name:AMILORIDE",
                                "name:Amiloride",
                                "name:amiloride"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:38338": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:38338",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:38338"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:47885": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:47885",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:47885"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:35868": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:35868",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:35868"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:52396": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:52396",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:52396"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:26873": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:26873",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:26873"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:61538": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:61538",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:61538"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:53105": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "UMP 5'-end residue",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:53105",
                                "name:UMP 5'-end residue"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:33579": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:33579",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:33579"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:76939": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:76939",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:76939"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:16042": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "halide anion",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:16042",
                                "name:halide anion"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:35478": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:35478",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:35478"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:33318": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:33318",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:33318"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:53325": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "nitrocellulose",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:53325",
                                "name:nitrocellulose"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:36683": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "organochlorine compound",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:36683",
                                "name:organochlorine compound"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:24400": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:24400",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:24400"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:49319": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:49319",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:49319"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:72695": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:72695",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:72695"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:48001": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:48001",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:48001"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:50320": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:50320",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:50320"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:63409": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:63409",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:63409"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:82852": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "inosine 5'-phosphate(1-) residue",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:82852",
                                "name:inosine 5'-phosphate(1-) residue"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:24532": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:24532",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:24532"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:16670": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "peptide",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:16670",
                                "name:peptide"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:28304": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "Heparin",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEMBL.COMPOUND:CHEMBL1201513",
                                "CHEMBL.COMPOUND:CHEMBL1201657",
                                "CHEMBL.COMPOUND:CHEMBL1909300",
                                "DRUGBANK:DB01109",
                                "PUBCHEM.COMPOUND:772",
                                "CHEBI:28304",
                                "UMLS:C0770546",
                                "UMLS:C0019134",
                                "MESH:D006493",
                                "UNII:M4F288ZCTR",
                                "name:Heparin"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:33317": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:33317",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:33317"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:31624": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "FLUORESCEIN SODIUM",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEMBL.COMPOUND:CHEMBL1628233",
                                "CHEMBL.COMPOUND:CHEMBL177756",
                                "DRUGBANK:DB00693",
                                "PUBCHEM.COMPOUND:10608",
                                "PUBCHEM.COMPOUND:16850",
                                "CHEBI:31624",
                                "UMLS:C0060520",
                                "MESH:D019793",
                                "UNII:93X55PE38X",
                                "INCHIKEY:NJDNXYGOVLYJHP-UHFFFAOYSA-L",
                                "INCHI:InChI=1S/C20H12O5.2Na/c21-11-5-7-15-17(9-11)25-18-10-12(22)6-8-16(18)19(15)13-3-1-2-4-14(13)20(23)24;;/h1-10,21H,(H,23,24);;/q;2*+1/p-2",
                                "name:FLUORESCEIN SODIUM"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:20706": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:20706",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:20706"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:51061": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:51061",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:51061"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:33482": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:33482",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:33482"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:26632": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:26632",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:26632"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:61692": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:61692",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:61692"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:53113": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "dAMP 3'-end residue",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:53113",
                                "name:dAMP 3'-end residue"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:26912": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:26912",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:26912"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:63962": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:63962",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:63962"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:38215": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:38215",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:38215"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:23213": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:23213",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:23213"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:33298": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:33298",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:33298"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:33563": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:33563",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:33563"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:50308": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "cytidine 5'-monophosphate residue",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:50308",
                                "name:cytidine 5'-monophosphate residue"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:35724": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:35724",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:35724"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:35416": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:35416",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:35416"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:37247": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:37247",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:37247"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:33458": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:33458",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:33458"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:50306": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "adenosine 5'-monophosphate residue",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:50306",
                                "name:adenosine 5'-monophosphate residue"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:36389": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:36389",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:36389"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:17568": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "URACIL",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEMBL.COMPOUND:CHEMBL566",
                                "DRUGBANK:DB03419",
                                "PUBCHEM.COMPOUND:1174",
                                "CHEBI:17568",
                                "UMLS:C0041917",
                                "MESH:D014498",
                                "UNII:56HH86ZVCT",
                                "INCHIKEY:ISAKRJDGNUQOIC-UHFFFAOYSA-N",
                                "INCHI:InChI=1S/C4H4N2O2/c7-3-1-2-5-4(8)6-3/h1-2H,(H2,5,6,7,8)",
                                "KEGG:C00106",
                                "name:URACIL",
                                "name:Uracil",
                                "name:uracil"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:50753": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:50753",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:50753"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:24898": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:24898",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:24898"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:33504": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:33504",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:33504"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:26191": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:26191",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:26191"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:139592": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "tertiary alpha-hydroxy ketone",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:139592",
                                "name:tertiary alpha-hydroxy ketone"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:22314": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:22314",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:22314"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:17996": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "Chloride ion",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEMBL.COMPOUND:CHEMBL19429",
                                "DRUGBANK:DB14547",
                                "PUBCHEM.COMPOUND:312",
                                "CHEBI:17996",
                                "UNII:Q32ZN48698",
                                "INCHIKEY:VEXZGXHMUGYJMC-UHFFFAOYSA-M",
                                "INCHI:InChI=1S/ClH/h1H/p-1",
                                "KEGG:C00698",
                                "name:Chloride ion",
                                "name:CHLORIDE ION",
                                "name:chloride"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:37404": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:37404",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:37404"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:85264": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CLAVULANATE POTASSIUM",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEMBL.COMPOUND:CHEMBL1003",
                                "DRUGBANK:DB00766",
                                "PUBCHEM.COMPOUND:23665591",
                                "CHEBI:85264",
                                "UNII:Q42OMW3AT8",
                                "INCHIKEY:ABVRVIZBZKUTMK-JSYANWSFSA-M",
                                "INCHI:InChI=1S/C8H9NO5.K/c10-2-1-4-7(8(12)13)9-5(11)3-6(9)14-4;/h1,6-7,10H,2-3H2,(H,12,13);/q;+1/p-1/b4-1-;/t6-,7-;/m1./s1",
                                "name:CLAVULANATE POTASSIUM",
                                "name:potassium clavulanate"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:60766": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:60766",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:60766"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:64654": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "guanosine residue",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:64654",
                                "name:guanosine residue"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:32835": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:32835",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:32835"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:33543": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "sulfonate",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "PUBCHEM.COMPOUND:656472",
                                "CHEBI:33543",
                                "INCHIKEY:BDHFUVZGWQCTTF-UHFFFAOYSA-M",
                                "INCHI:InChI=1S/H2O3S/c1-4(2)3/h4H,(H,1,2,3)/p-1",
                                "name:sulfonate"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:22702": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:22702",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:22702"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:60027": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:60027",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:60027"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:59941": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:59941",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:59941"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:35350": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:35350",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:35350"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:25384": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:25384",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:25384"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:33570": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:33570",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:33570"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:53103": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CMP 5'-end residue",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:53103",
                                "name:CMP 5'-end residue"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:33620": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:33620",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:33620"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:42191": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "EDETIC ACID",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEMBL.COMPOUND:CHEMBL858",
                                "CHEMBL.COMPOUND:CHEMBL1749",
                                "CHEMBL.COMPOUND:CHEMBL1200375",
                                "DRUGBANK:DB00974",
                                "PUBCHEM.COMPOUND:6049",
                                "CHEBI:42191",
                                "UMLS:C0012695",
                                "UMLS:C0013618",
                                "UMLS:C0006692",
                                "MESH:D004492",
                                "UNII:25IH6R4SGF",
                                "UNII:9G34HU7RV0",
                                "INCHIKEY:KCXVZYZYPLLWCC-UHFFFAOYSA-N",
                                "INCHI:InChI=1S/C10H16N2O8/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20)",
                                "KEGG:C00284",
                                "name:EDETIC ACID",
                                "name:Edetic acid",
                                "name:Calcium Disodium Edetate",
                                "name:edetic acid",
                                "name:ethylenediaminetetraacetic acid"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:26822": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:26822",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:26822"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:61120": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:61120",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:61120"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:33581": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:33581",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:33581"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:33459": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:33459",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:33459"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:22718": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:22718",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:22718"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:27369": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:27369",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:27369"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:27140": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "OXYGEN",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEMBL.COMPOUND:CHEMBL1234886",
                                "DRUGBANK:DB09140",
                                "PUBCHEM.COMPOUND:977",
                                "CHEBI:27140",
                                "CHEBI:26689",
                                "CHEBI:15379",
                                "CHEBI:25805",
                                "UMLS:C0030054",
                                "MESH:D010100",
                                "UNII:S88TT14065",
                                "INCHIKEY:MYMOFIZGZYHOMD-UHFFFAOYSA-N",
                                "INCHI:InChI=1S/O2/c1-2",
                                "KEGG:C00007",
                                "name:OXYGEN",
                                "name:Oxygen",
                                "name:triplet dioxygen",
                                "name:singlet dioxygen",
                                "name:dioxygen"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:38755": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:38755",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:38755"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:33282": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:33282",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:33282"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:33304": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:33304",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:33304"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:59132": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:59132",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:59132"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:33702": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:33702",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:33702"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:36830": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:36830",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:36830"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:9566": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "THIORIDAZINE",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEMBL.COMPOUND:CHEMBL479",
                                "CHEMBL.COMPOUND:CHEMBL1200916",
                                "DRUGBANK:DB00679",
                                "PUBCHEM.COMPOUND:5452",
                                "CHEBI:9566",
                                "UMLS:C0039943",
                                "UMLS:C0025225",
                                "MESH:D013881",
                                "UNII:4WCI67NK8M",
                                "UNII:N3D6TG58NI",
                                "INCHIKEY:KLBQZWRITKRQQV-UHFFFAOYSA-N",
                                "INCHI:InChI=1S/C21H26N2S2/c1-22-13-6-5-7-16(22)12-14-23-18-8-3-4-9-20(18)25-21-11-10-17(24-2)15-19(21)23/h3-4,8-11,15-16H,5-7,12-14H2,1-2H3",
                                "name:THIORIDAZINE",
                                "name:Thioridazine",
                                "name:Sonapax",
                                "name:thioridazine"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:73477": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "terminal acetylenic compound",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:73477",
                                "name:terminal acetylenic compound"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:24436": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:24436",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:24436"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:50843": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:50843",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:50843"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:53116": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CMP 3'-end residue",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:53116",
                                "name:CMP 3'-end residue"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:33711": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:33711",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:33711"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:22726": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:22726",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:22726"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:31577": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:31577",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:31577"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:22256": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:22256",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:22256"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:60258": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:60258",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:60258"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:33300": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:33300",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:33300"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:35274": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:35274",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:35274"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:37750": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:37750",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:37750"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:51151": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:51151",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:51151"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:50300": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "thymidine 5'-monophosphate residue",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:50300",
                                "name:thymidine 5'-monophosphate residue"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:33629": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "Aluminium",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "DRUGBANK:DB01370",
                                "PUBCHEM.COMPOUND:5359268",
                                "CHEBI:33629",
                                "CHEBI:28984",
                                "UMLS:C0002367",
                                "MESH:D000535",
                                "UNII:CPD4NFA903",
                                "INCHIKEY:XAGFODPZIPBFFR-UHFFFAOYSA-N",
                                "INCHI:InChI=1S/Al",
                                "KEGG:C06264",
                                "name:Aluminium",
                                "name:Aluminum",
                                "name:ALUMINUM",
                                "name:aluminium",
                                "name:aluminium(0)",
                                "name:aluminium atom"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:24458": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:24458",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:24458"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:26389": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:26389",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:26389"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:57856": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "S-ADENOSYLHOMOCYSTEINE",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEMBL.COMPOUND:CHEMBL418052",
                                "DRUGBANK:DB01752",
                                "PUBCHEM.COMPOUND:439155",
                                "CHEBI:57856",
                                "CHEBI:16680",
                                "UNII:8K31Q2S66S",
                                "INCHIKEY:ZJUKTBDSGOFHSH-WFMPWKQPSA-N",
                                "INCHI:InChI=1S/C14H20N6O5S/c15-6(14(23)24)1-2-26-3-7-9(21)10(22)13(25-7)20-5-19-8-11(16)17-4-18-12(8)20/h4-7,9-10,13,21-22H,1-3,15H2,(H,23,24)(H2,16,17,18)/t6-,7+,9+,10+,13+/m0/s1",
                                "KEGG:C00021",
                                "name:S-ADENOSYLHOMOCYSTEINE",
                                "name:S-adenosyl-L-homocysteine",
                                "name:S-ADENOSYL-L-HOMOCYSTEINE",
                                "name:S-adenosyl-L-homocysteine zwitterion"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:35175": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:35175",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:35175"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:31342": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CALCIUM HYPOCHLORIDE",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEMBL.COMPOUND:CHEMBL2251447",
                                "PUBCHEM.COMPOUND:24504",
                                "CHEBI:31342",
                                "UMLS:C0054471",
                                "MESH:C004488",
                                "UNII:11DXB629VZ",
                                "INCHIKEY:ZKQDCIXGCQPQNV-UHFFFAOYSA-N",
                                "INCHI:InChI=1S/Ca.2ClO/c;2*1-2/q+2;2*-1",
                                "name:CALCIUM HYPOCHLORIDE",
                                "name:calcium hypochlorite",
                                "name:CALCIUM HYPOCHLORITE",
                                "name:Calcium hypochlorite"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:26034": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:26034",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:26034"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:23007": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:23007",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:23007"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:37826": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:37826",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:37826"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:32504": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "phenylalaninate",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "PUBCHEM.COMPOUND:5460950",
                                "CHEBI:32504",
                                "INCHIKEY:COLNVLDHVKWLRT-UHFFFAOYSA-M",
                                "INCHI:InChI=1S/C9H11NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H,11,12)/p-1",
                                "name:phenylalaninate"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:28963": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:28963",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:28963"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:46963": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:46963",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:46963"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:25108": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:25108",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:25108"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:51323": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:51323",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:51323"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:57427": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "LEUCINE",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEMBL.COMPOUND:CHEMBL291962",
                                "DRUGBANK:DB00149",
                                "PUBCHEM.COMPOUND:7045798",
                                "PUBCHEM.COMPOUND:6106",
                                "CHEBI:57427",
                                "CHEBI:15603",
                                "CHEBI:25017",
                                "UMLS:C0023401",
                                "MESH:D007930",
                                "UNII:GMW67QNF9C",
                                "INCHIKEY:ROHFNLRQFUQHCH-YFKPBYRVSA-N",
                                "INCHI:InChI=1S/C6H13NO2/c1-4(2)3-5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)/t5-/m0/s1",
                                "KEGG:C00123",
                                "name:LEUCINE",
                                "name:Leucine",
                                "name:l-leucine",
                                "name:L-leucine zwitterion",
                                "name:L-leucine"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:38831": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:38831",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:38831"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:26562": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:26562",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:26562"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:46789": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:46789",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:46789"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:4917": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "EUGENOL",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEMBL.COMPOUND:CHEMBL42710",
                                "DRUGBANK:DB09086",
                                "PUBCHEM.COMPOUND:3314",
                                "CHEBI:4917",
                                "UMLS:C0015153",
                                "MESH:D005054",
                                "UNII:3T8H1794QW",
                                "INCHIKEY:RRAFCDWBNXTKKO-UHFFFAOYSA-N",
                                "INCHI:InChI=1S/C10H12O2/c1-3-4-8-5-6-9(11)10(7-8)12-2/h3,5-7,11H,1,4H2,2H3",
                                "KEGG:C10453",
                                "name:EUGENOL",
                                "name:Eugenol",
                                "name:eugenol"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:33245": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:33245",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:33245"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:35701": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:35701",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:35701"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:35780": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:35780",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:35780"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:36313": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:36313",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:36313"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:22918": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:22918",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:22918"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:38702": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:38702",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:38702"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:32832": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:32832",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:32832"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:35223": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:35223",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:35223"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:78840": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:78840",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:78840"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:50584": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:50584",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:50584"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:33695": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:33695",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:33695"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:36735": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:36735",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:36735"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:16412": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:16412",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:16412"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:24780": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:24780",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:24780"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:36684": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:36684",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:36684"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:21731": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:21731",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:21731"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:44658": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "OKADAIC ACID",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEMBL.COMPOUND:CHEMBL280487",
                                "DRUGBANK:DB02169",
                                "PUBCHEM.COMPOUND:446512",
                                "CHEBI:44658",
                                "UMLS:C0069389",
                                "MESH:D019319",
                                "UNII:1W21G5Q4N2",
                                "INCHIKEY:QNDVLZJODHBUFM-WFXQOWMNSA-N",
                                "INCHI:InChI=1S/C44H68O13/c1-25-21-34(55-44(23-25)35(46)12-11-31(54-44)24-41(6,50)40(48)49)26(2)9-10-30-14-18-43(53-30)19-15-33-39(57-43)36(47)29(5)38(52-33)32(45)22-28(4)37-27(3)13-17-42(56-37)16-7-8-20-51-42/h9-10,23,26-28,30-39,45-47,50H,5,7-8,11-22,24H2,1-4,6H3,(H,48,49)/b10-9+/t26-,27-,28+,30+,31+,32+,33-,34+,35-,36-,37+,38+,39-,41-,42+,43-,44-/m1/s1",
                                "KEGG:C01945",
                                "name:OKADAIC ACID",
                                "name:9,10-Deepithio-9,10-Didehydroacanthifolicin",
                                "name:Okadaic Acid",
                                "name:okadaic acid"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:24433": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:24433",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:24433"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:39457": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:39457",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:39457"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:33917": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:33917",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEMBL.COMPOUND:CHEMBL1206211",
                                "PUBCHEM.COMPOUND:24749",
                                "CHEBI:33917",
                                "INCHI:InChI=1S/C6H12O6/c7-1-3(9)5(11)6(12)4(10)2-8/h1,3-6,8-12H,2H2"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:26386": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "purine nucleobase",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:26386",
                                "name:purine nucleobase"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:64708": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:64708",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:64708"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:22986": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:22986",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:22986"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:30756": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "adenin-9-yl group",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:30756",
                                "name:adenin-9-yl group"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:63131": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "EDTA(3-)",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "PUBCHEM.COMPOUND:5147705",
                                "CHEBI:63131",
                                "INCHIKEY:KCXVZYZYPLLWCC-UHFFFAOYSA-K",
                                "INCHI:InChI=1S/C10H16N2O8/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20)/p-3",
                                "name:EDTA(3-)"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:25608": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:25608",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:25608"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:35391": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "aspartate(1-)",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "PUBCHEM.COMPOUND:4083066",
                                "CHEBI:35391",
                                "INCHIKEY:CKLJMWTZIZZHCS-UHFFFAOYSA-M",
                                "INCHI:InChI=1S/C4H7NO4/c5-2(4(8)9)1-3(6)7/h2H,1,5H2,(H,6,7)(H,8,9)/p-1",
                                "name:aspartate(1-)"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:22720": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:22720",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:22720"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:26932": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:26932",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:26932"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:35754": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:35754",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:35754"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:38716": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:38716",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:38716"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:64898": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:64898",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:64898"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:46470": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "uridine 5'-monophosphate residue",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:46470",
                                "name:uridine 5'-monophosphate residue"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:17790": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "METHYL ALCOHOL",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEMBL.COMPOUND:CHEMBL14688",
                                "PUBCHEM.COMPOUND:887",
                                "CHEBI:17790",
                                "UMLS:C0001963",
                                "MESH:D000432",
                                "UNII:Y4S76JWI15",
                                "INCHIKEY:OKKJLVBELUTLKV-UHFFFAOYSA-N",
                                "INCHI:InChI=1S/CH4O/c1-2/h2H,1H3",
                                "name:METHYL ALCOHOL",
                                "name:Methanol",
                                "name:methanol"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:23449": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:23449",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:23449"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:25704": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:25704",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:25704"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:19237": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:19237",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:19237"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:26714": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:26714",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:26714"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:17997": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "NITROGEN",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEMBL.COMPOUND:CHEMBL142438",
                                "DRUGBANK:DB09152",
                                "PUBCHEM.COMPOUND:947",
                                "CHEBI:17997",
                                "CHEBI:25555",
                                "UMLS:C0028158",
                                "MESH:D009584",
                                "UNII:N762921K75",
                                "INCHIKEY:IJGRMHOSHXDMSA-UHFFFAOYSA-N",
                                "INCHI:InChI=1S/N2/c1-2",
                                "KEGG:C00697",
                                "name:NITROGEN",
                                "name:Nitrogen",
                                "name:dinitrogen"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:38337": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:38337",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:38337"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:63470": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:63470",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:63470"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:48706": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:48706",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:48706"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:29769": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "hydroxyamino group",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:29769",
                                "name:hydroxyamino group"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:3638": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHLOROQUINE",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEMBL.COMPOUND:CHEMBL76",
                                "CHEMBL.COMPOUND:CHEMBL58510",
                                "CHEMBL.COMPOUND:CHEMBL1326",
                                "CHEMBL.COMPOUND:CHEMBL1669",
                                "CHEMBL.COMPOUND:CHEMBL2095223",
                                "DRUGBANK:DB00608",
                                "PUBCHEM.COMPOUND:2719",
                                "CHEBI:3638",
                                "UMLS:C0700447",
                                "UMLS:C0008269",
                                "UMLS:C0003751",
                                "MESH:D002738",
                                "MESH:C023676",
                                "UNII:6E17K3343P",
                                "UNII:886U3H6UFF",
                                "INCHIKEY:WHTVZRBIWZFKQO-UHFFFAOYSA-N",
                                "INCHI:InChI=1S/C18H26ClN3/c1-4-22(5-2)12-6-7-14(3)21-17-10-11-20-18-13-15(19)8-9-16(17)18/h8-11,13-14H,4-7,12H2,1-3H3,(H,20,21)",
                                "KEGG:C07625",
                                "name:CHLOROQUINE",
                                "name:Chloroquine",
                                "name:Arequin",
                                "name:chloroquine"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:26605": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:26605",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:26605"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:26218": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:26218",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:26218"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:32470": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "aspartic acid residue",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:32470",
                                "name:aspartic acid residue"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:33280": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:33280",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:33280"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:33505": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:33505",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:33505"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:46787": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:46787",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:46787"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:35352": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:35352",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:35352"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:53536": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:53536",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:53536"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:53112": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "AMP 3'-end residue",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:53112",
                                "name:AMP 3'-end residue"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:33966": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:33966",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:33966"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:36902": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:36902",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:36902"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:3614": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHLORHEXIDINE",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEMBL.COMPOUND:CHEMBL790",
                                "CHEMBL.COMPOUND:CHEMBL1628",
                                "CHEMBL.COMPOUND:CHEMBL1484251",
                                "DRUGBANK:DB00878",
                                "PUBCHEM.COMPOUND:2713",
                                "PUBCHEM.COMPOUND:9552079",
                                "CHEBI:3614",
                                "UMLS:C0008199",
                                "UMLS:C0008196",
                                "MESH:D002710",
                                "MESH:C010882",
                                "UNII:E64XL9U38K",
                                "UNII:R4KO0DY52L",
                                "INCHIKEY:GHXZTYHSJHQHIJ-UHFFFAOYSA-N",
                                "INCHI:InChI=1S/C22H30Cl2N10/c23-15-5-9-17(10-6-15)31-21(27)33-19(25)29-13-3-1-2-4-14-30-20(26)34-22(28)32-18-11-7-16(24)8-12-18/h5-12H,1-4,13-14H2,(H5,25,27,29,31,33)(H5,26,28,30,32,34)",
                                "KEGG:C06902",
                                "name:CHLORHEXIDINE",
                                "name:Chlorhexidine",
                                "name:chlorhexidine"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:37929": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:37929",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:37929"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:24471": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:24471",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:24471"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:47779": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:47779",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:47779"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:26446": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:26446",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:26446"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:29320": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "Calcium",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "DRUGBANK:DB01373",
                                "PUBCHEM.COMPOUND:5460341",
                                "PUBCHEM.COMPOUND:271",
                                "CHEBI:29320",
                                "CHEBI:22984",
                                "UMLS:C0006675",
                                "MESH:D002118",
                                "UNII:SY7Q814VUP",
                                "INCHIKEY:OYPRJOBELJOOCE-UHFFFAOYSA-N",
                                "INCHI:InChI=1S/Ca",
                                "KEGG:C00076",
                                "name:Calcium",
                                "name:CALCIUM",
                                "name:calcium",
                                "name:calcium(0)",
                                "name:calcium atom"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:37838": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:37838",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:37838"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:26513": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:26513",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:26513"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:33327": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:33327",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:33327"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:33559": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:33559",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:33559"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:33910": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:33910",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:33910"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:23451": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:23451",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:23451"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:25614": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:25614",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:25614"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:51959": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:51959",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:51959"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:58315": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "TYROSINE",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEMBL.COMPOUND:CHEMBL925",
                                "DRUGBANK:DB00135",
                                "PUBCHEM.COMPOUND:6057",
                                "CHEBI:58315",
                                "CHEBI:17895",
                                "CHEBI:18186",
                                "UMLS:C0041485",
                                "MESH:D014443",
                                "UNII:42HK56048U",
                                "INCHIKEY:OUYCCCASQSFEME-QMMMGPOBSA-N",
                                "INCHI:InChI=1S/C9H11NO3/c10-8(9(12)13)5-6-1-3-7(11)4-2-6/h1-4,8,11H,5,10H2,(H,12,13)/t8-/m0/s1",
                                "KEGG:C00082",
                                "name:TYROSINE",
                                "name:Tyrosine",
                                "name:l-tyrosine",
                                "name:L-tyrosine zwitterion",
                                "name:L-tyrosine"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:60004": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:60004",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:60004"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:33744": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:33744",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:33744"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:76072": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "nicotinic acid-adenine dinucleotide phosphate",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "PUBCHEM.COMPOUND:123953",
                                "CHEBI:76072",
                                "INCHIKEY:QOTXBMGJKFVZRD-HISDBWNOSA-O",
                                "INCHI:InChI=1S/C21H27N6O18P3/c22-17-12-18(24-7-23-17)27(8-25-12)20-16(44-46(33,34)35)14(29)11(43-20)6-41-48(38,39)45-47(36,37)40-5-10-13(28)15(30)19(42-10)26-3-1-2-9(4-26)21(31)32/h1-4,7-8,10-11,13-16,19-20,28-30H,5-6H2,(H6-,22,23,24,31,32,33,34,35,36,37,38,39)/p+1/t10-,11-,13-,14-,15-,16-,19-,20-/m1/s1",
                                "name:nicotinic acid-adenine dinucleotide phosphate"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:18421": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "Superoxide",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "PUBCHEM.COMPOUND:5359597",
                                "CHEBI:18421",
                                "UMLS:C0038836",
                                "MESH:D013481",
                                "INCHIKEY:OUUQCZGPVNCOIJ-UHFFFAOYSA-M",
                                "INCHI:InChI=1S/HO2/c1-2/h1H/p-1",
                                "name:Superoxide",
                                "name:superoxide"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:6827": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "METHICILLIN",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEMBL.COMPOUND:CHEMBL575",
                                "CHEMBL.COMPOUND:CHEMBL1164",
                                "DRUGBANK:DB01603",
                                "PUBCHEM.COMPOUND:6087",
                                "CHEBI:6827",
                                "CHEBI:52065",
                                "UMLS:C0887175",
                                "UMLS:C0025643",
                                "MESH:D008712",
                                "UNII:AO9YF4MN30",
                                "UNII:Q91FH1328A",
                                "INCHIKEY:RJQXTJLFIWVMTO-TYNCELHUSA-N",
                                "INCHI:InChI=1S/C17H20N2O6S/c1-17(2)12(16(22)23)19-14(21)11(15(19)26-17)18-13(20)10-8(24-3)6-5-7-9(10)25-4/h5-7,11-12,15H,1-4H3,(H,18,20)(H,22,23)/t11-,12+,15-/m1/s1",
                                "KEGG:C07177",
                                "name:METHICILLIN",
                                "name:Meticillin",
                                "name:Methicillin",
                                "name:meticillin",
                                "name:methicillin"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:38631": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:38631",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:38631"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:33405": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:33405",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:33405"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:57305": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "GLYCINE",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEMBL.COMPOUND:CHEMBL773",
                                "DRUGBANK:DB00145",
                                "PUBCHEM.COMPOUND:750",
                                "CHEBI:57305",
                                "CHEBI:15428",
                                "UMLS:C0017890",
                                "MESH:D005998",
                                "MESH:C011080",
                                "UNII:TE7660XO1C",
                                "INCHIKEY:DHMQDGOQFOQNFH-UHFFFAOYSA-N",
                                "INCHI:InChI=1S/C2H5NO2/c3-1-2(4)5/h1,3H2,(H,4,5)",
                                "KEGG:C00037",
                                "name:GLYCINE",
                                "name:Glycine",
                                "name:glycine",
                                "name:glycine zwitterion"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:2674": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "AMODIAQUINE",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEMBL.COMPOUND:CHEMBL682",
                                "CHEMBL.COMPOUND:CHEMBL1630",
                                "DRUGBANK:DB00613",
                                "PUBCHEM.COMPOUND:2165",
                                "CHEBI:2674",
                                "UMLS:C0002641",
                                "MESH:D000655",
                                "UNII:220236ED28",
                                "INCHIKEY:OVCDSSHSILBFBN-UHFFFAOYSA-N",
                                "INCHI:InChI=1S/C20H22ClN3O/c1-3-24(4-2)13-14-11-16(6-8-20(14)25)23-18-9-10-22-19-12-15(21)5-7-17(18)19/h5-12,25H,3-4,13H2,1-2H3,(H,22,23)",
                                "KEGG:C07626",
                                "name:AMODIAQUINE",
                                "name:Amodiaquine",
                                "name:amodiaquine"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:35741": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:35741",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:35741"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:83821": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:83821",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:83821"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:37699": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:37699",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:37699"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:36054": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:36054",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:36054"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:16240": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "HYDROGEN PEROXIDE",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEMBL.COMPOUND:CHEMBL71595",
                                "DRUGBANK:DB11091",
                                "PUBCHEM.COMPOUND:784",
                                "CHEBI:16240",
                                "UMLS:C1246476",
                                "UMLS:C0020281",
                                "MESH:D006861",
                                "UNII:BBX060AN9V",
                                "INCHIKEY:MHAJPDPJQMAIIY-UHFFFAOYSA-N",
                                "INCHI:InChI=1S/H2O2/c1-2/h1-2H",
                                "KEGG:C00027",
                                "name:HYDROGEN PEROXIDE",
                                "name:Hydrogen peroxide",
                                "name:Hydrogen Peroxide",
                                "name:hydrogen peroxide"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:35131": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:35131",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:35131"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:26441": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:26441",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:26441"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:16235": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "GUANINE",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEMBL.COMPOUND:CHEMBL219568",
                                "DRUGBANK:DB02377",
                                "PUBCHEM.COMPOUND:135398634",
                                "PUBCHEM.COMPOUND:764",
                                "CHEBI:16235",
                                "UMLS:C0018321",
                                "MESH:D006147",
                                "UNII:5Z93L87A1R",
                                "INCHIKEY:UYTPUPDQBNUYGX-UHFFFAOYSA-N",
                                "INCHI:InChI=1S/C5H5N5O/c6-5-9-3-2(4(11)10-5)7-1-8-3/h1H,(H4,6,7,8,9,10,11)",
                                "KEGG:C00242",
                                "name:GUANINE",
                                "name:Guanine",
                                "name:guanine"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:26398": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:26398",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:26398"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:37010": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:37010",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:37010"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:23367": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:23367",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:23367"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:8347": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:8347",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEMBL.COMPOUND:CHEMBL1201724",
                                "DRUGBANK:DB06812",
                                "PUBCHEM.COMPOUND:410087",
                                "CHEBI:8347",
                                "UMLS:C0032857",
                                "MESH:D011206",
                                "UNII:85H0HZU99M"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:33672": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:33672",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:33672"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:24621": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:24621",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:24621"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:29947": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "glycine residue",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:29947",
                                "name:glycine residue"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:53118": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "dTMP 3'-end residue",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:53118",
                                "name:dTMP 3'-end residue"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:33554": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "organosulfonate oxoanion",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:33554",
                                "name:organosulfonate oxoanion"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:33599": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:33599",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:33599"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:60425": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:60425",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:60425"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:33302": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:33302",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:33302"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:58945": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:58945",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:58945"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:28765": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:28765",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:28765"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:57586": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "biotinate",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "PUBCHEM.COMPOUND:6560210",
                                "CHEBI:57586",
                                "INCHIKEY:YBJHBAHKTGYVGT-ZKWXMUAHSA-M",
                                "INCHI:InChI=1S/C10H16N2O3S/c13-8(14)4-2-1-3-7-9-6(5-16-7)11-10(15)12-9/h6-7,9H,1-5H2,(H,13,14)(H2,11,12,15)/p-1/t6-,7-,9-/m0/s1",
                                "name:biotinate"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:52495": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:52495",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:52495"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:61662": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:61662",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:61662"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:22645": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:22645",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:22645"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:33485": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:33485",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:33485"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:38295": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:38295",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:38295"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:35358": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "sulfonamide",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:35358",
                                "name:sulfonamide"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:61536": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:61536",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:61536"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:35740": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:35740",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:35740"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:17992": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "SUCROSE",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEMBL.COMPOUND:CHEMBL253582",
                                "DRUGBANK:DB02772",
                                "PUBCHEM.COMPOUND:5988",
                                "CHEBI:17992",
                                "UMLS:C0038636",
                                "MESH:D013395",
                                "UNII:C151H8M554",
                                "INCHIKEY:CZMRCDWAGMRECN-UGDNZRGBSA-N",
                                "INCHI:InChI=1S/C12H22O11/c13-1-4-6(16)8(18)9(19)11(21-4)23-12(3-15)10(20)7(17)5(2-14)22-12/h4-11,13-20H,1-3H2/t4-,5-,6-,7-,8+,9-,10+,11-,12+/m1/s1",
                                "KEGG:C00089",
                                "name:SUCROSE",
                                "name:Sucrose",
                                "name:sucrose"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:16234": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "Hydroxide ion",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "DRUGBANK:DB14522",
                                "PUBCHEM.COMPOUND:961",
                                "CHEBI:16234",
                                "UMLS:C0220853",
                                "MESH:C031356",
                                "UNII:9159UV381P",
                                "INCHIKEY:XLYOFNOQVPJJNP-UHFFFAOYSA-M",
                                "INCHI:InChI=1S/H2O/h1H2/p-1",
                                "KEGG:C01328",
                                "name:Hydroxide ion",
                                "name:hydroxide ion",
                                "name:HYDROXIDE ION",
                                "name:hydroxide"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:23965": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "estradiol",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "PUBCHEM.COMPOUND:9811784",
                                "CHEBI:23965",
                                "INCHIKEY:VOXZDWNPVJITMN-WKUFJEKOSA-N",
                                "INCHI:InChI=1S/C18H24O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h3,5,10,14-17,19-20H,2,4,6-9H2,1H3/t14-,15-,16+,17?,18+/m1/s1",
                                "name:estradiol"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:61292": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:61292",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:61292"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:18133": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:18133",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:18133"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:25534": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:25534",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:25534"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:38443": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:38443",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:38443"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:36359": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:36359",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:36359"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:36878": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:36878",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:36878"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:5054": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "Fibrin",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "PUBCHEM.COMPOUND:439199",
                                "CHEBI:5054",
                                "UMLS:C0015982",
                                "MESH:D005337",
                                "UNII:9BKZ7NA5HT",
                                "INCHIKEY:BWGVNKXGVNDBDI-UHFFFAOYSA-N",
                                "INCHI:InChI=1S/C5H11N3O2/c1-7-5(10)3-8-4(9)2-6/h2-3,6H2,1H3,(H,7,10)(H,8,9)",
                                "name:Fibrin"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:48545": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:48545",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:48545"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:37096": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:37096",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:37096"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:38700": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:38700",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:38700"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:8583": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:8583",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:8583"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:24921": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:24921",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:24921"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:24402": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:24402",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:24402"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:16335": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "ADENOSINE",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEMBL.COMPOUND:CHEMBL477",
                                "DRUGBANK:DB00640",
                                "PUBCHEM.COMPOUND:60961",
                                "CHEBI:16335",
                                "UMLS:C0001443",
                                "MESH:D000241",
                                "UNII:K72T3FS567",
                                "INCHIKEY:OIRDTQYFTABQOQ-KQYNXXCUSA-N",
                                "INCHI:InChI=1S/C10H13N5O4/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(18)6(17)4(1-16)19-10/h2-4,6-7,10,16-18H,1H2,(H2,11,12,13)/t4-,6-,7-,10-/m1/s1",
                                "KEGG:C00212",
                                "name:ADENOSINE",
                                "name:Adenosine",
                                "name:adenosine"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:51570": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:51570",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:51570"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:33299": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:33299",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:33299"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:22260": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:22260",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:22260"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:26820": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:26820",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:26820"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:24913": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:24913",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:24913"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:16027": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "ADENOSINE PHOSPHATE",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEMBL.COMPOUND:CHEMBL752",
                                "DRUGBANK:DB00131",
                                "DRUGBANK:DB00640",
                                "PUBCHEM.COMPOUND:6083",
                                "CHEBI:16027",
                                "UMLS:C0001465",
                                "UMLS:C0001444",
                                "MESH:D000249",
                                "MESH:C037185",
                                "UNII:415SHH325A",
                                "INCHIKEY:UDMBCSSLTHHNCD-KQYNXXCUSA-N",
                                "INCHI:InChI=1S/C10H14N5O7P/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(22-10)1-21-23(18,19)20/h2-4,6-7,10,16-17H,1H2,(H2,11,12,13)(H2,18,19,20)/t4-,6-,7-,10-/m1/s1",
                                "KEGG:C00020",
                                "name:ADENOSINE PHOSPHATE",
                                "name:Adenosine phosphate",
                                "name:Adenosine 2'-Phosphate",
                                "name:adenosine monophosphate",
                                "name:adenosine 5'-monophosphate"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:41264": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "butyl group",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:41264",
                                "name:butyl group"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:27003": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "5'-thymidylyl group",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:27003",
                                "name:5'-thymidylyl group"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:18367": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "Phosphate ion",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "DRUGBANK:DB14523",
                                "PUBCHEM.COMPOUND:1061",
                                "CHEBI:18367",
                                "UNII:NK08V8K8HR",
                                "INCHIKEY:NBIIXXVUZAFLBC-UHFFFAOYSA-K",
                                "INCHI:InChI=1S/H3O4P/c1-5(2,3)4/h(H3,1,2,3,4)/p-3",
                                "name:Phosphate ion",
                                "name:PHOSPHATE ION",
                                "name:phosphate(3-)"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:33251": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "monoatomic hydrogen",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "PUBCHEM.COMPOUND:5362549",
                                "CHEBI:33251",
                                "CHEBI:29235",
                                "CHEBI:49637",
                                "UNII:7YNJ3PO35Z",
                                "INCHIKEY:YZCKVEUIGOORGS-UHFFFAOYSA-N",
                                "INCHI:InChI=1S/H",
                                "name:monoatomic hydrogen",
                                "name:hydrogen(.)",
                                "name:hydrogen atom"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:36916": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:36916",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:36916"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:80332": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:80332",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:80332"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:68472": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:68472",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:68472"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:64755": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "EDTA(2-)",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "PUBCHEM.COMPOUND:3383826",
                                "CHEBI:64755",
                                "INCHIKEY:KCXVZYZYPLLWCC-UHFFFAOYSA-L",
                                "INCHI:InChI=1S/C10H16N2O8/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20)/p-2",
                                "name:EDTA(2-)"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:60801": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:60801",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "value": [
                                "CHEBI:60801"
                            ],
                            "type": "biolink:id"
                        }
                    ]
                },
                "CHEBI:37176": {
                    "category": "biolink:ChemicalSubstance",
                    "name": "CHEBI:37176",
                    "attributes": [
                        {
                            "name": "equivalent_identifiers",
                            "v