diff --git a/R/otb_subbasin_loads.R b/R/otb_subbasin_loads.R deleted file mode 100644 index c69de51..0000000 --- a/R/otb_subbasin_loads.R +++ /dev/null @@ -1,85 +0,0 @@ -library(haven) -library(dplyr) -library(sf) -library(leaflet) -library(tibble) -library(tidyr) -library(leaflet) -library(mapedit) - -load(file = here::here('data/otbsub.RData')) - -pth <- 'T:/03_BOARDS_COMMITTEES/05_TBNMC/TB_LOADS/2022_RA_Deliverables/2017-2021Annual&MonthlyLoadDatasets/NPS1721/Monthly' - -dat <- read_sas(file.path(pth, 'allnuts1721monthbasin20221027.sas7bdat')) |> - filter(BAY_SEG == 1) - -shp <- st_read('T:/05_GIS/BOUNDARIES/TBEP_dBasins_Correct_Projection.shp') |> - filter(BAYSEGNAME == 'Old Tampa Bay') |> - st_transform(crs = 4326) - -gagebas <- shp |> - mutate( - subbasin = case_when( - NEWGAGE %in% 'LTARPON' ~ 'NW', - NEWGAGE %in% '02307359' ~ 'NW', - NEWGAGE %in% c('02307000', '02306647') ~ 'NE', - T ~ NA_character_ - ) - ) |> - filter(!is.na(subbasin)) - -# interactively select polygons on mapiew - -# create leaflet polygon map with ungage -m <- leaflet() |> - addProviderTiles('CartoDB.Positron') |> - addPolygons(data = shp[shp$NEWGAGE == '206-1', ], weight = 0.5) |> - addPolygons(data = otbsub) |> - addDrawToolbar( - targetGroup = 'draw', - editOptions = editToolbarOptions() - ) - -NW <- selectFeatures(ungage, map = m) -NE <- selectFeatures(ungage, map = m) -CW <- selectFeatures(ungage, map = m) -CE <- selectFeatures(ungage, map = m) -SW <- selectFeatures(ungage, map = m) -SE <- selectFeatures(ungage, map = m) - -ungagebas <- list( - NW = NW, - NE = NE, - CW = CW, - CE = CE, - SW = SW, - SE = SE - ) |> - enframe(name = 'subbasin', value = 'data') |> - unnest('data') |> - st_sf() - -allsubbas <- bind_rows(ungagebas, gagebas) - -save(allsubbas, file = here::here('data/allsubbas.RData')) - -tmp <- allsubbas |> - group_by(NEWGAGE, subbasin) |> - summarise() |> - ungroup() -tmp$acres <- as.numeric(st_area(tmp) / 4047) -tmp <- tmp |> - mutate( - prop = case_when( - NEWGAGE != '206-1' ~ 1, - TRUE ~ acres / sum(acres) - ) - ) |> - st_set_geometry(NULL) - -# tmp2 <- dat |> -# select(basin, source, year, month, tnload) |> -# left_join(tmp, by = c('basin' = 'NEWGAGE'), relationship = 'many-to-many') |> -# mutate(tnload = tnload * prop) -# # verify proportional sums are same as dat sums for tn load diff --git a/README.md b/README.md index e69b806..6d2345f 100644 --- a/README.md +++ b/README.md @@ -8,6 +8,8 @@ * GLM of monthly chlorophyll attainment for sug-segments [link](https://tbep-tech.github.io/otbasscap-data/chlmoattain.html) +* Explanation of monthly load data assignment to OTB subsegments [link](https://tbep-tech.github.io/otbasscap-data/otb_subbasin_loads.html) + ---------------------- ## ./data/winwq.RData diff --git a/data-raw/TBEP_dBasins_Correct_Projection.dbf b/data-raw/TBEP_dBasins_Correct_Projection.dbf new file mode 100644 index 0000000..e259188 Binary files /dev/null and b/data-raw/TBEP_dBasins_Correct_Projection.dbf differ diff --git a/data-raw/TBEP_dBasins_Correct_Projection.prj b/data-raw/TBEP_dBasins_Correct_Projection.prj new file mode 100644 index 0000000..6318bf9 --- /dev/null +++ b/data-raw/TBEP_dBasins_Correct_Projection.prj @@ -0,0 +1 @@ +PROJCS["NAD_1983_HARN_UTM_Zone_17N",GEOGCS["GCS_North_American_1983_HARN",DATUM["D_North_American_1983_HARN",SPHEROID["GRS_1980",6378137.0,298.257222101]],PRIMEM["Greenwich",0.0],UNIT["Degree",0.0174532925199433]],PROJECTION["Transverse_Mercator"],PARAMETER["False_Easting",500000.0],PARAMETER["False_Northing",0.0],PARAMETER["Central_Meridian",-81.0],PARAMETER["Scale_Factor",0.9996],PARAMETER["Latitude_Of_Origin",0.0],UNIT["Meter",1.0]] \ No newline at end of file diff --git a/data-raw/TBEP_dBasins_Correct_Projection.sbn b/data-raw/TBEP_dBasins_Correct_Projection.sbn new file mode 100644 index 0000000..3e417c9 Binary files /dev/null and b/data-raw/TBEP_dBasins_Correct_Projection.sbn differ diff --git a/data-raw/TBEP_dBasins_Correct_Projection.sbx b/data-raw/TBEP_dBasins_Correct_Projection.sbx new file mode 100644 index 0000000..bbfc272 Binary files /dev/null and b/data-raw/TBEP_dBasins_Correct_Projection.sbx differ diff --git a/data-raw/TBEP_dBasins_Correct_Projection.shp b/data-raw/TBEP_dBasins_Correct_Projection.shp new file mode 100644 index 0000000..cfb4604 Binary files /dev/null and b/data-raw/TBEP_dBasins_Correct_Projection.shp differ diff --git a/data-raw/TBEP_dBasins_Correct_Projection.shx b/data-raw/TBEP_dBasins_Correct_Projection.shx new file mode 100644 index 0000000..1d13992 Binary files /dev/null and b/data-raw/TBEP_dBasins_Correct_Projection.shx differ diff --git a/data-raw/allnuts1721monthbasin20221027.sas7bdat b/data-raw/allnuts1721monthbasin20221027.sas7bdat new file mode 100644 index 0000000..b27c820 Binary files /dev/null and b/data-raw/allnuts1721monthbasin20221027.sas7bdat differ diff --git a/data/allsubbas.RData b/data/allsubbas.RData index 68360f4..cbf931c 100644 Binary files a/data/allsubbas.RData and b/data/allsubbas.RData differ diff --git a/docs/otb_subbasin_loads.html b/docs/otb_subbasin_loads.html new file mode 100644 index 0000000..0df92b4 --- /dev/null +++ b/docs/otb_subbasin_loads.html @@ -0,0 +1,722 @@ + + + + + + + + + +Assigning OTB loadings to sub-segments + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ +
+ +
+
+

Assigning OTB loadings to sub-segments

+
+ + + +
+ + + + +
+ + + +
+ + +

This document provides a brief explanation of load assignments to sub-segments of Old Tampa Bay based on likely sub-basins. It address the problem of total loads assigned to Old Tampa Bay as a whole. An interim dataset provided by Janicki Env. that assigns monthly loading to gaged and ungaged portions of Old Tampa Bay is used for the assignments.

+

First, the required libraries and loading dataset are loaded.

+
+
library(haven)
+library(dplyr)
+library(sf)
+library(tibble)
+library(tidyr)
+library(leaflet)
+library(mapedit)
+
+# OTB sub-segments
+load(file = here::here('data/otbsub.RData'))
+
+# basin loading data
+# original here T:/03_BOARDS_COMMITTEES/05_TBNMC/TB_LOADS/2022_RA_Deliverables/2017-2021Annual&MonthlyLoadDatasets/NPS1721/Monthly
+dat <- read_sas(here::here('data-raw/allnuts1721monthbasin20221027.sas7bdat')) |> 
+  filter(BAY_SEG == 1)
+head(dat)
+
+
# A tibble: 6 × 10
+  BAY_SEG basin    source  year month tnload tpload tssload BODLOAD  h2oload
+    <dbl> <chr>    <chr>  <dbl> <dbl>  <dbl>  <dbl>   <dbl>   <dbl>    <dbl>
+1       1 02306647 NPS     2017     1  0.270 0.0538    8.32    1.53  177942.
+2       1 02306647 NPS     2017     2  0.355 0.0717   11.1     2.04  237138.
+3       1 02306647 NPS     2017     3  0.280 0.0572    8.85    1.63  189218.
+4       1 02306647 NPS     2017     4  0.225 0.0435    6.73    1.24  143787.
+5       1 02306647 NPS     2017     5  0.195 0.0358    5.54    1.02  118492.
+6       1 02306647 NPS     2017     6  3.37  0.683   106.     19.5  2260524.
+
+
+

The basin column describes the gaged and ungaged basins for each loading estimate. The basin 206-1 is ungaged.

+
+
unique(dat$basin)
+
+
[1] "02306647" "02307000" "206-1"    "LTARPON" 
+
+
+

We can view a map of these basins using the dbasin shapefile.

+
+
# dbasins shapefile
+# original here T:/05_GIS/BOUNDARIES
+shp <- st_read(here::here('data-raw/TBEP_dBasins_Correct_Projection.shp'), quiet = T) |>
+  filter(BAYSEGNAME == 'Old Tampa Bay') |>
+  st_transform(crs = 4326)
+
+tomap <- shp |> 
+  group_by(NEWGAGE) |> 
+  summarise()
+
+pal <- colorFactor(
+  palette = 'viridis', 
+  domain = tomap$NEWGAGE
+)
+
+leaflet() |> 
+  addProviderTiles('CartoDB.Positron') |>
+  addPolygons(data = tomap, weight =  0.5, fillColor = ~pal(NEWGAGE), fillOpacity = 0.9) |>
+  addPolygons(data = otbsub, label = ~paste(subseg)) |> 
+  addLegend(
+    pal = pal,
+    values = tomap$NEWGAGE,
+    opacity = 0.9,
+    title = "Basin",
+    position = "bottomright"
+  )
+
+
+ +
+
+

Loadings from the gaged portions (02307000, 02306647, 02307359, LTARPON) can be assigned to sub-segments based on drainage location (02307359, LTARPON drain to the NW subsegment; 02307000, 02306647 drain to the NE subsegment). The loadings for the ungaged portion (206-1) can be proportionately assigned based on the approximate area that likely drains to each sub-segment. The sub-basins in the dbasin area are interactively assigned to each sub-segment based on location in 206-1.

+
+
# this is all done interactively, saved file is loaded below
+
+# gaged portion with sub-segment assignment
+gagebas <- shp |> 
+ mutate(
+   subsegment = case_when(
+     NEWGAGE %in% 'LTARPON' ~ 'NW', 
+     NEWGAGE %in% '02307359' ~ 'NW', 
+     NEWGAGE %in% c('02307000', '02306647') ~ 'NE', 
+     T ~ NA_character_   
+   )
+ ) |> 
+ filter(!is.na(subsegment))
+
+# create leaflet polygon map with ungage
+m <- leaflet() |> 
+ addProviderTiles('CartoDB.Positron') |> 
+ addPolygons(data = shp[shp$NEWGAGE == '206-1', ], weight =  0.5) |> 
+ addPolygons(data = otbsub) |> 
+ addDrawToolbar(
+   targetGroup = 'draw',
+   editOptions = editToolbarOptions()
+ )
+
+# use interactive selection
+NW <- selectFeatures(ungage, map = m)
+NE <- selectFeatures(ungage, map = m)
+CW <- selectFeatures(ungage, map = m)
+CE <- selectFeatures(ungage, map = m)
+SW <- selectFeatures(ungage, map = m)
+SE <- selectFeatures(ungage, map = m)
+
+ungagebas <- list(
+ NW = NW,  
+ NE = NE,
+ CW = CW,
+ CE = CE,
+ SW = SW,
+ SE = SE
+ ) |> 
+ enframe(name = 'subsegment', value = 'data') |> 
+ unnest('data') |> 
+ st_sf()
+
+allsubbas <- bind_rows(ungagebas, gagebas) 
+
+save(allsubbas, file = here::here('data/allsubbas.RData'))
+
+

The previously created file is loaded. This is how the assignment looks. The original gaged and ungaged areas are outlined in red.

+
+
load(file = here::here('data/allsubbas.RData'))
+
+pal <- colorFactor(
+  palette = 'viridis', 
+  domain = allsubbas$subsegment
+)
+
+leaflet() |> 
+  addProviderTiles('CartoDB.Positron') |>
+  addPolygons(data = allsubbas, weight =  0.5, fillOpacity = 0.9, fillColor = ~pal(subsegment)) |>
+  addPolygons(data = otbsub, label = ~paste(subseg)) |> 
+  addPolygons(data = tomap, weight =  2, fillOpacity = 0, color = 'red') |>
+  addLegend(
+    pal = pal,
+    values = allsubbas$subsegment,
+    opacity = 0.9,
+    title = "Sub-segment",
+    position = "bottomright"
+  )
+
+
+ +
+
+

Next, a data object that shows how to proportionally assign the loads to each subsegment based on the gaged and ungaged portions is created. The gaged portions are given a 1, meaning their loadings are used as is, and the ungaged portion is given a proportion based on the area attributed to each subsegment.

+
+
# get tn load proportion multipliers based on basin area attributed to ungaged portions
+props <- allsubbas |> 
+  group_by(NEWGAGE, subsegment) |> 
+  summarise() |> 
+  ungroup()
+props$acres <- as.numeric(st_area(props) / 4047)
+props <- props |> 
+  mutate(
+    prop = case_when(
+      NEWGAGE != '206-1' ~ 1,
+      TRUE ~ acres / sum(acres[NEWGAGE == '206-1'])
+    )
+  ) |> 
+  st_set_geometry(NULL)
+props
+
+
# A tibble: 10 × 4
+   NEWGAGE  subsegment  acres   prop
+ * <chr>    <chr>       <dbl>  <dbl>
+ 1 02306647 NE         12231. 1     
+ 2 02307000 NE         28852. 1     
+ 3 02307359 NW         23273. 1     
+ 4 206-1    CE          5563. 0.0642
+ 5 206-1    CW         23367. 0.270 
+ 6 206-1    NE         33685. 0.389 
+ 7 206-1    NW         14502. 0.167 
+ 8 206-1    SE          8147. 0.0940
+ 9 206-1    SW          1411. 0.0163
+10 LTARPON  NW         13734. 1     
+
+
+

The props object is joined to the original loading data using the gaged/ungaged column in each. The load is proportioned for each year/month/location by multiplying the original by the prop column in props.

+
+
datprop <- dat |>
+  select(basin, source, year, month, tnload) |>
+  left_join(props, by = c('basin' = 'NEWGAGE'), relationship = 'many-to-many') |>
+  mutate(tnload = tnload * prop)
+datprop
+
+
# A tibble: 1,380 × 8
+   basin    source  year month tnload subsegment  acres  prop
+   <chr>    <chr>  <dbl> <dbl>  <dbl> <chr>       <dbl> <dbl>
+ 1 02306647 NPS     2017     1  0.270 NE         12231.     1
+ 2 02306647 NPS     2017     2  0.355 NE         12231.     1
+ 3 02306647 NPS     2017     3  0.280 NE         12231.     1
+ 4 02306647 NPS     2017     4  0.225 NE         12231.     1
+ 5 02306647 NPS     2017     5  0.195 NE         12231.     1
+ 6 02306647 NPS     2017     6  3.37  NE         12231.     1
+ 7 02306647 NPS     2017     7  3.58  NE         12231.     1
+ 8 02306647 NPS     2017     8  7.54  NE         12231.     1
+ 9 02306647 NPS     2017     9 12.2   NE         12231.     1
+10 02306647 NPS     2017    10  2.20  NE         12231.     1
+# ℹ 1,370 more rows
+
+
+

The total loading is the same between the original dataset and the proportionally assigned dataset.

+
+
sum(datprop$tnload)
+
+
[1] 1991.495
+
+
sum(dat$tnload)
+
+
[1] 1991.495
+
+
+

This example uses data only for the 2017 to 2021 RA period. For use with CASM, the monthly data must be interpolated to a daily time step and previous years must be added.

+ +
+ + +
+ + + + + \ No newline at end of file diff --git a/docs/otb_subbasin_loads.qmd b/docs/otb_subbasin_loads.qmd new file mode 100644 index 0000000..f3451c8 --- /dev/null +++ b/docs/otb_subbasin_loads.qmd @@ -0,0 +1,191 @@ +--- +title: "Assigning OTB loadings to sub-segments" +format: + html: + code-fold: false +editor: source +lightbox: true + +execute: + warning: false + message: false + echo: true +--- + +This document provides a brief explanation of load assignments to sub-segments of Old Tampa Bay based on likely sub-basins. It address the problem of total loads assigned to Old Tampa Bay as a whole. An interim dataset provided by Janicki Env. that assigns monthly loading to gaged and ungaged portions of Old Tampa Bay is used for the assignments. + +First, the required libraries and loading dataset are loaded. + +```{r} +library(haven) +library(dplyr) +library(sf) +library(tibble) +library(tidyr) +library(leaflet) +library(mapedit) + +# OTB sub-segments +load(file = here::here('data/otbsub.RData')) + +# basin loading data +# original here T:/03_BOARDS_COMMITTEES/05_TBNMC/TB_LOADS/2022_RA_Deliverables/2017-2021Annual&MonthlyLoadDatasets/NPS1721/Monthly +dat <- read_sas(here::here('data-raw/allnuts1721monthbasin20221027.sas7bdat')) |> + filter(BAY_SEG == 1) +head(dat) +``` + +The `basin` column describes the gaged and ungaged basins for each loading estimate. The basin `206-1` is ungaged. + +```{r} +unique(dat$basin) +``` + +We can view a map of these basins using the `dbasin` shapefile. + +```{r} +#| out-width: '100%' +# dbasins shapefile +# original here T:/05_GIS/BOUNDARIES +shp <- st_read(here::here('data-raw/TBEP_dBasins_Correct_Projection.shp'), quiet = T) |> + filter(BAYSEGNAME == 'Old Tampa Bay') |> + st_transform(crs = 4326) + +tomap <- shp |> + group_by(NEWGAGE) |> + summarise() + +pal <- colorFactor( + palette = 'viridis', + domain = tomap$NEWGAGE +) + +leaflet() |> + addProviderTiles('CartoDB.Positron') |> + addPolygons(data = tomap, weight = 0.5, fillColor = ~pal(NEWGAGE), fillOpacity = 0.9) |> + addPolygons(data = otbsub, label = ~paste(subseg)) |> + addLegend( + pal = pal, + values = tomap$NEWGAGE, + opacity = 0.9, + title = "Basin", + position = "bottomright" + ) +``` + +Loadings from the gaged portions (02307000, 02306647, 02307359, LTARPON) can be assigned to sub-segments based on drainage location (02307359, LTARPON drain to the NW subsegment; 02307000, 02306647 drain to the NE subsegment). The loadings for the ungaged portion (206-1) can be proportionately assigned based on the approximate area that likely drains to each sub-segment. The sub-basins in the `dbasin` area are interactively assigned to each sub-segment based on location in 206-1. + +```{r} +#| eval: false +# this is all done interactively, saved file is loaded below + +# gaged portion with sub-segment assignment +gagebas <- shp |> + mutate( + subsegment = case_when( + NEWGAGE %in% 'LTARPON' ~ 'NW', + NEWGAGE %in% '02307359' ~ 'NW', + NEWGAGE %in% c('02307000', '02306647') ~ 'NE', + T ~ NA_character_ + ) + ) |> + filter(!is.na(subsegment)) + +# create leaflet polygon map with ungage +m <- leaflet() |> + addProviderTiles('CartoDB.Positron') |> + addPolygons(data = shp[shp$NEWGAGE == '206-1', ], weight = 0.5) |> + addPolygons(data = otbsub) |> + addDrawToolbar( + targetGroup = 'draw', + editOptions = editToolbarOptions() + ) + +# use interactive selection +NW <- selectFeatures(ungage, map = m) +NE <- selectFeatures(ungage, map = m) +CW <- selectFeatures(ungage, map = m) +CE <- selectFeatures(ungage, map = m) +SW <- selectFeatures(ungage, map = m) +SE <- selectFeatures(ungage, map = m) + +ungagebas <- list( + NW = NW, + NE = NE, + CW = CW, + CE = CE, + SW = SW, + SE = SE + ) |> + enframe(name = 'subsegment', value = 'data') |> + unnest('data') |> + st_sf() + +allsubbas <- bind_rows(ungagebas, gagebas) + +save(allsubbas, file = here::here('data/allsubbas.RData')) +``` + +The previously created file is loaded. This is how the assignment looks. The original gaged and ungaged areas are outlined in red. + +```{r} +#| out-width: '100%' +load(file = here::here('data/allsubbas.RData')) + +pal <- colorFactor( + palette = 'viridis', + domain = allsubbas$subsegment +) + +leaflet() |> + addProviderTiles('CartoDB.Positron') |> + addPolygons(data = allsubbas, weight = 0.5, fillOpacity = 0.9, fillColor = ~pal(subsegment)) |> + addPolygons(data = otbsub, label = ~paste(subseg)) |> + addPolygons(data = tomap, weight = 2, fillOpacity = 0, color = 'red') |> + addLegend( + pal = pal, + values = allsubbas$subsegment, + opacity = 0.9, + title = "Sub-segment", + position = "bottomright" + ) +``` + +Next, a data object that shows how to proportionally assign the loads to each subsegment based on the gaged and ungaged portions is created. The gaged portions are given a 1, meaning their loadings are used as is, and the ungaged portion is given a proportion based on the area attributed to each subsegment. + +```{r} +# get tn load proportion multipliers based on basin area attributed to ungaged portions +props <- allsubbas |> + group_by(NEWGAGE, subsegment) |> + summarise() |> + ungroup() +props$acres <- as.numeric(st_area(props) / 4047) +props <- props |> + mutate( + prop = case_when( + NEWGAGE != '206-1' ~ 1, + TRUE ~ acres / sum(acres[NEWGAGE == '206-1']) + ) + ) |> + st_set_geometry(NULL) +props +``` + +The `props` object is joined to the original loading data using the gaged/ungaged column in each. The load is proportioned for each year/month/location by multiplying the original by the `prop` column in `props`. + +```{r} +datprop <- dat |> + select(basin, source, year, month, tnload) |> + left_join(props, by = c('basin' = 'NEWGAGE'), relationship = 'many-to-many') |> + mutate(tnload = tnload * prop) +datprop +``` + +The total loading is the same between the original dataset and the proportionally assigned dataset. + +```{r} +sum(datprop$tnload) +sum(dat$tnload) +``` + +This example uses data only for the 2017 to 2021 RA period. For use with CASM, the monthly data must be interpolated to a daily time step and previous years must be added. diff --git a/docs/otb_subbasin_loads_files/libs/Proj4Leaflet-1.0.1/proj4leaflet.js b/docs/otb_subbasin_loads_files/libs/Proj4Leaflet-1.0.1/proj4leaflet.js new file mode 100644 index 0000000..5ce8d47 --- /dev/null +++ b/docs/otb_subbasin_loads_files/libs/Proj4Leaflet-1.0.1/proj4leaflet.js @@ -0,0 +1,272 @@ +(function (factory) { + var L, proj4; + if (typeof define === 'function' && define.amd) { + // AMD + define(['leaflet', 'proj4'], factory); + } else if (typeof module === 'object' && typeof module.exports === "object") { + // Node/CommonJS + L = require('leaflet'); + proj4 = require('proj4'); + module.exports = factory(L, proj4); + } else { + // Browser globals + if (typeof window.L === 'undefined' || typeof window.proj4 === 'undefined') + throw 'Leaflet and proj4 must be loaded first'; + factory(window.L, window.proj4); + } +}(function (L, proj4) { + if (proj4.__esModule && proj4.default) { + // If proj4 was bundled as an ES6 module, unwrap it to get + // to the actual main proj4 object. + // See discussion in https://github.com/kartena/Proj4Leaflet/pull/147 + proj4 = proj4.default; + } + + L.Proj = {}; + + L.Proj._isProj4Obj = function(a) { + return (typeof a.inverse !== 'undefined' && + typeof a.forward !== 'undefined'); + }; + + L.Proj.Projection = L.Class.extend({ + initialize: function(code, def, bounds) { + var isP4 = L.Proj._isProj4Obj(code); + this._proj = isP4 ? code : this._projFromCodeDef(code, def); + this.bounds = isP4 ? def : bounds; + }, + + project: function (latlng) { + var point = this._proj.forward([latlng.lng, latlng.lat]); + return new L.Point(point[0], point[1]); + }, + + unproject: function (point, unbounded) { + var point2 = this._proj.inverse([point.x, point.y]); + return new L.LatLng(point2[1], point2[0], unbounded); + }, + + _projFromCodeDef: function(code, def) { + if (def) { + proj4.defs(code, def); + } else if (proj4.defs[code] === undefined) { + var urn = code.split(':'); + if (urn.length > 3) { + code = urn[urn.length - 3] + ':' + urn[urn.length - 1]; + } + if (proj4.defs[code] === undefined) { + throw 'No projection definition for code ' + code; + } + } + + return proj4(code); + } + }); + + L.Proj.CRS = L.Class.extend({ + includes: L.CRS, + + options: { + transformation: new L.Transformation(1, 0, -1, 0) + }, + + initialize: function(a, b, c) { + var code, + proj, + def, + options; + + if (L.Proj._isProj4Obj(a)) { + proj = a; + code = proj.srsCode; + options = b || {}; + + this.projection = new L.Proj.Projection(proj, options.bounds); + } else { + code = a; + def = b; + options = c || {}; + this.projection = new L.Proj.Projection(code, def, options.bounds); + } + + L.Util.setOptions(this, options); + this.code = code; + this.transformation = this.options.transformation; + + if (this.options.origin) { + this.transformation = + new L.Transformation(1, -this.options.origin[0], + -1, this.options.origin[1]); + } + + if (this.options.scales) { + this._scales = this.options.scales; + } else if (this.options.resolutions) { + this._scales = []; + for (var i = this.options.resolutions.length - 1; i >= 0; i--) { + if (this.options.resolutions[i]) { + this._scales[i] = 1 / this.options.resolutions[i]; + } + } + } + + this.infinite = !this.options.bounds; + + }, + + scale: function(zoom) { + var iZoom = Math.floor(zoom), + baseScale, + nextScale, + scaleDiff, + zDiff; + if (zoom === iZoom) { + return this._scales[zoom]; + } else { + // Non-integer zoom, interpolate + baseScale = this._scales[iZoom]; + nextScale = this._scales[iZoom + 1]; + scaleDiff = nextScale - baseScale; + zDiff = (zoom - iZoom); + return baseScale + scaleDiff * zDiff; + } + }, + + zoom: function(scale) { + // Find closest number in this._scales, down + var downScale = this._closestElement(this._scales, scale), + downZoom = this._scales.indexOf(downScale), + nextScale, + nextZoom, + scaleDiff; + // Check if scale is downScale => return array index + if (scale === downScale) { + return downZoom; + } + if (downScale === undefined) { + return -Infinity; + } + // Interpolate + nextZoom = downZoom + 1; + nextScale = this._scales[nextZoom]; + if (nextScale === undefined) { + return Infinity; + } + scaleDiff = nextScale - downScale; + return (scale - downScale) / scaleDiff + downZoom; + }, + + distance: L.CRS.Earth.distance, + + R: L.CRS.Earth.R, + + /* Get the closest lowest element in an array */ + _closestElement: function(array, element) { + var low; + for (var i = array.length; i--;) { + if (array[i] <= element && (low === undefined || low < array[i])) { + low = array[i]; + } + } + return low; + } + }); + + L.Proj.GeoJSON = L.GeoJSON.extend({ + initialize: function(geojson, options) { + this._callLevel = 0; + L.GeoJSON.prototype.initialize.call(this, geojson, options); + }, + + addData: function(geojson) { + var crs; + + if (geojson) { + if (geojson.crs && geojson.crs.type === 'name') { + crs = new L.Proj.CRS(geojson.crs.properties.name); + } else if (geojson.crs && geojson.crs.type) { + crs = new L.Proj.CRS(geojson.crs.type + ':' + geojson.crs.properties.code); + } + + if (crs !== undefined) { + this.options.coordsToLatLng = function(coords) { + var point = L.point(coords[0], coords[1]); + return crs.projection.unproject(point); + }; + } + } + + // Base class' addData might call us recursively, but + // CRS shouldn't be cleared in that case, since CRS applies + // to the whole GeoJSON, inluding sub-features. + this._callLevel++; + try { + L.GeoJSON.prototype.addData.call(this, geojson); + } finally { + this._callLevel--; + if (this._callLevel === 0) { + delete this.options.coordsToLatLng; + } + } + } + }); + + L.Proj.geoJson = function(geojson, options) { + return new L.Proj.GeoJSON(geojson, options); + }; + + L.Proj.ImageOverlay = L.ImageOverlay.extend({ + initialize: function (url, bounds, options) { + L.ImageOverlay.prototype.initialize.call(this, url, null, options); + this._projectedBounds = bounds; + }, + + // Danger ahead: Overriding internal methods in Leaflet. + // Decided to do this rather than making a copy of L.ImageOverlay + // and doing very tiny modifications to it. + // Future will tell if this was wise or not. + _animateZoom: function (event) { + var scale = this._map.getZoomScale(event.zoom); + var northWest = L.point(this._projectedBounds.min.x, this._projectedBounds.max.y); + var offset = this._projectedToNewLayerPoint(northWest, event.zoom, event.center); + + L.DomUtil.setTransform(this._image, offset, scale); + }, + + _reset: function () { + var zoom = this._map.getZoom(); + var pixelOrigin = this._map.getPixelOrigin(); + var bounds = L.bounds( + this._transform(this._projectedBounds.min, zoom)._subtract(pixelOrigin), + this._transform(this._projectedBounds.max, zoom)._subtract(pixelOrigin) + ); + var size = bounds.getSize(); + + L.DomUtil.setPosition(this._image, bounds.min); + this._image.style.width = size.x + 'px'; + this._image.style.height = size.y + 'px'; + }, + + _projectedToNewLayerPoint: function (point, zoom, center) { + var viewHalf = this._map.getSize()._divideBy(2); + var newTopLeft = this._map.project(center, zoom)._subtract(viewHalf)._round(); + var topLeft = newTopLeft.add(this._map._getMapPanePos()); + + return this._transform(point, zoom)._subtract(topLeft); + }, + + _transform: function (point, zoom) { + var crs = this._map.options.crs; + var transformation = crs.transformation; + var scale = crs.scale(zoom); + + return transformation.transform(point, scale); + } + }); + + L.Proj.imageOverlay = function (url, bounds, options) { + return new L.Proj.ImageOverlay(url, bounds, options); + }; + + return L.Proj; +})); diff --git a/docs/otb_subbasin_loads_files/libs/bootstrap/bootstrap-icons.css b/docs/otb_subbasin_loads_files/libs/bootstrap/bootstrap-icons.css new file mode 100644 index 0000000..285e444 --- /dev/null +++ b/docs/otb_subbasin_loads_files/libs/bootstrap/bootstrap-icons.css @@ -0,0 +1,2078 @@ +/*! + * Bootstrap Icons v1.11.1 (https://icons.getbootstrap.com/) + * Copyright 2019-2023 The Bootstrap Authors + * Licensed under MIT (https://github.com/twbs/icons/blob/main/LICENSE) + */ + +@font-face { + font-display: block; + font-family: "bootstrap-icons"; + src: +url("./bootstrap-icons.woff?2820a3852bdb9a5832199cc61cec4e65") format("woff"); +} + +.bi::before, +[class^="bi-"]::before, +[class*=" bi-"]::before { + display: inline-block; + font-family: bootstrap-icons !important; + font-style: normal; + font-weight: normal !important; + font-variant: normal; + text-transform: none; + line-height: 1; + vertical-align: -.125em; + -webkit-font-smoothing: antialiased; + -moz-osx-font-smoothing: grayscale; +} + +.bi-123::before { content: "\f67f"; } +.bi-alarm-fill::before { content: "\f101"; } +.bi-alarm::before { content: "\f102"; } +.bi-align-bottom::before { content: "\f103"; } +.bi-align-center::before { content: "\f104"; } +.bi-align-end::before { content: "\f105"; } +.bi-align-middle::before { content: "\f106"; } +.bi-align-start::before { content: "\f107"; } +.bi-align-top::before { content: "\f108"; } +.bi-alt::before { content: "\f109"; } +.bi-app-indicator::before { content: "\f10a"; } +.bi-app::before { content: "\f10b"; } +.bi-archive-fill::before { content: "\f10c"; } +.bi-archive::before { content: "\f10d"; } +.bi-arrow-90deg-down::before { content: "\f10e"; } +.bi-arrow-90deg-left::before { content: "\f10f"; } +.bi-arrow-90deg-right::before { content: "\f110"; } +.bi-arrow-90deg-up::before { content: "\f111"; } +.bi-arrow-bar-down::before { content: "\f112"; } +.bi-arrow-bar-left::before { content: "\f113"; } +.bi-arrow-bar-right::before { content: "\f114"; } +.bi-arrow-bar-up::before { content: "\f115"; } +.bi-arrow-clockwise::before { content: "\f116"; } +.bi-arrow-counterclockwise::before { content: "\f117"; } +.bi-arrow-down-circle-fill::before { content: "\f118"; } +.bi-arrow-down-circle::before { content: "\f119"; } +.bi-arrow-down-left-circle-fill::before { content: "\f11a"; } +.bi-arrow-down-left-circle::before { content: "\f11b"; } +.bi-arrow-down-left-square-fill::before { content: "\f11c"; } +.bi-arrow-down-left-square::before { content: "\f11d"; } +.bi-arrow-down-left::before { content: "\f11e"; } +.bi-arrow-down-right-circle-fill::before { content: "\f11f"; } +.bi-arrow-down-right-circle::before { content: "\f120"; } +.bi-arrow-down-right-square-fill::before { content: "\f121"; } +.bi-arrow-down-right-square::before { content: "\f122"; } +.bi-arrow-down-right::before { content: "\f123"; } +.bi-arrow-down-short::before { content: "\f124"; } +.bi-arrow-down-square-fill::before { content: "\f125"; } +.bi-arrow-down-square::before { content: "\f126"; } +.bi-arrow-down-up::before { content: "\f127"; } +.bi-arrow-down::before { content: "\f128"; } +.bi-arrow-left-circle-fill::before { content: "\f129"; } +.bi-arrow-left-circle::before { content: "\f12a"; } +.bi-arrow-left-right::before { content: "\f12b"; } +.bi-arrow-left-short::before { content: "\f12c"; } +.bi-arrow-left-square-fill::before { content: "\f12d"; } +.bi-arrow-left-square::before { content: "\f12e"; } +.bi-arrow-left::before { content: "\f12f"; } +.bi-arrow-repeat::before { content: "\f130"; } +.bi-arrow-return-left::before { content: "\f131"; } +.bi-arrow-return-right::before { content: "\f132"; } +.bi-arrow-right-circle-fill::before { content: "\f133"; } +.bi-arrow-right-circle::before { content: "\f134"; } +.bi-arrow-right-short::before { content: "\f135"; } +.bi-arrow-right-square-fill::before { content: "\f136"; } +.bi-arrow-right-square::before { content: "\f137"; } +.bi-arrow-right::before { content: "\f138"; } +.bi-arrow-up-circle-fill::before { content: "\f139"; } +.bi-arrow-up-circle::before { content: "\f13a"; } +.bi-arrow-up-left-circle-fill::before { content: "\f13b"; } +.bi-arrow-up-left-circle::before { content: "\f13c"; } +.bi-arrow-up-left-square-fill::before { content: "\f13d"; } +.bi-arrow-up-left-square::before { content: "\f13e"; } +.bi-arrow-up-left::before { content: "\f13f"; } +.bi-arrow-up-right-circle-fill::before { content: "\f140"; } +.bi-arrow-up-right-circle::before { content: "\f141"; } +.bi-arrow-up-right-square-fill::before { content: "\f142"; } +.bi-arrow-up-right-square::before { content: "\f143"; } +.bi-arrow-up-right::before { content: "\f144"; } +.bi-arrow-up-short::before { content: "\f145"; } +.bi-arrow-up-square-fill::before { content: "\f146"; } +.bi-arrow-up-square::before { content: "\f147"; } +.bi-arrow-up::before { content: "\f148"; } +.bi-arrows-angle-contract::before { content: "\f149"; } +.bi-arrows-angle-expand::before { content: "\f14a"; } +.bi-arrows-collapse::before { content: "\f14b"; } +.bi-arrows-expand::before { content: "\f14c"; } +.bi-arrows-fullscreen::before { content: "\f14d"; } +.bi-arrows-move::before { content: "\f14e"; } +.bi-aspect-ratio-fill::before { content: "\f14f"; } +.bi-aspect-ratio::before { content: "\f150"; } +.bi-asterisk::before { content: "\f151"; } +.bi-at::before { content: "\f152"; } +.bi-award-fill::before { content: "\f153"; } +.bi-award::before { content: "\f154"; } +.bi-back::before { content: "\f155"; } +.bi-backspace-fill::before { content: "\f156"; } +.bi-backspace-reverse-fill::before { content: "\f157"; } +.bi-backspace-reverse::before { content: "\f158"; } +.bi-backspace::before { content: "\f159"; } +.bi-badge-3d-fill::before { content: "\f15a"; } +.bi-badge-3d::before { content: "\f15b"; } +.bi-badge-4k-fill::before { content: "\f15c"; } +.bi-badge-4k::before { content: "\f15d"; } +.bi-badge-8k-fill::before { content: "\f15e"; } +.bi-badge-8k::before { content: "\f15f"; } +.bi-badge-ad-fill::before { content: "\f160"; } +.bi-badge-ad::before { content: "\f161"; } +.bi-badge-ar-fill::before { content: "\f162"; } +.bi-badge-ar::before { content: "\f163"; } +.bi-badge-cc-fill::before { content: "\f164"; } +.bi-badge-cc::before { content: "\f165"; } +.bi-badge-hd-fill::before { content: "\f166"; } +.bi-badge-hd::before { content: "\f167"; } +.bi-badge-tm-fill::before { content: "\f168"; } +.bi-badge-tm::before { content: "\f169"; } +.bi-badge-vo-fill::before { content: "\f16a"; } +.bi-badge-vo::before { content: "\f16b"; } +.bi-badge-vr-fill::before { content: "\f16c"; } +.bi-badge-vr::before { content: "\f16d"; } +.bi-badge-wc-fill::before { content: "\f16e"; } +.bi-badge-wc::before { content: "\f16f"; } +.bi-bag-check-fill::before { content: "\f170"; } +.bi-bag-check::before { content: "\f171"; } +.bi-bag-dash-fill::before { content: "\f172"; } +.bi-bag-dash::before { content: "\f173"; } +.bi-bag-fill::before { content: "\f174"; } +.bi-bag-plus-fill::before { content: "\f175"; } +.bi-bag-plus::before { content: "\f176"; } +.bi-bag-x-fill::before { content: "\f177"; } +.bi-bag-x::before { content: "\f178"; } +.bi-bag::before { content: "\f179"; } +.bi-bar-chart-fill::before { content: "\f17a"; } +.bi-bar-chart-line-fill::before { content: "\f17b"; } +.bi-bar-chart-line::before { content: "\f17c"; } +.bi-bar-chart-steps::before { content: "\f17d"; } +.bi-bar-chart::before { content: "\f17e"; } +.bi-basket-fill::before { content: "\f17f"; } +.bi-basket::before { content: "\f180"; } +.bi-basket2-fill::before { content: "\f181"; } +.bi-basket2::before { content: "\f182"; } +.bi-basket3-fill::before { content: "\f183"; } +.bi-basket3::before { content: "\f184"; } +.bi-battery-charging::before { content: "\f185"; } +.bi-battery-full::before { content: "\f186"; } +.bi-battery-half::before { content: "\f187"; } +.bi-battery::before { content: "\f188"; } +.bi-bell-fill::before { content: "\f189"; } +.bi-bell::before { content: "\f18a"; } +.bi-bezier::before { content: "\f18b"; } +.bi-bezier2::before { content: "\f18c"; } +.bi-bicycle::before { content: "\f18d"; } +.bi-binoculars-fill::before { content: "\f18e"; } +.bi-binoculars::before { content: "\f18f"; } +.bi-blockquote-left::before { content: "\f190"; } +.bi-blockquote-right::before { content: "\f191"; } +.bi-book-fill::before { content: "\f192"; } +.bi-book-half::before { content: "\f193"; } +.bi-book::before { content: "\f194"; } +.bi-bookmark-check-fill::before { content: "\f195"; } +.bi-bookmark-check::before { content: "\f196"; } +.bi-bookmark-dash-fill::before { content: "\f197"; } +.bi-bookmark-dash::before { content: "\f198"; } +.bi-bookmark-fill::before { content: "\f199"; } +.bi-bookmark-heart-fill::before { content: "\f19a"; } +.bi-bookmark-heart::before { content: "\f19b"; } +.bi-bookmark-plus-fill::before { content: "\f19c"; } +.bi-bookmark-plus::before { content: "\f19d"; } +.bi-bookmark-star-fill::before { content: "\f19e"; } +.bi-bookmark-star::before { content: "\f19f"; } +.bi-bookmark-x-fill::before { content: "\f1a0"; } +.bi-bookmark-x::before { content: "\f1a1"; } +.bi-bookmark::before { content: "\f1a2"; } +.bi-bookmarks-fill::before { content: "\f1a3"; } +.bi-bookmarks::before { content: "\f1a4"; } +.bi-bookshelf::before { content: "\f1a5"; } +.bi-bootstrap-fill::before { content: "\f1a6"; } +.bi-bootstrap-reboot::before { content: "\f1a7"; } +.bi-bootstrap::before { content: "\f1a8"; } +.bi-border-all::before { content: "\f1a9"; } +.bi-border-bottom::before { content: "\f1aa"; } +.bi-border-center::before { content: "\f1ab"; } +.bi-border-inner::before { content: "\f1ac"; } +.bi-border-left::before { content: "\f1ad"; } +.bi-border-middle::before { content: "\f1ae"; } +.bi-border-outer::before { content: "\f1af"; } +.bi-border-right::before { content: "\f1b0"; } +.bi-border-style::before { content: "\f1b1"; } +.bi-border-top::before { content: "\f1b2"; } +.bi-border-width::before { content: "\f1b3"; } +.bi-border::before { content: "\f1b4"; } +.bi-bounding-box-circles::before { content: "\f1b5"; } +.bi-bounding-box::before { content: "\f1b6"; } +.bi-box-arrow-down-left::before { content: "\f1b7"; } +.bi-box-arrow-down-right::before { content: "\f1b8"; } +.bi-box-arrow-down::before { content: "\f1b9"; } +.bi-box-arrow-in-down-left::before { content: "\f1ba"; } +.bi-box-arrow-in-down-right::before { content: "\f1bb"; } +.bi-box-arrow-in-down::before { content: "\f1bc"; } +.bi-box-arrow-in-left::before { content: "\f1bd"; } +.bi-box-arrow-in-right::before { content: "\f1be"; } +.bi-box-arrow-in-up-left::before { content: "\f1bf"; } +.bi-box-arrow-in-up-right::before { content: "\f1c0"; } +.bi-box-arrow-in-up::before { content: "\f1c1"; } +.bi-box-arrow-left::before { content: "\f1c2"; } +.bi-box-arrow-right::before { content: "\f1c3"; } +.bi-box-arrow-up-left::before { content: "\f1c4"; } +.bi-box-arrow-up-right::before { content: "\f1c5"; } +.bi-box-arrow-up::before { content: "\f1c6"; } +.bi-box-seam::before { content: "\f1c7"; } +.bi-box::before { content: "\f1c8"; } +.bi-braces::before { content: "\f1c9"; } +.bi-bricks::before { content: "\f1ca"; } +.bi-briefcase-fill::before { content: "\f1cb"; } +.bi-briefcase::before { content: "\f1cc"; } +.bi-brightness-alt-high-fill::before { content: "\f1cd"; } +.bi-brightness-alt-high::before { content: "\f1ce"; } +.bi-brightness-alt-low-fill::before { content: "\f1cf"; } +.bi-brightness-alt-low::before { content: "\f1d0"; } +.bi-brightness-high-fill::before { content: "\f1d1"; } +.bi-brightness-high::before { content: "\f1d2"; } +.bi-brightness-low-fill::before { content: "\f1d3"; } +.bi-brightness-low::before { content: "\f1d4"; } +.bi-broadcast-pin::before { content: "\f1d5"; } +.bi-broadcast::before { content: "\f1d6"; } +.bi-brush-fill::before { content: "\f1d7"; } +.bi-brush::before { content: "\f1d8"; } +.bi-bucket-fill::before { content: "\f1d9"; } +.bi-bucket::before { content: "\f1da"; } +.bi-bug-fill::before { content: "\f1db"; } +.bi-bug::before { content: "\f1dc"; } +.bi-building::before { content: "\f1dd"; } +.bi-bullseye::before { content: "\f1de"; } +.bi-calculator-fill::before { content: "\f1df"; } +.bi-calculator::before { content: "\f1e0"; } +.bi-calendar-check-fill::before { content: "\f1e1"; } +.bi-calendar-check::before { content: "\f1e2"; } +.bi-calendar-date-fill::before { content: "\f1e3"; } +.bi-calendar-date::before { content: "\f1e4"; } +.bi-calendar-day-fill::before { content: "\f1e5"; } +.bi-calendar-day::before { content: "\f1e6"; } +.bi-calendar-event-fill::before { content: "\f1e7"; } +.bi-calendar-event::before { content: "\f1e8"; } +.bi-calendar-fill::before { content: "\f1e9"; } +.bi-calendar-minus-fill::before { content: "\f1ea"; } +.bi-calendar-minus::before { content: "\f1eb"; } +.bi-calendar-month-fill::before { content: "\f1ec"; } +.bi-calendar-month::before { content: "\f1ed"; } +.bi-calendar-plus-fill::before { content: "\f1ee"; } +.bi-calendar-plus::before { content: "\f1ef"; } +.bi-calendar-range-fill::before { content: "\f1f0"; } +.bi-calendar-range::before { content: "\f1f1"; } +.bi-calendar-week-fill::before { content: "\f1f2"; } +.bi-calendar-week::before { content: "\f1f3"; } +.bi-calendar-x-fill::before { content: "\f1f4"; } +.bi-calendar-x::before { content: "\f1f5"; } +.bi-calendar::before { content: "\f1f6"; } +.bi-calendar2-check-fill::before { content: "\f1f7"; } +.bi-calendar2-check::before { content: "\f1f8"; } +.bi-calendar2-date-fill::before { content: "\f1f9"; } +.bi-calendar2-date::before { content: "\f1fa"; } +.bi-calendar2-day-fill::before { content: "\f1fb"; } +.bi-calendar2-day::before { content: "\f1fc"; } +.bi-calendar2-event-fill::before { content: "\f1fd"; } +.bi-calendar2-event::before { content: "\f1fe"; } +.bi-calendar2-fill::before { content: "\f1ff"; } +.bi-calendar2-minus-fill::before { content: "\f200"; } +.bi-calendar2-minus::before { content: "\f201"; } +.bi-calendar2-month-fill::before { content: "\f202"; } +.bi-calendar2-month::before { content: "\f203"; } +.bi-calendar2-plus-fill::before { content: "\f204"; } +.bi-calendar2-plus::before { content: "\f205"; } +.bi-calendar2-range-fill::before { content: "\f206"; } +.bi-calendar2-range::before { content: "\f207"; } +.bi-calendar2-week-fill::before { content: "\f208"; } +.bi-calendar2-week::before { content: "\f209"; } +.bi-calendar2-x-fill::before { content: "\f20a"; } +.bi-calendar2-x::before { content: "\f20b"; } +.bi-calendar2::before { content: "\f20c"; } +.bi-calendar3-event-fill::before { content: "\f20d"; } +.bi-calendar3-event::before { content: "\f20e"; } +.bi-calendar3-fill::before { content: "\f20f"; } +.bi-calendar3-range-fill::before { content: "\f210"; } +.bi-calendar3-range::before { content: "\f211"; } +.bi-calendar3-week-fill::before { content: "\f212"; } +.bi-calendar3-week::before { content: "\f213"; } +.bi-calendar3::before { content: "\f214"; } +.bi-calendar4-event::before { content: "\f215"; } +.bi-calendar4-range::before { content: "\f216"; } +.bi-calendar4-week::before { content: "\f217"; } +.bi-calendar4::before { content: "\f218"; } +.bi-camera-fill::before { content: "\f219"; } +.bi-camera-reels-fill::before { content: "\f21a"; } +.bi-camera-reels::before { content: "\f21b"; } +.bi-camera-video-fill::before { content: "\f21c"; } +.bi-camera-video-off-fill::before { content: "\f21d"; } +.bi-camera-video-off::before { content: "\f21e"; } +.bi-camera-video::before { content: "\f21f"; } +.bi-camera::before { content: "\f220"; } +.bi-camera2::before { content: "\f221"; } +.bi-capslock-fill::before { content: "\f222"; } +.bi-capslock::before { content: "\f223"; } +.bi-card-checklist::before { content: "\f224"; } +.bi-card-heading::before { content: "\f225"; } +.bi-card-image::before { content: "\f226"; } +.bi-card-list::before { content: "\f227"; } +.bi-card-text::before { content: "\f228"; } +.bi-caret-down-fill::before { content: "\f229"; } +.bi-caret-down-square-fill::before { content: "\f22a"; } +.bi-caret-down-square::before { content: "\f22b"; } +.bi-caret-down::before { content: "\f22c"; } +.bi-caret-left-fill::before { content: "\f22d"; } +.bi-caret-left-square-fill::before { content: "\f22e"; } +.bi-caret-left-square::before { content: "\f22f"; } +.bi-caret-left::before { content: "\f230"; } +.bi-caret-right-fill::before { content: "\f231"; } +.bi-caret-right-square-fill::before { content: "\f232"; } +.bi-caret-right-square::before { content: "\f233"; } +.bi-caret-right::before { content: "\f234"; } +.bi-caret-up-fill::before { content: "\f235"; } +.bi-caret-up-square-fill::before { content: "\f236"; } +.bi-caret-up-square::before { content: "\f237"; } +.bi-caret-up::before { content: "\f238"; } +.bi-cart-check-fill::before { content: "\f239"; } +.bi-cart-check::before { content: "\f23a"; } +.bi-cart-dash-fill::before { content: "\f23b"; } +.bi-cart-dash::before { content: "\f23c"; } +.bi-cart-fill::before { content: "\f23d"; } +.bi-cart-plus-fill::before { content: "\f23e"; } +.bi-cart-plus::before { content: "\f23f"; } +.bi-cart-x-fill::before { content: "\f240"; } +.bi-cart-x::before { content: "\f241"; } +.bi-cart::before { content: "\f242"; } +.bi-cart2::before { content: "\f243"; } +.bi-cart3::before { content: "\f244"; } +.bi-cart4::before { content: "\f245"; } +.bi-cash-stack::before { content: "\f246"; } +.bi-cash::before { content: "\f247"; } +.bi-cast::before { content: "\f248"; } +.bi-chat-dots-fill::before { content: "\f249"; } +.bi-chat-dots::before { content: "\f24a"; } +.bi-chat-fill::before { content: "\f24b"; } +.bi-chat-left-dots-fill::before { content: "\f24c"; } +.bi-chat-left-dots::before { content: "\f24d"; } +.bi-chat-left-fill::before { content: "\f24e"; } +.bi-chat-left-quote-fill::before { content: "\f24f"; } +.bi-chat-left-quote::before { content: "\f250"; } +.bi-chat-left-text-fill::before { content: "\f251"; } +.bi-chat-left-text::before { content: "\f252"; } +.bi-chat-left::before { content: "\f253"; } +.bi-chat-quote-fill::before { content: "\f254"; } +.bi-chat-quote::before { content: "\f255"; } +.bi-chat-right-dots-fill::before { content: "\f256"; } +.bi-chat-right-dots::before { content: "\f257"; } +.bi-chat-right-fill::before { content: "\f258"; } +.bi-chat-right-quote-fill::before { content: "\f259"; } +.bi-chat-right-quote::before { content: "\f25a"; } +.bi-chat-right-text-fill::before { content: "\f25b"; } +.bi-chat-right-text::before { content: "\f25c"; } +.bi-chat-right::before { content: "\f25d"; } +.bi-chat-square-dots-fill::before { content: "\f25e"; } +.bi-chat-square-dots::before { content: "\f25f"; } +.bi-chat-square-fill::before { content: "\f260"; } +.bi-chat-square-quote-fill::before { content: "\f261"; } +.bi-chat-square-quote::before { content: "\f262"; } +.bi-chat-square-text-fill::before { content: "\f263"; } +.bi-chat-square-text::before { content: "\f264"; } +.bi-chat-square::before { content: "\f265"; } +.bi-chat-text-fill::before { content: "\f266"; } +.bi-chat-text::before { content: "\f267"; } +.bi-chat::before { content: "\f268"; } +.bi-check-all::before { content: "\f269"; } +.bi-check-circle-fill::before { content: "\f26a"; } +.bi-check-circle::before { content: "\f26b"; } +.bi-check-square-fill::before { content: "\f26c"; } +.bi-check-square::before { content: "\f26d"; } +.bi-check::before { content: "\f26e"; } +.bi-check2-all::before { content: "\f26f"; } +.bi-check2-circle::before { content: "\f270"; } +.bi-check2-square::before { content: "\f271"; } +.bi-check2::before { content: "\f272"; } +.bi-chevron-bar-contract::before { content: "\f273"; } +.bi-chevron-bar-down::before { content: "\f274"; } +.bi-chevron-bar-expand::before { content: "\f275"; } +.bi-chevron-bar-left::before { content: "\f276"; } +.bi-chevron-bar-right::before { content: "\f277"; } +.bi-chevron-bar-up::before { content: "\f278"; } +.bi-chevron-compact-down::before { content: "\f279"; } +.bi-chevron-compact-left::before { content: "\f27a"; } +.bi-chevron-compact-right::before { content: "\f27b"; } +.bi-chevron-compact-up::before { content: "\f27c"; } +.bi-chevron-contract::before { content: "\f27d"; } +.bi-chevron-double-down::before { content: "\f27e"; } +.bi-chevron-double-left::before { content: "\f27f"; } +.bi-chevron-double-right::before { content: "\f280"; } +.bi-chevron-double-up::before { content: "\f281"; } +.bi-chevron-down::before { content: "\f282"; } +.bi-chevron-expand::before { content: "\f283"; } +.bi-chevron-left::before { content: "\f284"; } +.bi-chevron-right::before { content: "\f285"; } +.bi-chevron-up::before { content: "\f286"; } +.bi-circle-fill::before { content: "\f287"; } +.bi-circle-half::before { content: "\f288"; } +.bi-circle-square::before { content: "\f289"; } +.bi-circle::before { content: "\f28a"; } +.bi-clipboard-check::before { content: "\f28b"; } +.bi-clipboard-data::before { content: "\f28c"; } +.bi-clipboard-minus::before { content: "\f28d"; } +.bi-clipboard-plus::before { content: "\f28e"; } +.bi-clipboard-x::before { content: "\f28f"; } +.bi-clipboard::before { content: "\f290"; } +.bi-clock-fill::before { content: "\f291"; } +.bi-clock-history::before { content: "\f292"; } +.bi-clock::before { content: "\f293"; } +.bi-cloud-arrow-down-fill::before { content: "\f294"; } +.bi-cloud-arrow-down::before { content: "\f295"; } +.bi-cloud-arrow-up-fill::before { content: "\f296"; } +.bi-cloud-arrow-up::before { content: "\f297"; } +.bi-cloud-check-fill::before { content: "\f298"; } +.bi-cloud-check::before { content: "\f299"; } +.bi-cloud-download-fill::before { content: "\f29a"; } +.bi-cloud-download::before { content: "\f29b"; } +.bi-cloud-drizzle-fill::before { content: "\f29c"; } +.bi-cloud-drizzle::before { content: "\f29d"; } +.bi-cloud-fill::before { content: "\f29e"; } +.bi-cloud-fog-fill::before { content: "\f29f"; } +.bi-cloud-fog::before { content: "\f2a0"; } +.bi-cloud-fog2-fill::before { content: "\f2a1"; } +.bi-cloud-fog2::before { content: "\f2a2"; } +.bi-cloud-hail-fill::before { content: "\f2a3"; } +.bi-cloud-hail::before { content: "\f2a4"; } +.bi-cloud-haze-fill::before { content: "\f2a6"; } +.bi-cloud-haze::before { content: "\f2a7"; } +.bi-cloud-haze2-fill::before { content: "\f2a8"; } +.bi-cloud-lightning-fill::before { content: "\f2a9"; } +.bi-cloud-lightning-rain-fill::before { content: "\f2aa"; } +.bi-cloud-lightning-rain::before { content: "\f2ab"; } +.bi-cloud-lightning::before { content: "\f2ac"; } +.bi-cloud-minus-fill::before { content: "\f2ad"; } +.bi-cloud-minus::before { content: "\f2ae"; } +.bi-cloud-moon-fill::before { content: "\f2af"; } +.bi-cloud-moon::before { content: "\f2b0"; } +.bi-cloud-plus-fill::before { content: "\f2b1"; } +.bi-cloud-plus::before { content: "\f2b2"; } +.bi-cloud-rain-fill::before { content: "\f2b3"; } +.bi-cloud-rain-heavy-fill::before { content: "\f2b4"; } +.bi-cloud-rain-heavy::before { content: "\f2b5"; } +.bi-cloud-rain::before { content: "\f2b6"; } +.bi-cloud-slash-fill::before { content: "\f2b7"; } +.bi-cloud-slash::before { content: "\f2b8"; } +.bi-cloud-sleet-fill::before { content: "\f2b9"; } +.bi-cloud-sleet::before { content: "\f2ba"; } +.bi-cloud-snow-fill::before { content: "\f2bb"; } +.bi-cloud-snow::before { content: "\f2bc"; } +.bi-cloud-sun-fill::before { content: "\f2bd"; } +.bi-cloud-sun::before { content: "\f2be"; } +.bi-cloud-upload-fill::before { content: "\f2bf"; } +.bi-cloud-upload::before { content: "\f2c0"; } +.bi-cloud::before { content: "\f2c1"; } +.bi-clouds-fill::before { content: "\f2c2"; } +.bi-clouds::before { content: "\f2c3"; } +.bi-cloudy-fill::before { content: "\f2c4"; } +.bi-cloudy::before { content: "\f2c5"; } +.bi-code-slash::before { content: "\f2c6"; } +.bi-code-square::before { content: "\f2c7"; } +.bi-code::before { content: "\f2c8"; } +.bi-collection-fill::before { content: "\f2c9"; } +.bi-collection-play-fill::before { content: "\f2ca"; } +.bi-collection-play::before { content: "\f2cb"; } +.bi-collection::before { content: "\f2cc"; } +.bi-columns-gap::before { content: "\f2cd"; } +.bi-columns::before { content: "\f2ce"; } +.bi-command::before { content: "\f2cf"; } +.bi-compass-fill::before { content: "\f2d0"; } +.bi-compass::before { content: "\f2d1"; } +.bi-cone-striped::before { content: "\f2d2"; } +.bi-cone::before { content: "\f2d3"; } +.bi-controller::before { content: "\f2d4"; } +.bi-cpu-fill::before { content: "\f2d5"; } +.bi-cpu::before { content: "\f2d6"; } +.bi-credit-card-2-back-fill::before { content: "\f2d7"; } +.bi-credit-card-2-back::before { content: "\f2d8"; } +.bi-credit-card-2-front-fill::before { content: "\f2d9"; } +.bi-credit-card-2-front::before { content: "\f2da"; } +.bi-credit-card-fill::before { content: "\f2db"; } +.bi-credit-card::before { content: "\f2dc"; } +.bi-crop::before { content: "\f2dd"; } +.bi-cup-fill::before { content: "\f2de"; } +.bi-cup-straw::before { content: "\f2df"; } +.bi-cup::before { content: "\f2e0"; } +.bi-cursor-fill::before { content: "\f2e1"; } +.bi-cursor-text::before { content: "\f2e2"; } +.bi-cursor::before { content: "\f2e3"; } +.bi-dash-circle-dotted::before { content: "\f2e4"; } +.bi-dash-circle-fill::before { content: "\f2e5"; } +.bi-dash-circle::before { content: "\f2e6"; } +.bi-dash-square-dotted::before { content: "\f2e7"; } +.bi-dash-square-fill::before { content: "\f2e8"; } +.bi-dash-square::before { content: "\f2e9"; } +.bi-dash::before { content: "\f2ea"; } +.bi-diagram-2-fill::before { content: "\f2eb"; } +.bi-diagram-2::before { content: "\f2ec"; } +.bi-diagram-3-fill::before { content: "\f2ed"; } +.bi-diagram-3::before { content: "\f2ee"; } +.bi-diamond-fill::before { content: "\f2ef"; } +.bi-diamond-half::before { content: "\f2f0"; } +.bi-diamond::before { content: "\f2f1"; } +.bi-dice-1-fill::before { content: "\f2f2"; } +.bi-dice-1::before { content: "\f2f3"; } +.bi-dice-2-fill::before { content: "\f2f4"; } +.bi-dice-2::before { content: "\f2f5"; } +.bi-dice-3-fill::before { content: "\f2f6"; } +.bi-dice-3::before { content: "\f2f7"; } +.bi-dice-4-fill::before { content: "\f2f8"; } +.bi-dice-4::before { content: "\f2f9"; } +.bi-dice-5-fill::before { content: "\f2fa"; } +.bi-dice-5::before { content: "\f2fb"; } +.bi-dice-6-fill::before { content: "\f2fc"; } +.bi-dice-6::before { content: "\f2fd"; } +.bi-disc-fill::before { content: "\f2fe"; } +.bi-disc::before { content: "\f2ff"; } +.bi-discord::before { content: "\f300"; } +.bi-display-fill::before { content: "\f301"; } +.bi-display::before { content: "\f302"; } +.bi-distribute-horizontal::before { content: "\f303"; } +.bi-distribute-vertical::before { content: "\f304"; } +.bi-door-closed-fill::before { content: "\f305"; } +.bi-door-closed::before { content: "\f306"; } +.bi-door-open-fill::before { content: "\f307"; } +.bi-door-open::before { content: "\f308"; } +.bi-dot::before { content: "\f309"; } +.bi-download::before { content: "\f30a"; } +.bi-droplet-fill::before { content: "\f30b"; } +.bi-droplet-half::before { content: "\f30c"; } +.bi-droplet::before { content: "\f30d"; } +.bi-earbuds::before { content: "\f30e"; } +.bi-easel-fill::before { content: "\f30f"; } +.bi-easel::before { content: "\f310"; } +.bi-egg-fill::before { content: "\f311"; } +.bi-egg-fried::before { content: "\f312"; } +.bi-egg::before { content: "\f313"; } +.bi-eject-fill::before { content: "\f314"; } +.bi-eject::before { content: "\f315"; } +.bi-emoji-angry-fill::before { content: "\f316"; } +.bi-emoji-angry::before { content: "\f317"; } +.bi-emoji-dizzy-fill::before { content: "\f318"; } +.bi-emoji-dizzy::before { content: "\f319"; } +.bi-emoji-expressionless-fill::before { content: "\f31a"; } +.bi-emoji-expressionless::before { content: "\f31b"; } +.bi-emoji-frown-fill::before { content: "\f31c"; } +.bi-emoji-frown::before { content: "\f31d"; } +.bi-emoji-heart-eyes-fill::before { content: "\f31e"; } +.bi-emoji-heart-eyes::before { content: "\f31f"; } +.bi-emoji-laughing-fill::before { content: "\f320"; } +.bi-emoji-laughing::before { content: "\f321"; } +.bi-emoji-neutral-fill::before { content: "\f322"; } +.bi-emoji-neutral::before { content: "\f323"; } +.bi-emoji-smile-fill::before { content: "\f324"; } +.bi-emoji-smile-upside-down-fill::before { content: "\f325"; } +.bi-emoji-smile-upside-down::before { content: "\f326"; } +.bi-emoji-smile::before { content: "\f327"; } +.bi-emoji-sunglasses-fill::before { content: "\f328"; } +.bi-emoji-sunglasses::before { content: "\f329"; } +.bi-emoji-wink-fill::before { content: "\f32a"; } +.bi-emoji-wink::before { content: "\f32b"; } +.bi-envelope-fill::before { content: "\f32c"; } +.bi-envelope-open-fill::before { content: "\f32d"; } +.bi-envelope-open::before { content: "\f32e"; } +.bi-envelope::before { content: "\f32f"; } +.bi-eraser-fill::before { content: "\f330"; } +.bi-eraser::before { content: "\f331"; } +.bi-exclamation-circle-fill::before { content: "\f332"; } +.bi-exclamation-circle::before { content: "\f333"; } +.bi-exclamation-diamond-fill::before { content: "\f334"; } +.bi-exclamation-diamond::before { content: "\f335"; } +.bi-exclamation-octagon-fill::before { content: "\f336"; } +.bi-exclamation-octagon::before { content: "\f337"; } +.bi-exclamation-square-fill::before { content: "\f338"; } +.bi-exclamation-square::before { content: "\f339"; } +.bi-exclamation-triangle-fill::before { content: "\f33a"; } +.bi-exclamation-triangle::before { content: "\f33b"; } +.bi-exclamation::before { content: "\f33c"; } +.bi-exclude::before { content: "\f33d"; } +.bi-eye-fill::before { content: "\f33e"; } +.bi-eye-slash-fill::before { content: "\f33f"; } +.bi-eye-slash::before { content: "\f340"; } +.bi-eye::before { content: "\f341"; } +.bi-eyedropper::before { content: "\f342"; } +.bi-eyeglasses::before { content: "\f343"; } +.bi-facebook::before { content: "\f344"; } +.bi-file-arrow-down-fill::before { content: "\f345"; } +.bi-file-arrow-down::before { content: "\f346"; } +.bi-file-arrow-up-fill::before { content: "\f347"; } +.bi-file-arrow-up::before { content: "\f348"; } +.bi-file-bar-graph-fill::before { content: "\f349"; } +.bi-file-bar-graph::before { content: "\f34a"; } +.bi-file-binary-fill::before { content: "\f34b"; } +.bi-file-binary::before { content: "\f34c"; } +.bi-file-break-fill::before { content: "\f34d"; } +.bi-file-break::before { content: "\f34e"; } +.bi-file-check-fill::before { content: "\f34f"; } +.bi-file-check::before { content: "\f350"; } +.bi-file-code-fill::before { content: "\f351"; } +.bi-file-code::before { content: "\f352"; } +.bi-file-diff-fill::before { content: "\f353"; } +.bi-file-diff::before { content: "\f354"; } +.bi-file-earmark-arrow-down-fill::before { content: "\f355"; } +.bi-file-earmark-arrow-down::before { content: "\f356"; } +.bi-file-earmark-arrow-up-fill::before { content: "\f357"; } +.bi-file-earmark-arrow-up::before { content: "\f358"; } +.bi-file-earmark-bar-graph-fill::before { content: "\f359"; } +.bi-file-earmark-bar-graph::before { content: "\f35a"; } +.bi-file-earmark-binary-fill::before { content: "\f35b"; } +.bi-file-earmark-binary::before { content: "\f35c"; } +.bi-file-earmark-break-fill::before { content: "\f35d"; } +.bi-file-earmark-break::before { content: "\f35e"; } +.bi-file-earmark-check-fill::before { content: "\f35f"; } +.bi-file-earmark-check::before { content: "\f360"; } +.bi-file-earmark-code-fill::before { content: "\f361"; } +.bi-file-earmark-code::before { content: "\f362"; } +.bi-file-earmark-diff-fill::before { content: "\f363"; } +.bi-file-earmark-diff::before { content: "\f364"; } +.bi-file-earmark-easel-fill::before { content: "\f365"; } +.bi-file-earmark-easel::before { content: "\f366"; } +.bi-file-earmark-excel-fill::before { content: "\f367"; } +.bi-file-earmark-excel::before { content: "\f368"; } +.bi-file-earmark-fill::before { content: "\f369"; } +.bi-file-earmark-font-fill::before { content: "\f36a"; } +.bi-file-earmark-font::before { content: "\f36b"; } +.bi-file-earmark-image-fill::before { content: "\f36c"; } +.bi-file-earmark-image::before { content: "\f36d"; } +.bi-file-earmark-lock-fill::before { content: "\f36e"; } +.bi-file-earmark-lock::before { content: "\f36f"; } +.bi-file-earmark-lock2-fill::before { content: "\f370"; } +.bi-file-earmark-lock2::before { content: "\f371"; } +.bi-file-earmark-medical-fill::before { content: "\f372"; } +.bi-file-earmark-medical::before { content: "\f373"; } +.bi-file-earmark-minus-fill::before { content: "\f374"; } +.bi-file-earmark-minus::before { content: "\f375"; } +.bi-file-earmark-music-fill::before { content: "\f376"; } +.bi-file-earmark-music::before { content: "\f377"; } +.bi-file-earmark-person-fill::before { content: "\f378"; } +.bi-file-earmark-person::before { content: "\f379"; } +.bi-file-earmark-play-fill::before { content: "\f37a"; } +.bi-file-earmark-play::before { content: "\f37b"; } +.bi-file-earmark-plus-fill::before { content: "\f37c"; } +.bi-file-earmark-plus::before { content: "\f37d"; } +.bi-file-earmark-post-fill::before { content: "\f37e"; } +.bi-file-earmark-post::before { content: "\f37f"; } +.bi-file-earmark-ppt-fill::before { content: "\f380"; } +.bi-file-earmark-ppt::before { content: "\f381"; } +.bi-file-earmark-richtext-fill::before { content: "\f382"; } +.bi-file-earmark-richtext::before { content: "\f383"; } +.bi-file-earmark-ruled-fill::before { content: "\f384"; } +.bi-file-earmark-ruled::before { content: "\f385"; } +.bi-file-earmark-slides-fill::before { content: "\f386"; } +.bi-file-earmark-slides::before { content: "\f387"; } +.bi-file-earmark-spreadsheet-fill::before { content: "\f388"; } +.bi-file-earmark-spreadsheet::before { content: "\f389"; } +.bi-file-earmark-text-fill::before { content: "\f38a"; } +.bi-file-earmark-text::before { content: "\f38b"; } +.bi-file-earmark-word-fill::before { content: "\f38c"; } +.bi-file-earmark-word::before { content: "\f38d"; } +.bi-file-earmark-x-fill::before { content: "\f38e"; } +.bi-file-earmark-x::before { content: "\f38f"; } +.bi-file-earmark-zip-fill::before { content: "\f390"; } +.bi-file-earmark-zip::before { content: "\f391"; } +.bi-file-earmark::before { content: "\f392"; } +.bi-file-easel-fill::before { content: "\f393"; } +.bi-file-easel::before { content: "\f394"; } +.bi-file-excel-fill::before { content: "\f395"; } +.bi-file-excel::before { content: "\f396"; } +.bi-file-fill::before { content: "\f397"; } +.bi-file-font-fill::before { content: "\f398"; } +.bi-file-font::before { content: "\f399"; } +.bi-file-image-fill::before { content: "\f39a"; } +.bi-file-image::before { content: "\f39b"; } +.bi-file-lock-fill::before { content: "\f39c"; } +.bi-file-lock::before { content: "\f39d"; } +.bi-file-lock2-fill::before { content: "\f39e"; } +.bi-file-lock2::before { content: "\f39f"; } +.bi-file-medical-fill::before { content: "\f3a0"; } +.bi-file-medical::before { content: "\f3a1"; } +.bi-file-minus-fill::before { content: "\f3a2"; } +.bi-file-minus::before { content: "\f3a3"; } +.bi-file-music-fill::before { content: "\f3a4"; } +.bi-file-music::before { content: "\f3a5"; } +.bi-file-person-fill::before { content: "\f3a6"; } +.bi-file-person::before { content: "\f3a7"; } +.bi-file-play-fill::before { content: "\f3a8"; } +.bi-file-play::before { content: "\f3a9"; } +.bi-file-plus-fill::before { content: "\f3aa"; } +.bi-file-plus::before { content: "\f3ab"; } +.bi-file-post-fill::before { content: "\f3ac"; } +.bi-file-post::before { content: "\f3ad"; } +.bi-file-ppt-fill::before { content: "\f3ae"; } +.bi-file-ppt::before { content: "\f3af"; } +.bi-file-richtext-fill::before { content: "\f3b0"; } +.bi-file-richtext::before { content: "\f3b1"; } +.bi-file-ruled-fill::before { content: "\f3b2"; } +.bi-file-ruled::before { content: "\f3b3"; } +.bi-file-slides-fill::before { content: "\f3b4"; } +.bi-file-slides::before { content: "\f3b5"; } +.bi-file-spreadsheet-fill::before { content: "\f3b6"; } +.bi-file-spreadsheet::before { content: "\f3b7"; } +.bi-file-text-fill::before { content: "\f3b8"; } +.bi-file-text::before { content: "\f3b9"; } +.bi-file-word-fill::before { content: "\f3ba"; } +.bi-file-word::before { content: "\f3bb"; } +.bi-file-x-fill::before { content: "\f3bc"; } +.bi-file-x::before { content: "\f3bd"; } +.bi-file-zip-fill::before { content: "\f3be"; } +.bi-file-zip::before { content: "\f3bf"; } +.bi-file::before { content: "\f3c0"; } +.bi-files-alt::before { content: "\f3c1"; } +.bi-files::before { content: "\f3c2"; } +.bi-film::before { content: "\f3c3"; } +.bi-filter-circle-fill::before { content: "\f3c4"; } +.bi-filter-circle::before { content: "\f3c5"; } +.bi-filter-left::before { content: "\f3c6"; } +.bi-filter-right::before { content: "\f3c7"; } +.bi-filter-square-fill::before { content: "\f3c8"; } +.bi-filter-square::before { content: "\f3c9"; } +.bi-filter::before { content: "\f3ca"; } +.bi-flag-fill::before { content: "\f3cb"; } +.bi-flag::before { content: "\f3cc"; } +.bi-flower1::before { content: "\f3cd"; } +.bi-flower2::before { content: "\f3ce"; } +.bi-flower3::before { content: "\f3cf"; } +.bi-folder-check::before { content: "\f3d0"; } +.bi-folder-fill::before { content: "\f3d1"; } +.bi-folder-minus::before { content: "\f3d2"; } +.bi-folder-plus::before { content: "\f3d3"; } +.bi-folder-symlink-fill::before { content: "\f3d4"; } +.bi-folder-symlink::before { content: "\f3d5"; } +.bi-folder-x::before { content: "\f3d6"; } +.bi-folder::before { content: "\f3d7"; } +.bi-folder2-open::before { content: "\f3d8"; } +.bi-folder2::before { content: "\f3d9"; } +.bi-fonts::before { content: "\f3da"; } +.bi-forward-fill::before { content: "\f3db"; } +.bi-forward::before { content: "\f3dc"; } +.bi-front::before { content: "\f3dd"; } +.bi-fullscreen-exit::before { content: "\f3de"; } +.bi-fullscreen::before { content: "\f3df"; } +.bi-funnel-fill::before { content: "\f3e0"; } +.bi-funnel::before { content: "\f3e1"; } +.bi-gear-fill::before { content: "\f3e2"; } +.bi-gear-wide-connected::before { content: "\f3e3"; } +.bi-gear-wide::before { content: "\f3e4"; } +.bi-gear::before { content: "\f3e5"; } +.bi-gem::before { content: "\f3e6"; } +.bi-geo-alt-fill::before { content: "\f3e7"; } +.bi-geo-alt::before { content: "\f3e8"; } +.bi-geo-fill::before { content: "\f3e9"; } +.bi-geo::before { content: "\f3ea"; } +.bi-gift-fill::before { content: "\f3eb"; } +.bi-gift::before { content: "\f3ec"; } +.bi-github::before { content: "\f3ed"; } +.bi-globe::before { content: "\f3ee"; } +.bi-globe2::before { content: "\f3ef"; } +.bi-google::before { content: "\f3f0"; } +.bi-graph-down::before { content: "\f3f1"; } +.bi-graph-up::before { content: "\f3f2"; } +.bi-grid-1x2-fill::before { content: "\f3f3"; } +.bi-grid-1x2::before { content: "\f3f4"; } +.bi-grid-3x2-gap-fill::before { content: "\f3f5"; } +.bi-grid-3x2-gap::before { content: "\f3f6"; } +.bi-grid-3x2::before { content: "\f3f7"; } +.bi-grid-3x3-gap-fill::before { content: "\f3f8"; } +.bi-grid-3x3-gap::before { content: "\f3f9"; } +.bi-grid-3x3::before { content: "\f3fa"; } +.bi-grid-fill::before { content: "\f3fb"; } +.bi-grid::before { content: "\f3fc"; } +.bi-grip-horizontal::before { content: "\f3fd"; } +.bi-grip-vertical::before { content: "\f3fe"; } +.bi-hammer::before { content: "\f3ff"; } +.bi-hand-index-fill::before { content: "\f400"; } +.bi-hand-index-thumb-fill::before { content: "\f401"; } +.bi-hand-index-thumb::before { content: "\f402"; } +.bi-hand-index::before { content: "\f403"; } +.bi-hand-thumbs-down-fill::before { content: "\f404"; } +.bi-hand-thumbs-down::before { content: "\f405"; } +.bi-hand-thumbs-up-fill::before { content: "\f406"; } +.bi-hand-thumbs-up::before { content: "\f407"; } +.bi-handbag-fill::before { content: "\f408"; } +.bi-handbag::before { content: "\f409"; } +.bi-hash::before { content: "\f40a"; } +.bi-hdd-fill::before { content: "\f40b"; } +.bi-hdd-network-fill::before { content: "\f40c"; } +.bi-hdd-network::before { content: "\f40d"; } +.bi-hdd-rack-fill::before { content: "\f40e"; } +.bi-hdd-rack::before { content: "\f40f"; } +.bi-hdd-stack-fill::before { content: "\f410"; } +.bi-hdd-stack::before { content: "\f411"; } +.bi-hdd::before { content: "\f412"; } +.bi-headphones::before { content: "\f413"; } +.bi-headset::before { content: "\f414"; } +.bi-heart-fill::before { content: "\f415"; } +.bi-heart-half::before { content: "\f416"; } +.bi-heart::before { content: "\f417"; } +.bi-heptagon-fill::before { content: "\f418"; } +.bi-heptagon-half::before { content: "\f419"; } +.bi-heptagon::before { content: "\f41a"; } +.bi-hexagon-fill::before { content: "\f41b"; } +.bi-hexagon-half::before { content: "\f41c"; } +.bi-hexagon::before { content: "\f41d"; } +.bi-hourglass-bottom::before { content: "\f41e"; } +.bi-hourglass-split::before { content: "\f41f"; } +.bi-hourglass-top::before { content: "\f420"; } +.bi-hourglass::before { content: "\f421"; } +.bi-house-door-fill::before { content: "\f422"; } +.bi-house-door::before { content: "\f423"; } +.bi-house-fill::before { content: "\f424"; } +.bi-house::before { content: "\f425"; } +.bi-hr::before { content: "\f426"; } +.bi-hurricane::before { content: "\f427"; } +.bi-image-alt::before { content: "\f428"; } +.bi-image-fill::before { content: "\f429"; } +.bi-image::before { content: "\f42a"; } +.bi-images::before { content: "\f42b"; } +.bi-inbox-fill::before { content: "\f42c"; } +.bi-inbox::before { content: "\f42d"; } +.bi-inboxes-fill::before { content: "\f42e"; } +.bi-inboxes::before { content: "\f42f"; } +.bi-info-circle-fill::before { content: "\f430"; } +.bi-info-circle::before { content: "\f431"; } +.bi-info-square-fill::before { content: "\f432"; } +.bi-info-square::before { content: "\f433"; } +.bi-info::before { content: "\f434"; } +.bi-input-cursor-text::before { content: "\f435"; } +.bi-input-cursor::before { content: "\f436"; } +.bi-instagram::before { content: "\f437"; } +.bi-intersect::before { content: "\f438"; } +.bi-journal-album::before { content: "\f439"; } +.bi-journal-arrow-down::before { content: "\f43a"; } +.bi-journal-arrow-up::before { content: "\f43b"; } +.bi-journal-bookmark-fill::before { content: "\f43c"; } +.bi-journal-bookmark::before { content: "\f43d"; } +.bi-journal-check::before { content: "\f43e"; } +.bi-journal-code::before { content: "\f43f"; } +.bi-journal-medical::before { content: "\f440"; } +.bi-journal-minus::before { content: "\f441"; } +.bi-journal-plus::before { content: "\f442"; } +.bi-journal-richtext::before { content: "\f443"; } +.bi-journal-text::before { content: "\f444"; } +.bi-journal-x::before { content: "\f445"; } +.bi-journal::before { content: "\f446"; } +.bi-journals::before { content: "\f447"; } +.bi-joystick::before { content: "\f448"; } +.bi-justify-left::before { content: "\f449"; } +.bi-justify-right::before { content: "\f44a"; } +.bi-justify::before { content: "\f44b"; } +.bi-kanban-fill::before { content: "\f44c"; } +.bi-kanban::before { content: "\f44d"; } +.bi-key-fill::before { content: "\f44e"; } +.bi-key::before { content: "\f44f"; } +.bi-keyboard-fill::before { content: "\f450"; } +.bi-keyboard::before { content: "\f451"; } +.bi-ladder::before { content: "\f452"; } +.bi-lamp-fill::before { content: "\f453"; } +.bi-lamp::before { content: "\f454"; } +.bi-laptop-fill::before { content: "\f455"; } +.bi-laptop::before { content: "\f456"; } +.bi-layer-backward::before { content: "\f457"; } +.bi-layer-forward::before { content: "\f458"; } +.bi-layers-fill::before { content: "\f459"; } +.bi-layers-half::before { content: "\f45a"; } +.bi-layers::before { content: "\f45b"; } +.bi-layout-sidebar-inset-reverse::before { content: "\f45c"; } +.bi-layout-sidebar-inset::before { content: "\f45d"; } +.bi-layout-sidebar-reverse::before { content: "\f45e"; } +.bi-layout-sidebar::before { content: "\f45f"; } +.bi-layout-split::before { content: "\f460"; } +.bi-layout-text-sidebar-reverse::before { content: "\f461"; } +.bi-layout-text-sidebar::before { content: "\f462"; } +.bi-layout-text-window-reverse::before { content: "\f463"; } +.bi-layout-text-window::before { content: "\f464"; } +.bi-layout-three-columns::before { content: "\f465"; } +.bi-layout-wtf::before { content: "\f466"; } +.bi-life-preserver::before { content: "\f467"; } +.bi-lightbulb-fill::before { content: "\f468"; } +.bi-lightbulb-off-fill::before { content: "\f469"; } +.bi-lightbulb-off::before { content: "\f46a"; } +.bi-lightbulb::before { content: "\f46b"; } +.bi-lightning-charge-fill::before { content: "\f46c"; } +.bi-lightning-charge::before { content: "\f46d"; } +.bi-lightning-fill::before { content: "\f46e"; } +.bi-lightning::before { content: "\f46f"; } +.bi-link-45deg::before { content: "\f470"; } +.bi-link::before { content: "\f471"; } +.bi-linkedin::before { content: "\f472"; } +.bi-list-check::before { content: "\f473"; } +.bi-list-nested::before { content: "\f474"; } +.bi-list-ol::before { content: "\f475"; } +.bi-list-stars::before { content: "\f476"; } +.bi-list-task::before { content: "\f477"; } +.bi-list-ul::before { content: "\f478"; } +.bi-list::before { content: "\f479"; } +.bi-lock-fill::before { content: "\f47a"; } +.bi-lock::before { content: "\f47b"; } +.bi-mailbox::before { content: "\f47c"; } +.bi-mailbox2::before { content: "\f47d"; } +.bi-map-fill::before { content: "\f47e"; } +.bi-map::before { content: "\f47f"; } +.bi-markdown-fill::before { content: "\f480"; } +.bi-markdown::before { content: "\f481"; } +.bi-mask::before { content: "\f482"; } +.bi-megaphone-fill::before { content: "\f483"; } +.bi-megaphone::before { content: "\f484"; } +.bi-menu-app-fill::before { content: "\f485"; } +.bi-menu-app::before { content: "\f486"; } +.bi-menu-button-fill::before { content: "\f487"; } +.bi-menu-button-wide-fill::before { content: "\f488"; } +.bi-menu-button-wide::before { content: "\f489"; } +.bi-menu-button::before { content: "\f48a"; } +.bi-menu-down::before { content: "\f48b"; } +.bi-menu-up::before { content: "\f48c"; } +.bi-mic-fill::before { content: "\f48d"; } +.bi-mic-mute-fill::before { content: "\f48e"; } +.bi-mic-mute::before { content: "\f48f"; } +.bi-mic::before { content: "\f490"; } +.bi-minecart-loaded::before { content: "\f491"; } +.bi-minecart::before { content: "\f492"; } +.bi-moisture::before { content: "\f493"; } +.bi-moon-fill::before { content: "\f494"; } +.bi-moon-stars-fill::before { content: "\f495"; } +.bi-moon-stars::before { content: "\f496"; } +.bi-moon::before { content: "\f497"; } +.bi-mouse-fill::before { content: "\f498"; } +.bi-mouse::before { content: "\f499"; } +.bi-mouse2-fill::before { content: "\f49a"; } +.bi-mouse2::before { content: "\f49b"; } +.bi-mouse3-fill::before { content: "\f49c"; } +.bi-mouse3::before { content: "\f49d"; } +.bi-music-note-beamed::before { content: "\f49e"; } +.bi-music-note-list::before { content: "\f49f"; } +.bi-music-note::before { content: "\f4a0"; } +.bi-music-player-fill::before { content: "\f4a1"; } +.bi-music-player::before { content: "\f4a2"; } +.bi-newspaper::before { content: "\f4a3"; } +.bi-node-minus-fill::before { content: "\f4a4"; } +.bi-node-minus::before { content: "\f4a5"; } +.bi-node-plus-fill::before { content: "\f4a6"; } +.bi-node-plus::before { content: "\f4a7"; } +.bi-nut-fill::before { content: "\f4a8"; } +.bi-nut::before { content: "\f4a9"; } +.bi-octagon-fill::before { content: "\f4aa"; } +.bi-octagon-half::before { content: "\f4ab"; } +.bi-octagon::before { content: "\f4ac"; } +.bi-option::before { content: "\f4ad"; } +.bi-outlet::before { content: "\f4ae"; } +.bi-paint-bucket::before { content: "\f4af"; } +.bi-palette-fill::before { content: "\f4b0"; } +.bi-palette::before { content: "\f4b1"; } +.bi-palette2::before { content: "\f4b2"; } +.bi-paperclip::before { content: "\f4b3"; } +.bi-paragraph::before { content: "\f4b4"; } +.bi-patch-check-fill::before { content: "\f4b5"; } +.bi-patch-check::before { content: "\f4b6"; } +.bi-patch-exclamation-fill::before { content: "\f4b7"; } +.bi-patch-exclamation::before { content: "\f4b8"; } +.bi-patch-minus-fill::before { content: "\f4b9"; } +.bi-patch-minus::before { content: "\f4ba"; } +.bi-patch-plus-fill::before { content: "\f4bb"; } +.bi-patch-plus::before { content: "\f4bc"; } +.bi-patch-question-fill::before { content: "\f4bd"; } +.bi-patch-question::before { content: "\f4be"; } +.bi-pause-btn-fill::before { content: "\f4bf"; } +.bi-pause-btn::before { content: "\f4c0"; } +.bi-pause-circle-fill::before { content: "\f4c1"; } +.bi-pause-circle::before { content: "\f4c2"; } +.bi-pause-fill::before { content: "\f4c3"; } +.bi-pause::before { content: "\f4c4"; } +.bi-peace-fill::before { content: "\f4c5"; } +.bi-peace::before { content: "\f4c6"; } +.bi-pen-fill::before { content: "\f4c7"; } +.bi-pen::before { content: "\f4c8"; } +.bi-pencil-fill::before { content: "\f4c9"; } +.bi-pencil-square::before { content: "\f4ca"; } +.bi-pencil::before { content: "\f4cb"; } +.bi-pentagon-fill::before { content: "\f4cc"; } +.bi-pentagon-half::before { content: "\f4cd"; } +.bi-pentagon::before { content: "\f4ce"; } +.bi-people-fill::before { content: "\f4cf"; } +.bi-people::before { content: "\f4d0"; } +.bi-percent::before { content: "\f4d1"; } +.bi-person-badge-fill::before { content: "\f4d2"; } +.bi-person-badge::before { content: "\f4d3"; } +.bi-person-bounding-box::before { content: "\f4d4"; } +.bi-person-check-fill::before { content: "\f4d5"; } +.bi-person-check::before { content: "\f4d6"; } +.bi-person-circle::before { content: "\f4d7"; } +.bi-person-dash-fill::before { content: "\f4d8"; } +.bi-person-dash::before { content: "\f4d9"; } +.bi-person-fill::before { content: "\f4da"; } +.bi-person-lines-fill::before { content: "\f4db"; } +.bi-person-plus-fill::before { content: "\f4dc"; } +.bi-person-plus::before { content: "\f4dd"; } +.bi-person-square::before { content: "\f4de"; } +.bi-person-x-fill::before { content: "\f4df"; } +.bi-person-x::before { content: "\f4e0"; } +.bi-person::before { content: "\f4e1"; } +.bi-phone-fill::before { content: "\f4e2"; } +.bi-phone-landscape-fill::before { content: "\f4e3"; } +.bi-phone-landscape::before { content: "\f4e4"; } +.bi-phone-vibrate-fill::before { content: "\f4e5"; } +.bi-phone-vibrate::before { content: "\f4e6"; } +.bi-phone::before { content: "\f4e7"; } +.bi-pie-chart-fill::before { content: "\f4e8"; } +.bi-pie-chart::before { content: "\f4e9"; } +.bi-pin-angle-fill::before { content: "\f4ea"; } +.bi-pin-angle::before { content: "\f4eb"; } +.bi-pin-fill::before { content: "\f4ec"; } +.bi-pin::before { content: "\f4ed"; } +.bi-pip-fill::before { content: "\f4ee"; } +.bi-pip::before { content: "\f4ef"; } +.bi-play-btn-fill::before { content: "\f4f0"; } +.bi-play-btn::before { content: "\f4f1"; } +.bi-play-circle-fill::before { content: "\f4f2"; } +.bi-play-circle::before { content: "\f4f3"; } +.bi-play-fill::before { content: "\f4f4"; } +.bi-play::before { content: "\f4f5"; } +.bi-plug-fill::before { content: "\f4f6"; } +.bi-plug::before { content: "\f4f7"; } +.bi-plus-circle-dotted::before { content: "\f4f8"; } +.bi-plus-circle-fill::before { content: "\f4f9"; } +.bi-plus-circle::before { content: "\f4fa"; } +.bi-plus-square-dotted::before { content: "\f4fb"; } +.bi-plus-square-fill::before { content: "\f4fc"; } +.bi-plus-square::before { content: "\f4fd"; } +.bi-plus::before { content: "\f4fe"; } +.bi-power::before { content: "\f4ff"; } +.bi-printer-fill::before { content: "\f500"; } +.bi-printer::before { content: "\f501"; } +.bi-puzzle-fill::before { content: "\f502"; } +.bi-puzzle::before { content: "\f503"; } +.bi-question-circle-fill::before { content: "\f504"; } +.bi-question-circle::before { content: "\f505"; } +.bi-question-diamond-fill::before { content: "\f506"; } +.bi-question-diamond::before { content: "\f507"; } +.bi-question-octagon-fill::before { content: "\f508"; } +.bi-question-octagon::before { content: "\f509"; } +.bi-question-square-fill::before { content: "\f50a"; } +.bi-question-square::before { content: "\f50b"; } +.bi-question::before { content: "\f50c"; } +.bi-rainbow::before { content: "\f50d"; } +.bi-receipt-cutoff::before { content: "\f50e"; } +.bi-receipt::before { content: "\f50f"; } +.bi-reception-0::before { content: "\f510"; } +.bi-reception-1::before { content: "\f511"; } +.bi-reception-2::before { content: "\f512"; } +.bi-reception-3::before { content: "\f513"; } +.bi-reception-4::before { content: "\f514"; } +.bi-record-btn-fill::before { content: "\f515"; } +.bi-record-btn::before { content: "\f516"; } +.bi-record-circle-fill::before { content: "\f517"; } +.bi-record-circle::before { content: "\f518"; } +.bi-record-fill::before { content: "\f519"; } +.bi-record::before { content: "\f51a"; } +.bi-record2-fill::before { content: "\f51b"; } +.bi-record2::before { content: "\f51c"; } +.bi-reply-all-fill::before { content: "\f51d"; } +.bi-reply-all::before { content: "\f51e"; } +.bi-reply-fill::before { content: "\f51f"; } +.bi-reply::before { content: "\f520"; } +.bi-rss-fill::before { content: "\f521"; } +.bi-rss::before { content: "\f522"; } +.bi-rulers::before { content: "\f523"; } +.bi-save-fill::before { content: "\f524"; } +.bi-save::before { content: "\f525"; } +.bi-save2-fill::before { content: "\f526"; } +.bi-save2::before { content: "\f527"; } +.bi-scissors::before { content: "\f528"; } +.bi-screwdriver::before { content: "\f529"; } +.bi-search::before { content: "\f52a"; } +.bi-segmented-nav::before { content: "\f52b"; } +.bi-server::before { content: "\f52c"; } +.bi-share-fill::before { content: "\f52d"; } +.bi-share::before { content: "\f52e"; } +.bi-shield-check::before { content: "\f52f"; } +.bi-shield-exclamation::before { content: "\f530"; } +.bi-shield-fill-check::before { content: "\f531"; } +.bi-shield-fill-exclamation::before { content: "\f532"; } +.bi-shield-fill-minus::before { content: "\f533"; } +.bi-shield-fill-plus::before { content: "\f534"; } +.bi-shield-fill-x::before { content: "\f535"; } +.bi-shield-fill::before { content: "\f536"; } +.bi-shield-lock-fill::before { content: "\f537"; } +.bi-shield-lock::before { content: "\f538"; } +.bi-shield-minus::before { content: "\f539"; } +.bi-shield-plus::before { content: "\f53a"; } +.bi-shield-shaded::before { content: "\f53b"; } +.bi-shield-slash-fill::before { content: "\f53c"; } +.bi-shield-slash::before { content: "\f53d"; } +.bi-shield-x::before { content: "\f53e"; } +.bi-shield::before { content: "\f53f"; } +.bi-shift-fill::before { content: "\f540"; } +.bi-shift::before { content: "\f541"; } +.bi-shop-window::before { content: "\f542"; } +.bi-shop::before { content: "\f543"; } +.bi-shuffle::before { content: "\f544"; } +.bi-signpost-2-fill::before { content: "\f545"; } +.bi-signpost-2::before { content: "\f546"; } +.bi-signpost-fill::before { content: "\f547"; } +.bi-signpost-split-fill::before { content: "\f548"; } +.bi-signpost-split::before { content: "\f549"; } +.bi-signpost::before { content: "\f54a"; } +.bi-sim-fill::before { content: "\f54b"; } +.bi-sim::before { content: "\f54c"; } +.bi-skip-backward-btn-fill::before { content: "\f54d"; } +.bi-skip-backward-btn::before { content: "\f54e"; } +.bi-skip-backward-circle-fill::before { content: "\f54f"; } +.bi-skip-backward-circle::before { content: "\f550"; } +.bi-skip-backward-fill::before { content: "\f551"; } +.bi-skip-backward::before { content: "\f552"; } +.bi-skip-end-btn-fill::before { content: "\f553"; } +.bi-skip-end-btn::before { content: "\f554"; } +.bi-skip-end-circle-fill::before { content: "\f555"; } +.bi-skip-end-circle::before { content: "\f556"; } +.bi-skip-end-fill::before { content: "\f557"; } +.bi-skip-end::before { content: "\f558"; } +.bi-skip-forward-btn-fill::before { content: "\f559"; } +.bi-skip-forward-btn::before { content: "\f55a"; } +.bi-skip-forward-circle-fill::before { content: "\f55b"; } +.bi-skip-forward-circle::before { content: "\f55c"; } +.bi-skip-forward-fill::before { content: "\f55d"; } +.bi-skip-forward::before { content: "\f55e"; } +.bi-skip-start-btn-fill::before { content: "\f55f"; } +.bi-skip-start-btn::before { content: "\f560"; } +.bi-skip-start-circle-fill::before { content: "\f561"; } +.bi-skip-start-circle::before { content: "\f562"; } +.bi-skip-start-fill::before { content: "\f563"; } +.bi-skip-start::before { content: "\f564"; } +.bi-slack::before { content: "\f565"; } +.bi-slash-circle-fill::before { content: "\f566"; } +.bi-slash-circle::before { content: "\f567"; } +.bi-slash-square-fill::before { content: "\f568"; } +.bi-slash-square::before { content: "\f569"; } +.bi-slash::before { content: "\f56a"; } +.bi-sliders::before { content: "\f56b"; } +.bi-smartwatch::before { content: "\f56c"; } +.bi-snow::before { content: "\f56d"; } +.bi-snow2::before { content: "\f56e"; } +.bi-snow3::before { content: "\f56f"; } +.bi-sort-alpha-down-alt::before { content: "\f570"; } +.bi-sort-alpha-down::before { content: "\f571"; } +.bi-sort-alpha-up-alt::before { content: "\f572"; } +.bi-sort-alpha-up::before { content: "\f573"; } +.bi-sort-down-alt::before { content: "\f574"; } +.bi-sort-down::before { content: "\f575"; } +.bi-sort-numeric-down-alt::before { content: "\f576"; } +.bi-sort-numeric-down::before { content: "\f577"; } +.bi-sort-numeric-up-alt::before { content: "\f578"; } +.bi-sort-numeric-up::before { content: "\f579"; } +.bi-sort-up-alt::before { content: "\f57a"; } +.bi-sort-up::before { content: "\f57b"; } +.bi-soundwave::before { content: "\f57c"; } +.bi-speaker-fill::before { content: "\f57d"; } +.bi-speaker::before { content: "\f57e"; } +.bi-speedometer::before { content: "\f57f"; } +.bi-speedometer2::before { content: "\f580"; } +.bi-spellcheck::before { content: "\f581"; } +.bi-square-fill::before { content: "\f582"; } +.bi-square-half::before { content: "\f583"; } +.bi-square::before { content: "\f584"; } +.bi-stack::before { content: "\f585"; } +.bi-star-fill::before { content: "\f586"; } +.bi-star-half::before { content: "\f587"; } +.bi-star::before { content: "\f588"; } +.bi-stars::before { content: "\f589"; } +.bi-stickies-fill::before { content: "\f58a"; } +.bi-stickies::before { content: "\f58b"; } +.bi-sticky-fill::before { content: "\f58c"; } +.bi-sticky::before { content: "\f58d"; } +.bi-stop-btn-fill::before { content: "\f58e"; } +.bi-stop-btn::before { content: "\f58f"; } +.bi-stop-circle-fill::before { content: "\f590"; } +.bi-stop-circle::before { content: "\f591"; } +.bi-stop-fill::before { content: "\f592"; } +.bi-stop::before { content: "\f593"; } +.bi-stoplights-fill::before { content: "\f594"; } +.bi-stoplights::before { content: "\f595"; } +.bi-stopwatch-fill::before { content: "\f596"; } +.bi-stopwatch::before { content: "\f597"; } +.bi-subtract::before { content: "\f598"; } +.bi-suit-club-fill::before { content: "\f599"; } +.bi-suit-club::before { content: "\f59a"; } +.bi-suit-diamond-fill::before { content: "\f59b"; } +.bi-suit-diamond::before { content: "\f59c"; } +.bi-suit-heart-fill::before { content: "\f59d"; } +.bi-suit-heart::before { content: "\f59e"; } +.bi-suit-spade-fill::before { content: "\f59f"; } +.bi-suit-spade::before { content: "\f5a0"; } +.bi-sun-fill::before { content: "\f5a1"; } +.bi-sun::before { content: "\f5a2"; } +.bi-sunglasses::before { content: "\f5a3"; } +.bi-sunrise-fill::before { content: "\f5a4"; } +.bi-sunrise::before { content: "\f5a5"; } +.bi-sunset-fill::before { content: "\f5a6"; } +.bi-sunset::before { content: "\f5a7"; } +.bi-symmetry-horizontal::before { content: "\f5a8"; } +.bi-symmetry-vertical::before { content: "\f5a9"; } +.bi-table::before { content: "\f5aa"; } +.bi-tablet-fill::before { content: "\f5ab"; } +.bi-tablet-landscape-fill::before { content: "\f5ac"; } +.bi-tablet-landscape::before { content: "\f5ad"; } +.bi-tablet::before { content: "\f5ae"; } +.bi-tag-fill::before { content: "\f5af"; } +.bi-tag::before { content: "\f5b0"; } +.bi-tags-fill::before { content: "\f5b1"; } +.bi-tags::before { content: "\f5b2"; } +.bi-telegram::before { content: "\f5b3"; } +.bi-telephone-fill::before { content: "\f5b4"; } +.bi-telephone-forward-fill::before { content: "\f5b5"; } +.bi-telephone-forward::before { content: "\f5b6"; } +.bi-telephone-inbound-fill::before { content: "\f5b7"; } +.bi-telephone-inbound::before { content: "\f5b8"; } +.bi-telephone-minus-fill::before { content: "\f5b9"; } +.bi-telephone-minus::before { content: "\f5ba"; } +.bi-telephone-outbound-fill::before { content: "\f5bb"; } +.bi-telephone-outbound::before { content: "\f5bc"; } +.bi-telephone-plus-fill::before { content: "\f5bd"; } +.bi-telephone-plus::before { content: "\f5be"; } +.bi-telephone-x-fill::before { content: "\f5bf"; } +.bi-telephone-x::before { content: "\f5c0"; } +.bi-telephone::before { content: "\f5c1"; } +.bi-terminal-fill::before { content: "\f5c2"; } +.bi-terminal::before { content: "\f5c3"; } +.bi-text-center::before { content: "\f5c4"; } +.bi-text-indent-left::before { content: "\f5c5"; } +.bi-text-indent-right::before { content: "\f5c6"; } +.bi-text-left::before { content: "\f5c7"; } +.bi-text-paragraph::before { content: "\f5c8"; } +.bi-text-right::before { content: "\f5c9"; } +.bi-textarea-resize::before { content: "\f5ca"; } +.bi-textarea-t::before { content: "\f5cb"; } +.bi-textarea::before { content: "\f5cc"; } +.bi-thermometer-half::before { content: "\f5cd"; } +.bi-thermometer-high::before { content: "\f5ce"; } +.bi-thermometer-low::before { content: "\f5cf"; } +.bi-thermometer-snow::before { content: "\f5d0"; } +.bi-thermometer-sun::before { content: "\f5d1"; } +.bi-thermometer::before { content: "\f5d2"; } +.bi-three-dots-vertical::before { content: "\f5d3"; } +.bi-three-dots::before { content: "\f5d4"; } +.bi-toggle-off::before { content: "\f5d5"; } +.bi-toggle-on::before { content: "\f5d6"; } +.bi-toggle2-off::before { content: "\f5d7"; } +.bi-toggle2-on::before { content: "\f5d8"; } +.bi-toggles::before { content: "\f5d9"; } +.bi-toggles2::before { content: "\f5da"; } +.bi-tools::before { content: "\f5db"; } +.bi-tornado::before { content: "\f5dc"; } +.bi-trash-fill::before { content: "\f5dd"; } +.bi-trash::before { content: "\f5de"; } +.bi-trash2-fill::before { content: "\f5df"; } +.bi-trash2::before { content: "\f5e0"; } +.bi-tree-fill::before { content: "\f5e1"; } +.bi-tree::before { content: "\f5e2"; } +.bi-triangle-fill::before { content: "\f5e3"; } +.bi-triangle-half::before { content: "\f5e4"; } +.bi-triangle::before { content: "\f5e5"; } +.bi-trophy-fill::before { content: "\f5e6"; } +.bi-trophy::before { content: "\f5e7"; } +.bi-tropical-storm::before { content: "\f5e8"; } +.bi-truck-flatbed::before { content: "\f5e9"; } +.bi-truck::before { content: "\f5ea"; } +.bi-tsunami::before { content: "\f5eb"; } +.bi-tv-fill::before { content: "\f5ec"; } +.bi-tv::before { content: "\f5ed"; } +.bi-twitch::before { content: "\f5ee"; } +.bi-twitter::before { content: "\f5ef"; } +.bi-type-bold::before { content: "\f5f0"; } +.bi-type-h1::before { content: "\f5f1"; } +.bi-type-h2::before { content: "\f5f2"; } +.bi-type-h3::before { content: "\f5f3"; } +.bi-type-italic::before { content: "\f5f4"; } +.bi-type-strikethrough::before { content: "\f5f5"; } +.bi-type-underline::before { content: "\f5f6"; } +.bi-type::before { content: "\f5f7"; } +.bi-ui-checks-grid::before { content: "\f5f8"; } +.bi-ui-checks::before { content: "\f5f9"; } +.bi-ui-radios-grid::before { content: "\f5fa"; } +.bi-ui-radios::before { content: "\f5fb"; } +.bi-umbrella-fill::before { content: "\f5fc"; } +.bi-umbrella::before { content: "\f5fd"; } +.bi-union::before { content: "\f5fe"; } +.bi-unlock-fill::before { content: "\f5ff"; } +.bi-unlock::before { content: "\f600"; } +.bi-upc-scan::before { content: "\f601"; } +.bi-upc::before { content: "\f602"; } +.bi-upload::before { content: "\f603"; } +.bi-vector-pen::before { content: "\f604"; } +.bi-view-list::before { content: "\f605"; } +.bi-view-stacked::before { content: "\f606"; } +.bi-vinyl-fill::before { content: "\f607"; } +.bi-vinyl::before { content: "\f608"; } +.bi-voicemail::before { content: "\f609"; } +.bi-volume-down-fill::before { content: "\f60a"; } +.bi-volume-down::before { content: "\f60b"; } +.bi-volume-mute-fill::before { content: "\f60c"; } +.bi-volume-mute::before { content: "\f60d"; } +.bi-volume-off-fill::before { content: "\f60e"; } +.bi-volume-off::before { content: "\f60f"; } +.bi-volume-up-fill::before { content: "\f610"; } +.bi-volume-up::before { content: "\f611"; } +.bi-vr::before { content: "\f612"; } +.bi-wallet-fill::before { content: "\f613"; } +.bi-wallet::before { content: "\f614"; } +.bi-wallet2::before { content: "\f615"; } +.bi-watch::before { content: "\f616"; } +.bi-water::before { content: "\f617"; } +.bi-whatsapp::before { content: "\f618"; } +.bi-wifi-1::before { content: "\f619"; } +.bi-wifi-2::before { content: "\f61a"; } +.bi-wifi-off::before { content: "\f61b"; } +.bi-wifi::before { content: "\f61c"; } +.bi-wind::before { content: "\f61d"; } +.bi-window-dock::before { content: "\f61e"; } +.bi-window-sidebar::before { content: "\f61f"; } +.bi-window::before { content: "\f620"; } +.bi-wrench::before { content: "\f621"; } +.bi-x-circle-fill::before { content: "\f622"; } +.bi-x-circle::before { content: "\f623"; } +.bi-x-diamond-fill::before { content: "\f624"; } +.bi-x-diamond::before { content: "\f625"; } +.bi-x-octagon-fill::before { content: "\f626"; } +.bi-x-octagon::before { content: "\f627"; } +.bi-x-square-fill::before { content: "\f628"; } +.bi-x-square::before { content: "\f629"; } +.bi-x::before { content: "\f62a"; } +.bi-youtube::before { content: "\f62b"; } +.bi-zoom-in::before { content: "\f62c"; } +.bi-zoom-out::before { content: "\f62d"; } +.bi-bank::before { content: "\f62e"; } +.bi-bank2::before { content: "\f62f"; } +.bi-bell-slash-fill::before { content: "\f630"; } +.bi-bell-slash::before { content: "\f631"; } +.bi-cash-coin::before { content: "\f632"; } +.bi-check-lg::before { content: "\f633"; } +.bi-coin::before { content: "\f634"; } +.bi-currency-bitcoin::before { content: "\f635"; } +.bi-currency-dollar::before { content: "\f636"; } +.bi-currency-euro::before { content: "\f637"; } +.bi-currency-exchange::before { content: "\f638"; } +.bi-currency-pound::before { content: "\f639"; } +.bi-currency-yen::before { content: "\f63a"; } +.bi-dash-lg::before { content: "\f63b"; } +.bi-exclamation-lg::before { content: "\f63c"; } +.bi-file-earmark-pdf-fill::before { content: "\f63d"; } +.bi-file-earmark-pdf::before { content: "\f63e"; } +.bi-file-pdf-fill::before { content: "\f63f"; } +.bi-file-pdf::before { content: "\f640"; } +.bi-gender-ambiguous::before { content: "\f641"; } +.bi-gender-female::before { content: "\f642"; } +.bi-gender-male::before { content: "\f643"; } +.bi-gender-trans::before { content: "\f644"; } +.bi-headset-vr::before { content: "\f645"; } +.bi-info-lg::before { content: "\f646"; } +.bi-mastodon::before { content: "\f647"; } +.bi-messenger::before { content: "\f648"; } +.bi-piggy-bank-fill::before { content: "\f649"; } +.bi-piggy-bank::before { content: "\f64a"; } +.bi-pin-map-fill::before { content: "\f64b"; } +.bi-pin-map::before { content: "\f64c"; } +.bi-plus-lg::before { content: "\f64d"; } +.bi-question-lg::before { content: "\f64e"; } +.bi-recycle::before { content: "\f64f"; } +.bi-reddit::before { content: "\f650"; } +.bi-safe-fill::before { content: "\f651"; } +.bi-safe2-fill::before { content: "\f652"; } +.bi-safe2::before { content: "\f653"; } +.bi-sd-card-fill::before { content: "\f654"; } +.bi-sd-card::before { content: "\f655"; } +.bi-skype::before { content: "\f656"; } +.bi-slash-lg::before { content: "\f657"; } +.bi-translate::before { content: "\f658"; } +.bi-x-lg::before { content: "\f659"; } +.bi-safe::before { content: "\f65a"; } +.bi-apple::before { content: "\f65b"; } +.bi-microsoft::before { content: "\f65d"; } +.bi-windows::before { content: "\f65e"; } +.bi-behance::before { content: "\f65c"; } +.bi-dribbble::before { content: "\f65f"; } +.bi-line::before { content: "\f660"; } +.bi-medium::before { content: "\f661"; } +.bi-paypal::before { content: "\f662"; } +.bi-pinterest::before { content: "\f663"; } +.bi-signal::before { content: "\f664"; } +.bi-snapchat::before { content: "\f665"; } +.bi-spotify::before { content: "\f666"; } +.bi-stack-overflow::before { content: "\f667"; } +.bi-strava::before { content: "\f668"; } +.bi-wordpress::before { content: "\f669"; } +.bi-vimeo::before { content: "\f66a"; } +.bi-activity::before { content: "\f66b"; } +.bi-easel2-fill::before { content: "\f66c"; } +.bi-easel2::before { content: "\f66d"; } +.bi-easel3-fill::before { content: "\f66e"; } +.bi-easel3::before { content: "\f66f"; } +.bi-fan::before { content: "\f670"; } +.bi-fingerprint::before { content: "\f671"; } +.bi-graph-down-arrow::before { content: "\f672"; } +.bi-graph-up-arrow::before { content: "\f673"; } +.bi-hypnotize::before { content: "\f674"; } +.bi-magic::before { content: "\f675"; } +.bi-person-rolodex::before { content: "\f676"; } +.bi-person-video::before { content: "\f677"; } +.bi-person-video2::before { content: "\f678"; } +.bi-person-video3::before { content: "\f679"; } +.bi-person-workspace::before { content: "\f67a"; } +.bi-radioactive::before { content: "\f67b"; } +.bi-webcam-fill::before { content: "\f67c"; } +.bi-webcam::before { content: "\f67d"; } +.bi-yin-yang::before { content: "\f67e"; } +.bi-bandaid-fill::before { content: "\f680"; } +.bi-bandaid::before { content: "\f681"; } +.bi-bluetooth::before { content: "\f682"; } +.bi-body-text::before { content: "\f683"; } +.bi-boombox::before { content: "\f684"; } +.bi-boxes::before { content: "\f685"; } +.bi-dpad-fill::before { content: "\f686"; } +.bi-dpad::before { content: "\f687"; } +.bi-ear-fill::before { content: "\f688"; } +.bi-ear::before { content: "\f689"; } +.bi-envelope-check-fill::before { content: "\f68b"; } +.bi-envelope-check::before { content: "\f68c"; } +.bi-envelope-dash-fill::before { content: "\f68e"; } +.bi-envelope-dash::before { content: "\f68f"; } +.bi-envelope-exclamation-fill::before { content: "\f691"; } +.bi-envelope-exclamation::before { content: "\f692"; } +.bi-envelope-plus-fill::before { content: "\f693"; } +.bi-envelope-plus::before { content: "\f694"; } +.bi-envelope-slash-fill::before { content: "\f696"; } +.bi-envelope-slash::before { content: "\f697"; } +.bi-envelope-x-fill::before { content: "\f699"; } +.bi-envelope-x::before { content: "\f69a"; } +.bi-explicit-fill::before { content: "\f69b"; } +.bi-explicit::before { content: "\f69c"; } +.bi-git::before { content: "\f69d"; } +.bi-infinity::before { content: "\f69e"; } +.bi-list-columns-reverse::before { content: "\f69f"; } +.bi-list-columns::before { content: "\f6a0"; } +.bi-meta::before { content: "\f6a1"; } +.bi-nintendo-switch::before { content: "\f6a4"; } +.bi-pc-display-horizontal::before { content: "\f6a5"; } +.bi-pc-display::before { content: "\f6a6"; } +.bi-pc-horizontal::before { content: "\f6a7"; } +.bi-pc::before { content: "\f6a8"; } +.bi-playstation::before { content: "\f6a9"; } +.bi-plus-slash-minus::before { content: "\f6aa"; } +.bi-projector-fill::before { content: "\f6ab"; } +.bi-projector::before { content: "\f6ac"; } +.bi-qr-code-scan::before { content: "\f6ad"; } +.bi-qr-code::before { content: "\f6ae"; } +.bi-quora::before { content: "\f6af"; } +.bi-quote::before { content: "\f6b0"; } +.bi-robot::before { content: "\f6b1"; } +.bi-send-check-fill::before { content: "\f6b2"; } +.bi-send-check::before { content: "\f6b3"; } +.bi-send-dash-fill::before { content: "\f6b4"; } +.bi-send-dash::before { content: "\f6b5"; } +.bi-send-exclamation-fill::before { content: "\f6b7"; } +.bi-send-exclamation::before { content: "\f6b8"; } +.bi-send-fill::before { content: "\f6b9"; } +.bi-send-plus-fill::before { content: "\f6ba"; } +.bi-send-plus::before { content: "\f6bb"; } +.bi-send-slash-fill::before { content: "\f6bc"; } +.bi-send-slash::before { content: "\f6bd"; } +.bi-send-x-fill::before { content: "\f6be"; } +.bi-send-x::before { content: "\f6bf"; } +.bi-send::before { content: "\f6c0"; } +.bi-steam::before { content: "\f6c1"; } +.bi-terminal-dash::before { content: "\f6c3"; } +.bi-terminal-plus::before { content: "\f6c4"; } +.bi-terminal-split::before { content: "\f6c5"; } +.bi-ticket-detailed-fill::before { content: "\f6c6"; } +.bi-ticket-detailed::before { content: "\f6c7"; } +.bi-ticket-fill::before { content: "\f6c8"; } +.bi-ticket-perforated-fill::before { content: "\f6c9"; } +.bi-ticket-perforated::before { content: "\f6ca"; } +.bi-ticket::before { content: "\f6cb"; } +.bi-tiktok::before { content: "\f6cc"; } +.bi-window-dash::before { content: "\f6cd"; } +.bi-window-desktop::before { content: "\f6ce"; } +.bi-window-fullscreen::before { content: "\f6cf"; } +.bi-window-plus::before { content: "\f6d0"; } +.bi-window-split::before { content: "\f6d1"; } +.bi-window-stack::before { content: "\f6d2"; } +.bi-window-x::before { content: "\f6d3"; } +.bi-xbox::before { content: "\f6d4"; } +.bi-ethernet::before { content: "\f6d5"; } +.bi-hdmi-fill::before { content: "\f6d6"; } +.bi-hdmi::before { content: "\f6d7"; } +.bi-usb-c-fill::before { content: "\f6d8"; } +.bi-usb-c::before { content: "\f6d9"; } +.bi-usb-fill::before { content: "\f6da"; } +.bi-usb-plug-fill::before { content: "\f6db"; } +.bi-usb-plug::before { content: "\f6dc"; } +.bi-usb-symbol::before { content: "\f6dd"; } +.bi-usb::before { content: "\f6de"; } +.bi-boombox-fill::before { content: "\f6df"; } +.bi-displayport::before { content: "\f6e1"; } +.bi-gpu-card::before { content: "\f6e2"; } +.bi-memory::before { content: "\f6e3"; } +.bi-modem-fill::before { content: "\f6e4"; } +.bi-modem::before { content: "\f6e5"; } +.bi-motherboard-fill::before { content: "\f6e6"; } +.bi-motherboard::before { content: "\f6e7"; } +.bi-optical-audio-fill::before { content: "\f6e8"; } +.bi-optical-audio::before { content: "\f6e9"; } +.bi-pci-card::before { content: "\f6ea"; } +.bi-router-fill::before { content: "\f6eb"; } +.bi-router::before { content: "\f6ec"; } +.bi-thunderbolt-fill::before { content: "\f6ef"; } +.bi-thunderbolt::before { content: "\f6f0"; } +.bi-usb-drive-fill::before { content: "\f6f1"; } +.bi-usb-drive::before { content: "\f6f2"; } +.bi-usb-micro-fill::before { content: "\f6f3"; } +.bi-usb-micro::before { content: "\f6f4"; } +.bi-usb-mini-fill::before { content: "\f6f5"; } +.bi-usb-mini::before { content: "\f6f6"; } +.bi-cloud-haze2::before { content: "\f6f7"; } +.bi-device-hdd-fill::before { content: "\f6f8"; } +.bi-device-hdd::before { content: "\f6f9"; } +.bi-device-ssd-fill::before { content: "\f6fa"; } +.bi-device-ssd::before { content: "\f6fb"; } +.bi-displayport-fill::before { content: "\f6fc"; } +.bi-mortarboard-fill::before { content: "\f6fd"; } +.bi-mortarboard::before { content: "\f6fe"; } +.bi-terminal-x::before { content: "\f6ff"; } +.bi-arrow-through-heart-fill::before { content: "\f700"; } +.bi-arrow-through-heart::before { content: "\f701"; } +.bi-badge-sd-fill::before { content: "\f702"; } +.bi-badge-sd::before { content: "\f703"; } +.bi-bag-heart-fill::before { content: "\f704"; } +.bi-bag-heart::before { content: "\f705"; } +.bi-balloon-fill::before { content: "\f706"; } +.bi-balloon-heart-fill::before { content: "\f707"; } +.bi-balloon-heart::before { content: "\f708"; } +.bi-balloon::before { content: "\f709"; } +.bi-box2-fill::before { content: "\f70a"; } +.bi-box2-heart-fill::before { content: "\f70b"; } +.bi-box2-heart::before { content: "\f70c"; } +.bi-box2::before { content: "\f70d"; } +.bi-braces-asterisk::before { content: "\f70e"; } +.bi-calendar-heart-fill::before { content: "\f70f"; } +.bi-calendar-heart::before { content: "\f710"; } +.bi-calendar2-heart-fill::before { content: "\f711"; } +.bi-calendar2-heart::before { content: "\f712"; } +.bi-chat-heart-fill::before { content: "\f713"; } +.bi-chat-heart::before { content: "\f714"; } +.bi-chat-left-heart-fill::before { content: "\f715"; } +.bi-chat-left-heart::before { content: "\f716"; } +.bi-chat-right-heart-fill::before { content: "\f717"; } +.bi-chat-right-heart::before { content: "\f718"; } +.bi-chat-square-heart-fill::before { content: "\f719"; } +.bi-chat-square-heart::before { content: "\f71a"; } +.bi-clipboard-check-fill::before { content: "\f71b"; } +.bi-clipboard-data-fill::before { content: "\f71c"; } +.bi-clipboard-fill::before { content: "\f71d"; } +.bi-clipboard-heart-fill::before { content: "\f71e"; } +.bi-clipboard-heart::before { content: "\f71f"; } +.bi-clipboard-minus-fill::before { content: "\f720"; } +.bi-clipboard-plus-fill::before { content: "\f721"; } +.bi-clipboard-pulse::before { content: "\f722"; } +.bi-clipboard-x-fill::before { content: "\f723"; } +.bi-clipboard2-check-fill::before { content: "\f724"; } +.bi-clipboard2-check::before { content: "\f725"; } +.bi-clipboard2-data-fill::before { content: "\f726"; } +.bi-clipboard2-data::before { content: "\f727"; } +.bi-clipboard2-fill::before { content: "\f728"; } +.bi-clipboard2-heart-fill::before { content: "\f729"; } +.bi-clipboard2-heart::before { content: "\f72a"; } +.bi-clipboard2-minus-fill::before { content: "\f72b"; } +.bi-clipboard2-minus::before { content: "\f72c"; } +.bi-clipboard2-plus-fill::before { content: "\f72d"; } +.bi-clipboard2-plus::before { content: "\f72e"; } +.bi-clipboard2-pulse-fill::before { content: "\f72f"; } +.bi-clipboard2-pulse::before { content: "\f730"; } +.bi-clipboard2-x-fill::before { content: "\f731"; } +.bi-clipboard2-x::before { content: "\f732"; } +.bi-clipboard2::before { content: "\f733"; } +.bi-emoji-kiss-fill::before { content: "\f734"; } +.bi-emoji-kiss::before { content: "\f735"; } +.bi-envelope-heart-fill::before { content: "\f736"; } +.bi-envelope-heart::before { content: "\f737"; } +.bi-envelope-open-heart-fill::before { content: "\f738"; } +.bi-envelope-open-heart::before { content: "\f739"; } +.bi-envelope-paper-fill::before { content: "\f73a"; } +.bi-envelope-paper-heart-fill::before { content: "\f73b"; } +.bi-envelope-paper-heart::before { content: "\f73c"; } +.bi-envelope-paper::before { content: "\f73d"; } +.bi-filetype-aac::before { content: "\f73e"; } +.bi-filetype-ai::before { content: "\f73f"; } +.bi-filetype-bmp::before { content: "\f740"; } +.bi-filetype-cs::before { content: "\f741"; } +.bi-filetype-css::before { content: "\f742"; } +.bi-filetype-csv::before { content: "\f743"; } +.bi-filetype-doc::before { content: "\f744"; } +.bi-filetype-docx::before { content: "\f745"; } +.bi-filetype-exe::before { content: "\f746"; } +.bi-filetype-gif::before { content: "\f747"; } +.bi-filetype-heic::before { content: "\f748"; } +.bi-filetype-html::before { content: "\f749"; } +.bi-filetype-java::before { content: "\f74a"; } +.bi-filetype-jpg::before { content: "\f74b"; } +.bi-filetype-js::before { content: "\f74c"; } +.bi-filetype-jsx::before { content: "\f74d"; } +.bi-filetype-key::before { content: "\f74e"; } +.bi-filetype-m4p::before { content: "\f74f"; } +.bi-filetype-md::before { content: "\f750"; } +.bi-filetype-mdx::before { content: "\f751"; } +.bi-filetype-mov::before { content: "\f752"; } +.bi-filetype-mp3::before { content: "\f753"; } +.bi-filetype-mp4::before { content: "\f754"; } +.bi-filetype-otf::before { content: "\f755"; } +.bi-filetype-pdf::before { content: "\f756"; } +.bi-filetype-php::before { content: "\f757"; } +.bi-filetype-png::before { content: "\f758"; } +.bi-filetype-ppt::before { content: "\f75a"; } +.bi-filetype-psd::before { content: "\f75b"; } +.bi-filetype-py::before { content: "\f75c"; } +.bi-filetype-raw::before { content: "\f75d"; } +.bi-filetype-rb::before { content: "\f75e"; } +.bi-filetype-sass::before { content: "\f75f"; } +.bi-filetype-scss::before { content: "\f760"; } +.bi-filetype-sh::before { content: "\f761"; } +.bi-filetype-svg::before { content: "\f762"; } +.bi-filetype-tiff::before { content: "\f763"; } +.bi-filetype-tsx::before { content: "\f764"; } +.bi-filetype-ttf::before { content: "\f765"; } +.bi-filetype-txt::before { content: "\f766"; } +.bi-filetype-wav::before { content: "\f767"; } +.bi-filetype-woff::before { content: "\f768"; } +.bi-filetype-xls::before { content: "\f76a"; } +.bi-filetype-xml::before { content: "\f76b"; } +.bi-filetype-yml::before { content: "\f76c"; } +.bi-heart-arrow::before { content: "\f76d"; } +.bi-heart-pulse-fill::before { content: "\f76e"; } +.bi-heart-pulse::before { content: "\f76f"; } +.bi-heartbreak-fill::before { content: "\f770"; } +.bi-heartbreak::before { content: "\f771"; } +.bi-hearts::before { content: "\f772"; } +.bi-hospital-fill::before { content: "\f773"; } +.bi-hospital::before { content: "\f774"; } +.bi-house-heart-fill::before { content: "\f775"; } +.bi-house-heart::before { content: "\f776"; } +.bi-incognito::before { content: "\f777"; } +.bi-magnet-fill::before { content: "\f778"; } +.bi-magnet::before { content: "\f779"; } +.bi-person-heart::before { content: "\f77a"; } +.bi-person-hearts::before { content: "\f77b"; } +.bi-phone-flip::before { content: "\f77c"; } +.bi-plugin::before { content: "\f77d"; } +.bi-postage-fill::before { content: "\f77e"; } +.bi-postage-heart-fill::before { content: "\f77f"; } +.bi-postage-heart::before { content: "\f780"; } +.bi-postage::before { content: "\f781"; } +.bi-postcard-fill::before { content: "\f782"; } +.bi-postcard-heart-fill::before { content: "\f783"; } +.bi-postcard-heart::before { content: "\f784"; } +.bi-postcard::before { content: "\f785"; } +.bi-search-heart-fill::before { content: "\f786"; } +.bi-search-heart::before { content: "\f787"; } +.bi-sliders2-vertical::before { content: "\f788"; } +.bi-sliders2::before { content: "\f789"; } +.bi-trash3-fill::before { content: "\f78a"; } +.bi-trash3::before { content: "\f78b"; } +.bi-valentine::before { content: "\f78c"; } +.bi-valentine2::before { content: "\f78d"; } +.bi-wrench-adjustable-circle-fill::before { content: "\f78e"; } +.bi-wrench-adjustable-circle::before { content: "\f78f"; } +.bi-wrench-adjustable::before { content: "\f790"; } +.bi-filetype-json::before { content: "\f791"; } +.bi-filetype-pptx::before { content: "\f792"; } +.bi-filetype-xlsx::before { content: "\f793"; } +.bi-1-circle-fill::before { content: "\f796"; } +.bi-1-circle::before { content: "\f797"; } +.bi-1-square-fill::before { content: "\f798"; } +.bi-1-square::before { content: "\f799"; } +.bi-2-circle-fill::before { content: "\f79c"; } +.bi-2-circle::before { content: "\f79d"; } +.bi-2-square-fill::before { content: "\f79e"; } +.bi-2-square::before { content: "\f79f"; } +.bi-3-circle-fill::before { content: "\f7a2"; } +.bi-3-circle::before { content: "\f7a3"; } +.bi-3-square-fill::before { content: "\f7a4"; } +.bi-3-square::before { content: "\f7a5"; } +.bi-4-circle-fill::before { content: "\f7a8"; } +.bi-4-circle::before { content: "\f7a9"; } +.bi-4-square-fill::before { content: "\f7aa"; } +.bi-4-square::before { content: "\f7ab"; } +.bi-5-circle-fill::before { content: "\f7ae"; } +.bi-5-circle::before { content: "\f7af"; } +.bi-5-square-fill::before { content: "\f7b0"; } +.bi-5-square::before { content: "\f7b1"; } +.bi-6-circle-fill::before { content: "\f7b4"; } +.bi-6-circle::before { content: "\f7b5"; } +.bi-6-square-fill::before { content: "\f7b6"; } +.bi-6-square::before { content: "\f7b7"; } +.bi-7-circle-fill::before { content: "\f7ba"; } +.bi-7-circle::before { content: "\f7bb"; } +.bi-7-square-fill::before { content: "\f7bc"; } +.bi-7-square::before { content: "\f7bd"; } +.bi-8-circle-fill::before { content: "\f7c0"; } +.bi-8-circle::before { content: "\f7c1"; } +.bi-8-square-fill::before { content: "\f7c2"; } +.bi-8-square::before { content: "\f7c3"; } +.bi-9-circle-fill::before { content: "\f7c6"; } +.bi-9-circle::before { content: "\f7c7"; } +.bi-9-square-fill::before { content: "\f7c8"; } +.bi-9-square::before { content: "\f7c9"; } +.bi-airplane-engines-fill::before { content: "\f7ca"; } +.bi-airplane-engines::before { content: "\f7cb"; } +.bi-airplane-fill::before { content: "\f7cc"; } +.bi-airplane::before { content: "\f7cd"; } +.bi-alexa::before { content: "\f7ce"; } +.bi-alipay::before { content: "\f7cf"; } +.bi-android::before { content: "\f7d0"; } +.bi-android2::before { content: "\f7d1"; } +.bi-box-fill::before { content: "\f7d2"; } +.bi-box-seam-fill::before { content: "\f7d3"; } +.bi-browser-chrome::before { content: "\f7d4"; } +.bi-browser-edge::before { content: "\f7d5"; } +.bi-browser-firefox::before { content: "\f7d6"; } +.bi-browser-safari::before { content: "\f7d7"; } +.bi-c-circle-fill::before { content: "\f7da"; } +.bi-c-circle::before { content: "\f7db"; } +.bi-c-square-fill::before { content: "\f7dc"; } +.bi-c-square::before { content: "\f7dd"; } +.bi-capsule-pill::before { content: "\f7de"; } +.bi-capsule::before { content: "\f7df"; } +.bi-car-front-fill::before { content: "\f7e0"; } +.bi-car-front::before { content: "\f7e1"; } +.bi-cassette-fill::before { content: "\f7e2"; } +.bi-cassette::before { content: "\f7e3"; } +.bi-cc-circle-fill::before { content: "\f7e6"; } +.bi-cc-circle::before { content: "\f7e7"; } +.bi-cc-square-fill::before { content: "\f7e8"; } +.bi-cc-square::before { content: "\f7e9"; } +.bi-cup-hot-fill::before { content: "\f7ea"; } +.bi-cup-hot::before { content: "\f7eb"; } +.bi-currency-rupee::before { content: "\f7ec"; } +.bi-dropbox::before { content: "\f7ed"; } +.bi-escape::before { content: "\f7ee"; } +.bi-fast-forward-btn-fill::before { content: "\f7ef"; } +.bi-fast-forward-btn::before { content: "\f7f0"; } +.bi-fast-forward-circle-fill::before { content: "\f7f1"; } +.bi-fast-forward-circle::before { content: "\f7f2"; } +.bi-fast-forward-fill::before { content: "\f7f3"; } +.bi-fast-forward::before { content: "\f7f4"; } +.bi-filetype-sql::before { content: "\f7f5"; } +.bi-fire::before { content: "\f7f6"; } +.bi-google-play::before { content: "\f7f7"; } +.bi-h-circle-fill::before { content: "\f7fa"; } +.bi-h-circle::before { content: "\f7fb"; } +.bi-h-square-fill::before { content: "\f7fc"; } +.bi-h-square::before { content: "\f7fd"; } +.bi-indent::before { content: "\f7fe"; } +.bi-lungs-fill::before { content: "\f7ff"; } +.bi-lungs::before { content: "\f800"; } +.bi-microsoft-teams::before { content: "\f801"; } +.bi-p-circle-fill::before { content: "\f804"; } +.bi-p-circle::before { content: "\f805"; } +.bi-p-square-fill::before { content: "\f806"; } +.bi-p-square::before { content: "\f807"; } +.bi-pass-fill::before { content: "\f808"; } +.bi-pass::before { content: "\f809"; } +.bi-prescription::before { content: "\f80a"; } +.bi-prescription2::before { content: "\f80b"; } +.bi-r-circle-fill::before { content: "\f80e"; } +.bi-r-circle::before { content: "\f80f"; } +.bi-r-square-fill::before { content: "\f810"; } +.bi-r-square::before { content: "\f811"; } +.bi-repeat-1::before { content: "\f812"; } +.bi-repeat::before { content: "\f813"; } +.bi-rewind-btn-fill::before { content: "\f814"; } +.bi-rewind-btn::before { content: "\f815"; } +.bi-rewind-circle-fill::before { content: "\f816"; } +.bi-rewind-circle::before { content: "\f817"; } +.bi-rewind-fill::before { content: "\f818"; } +.bi-rewind::before { content: "\f819"; } +.bi-train-freight-front-fill::before { content: "\f81a"; } +.bi-train-freight-front::before { content: "\f81b"; } +.bi-train-front-fill::before { content: "\f81c"; } +.bi-train-front::before { content: "\f81d"; } +.bi-train-lightrail-front-fill::before { content: "\f81e"; } +.bi-train-lightrail-front::before { content: "\f81f"; } +.bi-truck-front-fill::before { content: "\f820"; } +.bi-truck-front::before { content: "\f821"; } +.bi-ubuntu::before { content: "\f822"; } +.bi-unindent::before { content: "\f823"; } +.bi-unity::before { content: "\f824"; } +.bi-universal-access-circle::before { content: "\f825"; } +.bi-universal-access::before { content: "\f826"; } +.bi-virus::before { content: "\f827"; } +.bi-virus2::before { content: "\f828"; } +.bi-wechat::before { content: "\f829"; } +.bi-yelp::before { content: "\f82a"; } +.bi-sign-stop-fill::before { content: "\f82b"; } +.bi-sign-stop-lights-fill::before { content: "\f82c"; } +.bi-sign-stop-lights::before { content: "\f82d"; } +.bi-sign-stop::before { content: "\f82e"; } +.bi-sign-turn-left-fill::before { content: "\f82f"; } +.bi-sign-turn-left::before { content: "\f830"; } +.bi-sign-turn-right-fill::before { content: "\f831"; } +.bi-sign-turn-right::before { content: "\f832"; } +.bi-sign-turn-slight-left-fill::before { content: "\f833"; } +.bi-sign-turn-slight-left::before { content: "\f834"; } +.bi-sign-turn-slight-right-fill::before { content: "\f835"; } +.bi-sign-turn-slight-right::before { content: "\f836"; } +.bi-sign-yield-fill::before { content: "\f837"; } +.bi-sign-yield::before { content: "\f838"; } +.bi-ev-station-fill::before { content: "\f839"; } +.bi-ev-station::before { content: "\f83a"; } +.bi-fuel-pump-diesel-fill::before { content: "\f83b"; } +.bi-fuel-pump-diesel::before { content: "\f83c"; } +.bi-fuel-pump-fill::before { content: "\f83d"; } +.bi-fuel-pump::before { content: "\f83e"; } +.bi-0-circle-fill::before { content: "\f83f"; } +.bi-0-circle::before { content: "\f840"; } +.bi-0-square-fill::before { content: "\f841"; } +.bi-0-square::before { content: "\f842"; } +.bi-rocket-fill::before { content: "\f843"; } +.bi-rocket-takeoff-fill::before { content: "\f844"; } +.bi-rocket-takeoff::before { content: "\f845"; } +.bi-rocket::before { content: "\f846"; } +.bi-stripe::before { content: "\f847"; } +.bi-subscript::before { content: "\f848"; } +.bi-superscript::before { content: "\f849"; } +.bi-trello::before { content: "\f84a"; } +.bi-envelope-at-fill::before { content: "\f84b"; } +.bi-envelope-at::before { content: "\f84c"; } +.bi-regex::before { content: "\f84d"; } +.bi-text-wrap::before { content: "\f84e"; } +.bi-sign-dead-end-fill::before { content: "\f84f"; } +.bi-sign-dead-end::before { content: "\f850"; } +.bi-sign-do-not-enter-fill::before { content: "\f851"; } +.bi-sign-do-not-enter::before { content: "\f852"; } +.bi-sign-intersection-fill::before { content: "\f853"; } +.bi-sign-intersection-side-fill::before { content: "\f854"; } +.bi-sign-intersection-side::before { content: "\f855"; } +.bi-sign-intersection-t-fill::before { content: "\f856"; } +.bi-sign-intersection-t::before { content: "\f857"; } +.bi-sign-intersection-y-fill::before { content: "\f858"; } +.bi-sign-intersection-y::before { content: "\f859"; } +.bi-sign-intersection::before { content: "\f85a"; } +.bi-sign-merge-left-fill::before { content: "\f85b"; } +.bi-sign-merge-left::before { content: "\f85c"; } +.bi-sign-merge-right-fill::before { content: "\f85d"; } +.bi-sign-merge-right::before { content: "\f85e"; } +.bi-sign-no-left-turn-fill::before { content: "\f85f"; } +.bi-sign-no-left-turn::before { content: "\f860"; } +.bi-sign-no-parking-fill::before { content: "\f861"; } +.bi-sign-no-parking::before { content: "\f862"; } +.bi-sign-no-right-turn-fill::before { content: "\f863"; } +.bi-sign-no-right-turn::before { content: "\f864"; } +.bi-sign-railroad-fill::before { content: "\f865"; } +.bi-sign-railroad::before { content: "\f866"; } +.bi-building-add::before { content: "\f867"; } +.bi-building-check::before { content: "\f868"; } +.bi-building-dash::before { content: "\f869"; } +.bi-building-down::before { content: "\f86a"; } +.bi-building-exclamation::before { content: "\f86b"; } +.bi-building-fill-add::before { content: "\f86c"; } +.bi-building-fill-check::before { content: "\f86d"; } +.bi-building-fill-dash::before { content: "\f86e"; } +.bi-building-fill-down::before { content: "\f86f"; } +.bi-building-fill-exclamation::before { content: "\f870"; } +.bi-building-fill-gear::before { content: "\f871"; } +.bi-building-fill-lock::before { content: "\f872"; } +.bi-building-fill-slash::before { content: "\f873"; } +.bi-building-fill-up::before { content: "\f874"; } +.bi-building-fill-x::before { content: "\f875"; } +.bi-building-fill::before { content: "\f876"; } +.bi-building-gear::before { content: "\f877"; } +.bi-building-lock::before { content: "\f878"; } +.bi-building-slash::before { content: "\f879"; } +.bi-building-up::before { content: "\f87a"; } +.bi-building-x::before { content: "\f87b"; } +.bi-buildings-fill::before { content: "\f87c"; } +.bi-buildings::before { content: "\f87d"; } +.bi-bus-front-fill::before { content: "\f87e"; } +.bi-bus-front::before { content: "\f87f"; } +.bi-ev-front-fill::before { content: "\f880"; } +.bi-ev-front::before { content: "\f881"; } +.bi-globe-americas::before { content: "\f882"; } +.bi-globe-asia-australia::before { content: "\f883"; } +.bi-globe-central-south-asia::before { content: "\f884"; } +.bi-globe-europe-africa::before { content: "\f885"; } +.bi-house-add-fill::before { content: "\f886"; } +.bi-house-add::before { content: "\f887"; } +.bi-house-check-fill::before { content: "\f888"; } +.bi-house-check::before { content: "\f889"; } +.bi-house-dash-fill::before { content: "\f88a"; } +.bi-house-dash::before { content: "\f88b"; } +.bi-house-down-fill::before { content: "\f88c"; } +.bi-house-down::before { content: "\f88d"; } +.bi-house-exclamation-fill::before { content: "\f88e"; } +.bi-house-exclamation::before { content: "\f88f"; } +.bi-house-gear-fill::before { content: "\f890"; } +.bi-house-gear::before { content: "\f891"; } +.bi-house-lock-fill::before { content: "\f892"; } +.bi-house-lock::before { content: "\f893"; } +.bi-house-slash-fill::before { content: "\f894"; } +.bi-house-slash::before { content: "\f895"; } +.bi-house-up-fill::before { content: "\f896"; } +.bi-house-up::before { content: "\f897"; } +.bi-house-x-fill::before { content: "\f898"; } +.bi-house-x::before { content: "\f899"; } +.bi-person-add::before { content: "\f89a"; } +.bi-person-down::before { content: "\f89b"; } +.bi-person-exclamation::before { content: "\f89c"; } +.bi-person-fill-add::before { content: "\f89d"; } +.bi-person-fill-check::before { content: "\f89e"; } +.bi-person-fill-dash::before { content: "\f89f"; } +.bi-person-fill-down::before { content: "\f8a0"; } +.bi-person-fill-exclamation::before { content: "\f8a1"; } +.bi-person-fill-gear::before { content: "\f8a2"; } +.bi-person-fill-lock::before { content: "\f8a3"; } +.bi-person-fill-slash::before { content: "\f8a4"; } +.bi-person-fill-up::before { content: "\f8a5"; } +.bi-person-fill-x::before { content: "\f8a6"; } +.bi-person-gear::before { content: "\f8a7"; } +.bi-person-lock::before { content: "\f8a8"; } +.bi-person-slash::before { content: "\f8a9"; } +.bi-person-up::before { content: "\f8aa"; } +.bi-scooter::before { content: "\f8ab"; } +.bi-taxi-front-fill::before { content: "\f8ac"; } +.bi-taxi-front::before { content: "\f8ad"; } +.bi-amd::before { content: "\f8ae"; } +.bi-database-add::before { content: "\f8af"; } +.bi-database-check::before { content: "\f8b0"; } +.bi-database-dash::before { content: "\f8b1"; } +.bi-database-down::before { content: "\f8b2"; } +.bi-database-exclamation::before { content: "\f8b3"; } +.bi-database-fill-add::before { content: "\f8b4"; } +.bi-database-fill-check::before { content: "\f8b5"; } +.bi-database-fill-dash::before { content: "\f8b6"; } +.bi-database-fill-down::before { content: "\f8b7"; } +.bi-database-fill-exclamation::before { content: "\f8b8"; } +.bi-database-fill-gear::before { content: "\f8b9"; } +.bi-database-fill-lock::before { content: "\f8ba"; } +.bi-database-fill-slash::before { content: "\f8bb"; } +.bi-database-fill-up::before { content: "\f8bc"; } +.bi-database-fill-x::before { content: "\f8bd"; } +.bi-database-fill::before { content: "\f8be"; } +.bi-database-gear::before { content: "\f8bf"; } +.bi-database-lock::before { content: "\f8c0"; } +.bi-database-slash::before { content: "\f8c1"; } +.bi-database-up::before { content: "\f8c2"; } +.bi-database-x::before { content: "\f8c3"; } +.bi-database::before { content: "\f8c4"; } +.bi-houses-fill::before { content: "\f8c5"; } +.bi-houses::before { content: "\f8c6"; } +.bi-nvidia::before { content: "\f8c7"; } +.bi-person-vcard-fill::before { content: "\f8c8"; } +.bi-person-vcard::before { content: "\f8c9"; } +.bi-sina-weibo::before { content: "\f8ca"; } +.bi-tencent-qq::before { content: "\f8cb"; } +.bi-wikipedia::before { content: "\f8cc"; } +.bi-alphabet-uppercase::before { content: "\f2a5"; } +.bi-alphabet::before { content: "\f68a"; } +.bi-amazon::before { content: "\f68d"; } +.bi-arrows-collapse-vertical::before { content: "\f690"; } +.bi-arrows-expand-vertical::before { content: "\f695"; } +.bi-arrows-vertical::before { content: "\f698"; } +.bi-arrows::before { content: "\f6a2"; } +.bi-ban-fill::before { content: "\f6a3"; } +.bi-ban::before { content: "\f6b6"; } +.bi-bing::before { content: "\f6c2"; } +.bi-cake::before { content: "\f6e0"; } +.bi-cake2::before { content: "\f6ed"; } +.bi-cookie::before { content: "\f6ee"; } +.bi-copy::before { content: "\f759"; } +.bi-crosshair::before { content: "\f769"; } +.bi-crosshair2::before { content: "\f794"; } +.bi-emoji-astonished-fill::before { content: "\f795"; } +.bi-emoji-astonished::before { content: "\f79a"; } +.bi-emoji-grimace-fill::before { content: "\f79b"; } +.bi-emoji-grimace::before { content: "\f7a0"; } +.bi-emoji-grin-fill::before { content: "\f7a1"; } +.bi-emoji-grin::before { content: "\f7a6"; } +.bi-emoji-surprise-fill::before { content: "\f7a7"; } +.bi-emoji-surprise::before { content: "\f7ac"; } +.bi-emoji-tear-fill::before { content: "\f7ad"; } +.bi-emoji-tear::before { content: "\f7b2"; } +.bi-envelope-arrow-down-fill::before { content: "\f7b3"; } +.bi-envelope-arrow-down::before { content: "\f7b8"; } +.bi-envelope-arrow-up-fill::before { content: "\f7b9"; } +.bi-envelope-arrow-up::before { content: "\f7be"; } +.bi-feather::before { content: "\f7bf"; } +.bi-feather2::before { content: "\f7c4"; } +.bi-floppy-fill::before { content: "\f7c5"; } +.bi-floppy::before { content: "\f7d8"; } +.bi-floppy2-fill::before { content: "\f7d9"; } +.bi-floppy2::before { content: "\f7e4"; } +.bi-gitlab::before { content: "\f7e5"; } +.bi-highlighter::before { content: "\f7f8"; } +.bi-marker-tip::before { content: "\f802"; } +.bi-nvme-fill::before { content: "\f803"; } +.bi-nvme::before { content: "\f80c"; } +.bi-opencollective::before { content: "\f80d"; } +.bi-pci-card-network::before { content: "\f8cd"; } +.bi-pci-card-sound::before { content: "\f8ce"; } +.bi-radar::before { content: "\f8cf"; } +.bi-send-arrow-down-fill::before { content: "\f8d0"; } +.bi-send-arrow-down::before { content: "\f8d1"; } +.bi-send-arrow-up-fill::before { content: "\f8d2"; } +.bi-send-arrow-up::before { content: "\f8d3"; } +.bi-sim-slash-fill::before { content: "\f8d4"; } +.bi-sim-slash::before { content: "\f8d5"; } +.bi-sourceforge::before { content: "\f8d6"; } +.bi-substack::before { content: "\f8d7"; } +.bi-threads-fill::before { content: "\f8d8"; } +.bi-threads::before { content: "\f8d9"; } +.bi-transparency::before { content: "\f8da"; } +.bi-twitter-x::before { content: "\f8db"; } +.bi-type-h4::before { content: "\f8dc"; } +.bi-type-h5::before { content: "\f8dd"; } +.bi-type-h6::before { content: "\f8de"; } +.bi-backpack-fill::before { content: "\f8df"; } +.bi-backpack::before { content: "\f8e0"; } +.bi-backpack2-fill::before { content: "\f8e1"; } +.bi-backpack2::before { content: "\f8e2"; } +.bi-backpack3-fill::before { content: "\f8e3"; } +.bi-backpack3::before { content: "\f8e4"; } +.bi-backpack4-fill::before { content: "\f8e5"; } +.bi-backpack4::before { content: "\f8e6"; } +.bi-brilliance::before { content: "\f8e7"; } +.bi-cake-fill::before { content: "\f8e8"; } +.bi-cake2-fill::before { content: "\f8e9"; } +.bi-duffle-fill::before { content: "\f8ea"; } +.bi-duffle::before { content: "\f8eb"; } +.bi-exposure::before { content: "\f8ec"; } +.bi-gender-neuter::before { content: "\f8ed"; } +.bi-highlights::before { content: "\f8ee"; } +.bi-luggage-fill::before { content: "\f8ef"; } +.bi-luggage::before { content: "\f8f0"; } +.bi-mailbox-flag::before { content: "\f8f1"; } +.bi-mailbox2-flag::before { content: "\f8f2"; } +.bi-noise-reduction::before { content: "\f8f3"; } +.bi-passport-fill::before { content: "\f8f4"; } +.bi-passport::before { content: "\f8f5"; } +.bi-person-arms-up::before { content: "\f8f6"; } +.bi-person-raised-hand::before { content: "\f8f7"; } +.bi-person-standing-dress::before { content: "\f8f8"; } +.bi-person-standing::before { content: "\f8f9"; } +.bi-person-walking::before { content: "\f8fa"; } +.bi-person-wheelchair::before { content: "\f8fb"; } +.bi-shadows::before { content: "\f8fc"; } +.bi-suitcase-fill::before { content: "\f8fd"; } +.bi-suitcase-lg-fill::before { content: "\f8fe"; } +.bi-suitcase-lg::before { content: "\f8ff"; } +.bi-suitcase::before { content: "\f900"; } +.bi-suitcase2-fill::before { content: "\f901"; } +.bi-suitcase2::before { content: "\f902"; } +.bi-vignette::before { content: "\f903"; } diff --git a/docs/otb_subbasin_loads_files/libs/bootstrap/bootstrap-icons.woff b/docs/otb_subbasin_loads_files/libs/bootstrap/bootstrap-icons.woff new file mode 100644 index 0000000..dbeeb05 Binary files /dev/null and b/docs/otb_subbasin_loads_files/libs/bootstrap/bootstrap-icons.woff differ diff --git a/docs/otb_subbasin_loads_files/libs/bootstrap/bootstrap.min.css b/docs/otb_subbasin_loads_files/libs/bootstrap/bootstrap.min.css new file mode 100644 index 0000000..4cebd04 --- /dev/null +++ b/docs/otb_subbasin_loads_files/libs/bootstrap/bootstrap.min.css @@ -0,0 +1,12 @@ +/*! + * Bootstrap v5.3.1 (https://getbootstrap.com/) + * Copyright 2011-2023 The Bootstrap Authors + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE) + */:root,[data-bs-theme=light]{--bs-blue: #0d6efd;--bs-indigo: #6610f2;--bs-purple: #6f42c1;--bs-pink: #d63384;--bs-red: #dc3545;--bs-orange: #fd7e14;--bs-yellow: #ffc107;--bs-green: #198754;--bs-teal: #20c997;--bs-cyan: #0dcaf0;--bs-black: #000;--bs-white: #ffffff;--bs-gray: #6c757d;--bs-gray-dark: #343a40;--bs-gray-100: #f8f9fa;--bs-gray-200: #e9ecef;--bs-gray-300: #dee2e6;--bs-gray-400: #ced4da;--bs-gray-500: #adb5bd;--bs-gray-600: #6c757d;--bs-gray-700: #495057;--bs-gray-800: #343a40;--bs-gray-900: #212529;--bs-default: #dee2e6;--bs-primary: #0d6efd;--bs-secondary: #6c757d;--bs-success: #198754;--bs-info: #0dcaf0;--bs-warning: #ffc107;--bs-danger: #dc3545;--bs-light: #f8f9fa;--bs-dark: #212529;--bs-default-rgb: 222, 226, 230;--bs-primary-rgb: 13, 110, 253;--bs-secondary-rgb: 108, 117, 125;--bs-success-rgb: 25, 135, 84;--bs-info-rgb: 13, 202, 240;--bs-warning-rgb: 255, 193, 7;--bs-danger-rgb: 220, 53, 69;--bs-light-rgb: 248, 249, 250;--bs-dark-rgb: 33, 37, 41;--bs-primary-text-emphasis: #052c65;--bs-secondary-text-emphasis: #2b2f32;--bs-success-text-emphasis: #0a3622;--bs-info-text-emphasis: #055160;--bs-warning-text-emphasis: #664d03;--bs-danger-text-emphasis: #58151c;--bs-light-text-emphasis: #495057;--bs-dark-text-emphasis: #495057;--bs-primary-bg-subtle: #cfe2ff;--bs-secondary-bg-subtle: #e2e3e5;--bs-success-bg-subtle: #d1e7dd;--bs-info-bg-subtle: #cff4fc;--bs-warning-bg-subtle: #fff3cd;--bs-danger-bg-subtle: #f8d7da;--bs-light-bg-subtle: #fcfcfd;--bs-dark-bg-subtle: #ced4da;--bs-primary-border-subtle: #9ec5fe;--bs-secondary-border-subtle: #c4c8cb;--bs-success-border-subtle: #a3cfbb;--bs-info-border-subtle: #9eeaf9;--bs-warning-border-subtle: #ffe69c;--bs-danger-border-subtle: #f1aeb5;--bs-light-border-subtle: #e9ecef;--bs-dark-border-subtle: #adb5bd;--bs-white-rgb: 255, 255, 255;--bs-black-rgb: 0, 0, 0;--bs-font-sans-serif: system-ui, -apple-system, "Segoe UI", Roboto, "Helvetica Neue", "Noto Sans", "Liberation Sans", Arial, sans-serif, "Apple Color Emoji", "Segoe UI Emoji", "Segoe UI Symbol", "Noto Color Emoji";--bs-font-monospace: SFMono-Regular, Menlo, Monaco, Consolas, "Liberation Mono", "Courier New", monospace;--bs-gradient: linear-gradient(180deg, rgba(255, 255, 255, 0.15), rgba(255, 255, 255, 0));--bs-root-font-size: 17px;--bs-body-font-family: system-ui, -apple-system, "Segoe UI", Roboto, "Helvetica Neue", "Noto Sans", "Liberation Sans", Arial, sans-serif, "Apple Color Emoji", "Segoe UI Emoji", "Segoe UI Symbol", "Noto Color Emoji";--bs-body-font-size:1rem;--bs-body-font-weight: 400;--bs-body-line-height: 1.5;--bs-body-color: #212529;--bs-body-color-rgb: 33, 37, 41;--bs-body-bg: #ffffff;--bs-body-bg-rgb: 255, 255, 255;--bs-emphasis-color: #000;--bs-emphasis-color-rgb: 0, 0, 0;--bs-secondary-color: rgba(33, 37, 41, 0.75);--bs-secondary-color-rgb: 33, 37, 41;--bs-secondary-bg: #e9ecef;--bs-secondary-bg-rgb: 233, 236, 239;--bs-tertiary-color: rgba(33, 37, 41, 0.5);--bs-tertiary-color-rgb: 33, 37, 41;--bs-tertiary-bg: #f8f9fa;--bs-tertiary-bg-rgb: 248, 249, 250;--bs-heading-color: inherit;--bs-link-color: #0d6efd;--bs-link-color-rgb: 13, 110, 253;--bs-link-decoration: underline;--bs-link-hover-color: #0a58ca;--bs-link-hover-color-rgb: 10, 88, 202;--bs-code-color: #7d12ba;--bs-highlight-bg: #fff3cd;--bs-border-width: 1px;--bs-border-style: solid;--bs-border-color: #dee2e6;--bs-border-color-translucent: rgba(0, 0, 0, 0.175);--bs-border-radius: 0.375rem;--bs-border-radius-sm: 0.25rem;--bs-border-radius-lg: 0.5rem;--bs-border-radius-xl: 1rem;--bs-border-radius-xxl: 2rem;--bs-border-radius-2xl: var(--bs-border-radius-xxl);--bs-border-radius-pill: 50rem;--bs-box-shadow: 0 0.5rem 1rem rgba(0, 0, 0, 0.15);--bs-box-shadow-sm: 0 0.125rem 0.25rem rgba(0, 0, 0, 0.075);--bs-box-shadow-lg: 0 1rem 3rem rgba(0, 0, 0, 0.175);--bs-box-shadow-inset: inset 0 1px 2px rgba(0, 0, 0, 0.075);--bs-focus-ring-width: 0.25rem;--bs-focus-ring-opacity: 0.25;--bs-focus-ring-color: rgba(13, 110, 253, 0.25);--bs-form-valid-color: #198754;--bs-form-valid-border-color: #198754;--bs-form-invalid-color: #dc3545;--bs-form-invalid-border-color: #dc3545}[data-bs-theme=dark]{color-scheme:dark;--bs-body-color: #dee2e6;--bs-body-color-rgb: 222, 226, 230;--bs-body-bg: #212529;--bs-body-bg-rgb: 33, 37, 41;--bs-emphasis-color: #ffffff;--bs-emphasis-color-rgb: 255, 255, 255;--bs-secondary-color: rgba(222, 226, 230, 0.75);--bs-secondary-color-rgb: 222, 226, 230;--bs-secondary-bg: #343a40;--bs-secondary-bg-rgb: 52, 58, 64;--bs-tertiary-color: rgba(222, 226, 230, 0.5);--bs-tertiary-color-rgb: 222, 226, 230;--bs-tertiary-bg: #2b3035;--bs-tertiary-bg-rgb: 43, 48, 53;--bs-primary-text-emphasis: #6ea8fe;--bs-secondary-text-emphasis: #a7acb1;--bs-success-text-emphasis: #75b798;--bs-info-text-emphasis: #6edff6;--bs-warning-text-emphasis: #ffda6a;--bs-danger-text-emphasis: #ea868f;--bs-light-text-emphasis: #f8f9fa;--bs-dark-text-emphasis: #dee2e6;--bs-primary-bg-subtle: #031633;--bs-secondary-bg-subtle: #161719;--bs-success-bg-subtle: #051b11;--bs-info-bg-subtle: #032830;--bs-warning-bg-subtle: #332701;--bs-danger-bg-subtle: #2c0b0e;--bs-light-bg-subtle: #343a40;--bs-dark-bg-subtle: #1a1d20;--bs-primary-border-subtle: #084298;--bs-secondary-border-subtle: #41464b;--bs-success-border-subtle: #0f5132;--bs-info-border-subtle: #087990;--bs-warning-border-subtle: #997404;--bs-danger-border-subtle: #842029;--bs-light-border-subtle: #495057;--bs-dark-border-subtle: #343a40;--bs-heading-color: inherit;--bs-link-color: #6ea8fe;--bs-link-hover-color: #8bb9fe;--bs-link-color-rgb: 110, 168, 254;--bs-link-hover-color-rgb: 139, 185, 254;--bs-code-color: white;--bs-border-color: #495057;--bs-border-color-translucent: rgba(255, 255, 255, 0.15);--bs-form-valid-color: #75b798;--bs-form-valid-border-color: #75b798;--bs-form-invalid-color: #ea868f;--bs-form-invalid-border-color: #ea868f}*,*::before,*::after{box-sizing:border-box}:root{font-size:var(--bs-root-font-size)}body{margin:0;font-family:var(--bs-body-font-family);font-size:var(--bs-body-font-size);font-weight:var(--bs-body-font-weight);line-height:var(--bs-body-line-height);color:var(--bs-body-color);text-align:var(--bs-body-text-align);background-color:var(--bs-body-bg);-webkit-text-size-adjust:100%;-webkit-tap-highlight-color:rgba(0,0,0,0)}hr{margin:1rem 0;color:inherit;border:0;border-top:1px solid;opacity:.25}h6,.h6,h5,.h5,h4,.h4,h3,.h3,h2,.h2,h1,.h1{margin-top:0;margin-bottom:.5rem;font-weight:500;line-height:1.2;color:var(--bs-heading-color)}h1,.h1{font-size:calc(1.325rem + 0.9vw)}@media(min-width: 1200px){h1,.h1{font-size:2rem}}h2,.h2{font-size:calc(1.29rem + 0.48vw)}@media(min-width: 1200px){h2,.h2{font-size:1.65rem}}h3,.h3{font-size:calc(1.27rem + 0.24vw)}@media(min-width: 1200px){h3,.h3{font-size:1.45rem}}h4,.h4{font-size:1.25rem}h5,.h5{font-size:1.1rem}h6,.h6{font-size:1rem}p{margin-top:0;margin-bottom:1rem}abbr[title]{text-decoration:underline dotted;-webkit-text-decoration:underline dotted;-moz-text-decoration:underline dotted;-ms-text-decoration:underline dotted;-o-text-decoration:underline dotted;cursor:help;text-decoration-skip-ink:none}address{margin-bottom:1rem;font-style:normal;line-height:inherit}ol,ul{padding-left:2rem}ol,ul,dl{margin-top:0;margin-bottom:1rem}ol ol,ul ul,ol ul,ul ol{margin-bottom:0}dt{font-weight:700}dd{margin-bottom:.5rem;margin-left:0}blockquote{margin:0 0 1rem;padding:.625rem 1.25rem;border-left:.25rem solid #e9ecef}blockquote p:last-child,blockquote ul:last-child,blockquote ol:last-child{margin-bottom:0}b,strong{font-weight:bolder}small,.small{font-size:0.875em}mark,.mark{padding:.1875em;background-color:var(--bs-highlight-bg)}sub,sup{position:relative;font-size:0.75em;line-height:0;vertical-align:baseline}sub{bottom:-0.25em}sup{top:-0.5em}a{color:rgba(var(--bs-link-color-rgb), var(--bs-link-opacity, 1));text-decoration:underline;-webkit-text-decoration:underline;-moz-text-decoration:underline;-ms-text-decoration:underline;-o-text-decoration:underline}a:hover{--bs-link-color-rgb: var(--bs-link-hover-color-rgb)}a:not([href]):not([class]),a:not([href]):not([class]):hover{color:inherit;text-decoration:none}pre,code,kbd,samp{font-family:SFMono-Regular,Menlo,Monaco,Consolas,"Liberation Mono","Courier New",monospace;font-size:1em}pre{display:block;margin-top:0;margin-bottom:1rem;overflow:auto;font-size:0.875em;color:#000;background-color:#f8f9fa;padding:.5rem;border:1px solid var(--bs-border-color, #dee2e6);border-radius:.375rem}pre code{background-color:rgba(0,0,0,0);font-size:inherit;color:inherit;word-break:normal}code{font-size:0.875em;color:var(--bs-code-color);background-color:#f8f9fa;border-radius:.375rem;padding:.125rem .25rem;word-wrap:break-word}a>code{color:inherit}kbd{padding:.4rem .4rem;font-size:0.875em;color:#fff;background-color:#212529;border-radius:.25rem}kbd kbd{padding:0;font-size:1em}figure{margin:0 0 1rem}img,svg{vertical-align:middle}table{caption-side:bottom;border-collapse:collapse}caption{padding-top:.5rem;padding-bottom:.5rem;color:rgba(33,37,41,.75);text-align:left}th{text-align:inherit;text-align:-webkit-match-parent}thead,tbody,tfoot,tr,td,th{border-color:inherit;border-style:solid;border-width:0}label{display:inline-block}button{border-radius:0}button:focus:not(:focus-visible){outline:0}input,button,select,optgroup,textarea{margin:0;font-family:inherit;font-size:inherit;line-height:inherit}button,select{text-transform:none}[role=button]{cursor:pointer}select{word-wrap:normal}select:disabled{opacity:1}[list]:not([type=date]):not([type=datetime-local]):not([type=month]):not([type=week]):not([type=time])::-webkit-calendar-picker-indicator{display:none !important}button,[type=button],[type=reset],[type=submit]{-webkit-appearance:button}button:not(:disabled),[type=button]:not(:disabled),[type=reset]:not(:disabled),[type=submit]:not(:disabled){cursor:pointer}::-moz-focus-inner{padding:0;border-style:none}textarea{resize:vertical}fieldset{min-width:0;padding:0;margin:0;border:0}legend{float:left;width:100%;padding:0;margin-bottom:.5rem;font-size:calc(1.275rem + 0.3vw);line-height:inherit}@media(min-width: 1200px){legend{font-size:1.5rem}}legend+*{clear:left}::-webkit-datetime-edit-fields-wrapper,::-webkit-datetime-edit-text,::-webkit-datetime-edit-minute,::-webkit-datetime-edit-hour-field,::-webkit-datetime-edit-day-field,::-webkit-datetime-edit-month-field,::-webkit-datetime-edit-year-field{padding:0}::-webkit-inner-spin-button{height:auto}[type=search]{-webkit-appearance:textfield;outline-offset:-2px}::-webkit-search-decoration{-webkit-appearance:none}::-webkit-color-swatch-wrapper{padding:0}::file-selector-button{font:inherit;-webkit-appearance:button}output{display:inline-block}iframe{border:0}summary{display:list-item;cursor:pointer}progress{vertical-align:baseline}[hidden]{display:none !important}.lead{font-size:1.25rem;font-weight:300}.display-1{font-size:calc(1.625rem + 4.5vw);font-weight:300;line-height:1.2}@media(min-width: 1200px){.display-1{font-size:5rem}}.display-2{font-size:calc(1.575rem + 3.9vw);font-weight:300;line-height:1.2}@media(min-width: 1200px){.display-2{font-size:4.5rem}}.display-3{font-size:calc(1.525rem + 3.3vw);font-weight:300;line-height:1.2}@media(min-width: 1200px){.display-3{font-size:4rem}}.display-4{font-size:calc(1.475rem + 2.7vw);font-weight:300;line-height:1.2}@media(min-width: 1200px){.display-4{font-size:3.5rem}}.display-5{font-size:calc(1.425rem + 2.1vw);font-weight:300;line-height:1.2}@media(min-width: 1200px){.display-5{font-size:3rem}}.display-6{font-size:calc(1.375rem + 1.5vw);font-weight:300;line-height:1.2}@media(min-width: 1200px){.display-6{font-size:2.5rem}}.list-unstyled{padding-left:0;list-style:none}.list-inline{padding-left:0;list-style:none}.list-inline-item{display:inline-block}.list-inline-item:not(:last-child){margin-right:.5rem}.initialism{font-size:0.875em;text-transform:uppercase}.blockquote{margin-bottom:1rem;font-size:1.25rem}.blockquote>:last-child{margin-bottom:0}.blockquote-footer{margin-top:-1rem;margin-bottom:1rem;font-size:0.875em;color:#6c757d}.blockquote-footer::before{content:"— "}.img-fluid{max-width:100%;height:auto}.img-thumbnail{padding:.25rem;background-color:#fff;border:1px solid #dee2e6;border-radius:.375rem;max-width:100%;height:auto}.figure{display:inline-block}.figure-img{margin-bottom:.5rem;line-height:1}.figure-caption{font-size:0.875em;color:rgba(33,37,41,.75)}.container,.container-fluid,.container-xxl,.container-xl,.container-lg,.container-md,.container-sm{--bs-gutter-x: 1.5rem;--bs-gutter-y: 0;width:100%;padding-right:calc(var(--bs-gutter-x)*.5);padding-left:calc(var(--bs-gutter-x)*.5);margin-right:auto;margin-left:auto}@media(min-width: 576px){.container-sm,.container{max-width:540px}}@media(min-width: 768px){.container-md,.container-sm,.container{max-width:720px}}@media(min-width: 992px){.container-lg,.container-md,.container-sm,.container{max-width:960px}}@media(min-width: 1200px){.container-xl,.container-lg,.container-md,.container-sm,.container{max-width:1140px}}@media(min-width: 1400px){.container-xxl,.container-xl,.container-lg,.container-md,.container-sm,.container{max-width:1320px}}:root{--bs-breakpoint-xs: 0;--bs-breakpoint-sm: 576px;--bs-breakpoint-md: 768px;--bs-breakpoint-lg: 992px;--bs-breakpoint-xl: 1200px;--bs-breakpoint-xxl: 1400px}.grid{display:grid;grid-template-rows:repeat(var(--bs-rows, 1), 1fr);grid-template-columns:repeat(var(--bs-columns, 12), 1fr);gap:var(--bs-gap, 1.5rem)}.grid .g-col-1{grid-column:auto/span 1}.grid .g-col-2{grid-column:auto/span 2}.grid .g-col-3{grid-column:auto/span 3}.grid .g-col-4{grid-column:auto/span 4}.grid .g-col-5{grid-column:auto/span 5}.grid .g-col-6{grid-column:auto/span 6}.grid .g-col-7{grid-column:auto/span 7}.grid .g-col-8{grid-column:auto/span 8}.grid .g-col-9{grid-column:auto/span 9}.grid .g-col-10{grid-column:auto/span 10}.grid .g-col-11{grid-column:auto/span 11}.grid .g-col-12{grid-column:auto/span 12}.grid .g-start-1{grid-column-start:1}.grid .g-start-2{grid-column-start:2}.grid .g-start-3{grid-column-start:3}.grid .g-start-4{grid-column-start:4}.grid .g-start-5{grid-column-start:5}.grid .g-start-6{grid-column-start:6}.grid .g-start-7{grid-column-start:7}.grid .g-start-8{grid-column-start:8}.grid .g-start-9{grid-column-start:9}.grid .g-start-10{grid-column-start:10}.grid .g-start-11{grid-column-start:11}@media(min-width: 576px){.grid .g-col-sm-1{grid-column:auto/span 1}.grid .g-col-sm-2{grid-column:auto/span 2}.grid .g-col-sm-3{grid-column:auto/span 3}.grid .g-col-sm-4{grid-column:auto/span 4}.grid .g-col-sm-5{grid-column:auto/span 5}.grid .g-col-sm-6{grid-column:auto/span 6}.grid .g-col-sm-7{grid-column:auto/span 7}.grid .g-col-sm-8{grid-column:auto/span 8}.grid .g-col-sm-9{grid-column:auto/span 9}.grid .g-col-sm-10{grid-column:auto/span 10}.grid .g-col-sm-11{grid-column:auto/span 11}.grid .g-col-sm-12{grid-column:auto/span 12}.grid .g-start-sm-1{grid-column-start:1}.grid .g-start-sm-2{grid-column-start:2}.grid .g-start-sm-3{grid-column-start:3}.grid .g-start-sm-4{grid-column-start:4}.grid .g-start-sm-5{grid-column-start:5}.grid .g-start-sm-6{grid-column-start:6}.grid .g-start-sm-7{grid-column-start:7}.grid .g-start-sm-8{grid-column-start:8}.grid .g-start-sm-9{grid-column-start:9}.grid .g-start-sm-10{grid-column-start:10}.grid .g-start-sm-11{grid-column-start:11}}@media(min-width: 768px){.grid .g-col-md-1{grid-column:auto/span 1}.grid .g-col-md-2{grid-column:auto/span 2}.grid .g-col-md-3{grid-column:auto/span 3}.grid .g-col-md-4{grid-column:auto/span 4}.grid .g-col-md-5{grid-column:auto/span 5}.grid .g-col-md-6{grid-column:auto/span 6}.grid .g-col-md-7{grid-column:auto/span 7}.grid .g-col-md-8{grid-column:auto/span 8}.grid .g-col-md-9{grid-column:auto/span 9}.grid .g-col-md-10{grid-column:auto/span 10}.grid .g-col-md-11{grid-column:auto/span 11}.grid .g-col-md-12{grid-column:auto/span 12}.grid .g-start-md-1{grid-column-start:1}.grid .g-start-md-2{grid-column-start:2}.grid .g-start-md-3{grid-column-start:3}.grid .g-start-md-4{grid-column-start:4}.grid .g-start-md-5{grid-column-start:5}.grid .g-start-md-6{grid-column-start:6}.grid .g-start-md-7{grid-column-start:7}.grid .g-start-md-8{grid-column-start:8}.grid .g-start-md-9{grid-column-start:9}.grid .g-start-md-10{grid-column-start:10}.grid .g-start-md-11{grid-column-start:11}}@media(min-width: 992px){.grid .g-col-lg-1{grid-column:auto/span 1}.grid .g-col-lg-2{grid-column:auto/span 2}.grid .g-col-lg-3{grid-column:auto/span 3}.grid .g-col-lg-4{grid-column:auto/span 4}.grid .g-col-lg-5{grid-column:auto/span 5}.grid .g-col-lg-6{grid-column:auto/span 6}.grid .g-col-lg-7{grid-column:auto/span 7}.grid .g-col-lg-8{grid-column:auto/span 8}.grid .g-col-lg-9{grid-column:auto/span 9}.grid .g-col-lg-10{grid-column:auto/span 10}.grid .g-col-lg-11{grid-column:auto/span 11}.grid .g-col-lg-12{grid-column:auto/span 12}.grid .g-start-lg-1{grid-column-start:1}.grid .g-start-lg-2{grid-column-start:2}.grid .g-start-lg-3{grid-column-start:3}.grid .g-start-lg-4{grid-column-start:4}.grid .g-start-lg-5{grid-column-start:5}.grid .g-start-lg-6{grid-column-start:6}.grid .g-start-lg-7{grid-column-start:7}.grid .g-start-lg-8{grid-column-start:8}.grid .g-start-lg-9{grid-column-start:9}.grid .g-start-lg-10{grid-column-start:10}.grid .g-start-lg-11{grid-column-start:11}}@media(min-width: 1200px){.grid .g-col-xl-1{grid-column:auto/span 1}.grid .g-col-xl-2{grid-column:auto/span 2}.grid .g-col-xl-3{grid-column:auto/span 3}.grid .g-col-xl-4{grid-column:auto/span 4}.grid .g-col-xl-5{grid-column:auto/span 5}.grid .g-col-xl-6{grid-column:auto/span 6}.grid .g-col-xl-7{grid-column:auto/span 7}.grid .g-col-xl-8{grid-column:auto/span 8}.grid .g-col-xl-9{grid-column:auto/span 9}.grid .g-col-xl-10{grid-column:auto/span 10}.grid .g-col-xl-11{grid-column:auto/span 11}.grid .g-col-xl-12{grid-column:auto/span 12}.grid .g-start-xl-1{grid-column-start:1}.grid .g-start-xl-2{grid-column-start:2}.grid .g-start-xl-3{grid-column-start:3}.grid .g-start-xl-4{grid-column-start:4}.grid .g-start-xl-5{grid-column-start:5}.grid .g-start-xl-6{grid-column-start:6}.grid .g-start-xl-7{grid-column-start:7}.grid .g-start-xl-8{grid-column-start:8}.grid .g-start-xl-9{grid-column-start:9}.grid .g-start-xl-10{grid-column-start:10}.grid .g-start-xl-11{grid-column-start:11}}@media(min-width: 1400px){.grid .g-col-xxl-1{grid-column:auto/span 1}.grid .g-col-xxl-2{grid-column:auto/span 2}.grid .g-col-xxl-3{grid-column:auto/span 3}.grid .g-col-xxl-4{grid-column:auto/span 4}.grid .g-col-xxl-5{grid-column:auto/span 5}.grid .g-col-xxl-6{grid-column:auto/span 6}.grid .g-col-xxl-7{grid-column:auto/span 7}.grid .g-col-xxl-8{grid-column:auto/span 8}.grid .g-col-xxl-9{grid-column:auto/span 9}.grid .g-col-xxl-10{grid-column:auto/span 10}.grid .g-col-xxl-11{grid-column:auto/span 11}.grid .g-col-xxl-12{grid-column:auto/span 12}.grid .g-start-xxl-1{grid-column-start:1}.grid .g-start-xxl-2{grid-column-start:2}.grid .g-start-xxl-3{grid-column-start:3}.grid .g-start-xxl-4{grid-column-start:4}.grid .g-start-xxl-5{grid-column-start:5}.grid .g-start-xxl-6{grid-column-start:6}.grid .g-start-xxl-7{grid-column-start:7}.grid .g-start-xxl-8{grid-column-start:8}.grid .g-start-xxl-9{grid-column-start:9}.grid .g-start-xxl-10{grid-column-start:10}.grid .g-start-xxl-11{grid-column-start:11}}.table{--bs-table-color-type: initial;--bs-table-bg-type: initial;--bs-table-color-state: initial;--bs-table-bg-state: initial;--bs-table-color: #212529;--bs-table-bg: #ffffff;--bs-table-border-color: #dee2e6;--bs-table-accent-bg: transparent;--bs-table-striped-color: #212529;--bs-table-striped-bg: rgba(0, 0, 0, 0.05);--bs-table-active-color: #212529;--bs-table-active-bg: rgba(0, 0, 0, 0.1);--bs-table-hover-color: #212529;--bs-table-hover-bg: rgba(0, 0, 0, 0.075);width:100%;margin-bottom:1rem;vertical-align:top;border-color:var(--bs-table-border-color)}.table>:not(caption)>*>*{padding:.5rem .5rem;color:var(--bs-table-color-state, var(--bs-table-color-type, var(--bs-table-color)));background-color:var(--bs-table-bg);border-bottom-width:1px;box-shadow:inset 0 0 0 9999px var(--bs-table-bg-state, var(--bs-table-bg-type, var(--bs-table-accent-bg)))}.table>tbody{vertical-align:inherit}.table>thead{vertical-align:bottom}.table-group-divider{border-top:calc(1px*2) solid #9ba5ae}.caption-top{caption-side:top}.table-sm>:not(caption)>*>*{padding:.25rem .25rem}.table-bordered>:not(caption)>*{border-width:1px 0}.table-bordered>:not(caption)>*>*{border-width:0 1px}.table-borderless>:not(caption)>*>*{border-bottom-width:0}.table-borderless>:not(:first-child){border-top-width:0}.table-striped>tbody>tr:nth-of-type(odd)>*{--bs-table-color-type: var(--bs-table-striped-color);--bs-table-bg-type: var(--bs-table-striped-bg)}.table-striped-columns>:not(caption)>tr>:nth-child(even){--bs-table-color-type: var(--bs-table-striped-color);--bs-table-bg-type: var(--bs-table-striped-bg)}.table-active{--bs-table-color-state: var(--bs-table-active-color);--bs-table-bg-state: var(--bs-table-active-bg)}.table-hover>tbody>tr:hover>*{--bs-table-color-state: var(--bs-table-hover-color);--bs-table-bg-state: var(--bs-table-hover-bg)}.table-primary{--bs-table-color: #000;--bs-table-bg: #cfe2ff;--bs-table-border-color: #bacbe6;--bs-table-striped-bg: #c5d7f2;--bs-table-striped-color: #000;--bs-table-active-bg: #bacbe6;--bs-table-active-color: #000;--bs-table-hover-bg: #bfd1ec;--bs-table-hover-color: #000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-secondary{--bs-table-color: #000;--bs-table-bg: #e2e3e5;--bs-table-border-color: #cbccce;--bs-table-striped-bg: #d7d8da;--bs-table-striped-color: #000;--bs-table-active-bg: #cbccce;--bs-table-active-color: #000;--bs-table-hover-bg: #d1d2d4;--bs-table-hover-color: #000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-success{--bs-table-color: #000;--bs-table-bg: #d1e7dd;--bs-table-border-color: #bcd0c7;--bs-table-striped-bg: #c7dbd2;--bs-table-striped-color: #000;--bs-table-active-bg: #bcd0c7;--bs-table-active-color: #000;--bs-table-hover-bg: #c1d6cc;--bs-table-hover-color: #000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-info{--bs-table-color: #000;--bs-table-bg: #cff4fc;--bs-table-border-color: #badce3;--bs-table-striped-bg: #c5e8ef;--bs-table-striped-color: #000;--bs-table-active-bg: #badce3;--bs-table-active-color: #000;--bs-table-hover-bg: #bfe2e9;--bs-table-hover-color: #000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-warning{--bs-table-color: #000;--bs-table-bg: #fff3cd;--bs-table-border-color: #e6dbb9;--bs-table-striped-bg: #f2e7c3;--bs-table-striped-color: #000;--bs-table-active-bg: #e6dbb9;--bs-table-active-color: #000;--bs-table-hover-bg: #ece1be;--bs-table-hover-color: #000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-danger{--bs-table-color: #000;--bs-table-bg: #f8d7da;--bs-table-border-color: #dfc2c4;--bs-table-striped-bg: #eccccf;--bs-table-striped-color: #000;--bs-table-active-bg: #dfc2c4;--bs-table-active-color: #000;--bs-table-hover-bg: #e5c7ca;--bs-table-hover-color: #000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-light{--bs-table-color: #000;--bs-table-bg: #f8f9fa;--bs-table-border-color: #dfe0e1;--bs-table-striped-bg: #ecedee;--bs-table-striped-color: #000;--bs-table-active-bg: #dfe0e1;--bs-table-active-color: #000;--bs-table-hover-bg: #e5e6e7;--bs-table-hover-color: #000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-dark{--bs-table-color: #ffffff;--bs-table-bg: #212529;--bs-table-border-color: #373b3e;--bs-table-striped-bg: #2c3034;--bs-table-striped-color: #ffffff;--bs-table-active-bg: #373b3e;--bs-table-active-color: #ffffff;--bs-table-hover-bg: #323539;--bs-table-hover-color: #ffffff;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-responsive{overflow-x:auto;-webkit-overflow-scrolling:touch}@media(max-width: 575.98px){.table-responsive-sm{overflow-x:auto;-webkit-overflow-scrolling:touch}}@media(max-width: 767.98px){.table-responsive-md{overflow-x:auto;-webkit-overflow-scrolling:touch}}@media(max-width: 991.98px){.table-responsive-lg{overflow-x:auto;-webkit-overflow-scrolling:touch}}@media(max-width: 1199.98px){.table-responsive-xl{overflow-x:auto;-webkit-overflow-scrolling:touch}}@media(max-width: 1399.98px){.table-responsive-xxl{overflow-x:auto;-webkit-overflow-scrolling:touch}}.form-label,.shiny-input-container .control-label{margin-bottom:.5rem}.col-form-label{padding-top:calc(0.375rem + 1px);padding-bottom:calc(0.375rem + 1px);margin-bottom:0;font-size:inherit;line-height:1.5}.col-form-label-lg{padding-top:calc(0.5rem + 1px);padding-bottom:calc(0.5rem + 1px);font-size:1.25rem}.col-form-label-sm{padding-top:calc(0.25rem + 1px);padding-bottom:calc(0.25rem + 1px);font-size:0.875rem}.form-text{margin-top:.25rem;font-size:0.875em;color:rgba(33,37,41,.75)}.form-control{display:block;width:100%;padding:.375rem .75rem;font-size:1rem;font-weight:400;line-height:1.5;color:#212529;appearance:none;-webkit-appearance:none;-moz-appearance:none;-ms-appearance:none;-o-appearance:none;background-color:#fff;background-clip:padding-box;border:1px solid #dee2e6;border-radius:.375rem;transition:border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media(prefers-reduced-motion: reduce){.form-control{transition:none}}.form-control[type=file]{overflow:hidden}.form-control[type=file]:not(:disabled):not([readonly]){cursor:pointer}.form-control:focus{color:#212529;background-color:#fff;border-color:#86b7fe;outline:0;box-shadow:0 0 0 .25rem rgba(13,110,253,.25)}.form-control::-webkit-date-and-time-value{min-width:85px;height:1.5em;margin:0}.form-control::-webkit-datetime-edit{display:block;padding:0}.form-control::placeholder{color:rgba(33,37,41,.75);opacity:1}.form-control:disabled{background-color:#e9ecef;opacity:1}.form-control::file-selector-button{padding:.375rem .75rem;margin:-0.375rem -0.75rem;margin-inline-end:.75rem;color:#212529;background-color:#f8f9fa;pointer-events:none;border-color:inherit;border-style:solid;border-width:0;border-inline-end-width:1px;border-radius:0;transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media(prefers-reduced-motion: reduce){.form-control::file-selector-button{transition:none}}.form-control:hover:not(:disabled):not([readonly])::file-selector-button{background-color:#e9ecef}.form-control-plaintext{display:block;width:100%;padding:.375rem 0;margin-bottom:0;line-height:1.5;color:#212529;background-color:rgba(0,0,0,0);border:solid rgba(0,0,0,0);border-width:1px 0}.form-control-plaintext:focus{outline:0}.form-control-plaintext.form-control-sm,.form-control-plaintext.form-control-lg{padding-right:0;padding-left:0}.form-control-sm{min-height:calc(1.5em + 0.5rem + calc(1px * 2));padding:.25rem .5rem;font-size:0.875rem;border-radius:.25rem}.form-control-sm::file-selector-button{padding:.25rem .5rem;margin:-0.25rem -0.5rem;margin-inline-end:.5rem}.form-control-lg{min-height:calc(1.5em + 1rem + calc(1px * 2));padding:.5rem 1rem;font-size:1.25rem;border-radius:.5rem}.form-control-lg::file-selector-button{padding:.5rem 1rem;margin:-0.5rem -1rem;margin-inline-end:1rem}textarea.form-control{min-height:calc(1.5em + 0.75rem + calc(1px * 2))}textarea.form-control-sm{min-height:calc(1.5em + 0.5rem + calc(1px * 2))}textarea.form-control-lg{min-height:calc(1.5em + 1rem + calc(1px * 2))}.form-control-color{width:3rem;height:calc(1.5em + 0.75rem + calc(1px * 2));padding:.375rem}.form-control-color:not(:disabled):not([readonly]){cursor:pointer}.form-control-color::-moz-color-swatch{border:0 !important;border-radius:.375rem}.form-control-color::-webkit-color-swatch{border:0 !important;border-radius:.375rem}.form-control-color.form-control-sm{height:calc(1.5em + 0.5rem + calc(1px * 2))}.form-control-color.form-control-lg{height:calc(1.5em + 1rem + calc(1px * 2))}.form-select{--bs-form-select-bg-img: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16'%3e%3cpath fill='none' stroke='%23343a40' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' d='m2 5 6 6 6-6'/%3e%3c/svg%3e");display:block;width:100%;padding:.375rem 2.25rem .375rem .75rem;font-size:1rem;font-weight:400;line-height:1.5;color:#212529;appearance:none;-webkit-appearance:none;-moz-appearance:none;-ms-appearance:none;-o-appearance:none;background-color:#fff;background-image:var(--bs-form-select-bg-img),var(--bs-form-select-bg-icon, none);background-repeat:no-repeat;background-position:right .75rem center;background-size:16px 12px;border:1px solid #dee2e6;border-radius:.375rem;transition:border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media(prefers-reduced-motion: reduce){.form-select{transition:none}}.form-select:focus{border-color:#86b7fe;outline:0;box-shadow:0 0 0 .25rem rgba(13,110,253,.25)}.form-select[multiple],.form-select[size]:not([size="1"]){padding-right:.75rem;background-image:none}.form-select:disabled{background-color:#e9ecef}.form-select:-moz-focusring{color:rgba(0,0,0,0);text-shadow:0 0 0 #212529}.form-select-sm{padding-top:.25rem;padding-bottom:.25rem;padding-left:.5rem;font-size:0.875rem;border-radius:.25rem}.form-select-lg{padding-top:.5rem;padding-bottom:.5rem;padding-left:1rem;font-size:1.25rem;border-radius:.5rem}[data-bs-theme=dark] .form-select{--bs-form-select-bg-img: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16'%3e%3cpath fill='none' stroke='%23dee2e6' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' d='m2 5 6 6 6-6'/%3e%3c/svg%3e")}.form-check,.shiny-input-container .checkbox,.shiny-input-container .radio{display:block;min-height:1.5rem;padding-left:0;margin-bottom:.125rem}.form-check .form-check-input,.form-check .shiny-input-container .checkbox input,.form-check .shiny-input-container .radio input,.shiny-input-container .checkbox .form-check-input,.shiny-input-container .checkbox .shiny-input-container .checkbox input,.shiny-input-container .checkbox .shiny-input-container .radio input,.shiny-input-container .radio .form-check-input,.shiny-input-container .radio .shiny-input-container .checkbox input,.shiny-input-container .radio .shiny-input-container .radio input{float:left;margin-left:0}.form-check-reverse{padding-right:0;padding-left:0;text-align:right}.form-check-reverse .form-check-input{float:right;margin-right:0;margin-left:0}.form-check-input,.shiny-input-container .checkbox input,.shiny-input-container .checkbox-inline input,.shiny-input-container .radio input,.shiny-input-container .radio-inline input{--bs-form-check-bg: #ffffff;width:1em;height:1em;margin-top:.25em;vertical-align:top;appearance:none;-webkit-appearance:none;-moz-appearance:none;-ms-appearance:none;-o-appearance:none;background-color:var(--bs-form-check-bg);background-image:var(--bs-form-check-bg-image);background-repeat:no-repeat;background-position:center;background-size:contain;border:1px solid #dee2e6;print-color-adjust:exact}.form-check-input[type=checkbox],.shiny-input-container .checkbox input[type=checkbox],.shiny-input-container .checkbox-inline input[type=checkbox],.shiny-input-container .radio input[type=checkbox],.shiny-input-container .radio-inline input[type=checkbox]{border-radius:.25em}.form-check-input[type=radio],.shiny-input-container .checkbox input[type=radio],.shiny-input-container .checkbox-inline input[type=radio],.shiny-input-container .radio input[type=radio],.shiny-input-container .radio-inline input[type=radio]{border-radius:50%}.form-check-input:active,.shiny-input-container .checkbox input:active,.shiny-input-container .checkbox-inline input:active,.shiny-input-container .radio input:active,.shiny-input-container .radio-inline input:active{filter:brightness(90%)}.form-check-input:focus,.shiny-input-container .checkbox input:focus,.shiny-input-container .checkbox-inline input:focus,.shiny-input-container .radio input:focus,.shiny-input-container .radio-inline input:focus{border-color:#86b7fe;outline:0;box-shadow:0 0 0 .25rem rgba(13,110,253,.25)}.form-check-input:checked,.shiny-input-container .checkbox input:checked,.shiny-input-container .checkbox-inline input:checked,.shiny-input-container .radio input:checked,.shiny-input-container .radio-inline input:checked{background-color:#0d6efd;border-color:#0d6efd}.form-check-input:checked[type=checkbox],.shiny-input-container .checkbox input:checked[type=checkbox],.shiny-input-container .checkbox-inline input:checked[type=checkbox],.shiny-input-container .radio input:checked[type=checkbox],.shiny-input-container .radio-inline input:checked[type=checkbox]{--bs-form-check-bg-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 20 20'%3e%3cpath fill='none' stroke='%23ffffff' stroke-linecap='round' stroke-linejoin='round' stroke-width='3' d='m6 10 3 3 6-6'/%3e%3c/svg%3e")}.form-check-input:checked[type=radio],.shiny-input-container .checkbox input:checked[type=radio],.shiny-input-container .checkbox-inline input:checked[type=radio],.shiny-input-container .radio input:checked[type=radio],.shiny-input-container .radio-inline input:checked[type=radio]{--bs-form-check-bg-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='2' fill='%23ffffff'/%3e%3c/svg%3e")}.form-check-input[type=checkbox]:indeterminate,.shiny-input-container .checkbox input[type=checkbox]:indeterminate,.shiny-input-container .checkbox-inline input[type=checkbox]:indeterminate,.shiny-input-container .radio input[type=checkbox]:indeterminate,.shiny-input-container .radio-inline input[type=checkbox]:indeterminate{background-color:#0d6efd;border-color:#0d6efd;--bs-form-check-bg-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 20 20'%3e%3cpath fill='none' stroke='%23ffffff' stroke-linecap='round' stroke-linejoin='round' stroke-width='3' d='M6 10h8'/%3e%3c/svg%3e")}.form-check-input:disabled,.shiny-input-container .checkbox input:disabled,.shiny-input-container .checkbox-inline input:disabled,.shiny-input-container .radio input:disabled,.shiny-input-container .radio-inline input:disabled{pointer-events:none;filter:none;opacity:.5}.form-check-input[disabled]~.form-check-label,.form-check-input[disabled]~span,.form-check-input:disabled~.form-check-label,.form-check-input:disabled~span,.shiny-input-container .checkbox input[disabled]~.form-check-label,.shiny-input-container .checkbox input[disabled]~span,.shiny-input-container .checkbox input:disabled~.form-check-label,.shiny-input-container .checkbox input:disabled~span,.shiny-input-container .checkbox-inline input[disabled]~.form-check-label,.shiny-input-container .checkbox-inline input[disabled]~span,.shiny-input-container .checkbox-inline input:disabled~.form-check-label,.shiny-input-container .checkbox-inline input:disabled~span,.shiny-input-container .radio input[disabled]~.form-check-label,.shiny-input-container .radio input[disabled]~span,.shiny-input-container .radio input:disabled~.form-check-label,.shiny-input-container .radio input:disabled~span,.shiny-input-container .radio-inline input[disabled]~.form-check-label,.shiny-input-container .radio-inline input[disabled]~span,.shiny-input-container .radio-inline input:disabled~.form-check-label,.shiny-input-container .radio-inline input:disabled~span{cursor:default;opacity:.5}.form-check-label,.shiny-input-container .checkbox label,.shiny-input-container .checkbox-inline label,.shiny-input-container .radio label,.shiny-input-container .radio-inline label{cursor:pointer}.form-switch{padding-left:2.5em}.form-switch .form-check-input{--bs-form-switch-bg: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='rgba%280, 0, 0, 0.25%29'/%3e%3c/svg%3e");width:2em;margin-left:-2.5em;background-image:var(--bs-form-switch-bg);background-position:left center;border-radius:2em;transition:background-position .15s ease-in-out}@media(prefers-reduced-motion: reduce){.form-switch .form-check-input{transition:none}}.form-switch .form-check-input:focus{--bs-form-switch-bg: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='%2386b7fe'/%3e%3c/svg%3e")}.form-switch .form-check-input:checked{background-position:right center;--bs-form-switch-bg: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='%23ffffff'/%3e%3c/svg%3e")}.form-switch.form-check-reverse{padding-right:2.5em;padding-left:0}.form-switch.form-check-reverse .form-check-input{margin-right:-2.5em;margin-left:0}.form-check-inline{display:inline-block;margin-right:1rem}.btn-check{position:absolute;clip:rect(0, 0, 0, 0);pointer-events:none}.btn-check[disabled]+.btn,.btn-check:disabled+.btn{pointer-events:none;filter:none;opacity:.65}[data-bs-theme=dark] .form-switch .form-check-input:not(:checked):not(:focus){--bs-form-switch-bg: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='rgba%28255, 255, 255, 0.25%29'/%3e%3c/svg%3e")}.form-range{width:100%;height:1.5rem;padding:0;appearance:none;-webkit-appearance:none;-moz-appearance:none;-ms-appearance:none;-o-appearance:none;background-color:rgba(0,0,0,0)}.form-range:focus{outline:0}.form-range:focus::-webkit-slider-thumb{box-shadow:0 0 0 1px #fff,0 0 0 .25rem rgba(13,110,253,.25)}.form-range:focus::-moz-range-thumb{box-shadow:0 0 0 1px #fff,0 0 0 .25rem rgba(13,110,253,.25)}.form-range::-moz-focus-outer{border:0}.form-range::-webkit-slider-thumb{width:1rem;height:1rem;margin-top:-0.25rem;appearance:none;-webkit-appearance:none;-moz-appearance:none;-ms-appearance:none;-o-appearance:none;background-color:#0d6efd;border:0;border-radius:1rem;transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media(prefers-reduced-motion: reduce){.form-range::-webkit-slider-thumb{transition:none}}.form-range::-webkit-slider-thumb:active{background-color:#b6d4fe}.form-range::-webkit-slider-runnable-track{width:100%;height:.5rem;color:rgba(0,0,0,0);cursor:pointer;background-color:#f8f9fa;border-color:rgba(0,0,0,0);border-radius:1rem}.form-range::-moz-range-thumb{width:1rem;height:1rem;appearance:none;-webkit-appearance:none;-moz-appearance:none;-ms-appearance:none;-o-appearance:none;background-color:#0d6efd;border:0;border-radius:1rem;transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media(prefers-reduced-motion: reduce){.form-range::-moz-range-thumb{transition:none}}.form-range::-moz-range-thumb:active{background-color:#b6d4fe}.form-range::-moz-range-track{width:100%;height:.5rem;color:rgba(0,0,0,0);cursor:pointer;background-color:#f8f9fa;border-color:rgba(0,0,0,0);border-radius:1rem}.form-range:disabled{pointer-events:none}.form-range:disabled::-webkit-slider-thumb{background-color:rgba(33,37,41,.75)}.form-range:disabled::-moz-range-thumb{background-color:rgba(33,37,41,.75)}.form-floating{position:relative}.form-floating>.form-control,.form-floating>.form-control-plaintext,.form-floating>.form-select{height:calc(3.5rem + calc(1px * 2));min-height:calc(3.5rem + calc(1px * 2));line-height:1.25}.form-floating>label{position:absolute;top:0;left:0;z-index:2;height:100%;padding:1rem .75rem;overflow:hidden;text-align:start;text-overflow:ellipsis;white-space:nowrap;pointer-events:none;border:1px solid rgba(0,0,0,0);transform-origin:0 0;transition:opacity .1s ease-in-out,transform .1s ease-in-out}@media(prefers-reduced-motion: reduce){.form-floating>label{transition:none}}.form-floating>.form-control,.form-floating>.form-control-plaintext{padding:1rem .75rem}.form-floating>.form-control::placeholder,.form-floating>.form-control-plaintext::placeholder{color:rgba(0,0,0,0)}.form-floating>.form-control:focus,.form-floating>.form-control:not(:placeholder-shown),.form-floating>.form-control-plaintext:focus,.form-floating>.form-control-plaintext:not(:placeholder-shown){padding-top:1.625rem;padding-bottom:.625rem}.form-floating>.form-control:-webkit-autofill,.form-floating>.form-control-plaintext:-webkit-autofill{padding-top:1.625rem;padding-bottom:.625rem}.form-floating>.form-select{padding-top:1.625rem;padding-bottom:.625rem}.form-floating>.form-control:focus~label,.form-floating>.form-control:not(:placeholder-shown)~label,.form-floating>.form-control-plaintext~label,.form-floating>.form-select~label{color:rgba(var(--bs-body-color-rgb), 0.65);transform:scale(0.85) translateY(-0.5rem) translateX(0.15rem)}.form-floating>.form-control:focus~label::after,.form-floating>.form-control:not(:placeholder-shown)~label::after,.form-floating>.form-control-plaintext~label::after,.form-floating>.form-select~label::after{position:absolute;inset:1rem .375rem;z-index:-1;height:1.5em;content:"";background-color:#fff;border-radius:.375rem}.form-floating>.form-control:-webkit-autofill~label{color:rgba(var(--bs-body-color-rgb), 0.65);transform:scale(0.85) translateY(-0.5rem) translateX(0.15rem)}.form-floating>.form-control-plaintext~label{border-width:1px 0}.form-floating>:disabled~label,.form-floating>.form-control:disabled~label{color:#6c757d}.form-floating>:disabled~label::after,.form-floating>.form-control:disabled~label::after{background-color:#e9ecef}.input-group{position:relative;display:flex;display:-webkit-flex;flex-wrap:wrap;-webkit-flex-wrap:wrap;align-items:stretch;-webkit-align-items:stretch;width:100%}.input-group>.form-control,.input-group>.form-select,.input-group>.form-floating{position:relative;flex:1 1 auto;-webkit-flex:1 1 auto;width:1%;min-width:0}.input-group>.form-control:focus,.input-group>.form-select:focus,.input-group>.form-floating:focus-within{z-index:5}.input-group .btn{position:relative;z-index:2}.input-group .btn:focus{z-index:5}.input-group-text{display:flex;display:-webkit-flex;align-items:center;-webkit-align-items:center;padding:.375rem .75rem;font-size:1rem;font-weight:400;line-height:1.5;color:#212529;text-align:center;white-space:nowrap;background-color:#f8f9fa;border:1px solid #dee2e6;border-radius:.375rem}.input-group-lg>.form-control,.input-group-lg>.form-select,.input-group-lg>.input-group-text,.input-group-lg>.btn{padding:.5rem 1rem;font-size:1.25rem;border-radius:.5rem}.input-group-sm>.form-control,.input-group-sm>.form-select,.input-group-sm>.input-group-text,.input-group-sm>.btn{padding:.25rem .5rem;font-size:0.875rem;border-radius:.25rem}.input-group-lg>.form-select,.input-group-sm>.form-select{padding-right:3rem}.input-group:not(.has-validation)>:not(:last-child):not(.dropdown-toggle):not(.dropdown-menu):not(.form-floating),.input-group:not(.has-validation)>.dropdown-toggle:nth-last-child(n+3),.input-group:not(.has-validation)>.form-floating:not(:last-child)>.form-control,.input-group:not(.has-validation)>.form-floating:not(:last-child)>.form-select{border-top-right-radius:0;border-bottom-right-radius:0}.input-group.has-validation>:nth-last-child(n+3):not(.dropdown-toggle):not(.dropdown-menu):not(.form-floating),.input-group.has-validation>.dropdown-toggle:nth-last-child(n+4),.input-group.has-validation>.form-floating:nth-last-child(n+3)>.form-control,.input-group.has-validation>.form-floating:nth-last-child(n+3)>.form-select{border-top-right-radius:0;border-bottom-right-radius:0}.input-group>:not(:first-child):not(.dropdown-menu):not(.valid-tooltip):not(.valid-feedback):not(.invalid-tooltip):not(.invalid-feedback){margin-left:calc(1px*-1);border-top-left-radius:0;border-bottom-left-radius:0}.input-group>.form-floating:not(:first-child)>.form-control,.input-group>.form-floating:not(:first-child)>.form-select{border-top-left-radius:0;border-bottom-left-radius:0}.valid-feedback{display:none;width:100%;margin-top:.25rem;font-size:0.875em;color:#198754}.valid-tooltip{position:absolute;top:100%;z-index:5;display:none;max-width:100%;padding:.25rem .5rem;margin-top:.1rem;font-size:0.875rem;color:#fff;background-color:#198754;border-radius:.375rem}.was-validated :valid~.valid-feedback,.was-validated :valid~.valid-tooltip,.is-valid~.valid-feedback,.is-valid~.valid-tooltip{display:block}.was-validated .form-control:valid,.form-control.is-valid{border-color:#198754;padding-right:calc(1.5em + 0.75rem);background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3e%3cpath fill='%23198754' d='M2.3 6.73.6 4.53c-.4-1.04.46-1.4 1.1-.8l1.1 1.4 3.4-3.8c.6-.63 1.6-.27 1.2.7l-4 4.6c-.43.5-.8.4-1.1.1z'/%3e%3c/svg%3e");background-repeat:no-repeat;background-position:right calc(0.375em + 0.1875rem) center;background-size:calc(0.75em + 0.375rem) calc(0.75em + 0.375rem)}.was-validated .form-control:valid:focus,.form-control.is-valid:focus{border-color:#198754;box-shadow:0 0 0 .25rem rgba(25,135,84,.25)}.was-validated textarea.form-control:valid,textarea.form-control.is-valid{padding-right:calc(1.5em + 0.75rem);background-position:top calc(0.375em + 0.1875rem) right calc(0.375em + 0.1875rem)}.was-validated .form-select:valid,.form-select.is-valid{border-color:#198754}.was-validated .form-select:valid:not([multiple]):not([size]),.was-validated .form-select:valid:not([multiple])[size="1"],.form-select.is-valid:not([multiple]):not([size]),.form-select.is-valid:not([multiple])[size="1"]{--bs-form-select-bg-icon: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3e%3cpath fill='%23198754' d='M2.3 6.73.6 4.53c-.4-1.04.46-1.4 1.1-.8l1.1 1.4 3.4-3.8c.6-.63 1.6-.27 1.2.7l-4 4.6c-.43.5-.8.4-1.1.1z'/%3e%3c/svg%3e");padding-right:4.125rem;background-position:right .75rem center,center right 2.25rem;background-size:16px 12px,calc(0.75em + 0.375rem) calc(0.75em + 0.375rem)}.was-validated .form-select:valid:focus,.form-select.is-valid:focus{border-color:#198754;box-shadow:0 0 0 .25rem rgba(25,135,84,.25)}.was-validated .form-control-color:valid,.form-control-color.is-valid{width:calc(3rem + calc(1.5em + 0.75rem))}.was-validated .form-check-input:valid,.form-check-input.is-valid{border-color:#198754}.was-validated .form-check-input:valid:checked,.form-check-input.is-valid:checked{background-color:#198754}.was-validated .form-check-input:valid:focus,.form-check-input.is-valid:focus{box-shadow:0 0 0 .25rem rgba(25,135,84,.25)}.was-validated .form-check-input:valid~.form-check-label,.form-check-input.is-valid~.form-check-label{color:#198754}.form-check-inline .form-check-input~.valid-feedback{margin-left:.5em}.was-validated .input-group>.form-control:not(:focus):valid,.input-group>.form-control:not(:focus).is-valid,.was-validated .input-group>.form-select:not(:focus):valid,.input-group>.form-select:not(:focus).is-valid,.was-validated .input-group>.form-floating:not(:focus-within):valid,.input-group>.form-floating:not(:focus-within).is-valid{z-index:3}.invalid-feedback{display:none;width:100%;margin-top:.25rem;font-size:0.875em;color:#dc3545}.invalid-tooltip{position:absolute;top:100%;z-index:5;display:none;max-width:100%;padding:.25rem .5rem;margin-top:.1rem;font-size:0.875rem;color:#fff;background-color:#dc3545;border-radius:.375rem}.was-validated :invalid~.invalid-feedback,.was-validated :invalid~.invalid-tooltip,.is-invalid~.invalid-feedback,.is-invalid~.invalid-tooltip{display:block}.was-validated .form-control:invalid,.form-control.is-invalid{border-color:#dc3545;padding-right:calc(1.5em + 0.75rem);background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 12 12' width='12' height='12' fill='none' stroke='%23dc3545'%3e%3ccircle cx='6' cy='6' r='4.5'/%3e%3cpath stroke-linejoin='round' d='M5.8 3.6h.4L6 6.5z'/%3e%3ccircle cx='6' cy='8.2' r='.6' fill='%23dc3545' stroke='none'/%3e%3c/svg%3e");background-repeat:no-repeat;background-position:right calc(0.375em + 0.1875rem) center;background-size:calc(0.75em + 0.375rem) calc(0.75em + 0.375rem)}.was-validated .form-control:invalid:focus,.form-control.is-invalid:focus{border-color:#dc3545;box-shadow:0 0 0 .25rem rgba(220,53,69,.25)}.was-validated textarea.form-control:invalid,textarea.form-control.is-invalid{padding-right:calc(1.5em + 0.75rem);background-position:top calc(0.375em + 0.1875rem) right calc(0.375em + 0.1875rem)}.was-validated .form-select:invalid,.form-select.is-invalid{border-color:#dc3545}.was-validated .form-select:invalid:not([multiple]):not([size]),.was-validated .form-select:invalid:not([multiple])[size="1"],.form-select.is-invalid:not([multiple]):not([size]),.form-select.is-invalid:not([multiple])[size="1"]{--bs-form-select-bg-icon: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 12 12' width='12' height='12' fill='none' stroke='%23dc3545'%3e%3ccircle cx='6' cy='6' r='4.5'/%3e%3cpath stroke-linejoin='round' d='M5.8 3.6h.4L6 6.5z'/%3e%3ccircle cx='6' cy='8.2' r='.6' fill='%23dc3545' stroke='none'/%3e%3c/svg%3e");padding-right:4.125rem;background-position:right .75rem center,center right 2.25rem;background-size:16px 12px,calc(0.75em + 0.375rem) calc(0.75em + 0.375rem)}.was-validated .form-select:invalid:focus,.form-select.is-invalid:focus{border-color:#dc3545;box-shadow:0 0 0 .25rem rgba(220,53,69,.25)}.was-validated .form-control-color:invalid,.form-control-color.is-invalid{width:calc(3rem + calc(1.5em + 0.75rem))}.was-validated .form-check-input:invalid,.form-check-input.is-invalid{border-color:#dc3545}.was-validated .form-check-input:invalid:checked,.form-check-input.is-invalid:checked{background-color:#dc3545}.was-validated .form-check-input:invalid:focus,.form-check-input.is-invalid:focus{box-shadow:0 0 0 .25rem rgba(220,53,69,.25)}.was-validated .form-check-input:invalid~.form-check-label,.form-check-input.is-invalid~.form-check-label{color:#dc3545}.form-check-inline .form-check-input~.invalid-feedback{margin-left:.5em}.was-validated .input-group>.form-control:not(:focus):invalid,.input-group>.form-control:not(:focus).is-invalid,.was-validated .input-group>.form-select:not(:focus):invalid,.input-group>.form-select:not(:focus).is-invalid,.was-validated .input-group>.form-floating:not(:focus-within):invalid,.input-group>.form-floating:not(:focus-within).is-invalid{z-index:4}.btn{--bs-btn-padding-x: 0.75rem;--bs-btn-padding-y: 0.375rem;--bs-btn-font-family: ;--bs-btn-font-size:1rem;--bs-btn-font-weight: 400;--bs-btn-line-height: 1.5;--bs-btn-color: #212529;--bs-btn-bg: transparent;--bs-btn-border-width: 1px;--bs-btn-border-color: transparent;--bs-btn-border-radius: 0.375rem;--bs-btn-hover-border-color: transparent;--bs-btn-box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.15), 0 1px 1px rgba(0, 0, 0, 0.075);--bs-btn-disabled-opacity: 0.65;--bs-btn-focus-box-shadow: 0 0 0 0.25rem rgba(var(--bs-btn-focus-shadow-rgb), .5);display:inline-block;padding:var(--bs-btn-padding-y) var(--bs-btn-padding-x);font-family:var(--bs-btn-font-family);font-size:var(--bs-btn-font-size);font-weight:var(--bs-btn-font-weight);line-height:var(--bs-btn-line-height);color:var(--bs-btn-color);text-align:center;text-decoration:none;-webkit-text-decoration:none;-moz-text-decoration:none;-ms-text-decoration:none;-o-text-decoration:none;vertical-align:middle;cursor:pointer;user-select:none;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;-o-user-select:none;border:var(--bs-btn-border-width) solid var(--bs-btn-border-color);border-radius:var(--bs-btn-border-radius);background-color:var(--bs-btn-bg);transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media(prefers-reduced-motion: reduce){.btn{transition:none}}.btn:hover{color:var(--bs-btn-hover-color);background-color:var(--bs-btn-hover-bg);border-color:var(--bs-btn-hover-border-color)}.btn-check+.btn:hover{color:var(--bs-btn-color);background-color:var(--bs-btn-bg);border-color:var(--bs-btn-border-color)}.btn:focus-visible{color:var(--bs-btn-hover-color);background-color:var(--bs-btn-hover-bg);border-color:var(--bs-btn-hover-border-color);outline:0;box-shadow:var(--bs-btn-focus-box-shadow)}.btn-check:focus-visible+.btn{border-color:var(--bs-btn-hover-border-color);outline:0;box-shadow:var(--bs-btn-focus-box-shadow)}.btn-check:checked+.btn,:not(.btn-check)+.btn:active,.btn:first-child:active,.btn.active,.btn.show{color:var(--bs-btn-active-color);background-color:var(--bs-btn-active-bg);border-color:var(--bs-btn-active-border-color)}.btn-check:checked+.btn:focus-visible,:not(.btn-check)+.btn:active:focus-visible,.btn:first-child:active:focus-visible,.btn.active:focus-visible,.btn.show:focus-visible{box-shadow:var(--bs-btn-focus-box-shadow)}.btn:disabled,.btn.disabled,fieldset:disabled .btn{color:var(--bs-btn-disabled-color);pointer-events:none;background-color:var(--bs-btn-disabled-bg);border-color:var(--bs-btn-disabled-border-color);opacity:var(--bs-btn-disabled-opacity)}.btn-default{--bs-btn-color: #000;--bs-btn-bg: #dee2e6;--bs-btn-border-color: #dee2e6;--bs-btn-hover-color: #000;--bs-btn-hover-bg: #e3e6ea;--bs-btn-hover-border-color: #e1e5e9;--bs-btn-focus-shadow-rgb: 189, 192, 196;--bs-btn-active-color: #000;--bs-btn-active-bg: #e5e8eb;--bs-btn-active-border-color: #e1e5e9;--bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color: #000;--bs-btn-disabled-bg: #dee2e6;--bs-btn-disabled-border-color: #dee2e6}.btn-primary{--bs-btn-color: #ffffff;--bs-btn-bg: #0d6efd;--bs-btn-border-color: #0d6efd;--bs-btn-hover-color: #ffffff;--bs-btn-hover-bg: #0b5ed7;--bs-btn-hover-border-color: #0a58ca;--bs-btn-focus-shadow-rgb: 49, 132, 253;--bs-btn-active-color: #ffffff;--bs-btn-active-bg: #0a58ca;--bs-btn-active-border-color: #0a53be;--bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color: #ffffff;--bs-btn-disabled-bg: #0d6efd;--bs-btn-disabled-border-color: #0d6efd}.btn-secondary{--bs-btn-color: #ffffff;--bs-btn-bg: #6c757d;--bs-btn-border-color: #6c757d;--bs-btn-hover-color: #ffffff;--bs-btn-hover-bg: #5c636a;--bs-btn-hover-border-color: #565e64;--bs-btn-focus-shadow-rgb: 130, 138, 145;--bs-btn-active-color: #ffffff;--bs-btn-active-bg: #565e64;--bs-btn-active-border-color: #51585e;--bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color: #ffffff;--bs-btn-disabled-bg: #6c757d;--bs-btn-disabled-border-color: #6c757d}.btn-success{--bs-btn-color: #ffffff;--bs-btn-bg: #198754;--bs-btn-border-color: #198754;--bs-btn-hover-color: #ffffff;--bs-btn-hover-bg: #157347;--bs-btn-hover-border-color: #146c43;--bs-btn-focus-shadow-rgb: 60, 153, 110;--bs-btn-active-color: #ffffff;--bs-btn-active-bg: #146c43;--bs-btn-active-border-color: #13653f;--bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color: #ffffff;--bs-btn-disabled-bg: #198754;--bs-btn-disabled-border-color: #198754}.btn-info{--bs-btn-color: #000;--bs-btn-bg: #0dcaf0;--bs-btn-border-color: #0dcaf0;--bs-btn-hover-color: #000;--bs-btn-hover-bg: #31d2f2;--bs-btn-hover-border-color: #25cff2;--bs-btn-focus-shadow-rgb: 11, 172, 204;--bs-btn-active-color: #000;--bs-btn-active-bg: #3dd5f3;--bs-btn-active-border-color: #25cff2;--bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color: #000;--bs-btn-disabled-bg: #0dcaf0;--bs-btn-disabled-border-color: #0dcaf0}.btn-warning{--bs-btn-color: #000;--bs-btn-bg: #ffc107;--bs-btn-border-color: #ffc107;--bs-btn-hover-color: #000;--bs-btn-hover-bg: #ffca2c;--bs-btn-hover-border-color: #ffc720;--bs-btn-focus-shadow-rgb: 217, 164, 6;--bs-btn-active-color: #000;--bs-btn-active-bg: #ffcd39;--bs-btn-active-border-color: #ffc720;--bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color: #000;--bs-btn-disabled-bg: #ffc107;--bs-btn-disabled-border-color: #ffc107}.btn-danger{--bs-btn-color: #ffffff;--bs-btn-bg: #dc3545;--bs-btn-border-color: #dc3545;--bs-btn-hover-color: #ffffff;--bs-btn-hover-bg: #bb2d3b;--bs-btn-hover-border-color: #b02a37;--bs-btn-focus-shadow-rgb: 225, 83, 97;--bs-btn-active-color: #ffffff;--bs-btn-active-bg: #b02a37;--bs-btn-active-border-color: #a52834;--bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color: #ffffff;--bs-btn-disabled-bg: #dc3545;--bs-btn-disabled-border-color: #dc3545}.btn-light{--bs-btn-color: #000;--bs-btn-bg: #f8f9fa;--bs-btn-border-color: #f8f9fa;--bs-btn-hover-color: #000;--bs-btn-hover-bg: #d3d4d5;--bs-btn-hover-border-color: #c6c7c8;--bs-btn-focus-shadow-rgb: 211, 212, 213;--bs-btn-active-color: #000;--bs-btn-active-bg: #c6c7c8;--bs-btn-active-border-color: #babbbc;--bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color: #000;--bs-btn-disabled-bg: #f8f9fa;--bs-btn-disabled-border-color: #f8f9fa}.btn-dark{--bs-btn-color: #ffffff;--bs-btn-bg: #212529;--bs-btn-border-color: #212529;--bs-btn-hover-color: #ffffff;--bs-btn-hover-bg: #424649;--bs-btn-hover-border-color: #373b3e;--bs-btn-focus-shadow-rgb: 66, 70, 73;--bs-btn-active-color: #ffffff;--bs-btn-active-bg: #4d5154;--bs-btn-active-border-color: #373b3e;--bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color: #ffffff;--bs-btn-disabled-bg: #212529;--bs-btn-disabled-border-color: #212529}.btn-outline-default{--bs-btn-color: #dee2e6;--bs-btn-border-color: #dee2e6;--bs-btn-hover-color: #000;--bs-btn-hover-bg: #dee2e6;--bs-btn-hover-border-color: #dee2e6;--bs-btn-focus-shadow-rgb: 222, 226, 230;--bs-btn-active-color: #000;--bs-btn-active-bg: #dee2e6;--bs-btn-active-border-color: #dee2e6;--bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color: #dee2e6;--bs-btn-disabled-bg: transparent;--bs-btn-disabled-border-color: #dee2e6;--bs-btn-bg: transparent;--bs-gradient: none}.btn-outline-primary{--bs-btn-color: #0d6efd;--bs-btn-border-color: #0d6efd;--bs-btn-hover-color: #ffffff;--bs-btn-hover-bg: #0d6efd;--bs-btn-hover-border-color: #0d6efd;--bs-btn-focus-shadow-rgb: 13, 110, 253;--bs-btn-active-color: #ffffff;--bs-btn-active-bg: #0d6efd;--bs-btn-active-border-color: #0d6efd;--bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color: #0d6efd;--bs-btn-disabled-bg: transparent;--bs-btn-disabled-border-color: #0d6efd;--bs-btn-bg: transparent;--bs-gradient: none}.btn-outline-secondary{--bs-btn-color: #6c757d;--bs-btn-border-color: #6c757d;--bs-btn-hover-color: #ffffff;--bs-btn-hover-bg: #6c757d;--bs-btn-hover-border-color: #6c757d;--bs-btn-focus-shadow-rgb: 108, 117, 125;--bs-btn-active-color: #ffffff;--bs-btn-active-bg: #6c757d;--bs-btn-active-border-color: #6c757d;--bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color: #6c757d;--bs-btn-disabled-bg: transparent;--bs-btn-disabled-border-color: #6c757d;--bs-btn-bg: transparent;--bs-gradient: none}.btn-outline-success{--bs-btn-color: #198754;--bs-btn-border-color: #198754;--bs-btn-hover-color: #ffffff;--bs-btn-hover-bg: #198754;--bs-btn-hover-border-color: #198754;--bs-btn-focus-shadow-rgb: 25, 135, 84;--bs-btn-active-color: #ffffff;--bs-btn-active-bg: #198754;--bs-btn-active-border-color: #198754;--bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color: #198754;--bs-btn-disabled-bg: transparent;--bs-btn-disabled-border-color: #198754;--bs-btn-bg: transparent;--bs-gradient: none}.btn-outline-info{--bs-btn-color: #0dcaf0;--bs-btn-border-color: #0dcaf0;--bs-btn-hover-color: #000;--bs-btn-hover-bg: #0dcaf0;--bs-btn-hover-border-color: #0dcaf0;--bs-btn-focus-shadow-rgb: 13, 202, 240;--bs-btn-active-color: #000;--bs-btn-active-bg: #0dcaf0;--bs-btn-active-border-color: #0dcaf0;--bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color: #0dcaf0;--bs-btn-disabled-bg: transparent;--bs-btn-disabled-border-color: #0dcaf0;--bs-btn-bg: transparent;--bs-gradient: none}.btn-outline-warning{--bs-btn-color: #ffc107;--bs-btn-border-color: #ffc107;--bs-btn-hover-color: #000;--bs-btn-hover-bg: #ffc107;--bs-btn-hover-border-color: #ffc107;--bs-btn-focus-shadow-rgb: 255, 193, 7;--bs-btn-active-color: #000;--bs-btn-active-bg: #ffc107;--bs-btn-active-border-color: #ffc107;--bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color: #ffc107;--bs-btn-disabled-bg: transparent;--bs-btn-disabled-border-color: #ffc107;--bs-btn-bg: transparent;--bs-gradient: none}.btn-outline-danger{--bs-btn-color: #dc3545;--bs-btn-border-color: #dc3545;--bs-btn-hover-color: #ffffff;--bs-btn-hover-bg: #dc3545;--bs-btn-hover-border-color: #dc3545;--bs-btn-focus-shadow-rgb: 220, 53, 69;--bs-btn-active-color: #ffffff;--bs-btn-active-bg: #dc3545;--bs-btn-active-border-color: #dc3545;--bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color: #dc3545;--bs-btn-disabled-bg: transparent;--bs-btn-disabled-border-color: #dc3545;--bs-btn-bg: transparent;--bs-gradient: none}.btn-outline-light{--bs-btn-color: #f8f9fa;--bs-btn-border-color: #f8f9fa;--bs-btn-hover-color: #000;--bs-btn-hover-bg: #f8f9fa;--bs-btn-hover-border-color: #f8f9fa;--bs-btn-focus-shadow-rgb: 248, 249, 250;--bs-btn-active-color: #000;--bs-btn-active-bg: #f8f9fa;--bs-btn-active-border-color: #f8f9fa;--bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color: #f8f9fa;--bs-btn-disabled-bg: transparent;--bs-btn-disabled-border-color: #f8f9fa;--bs-btn-bg: transparent;--bs-gradient: none}.btn-outline-dark{--bs-btn-color: #212529;--bs-btn-border-color: #212529;--bs-btn-hover-color: #ffffff;--bs-btn-hover-bg: #212529;--bs-btn-hover-border-color: #212529;--bs-btn-focus-shadow-rgb: 33, 37, 41;--bs-btn-active-color: #ffffff;--bs-btn-active-bg: #212529;--bs-btn-active-border-color: #212529;--bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color: #212529;--bs-btn-disabled-bg: transparent;--bs-btn-disabled-border-color: #212529;--bs-btn-bg: transparent;--bs-gradient: none}.btn-link{--bs-btn-font-weight: 400;--bs-btn-color: #0d6efd;--bs-btn-bg: transparent;--bs-btn-border-color: transparent;--bs-btn-hover-color: #0a58ca;--bs-btn-hover-border-color: transparent;--bs-btn-active-color: #0a58ca;--bs-btn-active-border-color: transparent;--bs-btn-disabled-color: #6c757d;--bs-btn-disabled-border-color: transparent;--bs-btn-box-shadow: 0 0 0 #000;--bs-btn-focus-shadow-rgb: 49, 132, 253;text-decoration:underline;-webkit-text-decoration:underline;-moz-text-decoration:underline;-ms-text-decoration:underline;-o-text-decoration:underline}.btn-link:focus-visible{color:var(--bs-btn-color)}.btn-link:hover{color:var(--bs-btn-hover-color)}.btn-lg,.btn-group-lg>.btn{--bs-btn-padding-y: 0.5rem;--bs-btn-padding-x: 1rem;--bs-btn-font-size:1.25rem;--bs-btn-border-radius: 0.5rem}.btn-sm,.btn-group-sm>.btn{--bs-btn-padding-y: 0.25rem;--bs-btn-padding-x: 0.5rem;--bs-btn-font-size:0.875rem;--bs-btn-border-radius: 0.25rem}.fade{transition:opacity .15s linear}@media(prefers-reduced-motion: reduce){.fade{transition:none}}.fade:not(.show){opacity:0}.collapse:not(.show){display:none}.collapsing{height:0;overflow:hidden;transition:height .2s ease}@media(prefers-reduced-motion: reduce){.collapsing{transition:none}}.collapsing.collapse-horizontal{width:0;height:auto;transition:width .35s ease}@media(prefers-reduced-motion: reduce){.collapsing.collapse-horizontal{transition:none}}.dropup,.dropend,.dropdown,.dropstart,.dropup-center,.dropdown-center{position:relative}.dropdown-toggle{white-space:nowrap}.dropdown-toggle::after{display:inline-block;margin-left:.255em;vertical-align:.255em;content:"";border-top:.3em solid;border-right:.3em solid rgba(0,0,0,0);border-bottom:0;border-left:.3em solid rgba(0,0,0,0)}.dropdown-toggle:empty::after{margin-left:0}.dropdown-menu{--bs-dropdown-zindex: 1000;--bs-dropdown-min-width: 10rem;--bs-dropdown-padding-x: 0;--bs-dropdown-padding-y: 0.5rem;--bs-dropdown-spacer: 0.125rem;--bs-dropdown-font-size:1rem;--bs-dropdown-color: #212529;--bs-dropdown-bg: #ffffff;--bs-dropdown-border-color: rgba(0, 0, 0, 0.175);--bs-dropdown-border-radius: 0.375rem;--bs-dropdown-border-width: 1px;--bs-dropdown-inner-border-radius: calc(0.375rem - 1px);--bs-dropdown-divider-bg: rgba(0, 0, 0, 0.175);--bs-dropdown-divider-margin-y: 0.5rem;--bs-dropdown-box-shadow: 0 0.5rem 1rem rgba(0, 0, 0, 0.15);--bs-dropdown-link-color: #212529;--bs-dropdown-link-hover-color: #212529;--bs-dropdown-link-hover-bg: #f8f9fa;--bs-dropdown-link-active-color: #ffffff;--bs-dropdown-link-active-bg: #0d6efd;--bs-dropdown-link-disabled-color: rgba(33, 37, 41, 0.5);--bs-dropdown-item-padding-x: 1rem;--bs-dropdown-item-padding-y: 0.25rem;--bs-dropdown-header-color: #6c757d;--bs-dropdown-header-padding-x: 1rem;--bs-dropdown-header-padding-y: 0.5rem;position:absolute;z-index:var(--bs-dropdown-zindex);display:none;min-width:var(--bs-dropdown-min-width);padding:var(--bs-dropdown-padding-y) var(--bs-dropdown-padding-x);margin:0;font-size:var(--bs-dropdown-font-size);color:var(--bs-dropdown-color);text-align:left;list-style:none;background-color:var(--bs-dropdown-bg);background-clip:padding-box;border:var(--bs-dropdown-border-width) solid var(--bs-dropdown-border-color);border-radius:var(--bs-dropdown-border-radius)}.dropdown-menu[data-bs-popper]{top:100%;left:0;margin-top:var(--bs-dropdown-spacer)}.dropdown-menu-start{--bs-position: start}.dropdown-menu-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-end{--bs-position: end}.dropdown-menu-end[data-bs-popper]{right:0;left:auto}@media(min-width: 576px){.dropdown-menu-sm-start{--bs-position: start}.dropdown-menu-sm-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-sm-end{--bs-position: end}.dropdown-menu-sm-end[data-bs-popper]{right:0;left:auto}}@media(min-width: 768px){.dropdown-menu-md-start{--bs-position: start}.dropdown-menu-md-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-md-end{--bs-position: end}.dropdown-menu-md-end[data-bs-popper]{right:0;left:auto}}@media(min-width: 992px){.dropdown-menu-lg-start{--bs-position: start}.dropdown-menu-lg-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-lg-end{--bs-position: end}.dropdown-menu-lg-end[data-bs-popper]{right:0;left:auto}}@media(min-width: 1200px){.dropdown-menu-xl-start{--bs-position: start}.dropdown-menu-xl-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-xl-end{--bs-position: end}.dropdown-menu-xl-end[data-bs-popper]{right:0;left:auto}}@media(min-width: 1400px){.dropdown-menu-xxl-start{--bs-position: start}.dropdown-menu-xxl-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-xxl-end{--bs-position: end}.dropdown-menu-xxl-end[data-bs-popper]{right:0;left:auto}}.dropup .dropdown-menu[data-bs-popper]{top:auto;bottom:100%;margin-top:0;margin-bottom:var(--bs-dropdown-spacer)}.dropup .dropdown-toggle::after{display:inline-block;margin-left:.255em;vertical-align:.255em;content:"";border-top:0;border-right:.3em solid rgba(0,0,0,0);border-bottom:.3em solid;border-left:.3em solid rgba(0,0,0,0)}.dropup .dropdown-toggle:empty::after{margin-left:0}.dropend .dropdown-menu[data-bs-popper]{top:0;right:auto;left:100%;margin-top:0;margin-left:var(--bs-dropdown-spacer)}.dropend .dropdown-toggle::after{display:inline-block;margin-left:.255em;vertical-align:.255em;content:"";border-top:.3em solid rgba(0,0,0,0);border-right:0;border-bottom:.3em solid rgba(0,0,0,0);border-left:.3em solid}.dropend .dropdown-toggle:empty::after{margin-left:0}.dropend .dropdown-toggle::after{vertical-align:0}.dropstart .dropdown-menu[data-bs-popper]{top:0;right:100%;left:auto;margin-top:0;margin-right:var(--bs-dropdown-spacer)}.dropstart .dropdown-toggle::after{display:inline-block;margin-left:.255em;vertical-align:.255em;content:""}.dropstart .dropdown-toggle::after{display:none}.dropstart .dropdown-toggle::before{display:inline-block;margin-right:.255em;vertical-align:.255em;content:"";border-top:.3em solid rgba(0,0,0,0);border-right:.3em solid;border-bottom:.3em solid rgba(0,0,0,0)}.dropstart .dropdown-toggle:empty::after{margin-left:0}.dropstart .dropdown-toggle::before{vertical-align:0}.dropdown-divider{height:0;margin:var(--bs-dropdown-divider-margin-y) 0;overflow:hidden;border-top:1px solid var(--bs-dropdown-divider-bg);opacity:1}.dropdown-item{display:block;width:100%;padding:var(--bs-dropdown-item-padding-y) var(--bs-dropdown-item-padding-x);clear:both;font-weight:400;color:var(--bs-dropdown-link-color);text-align:inherit;text-decoration:none;-webkit-text-decoration:none;-moz-text-decoration:none;-ms-text-decoration:none;-o-text-decoration:none;white-space:nowrap;background-color:rgba(0,0,0,0);border:0;border-radius:var(--bs-dropdown-item-border-radius, 0)}.dropdown-item:hover,.dropdown-item:focus{color:var(--bs-dropdown-link-hover-color);background-color:var(--bs-dropdown-link-hover-bg)}.dropdown-item.active,.dropdown-item:active{color:var(--bs-dropdown-link-active-color);text-decoration:none;background-color:var(--bs-dropdown-link-active-bg)}.dropdown-item.disabled,.dropdown-item:disabled{color:var(--bs-dropdown-link-disabled-color);pointer-events:none;background-color:rgba(0,0,0,0)}.dropdown-menu.show{display:block}.dropdown-header{display:block;padding:var(--bs-dropdown-header-padding-y) var(--bs-dropdown-header-padding-x);margin-bottom:0;font-size:0.875rem;color:var(--bs-dropdown-header-color);white-space:nowrap}.dropdown-item-text{display:block;padding:var(--bs-dropdown-item-padding-y) var(--bs-dropdown-item-padding-x);color:var(--bs-dropdown-link-color)}.dropdown-menu-dark{--bs-dropdown-color: #dee2e6;--bs-dropdown-bg: #343a40;--bs-dropdown-border-color: rgba(0, 0, 0, 0.175);--bs-dropdown-box-shadow: ;--bs-dropdown-link-color: #dee2e6;--bs-dropdown-link-hover-color: #ffffff;--bs-dropdown-divider-bg: rgba(0, 0, 0, 0.175);--bs-dropdown-link-hover-bg: rgba(255, 255, 255, 0.15);--bs-dropdown-link-active-color: #ffffff;--bs-dropdown-link-active-bg: #0d6efd;--bs-dropdown-link-disabled-color: #adb5bd;--bs-dropdown-header-color: #adb5bd}.btn-group,.btn-group-vertical{position:relative;display:inline-flex;vertical-align:middle}.btn-group>.btn,.btn-group-vertical>.btn{position:relative;flex:1 1 auto;-webkit-flex:1 1 auto}.btn-group>.btn-check:checked+.btn,.btn-group>.btn-check:focus+.btn,.btn-group>.btn:hover,.btn-group>.btn:focus,.btn-group>.btn:active,.btn-group>.btn.active,.btn-group-vertical>.btn-check:checked+.btn,.btn-group-vertical>.btn-check:focus+.btn,.btn-group-vertical>.btn:hover,.btn-group-vertical>.btn:focus,.btn-group-vertical>.btn:active,.btn-group-vertical>.btn.active{z-index:1}.btn-toolbar{display:flex;display:-webkit-flex;flex-wrap:wrap;-webkit-flex-wrap:wrap;justify-content:flex-start;-webkit-justify-content:flex-start}.btn-toolbar .input-group{width:auto}.btn-group{border-radius:.375rem}.btn-group>:not(.btn-check:first-child)+.btn,.btn-group>.btn-group:not(:first-child){margin-left:calc(1px*-1)}.btn-group>.btn:not(:last-child):not(.dropdown-toggle),.btn-group>.btn.dropdown-toggle-split:first-child,.btn-group>.btn-group:not(:last-child)>.btn{border-top-right-radius:0;border-bottom-right-radius:0}.btn-group>.btn:nth-child(n+3),.btn-group>:not(.btn-check)+.btn,.btn-group>.btn-group:not(:first-child)>.btn{border-top-left-radius:0;border-bottom-left-radius:0}.dropdown-toggle-split{padding-right:.5625rem;padding-left:.5625rem}.dropdown-toggle-split::after,.dropup .dropdown-toggle-split::after,.dropend .dropdown-toggle-split::after{margin-left:0}.dropstart .dropdown-toggle-split::before{margin-right:0}.btn-sm+.dropdown-toggle-split,.btn-group-sm>.btn+.dropdown-toggle-split{padding-right:.375rem;padding-left:.375rem}.btn-lg+.dropdown-toggle-split,.btn-group-lg>.btn+.dropdown-toggle-split{padding-right:.75rem;padding-left:.75rem}.btn-group-vertical{flex-direction:column;-webkit-flex-direction:column;align-items:flex-start;-webkit-align-items:flex-start;justify-content:center;-webkit-justify-content:center}.btn-group-vertical>.btn,.btn-group-vertical>.btn-group{width:100%}.btn-group-vertical>.btn:not(:first-child),.btn-group-vertical>.btn-group:not(:first-child){margin-top:calc(1px*-1)}.btn-group-vertical>.btn:not(:last-child):not(.dropdown-toggle),.btn-group-vertical>.btn-group:not(:last-child)>.btn{border-bottom-right-radius:0;border-bottom-left-radius:0}.btn-group-vertical>.btn~.btn,.btn-group-vertical>.btn-group:not(:first-child)>.btn{border-top-left-radius:0;border-top-right-radius:0}.nav{--bs-nav-link-padding-x: 1rem;--bs-nav-link-padding-y: 0.5rem;--bs-nav-link-font-weight: ;--bs-nav-link-color: #0d6efd;--bs-nav-link-hover-color: #0a58ca;--bs-nav-link-disabled-color: rgba(33, 37, 41, 0.75);display:flex;display:-webkit-flex;flex-wrap:wrap;-webkit-flex-wrap:wrap;padding-left:0;margin-bottom:0;list-style:none}.nav-link{display:block;padding:var(--bs-nav-link-padding-y) var(--bs-nav-link-padding-x);font-size:var(--bs-nav-link-font-size);font-weight:var(--bs-nav-link-font-weight);color:var(--bs-nav-link-color);text-decoration:none;-webkit-text-decoration:none;-moz-text-decoration:none;-ms-text-decoration:none;-o-text-decoration:none;background:none;border:0;transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out}@media(prefers-reduced-motion: reduce){.nav-link{transition:none}}.nav-link:hover,.nav-link:focus{color:var(--bs-nav-link-hover-color)}.nav-link:focus-visible{outline:0;box-shadow:0 0 0 .25rem rgba(13,110,253,.25)}.nav-link.disabled,.nav-link:disabled{color:var(--bs-nav-link-disabled-color);pointer-events:none;cursor:default}.nav-tabs{--bs-nav-tabs-border-width: 1px;--bs-nav-tabs-border-color: #dee2e6;--bs-nav-tabs-border-radius: 0.375rem;--bs-nav-tabs-link-hover-border-color: #e9ecef #e9ecef #dee2e6;--bs-nav-tabs-link-active-color: #000;--bs-nav-tabs-link-active-bg: #ffffff;--bs-nav-tabs-link-active-border-color: #dee2e6 #dee2e6 #ffffff;border-bottom:var(--bs-nav-tabs-border-width) solid var(--bs-nav-tabs-border-color)}.nav-tabs .nav-link{margin-bottom:calc(-1*var(--bs-nav-tabs-border-width));border:var(--bs-nav-tabs-border-width) solid rgba(0,0,0,0);border-top-left-radius:var(--bs-nav-tabs-border-radius);border-top-right-radius:var(--bs-nav-tabs-border-radius)}.nav-tabs .nav-link:hover,.nav-tabs .nav-link:focus{isolation:isolate;border-color:var(--bs-nav-tabs-link-hover-border-color)}.nav-tabs .nav-link.active,.nav-tabs .nav-item.show .nav-link{color:var(--bs-nav-tabs-link-active-color);background-color:var(--bs-nav-tabs-link-active-bg);border-color:var(--bs-nav-tabs-link-active-border-color)}.nav-tabs .dropdown-menu{margin-top:calc(-1*var(--bs-nav-tabs-border-width));border-top-left-radius:0;border-top-right-radius:0}.nav-pills{--bs-nav-pills-border-radius: 0.375rem;--bs-nav-pills-link-active-color: #ffffff;--bs-nav-pills-link-active-bg: #0d6efd}.nav-pills .nav-link{border-radius:var(--bs-nav-pills-border-radius)}.nav-pills .nav-link.active,.nav-pills .show>.nav-link{color:var(--bs-nav-pills-link-active-color);background-color:var(--bs-nav-pills-link-active-bg)}.nav-underline{--bs-nav-underline-gap: 1rem;--bs-nav-underline-border-width: 0.125rem;--bs-nav-underline-link-active-color: #000;gap:var(--bs-nav-underline-gap)}.nav-underline .nav-link{padding-right:0;padding-left:0;border-bottom:var(--bs-nav-underline-border-width) solid rgba(0,0,0,0)}.nav-underline .nav-link:hover,.nav-underline .nav-link:focus{border-bottom-color:currentcolor}.nav-underline .nav-link.active,.nav-underline .show>.nav-link{font-weight:700;color:var(--bs-nav-underline-link-active-color);border-bottom-color:currentcolor}.nav-fill>.nav-link,.nav-fill .nav-item{flex:1 1 auto;-webkit-flex:1 1 auto;text-align:center}.nav-justified>.nav-link,.nav-justified .nav-item{flex-basis:0;-webkit-flex-basis:0;flex-grow:1;-webkit-flex-grow:1;text-align:center}.nav-fill .nav-item .nav-link,.nav-justified .nav-item .nav-link{width:100%}.tab-content>.tab-pane{display:none}.tab-content>.active{display:block}.navbar{--bs-navbar-padding-x: 0;--bs-navbar-padding-y: 0.5rem;--bs-navbar-color: #fdfefe;--bs-navbar-hover-color: rgba(253, 254, 255, 0.8);--bs-navbar-disabled-color: rgba(253, 254, 254, 0.75);--bs-navbar-active-color: #fdfeff;--bs-navbar-brand-padding-y: 0.3125rem;--bs-navbar-brand-margin-end: 1rem;--bs-navbar-brand-font-size: 1.25rem;--bs-navbar-brand-color: #fdfefe;--bs-navbar-brand-hover-color: #fdfeff;--bs-navbar-nav-link-padding-x: 0.5rem;--bs-navbar-toggler-padding-y: 0.25;--bs-navbar-toggler-padding-x: 0;--bs-navbar-toggler-font-size: 1.25rem;--bs-navbar-toggler-icon-bg: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 30 30'%3e%3cpath stroke='%23fdfefe' stroke-linecap='round' stroke-miterlimit='10' stroke-width='2' d='M4 7h22M4 15h22M4 23h22'/%3e%3c/svg%3e");--bs-navbar-toggler-border-color: rgba(253, 254, 254, 0);--bs-navbar-toggler-border-radius: 0.375rem;--bs-navbar-toggler-focus-width: 0.25rem;--bs-navbar-toggler-transition: box-shadow 0.15s ease-in-out;position:relative;display:flex;display:-webkit-flex;flex-wrap:wrap;-webkit-flex-wrap:wrap;align-items:center;-webkit-align-items:center;justify-content:space-between;-webkit-justify-content:space-between;padding:var(--bs-navbar-padding-y) var(--bs-navbar-padding-x)}.navbar>.container,.navbar>.container-fluid,.navbar>.container-sm,.navbar>.container-md,.navbar>.container-lg,.navbar>.container-xl,.navbar>.container-xxl{display:flex;display:-webkit-flex;flex-wrap:inherit;-webkit-flex-wrap:inherit;align-items:center;-webkit-align-items:center;justify-content:space-between;-webkit-justify-content:space-between}.navbar-brand{padding-top:var(--bs-navbar-brand-padding-y);padding-bottom:var(--bs-navbar-brand-padding-y);margin-right:var(--bs-navbar-brand-margin-end);font-size:var(--bs-navbar-brand-font-size);color:var(--bs-navbar-brand-color);text-decoration:none;-webkit-text-decoration:none;-moz-text-decoration:none;-ms-text-decoration:none;-o-text-decoration:none;white-space:nowrap}.navbar-brand:hover,.navbar-brand:focus{color:var(--bs-navbar-brand-hover-color)}.navbar-nav{--bs-nav-link-padding-x: 0;--bs-nav-link-padding-y: 0.5rem;--bs-nav-link-font-weight: ;--bs-nav-link-color: var(--bs-navbar-color);--bs-nav-link-hover-color: var(--bs-navbar-hover-color);--bs-nav-link-disabled-color: var(--bs-navbar-disabled-color);display:flex;display:-webkit-flex;flex-direction:column;-webkit-flex-direction:column;padding-left:0;margin-bottom:0;list-style:none}.navbar-nav .nav-link.active,.navbar-nav .nav-link.show{color:var(--bs-navbar-active-color)}.navbar-nav .dropdown-menu{position:static}.navbar-text{padding-top:.5rem;padding-bottom:.5rem;color:var(--bs-navbar-color)}.navbar-text a,.navbar-text a:hover,.navbar-text a:focus{color:var(--bs-navbar-active-color)}.navbar-collapse{flex-basis:100%;-webkit-flex-basis:100%;flex-grow:1;-webkit-flex-grow:1;align-items:center;-webkit-align-items:center}.navbar-toggler{padding:var(--bs-navbar-toggler-padding-y) var(--bs-navbar-toggler-padding-x);font-size:var(--bs-navbar-toggler-font-size);line-height:1;color:var(--bs-navbar-color);background-color:rgba(0,0,0,0);border:var(--bs-border-width) solid var(--bs-navbar-toggler-border-color);border-radius:var(--bs-navbar-toggler-border-radius);transition:var(--bs-navbar-toggler-transition)}@media(prefers-reduced-motion: reduce){.navbar-toggler{transition:none}}.navbar-toggler:hover{text-decoration:none}.navbar-toggler:focus{text-decoration:none;outline:0;box-shadow:0 0 0 var(--bs-navbar-toggler-focus-width)}.navbar-toggler-icon{display:inline-block;width:1.5em;height:1.5em;vertical-align:middle;background-image:var(--bs-navbar-toggler-icon-bg);background-repeat:no-repeat;background-position:center;background-size:100%}.navbar-nav-scroll{max-height:var(--bs-scroll-height, 75vh);overflow-y:auto}@media(min-width: 576px){.navbar-expand-sm{flex-wrap:nowrap;-webkit-flex-wrap:nowrap;justify-content:flex-start;-webkit-justify-content:flex-start}.navbar-expand-sm .navbar-nav{flex-direction:row;-webkit-flex-direction:row}.navbar-expand-sm .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-sm .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand-sm .navbar-nav-scroll{overflow:visible}.navbar-expand-sm .navbar-collapse{display:flex !important;display:-webkit-flex !important;flex-basis:auto;-webkit-flex-basis:auto}.navbar-expand-sm .navbar-toggler{display:none}.navbar-expand-sm .offcanvas{position:static;z-index:auto;flex-grow:1;-webkit-flex-grow:1;width:auto !important;height:auto !important;visibility:visible !important;background-color:rgba(0,0,0,0) !important;border:0 !important;transform:none !important;transition:none}.navbar-expand-sm .offcanvas .offcanvas-header{display:none}.navbar-expand-sm .offcanvas .offcanvas-body{display:flex;display:-webkit-flex;flex-grow:0;-webkit-flex-grow:0;padding:0;overflow-y:visible}}@media(min-width: 768px){.navbar-expand-md{flex-wrap:nowrap;-webkit-flex-wrap:nowrap;justify-content:flex-start;-webkit-justify-content:flex-start}.navbar-expand-md .navbar-nav{flex-direction:row;-webkit-flex-direction:row}.navbar-expand-md .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-md .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand-md .navbar-nav-scroll{overflow:visible}.navbar-expand-md .navbar-collapse{display:flex !important;display:-webkit-flex !important;flex-basis:auto;-webkit-flex-basis:auto}.navbar-expand-md .navbar-toggler{display:none}.navbar-expand-md .offcanvas{position:static;z-index:auto;flex-grow:1;-webkit-flex-grow:1;width:auto !important;height:auto !important;visibility:visible !important;background-color:rgba(0,0,0,0) !important;border:0 !important;transform:none !important;transition:none}.navbar-expand-md .offcanvas .offcanvas-header{display:none}.navbar-expand-md .offcanvas .offcanvas-body{display:flex;display:-webkit-flex;flex-grow:0;-webkit-flex-grow:0;padding:0;overflow-y:visible}}@media(min-width: 992px){.navbar-expand-lg{flex-wrap:nowrap;-webkit-flex-wrap:nowrap;justify-content:flex-start;-webkit-justify-content:flex-start}.navbar-expand-lg .navbar-nav{flex-direction:row;-webkit-flex-direction:row}.navbar-expand-lg .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-lg .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand-lg .navbar-nav-scroll{overflow:visible}.navbar-expand-lg .navbar-collapse{display:flex !important;display:-webkit-flex !important;flex-basis:auto;-webkit-flex-basis:auto}.navbar-expand-lg .navbar-toggler{display:none}.navbar-expand-lg .offcanvas{position:static;z-index:auto;flex-grow:1;-webkit-flex-grow:1;width:auto !important;height:auto !important;visibility:visible !important;background-color:rgba(0,0,0,0) !important;border:0 !important;transform:none !important;transition:none}.navbar-expand-lg .offcanvas .offcanvas-header{display:none}.navbar-expand-lg .offcanvas .offcanvas-body{display:flex;display:-webkit-flex;flex-grow:0;-webkit-flex-grow:0;padding:0;overflow-y:visible}}@media(min-width: 1200px){.navbar-expand-xl{flex-wrap:nowrap;-webkit-flex-wrap:nowrap;justify-content:flex-start;-webkit-justify-content:flex-start}.navbar-expand-xl .navbar-nav{flex-direction:row;-webkit-flex-direction:row}.navbar-expand-xl .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-xl .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand-xl .navbar-nav-scroll{overflow:visible}.navbar-expand-xl .navbar-collapse{display:flex !important;display:-webkit-flex !important;flex-basis:auto;-webkit-flex-basis:auto}.navbar-expand-xl .navbar-toggler{display:none}.navbar-expand-xl .offcanvas{position:static;z-index:auto;flex-grow:1;-webkit-flex-grow:1;width:auto !important;height:auto !important;visibility:visible !important;background-color:rgba(0,0,0,0) !important;border:0 !important;transform:none !important;transition:none}.navbar-expand-xl .offcanvas .offcanvas-header{display:none}.navbar-expand-xl .offcanvas .offcanvas-body{display:flex;display:-webkit-flex;flex-grow:0;-webkit-flex-grow:0;padding:0;overflow-y:visible}}@media(min-width: 1400px){.navbar-expand-xxl{flex-wrap:nowrap;-webkit-flex-wrap:nowrap;justify-content:flex-start;-webkit-justify-content:flex-start}.navbar-expand-xxl .navbar-nav{flex-direction:row;-webkit-flex-direction:row}.navbar-expand-xxl .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-xxl .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand-xxl .navbar-nav-scroll{overflow:visible}.navbar-expand-xxl .navbar-collapse{display:flex !important;display:-webkit-flex !important;flex-basis:auto;-webkit-flex-basis:auto}.navbar-expand-xxl .navbar-toggler{display:none}.navbar-expand-xxl .offcanvas{position:static;z-index:auto;flex-grow:1;-webkit-flex-grow:1;width:auto !important;height:auto !important;visibility:visible !important;background-color:rgba(0,0,0,0) !important;border:0 !important;transform:none !important;transition:none}.navbar-expand-xxl .offcanvas .offcanvas-header{display:none}.navbar-expand-xxl .offcanvas .offcanvas-body{display:flex;display:-webkit-flex;flex-grow:0;-webkit-flex-grow:0;padding:0;overflow-y:visible}}.navbar-expand{flex-wrap:nowrap;-webkit-flex-wrap:nowrap;justify-content:flex-start;-webkit-justify-content:flex-start}.navbar-expand .navbar-nav{flex-direction:row;-webkit-flex-direction:row}.navbar-expand .navbar-nav .dropdown-menu{position:absolute}.navbar-expand .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand .navbar-nav-scroll{overflow:visible}.navbar-expand .navbar-collapse{display:flex !important;display:-webkit-flex !important;flex-basis:auto;-webkit-flex-basis:auto}.navbar-expand .navbar-toggler{display:none}.navbar-expand .offcanvas{position:static;z-index:auto;flex-grow:1;-webkit-flex-grow:1;width:auto !important;height:auto !important;visibility:visible !important;background-color:rgba(0,0,0,0) !important;border:0 !important;transform:none !important;transition:none}.navbar-expand .offcanvas .offcanvas-header{display:none}.navbar-expand .offcanvas .offcanvas-body{display:flex;display:-webkit-flex;flex-grow:0;-webkit-flex-grow:0;padding:0;overflow-y:visible}.navbar-dark,.navbar[data-bs-theme=dark]{--bs-navbar-color: #fdfefe;--bs-navbar-hover-color: rgba(253, 254, 255, 0.8);--bs-navbar-disabled-color: rgba(253, 254, 254, 0.75);--bs-navbar-active-color: #fdfeff;--bs-navbar-brand-color: #fdfefe;--bs-navbar-brand-hover-color: #fdfeff;--bs-navbar-toggler-border-color: rgba(253, 254, 254, 0);--bs-navbar-toggler-icon-bg: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 30 30'%3e%3cpath stroke='%23fdfefe' stroke-linecap='round' stroke-miterlimit='10' stroke-width='2' d='M4 7h22M4 15h22M4 23h22'/%3e%3c/svg%3e")}[data-bs-theme=dark] .navbar-toggler-icon{--bs-navbar-toggler-icon-bg: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 30 30'%3e%3cpath stroke='%23fdfefe' stroke-linecap='round' stroke-miterlimit='10' stroke-width='2' d='M4 7h22M4 15h22M4 23h22'/%3e%3c/svg%3e")}.card{--bs-card-spacer-y: 1rem;--bs-card-spacer-x: 1rem;--bs-card-title-spacer-y: 0.5rem;--bs-card-title-color: ;--bs-card-subtitle-color: ;--bs-card-border-width: 1px;--bs-card-border-color: rgba(0, 0, 0, 0.175);--bs-card-border-radius: 0.375rem;--bs-card-box-shadow: ;--bs-card-inner-border-radius: calc(0.375rem - 1px);--bs-card-cap-padding-y: 0.5rem;--bs-card-cap-padding-x: 1rem;--bs-card-cap-bg: rgba(33, 37, 41, 0.03);--bs-card-cap-color: ;--bs-card-height: ;--bs-card-color: ;--bs-card-bg: #ffffff;--bs-card-img-overlay-padding: 1rem;--bs-card-group-margin: 0.75rem;position:relative;display:flex;display:-webkit-flex;flex-direction:column;-webkit-flex-direction:column;min-width:0;height:var(--bs-card-height);color:var(--bs-body-color);word-wrap:break-word;background-color:var(--bs-card-bg);background-clip:border-box;border:var(--bs-card-border-width) solid var(--bs-card-border-color);border-radius:var(--bs-card-border-radius)}.card>hr{margin-right:0;margin-left:0}.card>.list-group{border-top:inherit;border-bottom:inherit}.card>.list-group:first-child{border-top-width:0;border-top-left-radius:var(--bs-card-inner-border-radius);border-top-right-radius:var(--bs-card-inner-border-radius)}.card>.list-group:last-child{border-bottom-width:0;border-bottom-right-radius:var(--bs-card-inner-border-radius);border-bottom-left-radius:var(--bs-card-inner-border-radius)}.card>.card-header+.list-group,.card>.list-group+.card-footer{border-top:0}.card-body{flex:1 1 auto;-webkit-flex:1 1 auto;padding:var(--bs-card-spacer-y) var(--bs-card-spacer-x);color:var(--bs-card-color)}.card-title{margin-bottom:var(--bs-card-title-spacer-y);color:var(--bs-card-title-color)}.card-subtitle{margin-top:calc(-0.5*var(--bs-card-title-spacer-y));margin-bottom:0;color:var(--bs-card-subtitle-color)}.card-text:last-child{margin-bottom:0}.card-link+.card-link{margin-left:var(--bs-card-spacer-x)}.card-header{padding:var(--bs-card-cap-padding-y) var(--bs-card-cap-padding-x);margin-bottom:0;color:var(--bs-card-cap-color);background-color:var(--bs-card-cap-bg);border-bottom:var(--bs-card-border-width) solid var(--bs-card-border-color)}.card-header:first-child{border-radius:var(--bs-card-inner-border-radius) var(--bs-card-inner-border-radius) 0 0}.card-footer{padding:var(--bs-card-cap-padding-y) var(--bs-card-cap-padding-x);color:var(--bs-card-cap-color);background-color:var(--bs-card-cap-bg);border-top:var(--bs-card-border-width) solid var(--bs-card-border-color)}.card-footer:last-child{border-radius:0 0 var(--bs-card-inner-border-radius) var(--bs-card-inner-border-radius)}.card-header-tabs{margin-right:calc(-0.5*var(--bs-card-cap-padding-x));margin-bottom:calc(-1*var(--bs-card-cap-padding-y));margin-left:calc(-0.5*var(--bs-card-cap-padding-x));border-bottom:0}.card-header-tabs .nav-link.active{background-color:var(--bs-card-bg);border-bottom-color:var(--bs-card-bg)}.card-header-pills{margin-right:calc(-0.5*var(--bs-card-cap-padding-x));margin-left:calc(-0.5*var(--bs-card-cap-padding-x))}.card-img-overlay{position:absolute;top:0;right:0;bottom:0;left:0;padding:var(--bs-card-img-overlay-padding);border-radius:var(--bs-card-inner-border-radius)}.card-img,.card-img-top,.card-img-bottom{width:100%}.card-img,.card-img-top{border-top-left-radius:var(--bs-card-inner-border-radius);border-top-right-radius:var(--bs-card-inner-border-radius)}.card-img,.card-img-bottom{border-bottom-right-radius:var(--bs-card-inner-border-radius);border-bottom-left-radius:var(--bs-card-inner-border-radius)}.card-group>.card{margin-bottom:var(--bs-card-group-margin)}@media(min-width: 576px){.card-group{display:flex;display:-webkit-flex;flex-flow:row wrap;-webkit-flex-flow:row wrap}.card-group>.card{flex:1 0 0%;-webkit-flex:1 0 0%;margin-bottom:0}.card-group>.card+.card{margin-left:0;border-left:0}.card-group>.card:not(:last-child){border-top-right-radius:0;border-bottom-right-radius:0}.card-group>.card:not(:last-child) .card-img-top,.card-group>.card:not(:last-child) .card-header{border-top-right-radius:0}.card-group>.card:not(:last-child) .card-img-bottom,.card-group>.card:not(:last-child) .card-footer{border-bottom-right-radius:0}.card-group>.card:not(:first-child){border-top-left-radius:0;border-bottom-left-radius:0}.card-group>.card:not(:first-child) .card-img-top,.card-group>.card:not(:first-child) .card-header{border-top-left-radius:0}.card-group>.card:not(:first-child) .card-img-bottom,.card-group>.card:not(:first-child) .card-footer{border-bottom-left-radius:0}}.accordion{--bs-accordion-color: #212529;--bs-accordion-bg: #ffffff;--bs-accordion-transition: color 0.15s ease-in-out, background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out, border-radius 0.15s ease;--bs-accordion-border-color: #dee2e6;--bs-accordion-border-width: 1px;--bs-accordion-border-radius: 0.375rem;--bs-accordion-inner-border-radius: calc(0.375rem - 1px);--bs-accordion-btn-padding-x: 1.25rem;--bs-accordion-btn-padding-y: 1rem;--bs-accordion-btn-color: #212529;--bs-accordion-btn-bg: #ffffff;--bs-accordion-btn-icon: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23212529'%3e%3cpath fill-rule='evenodd' d='M1.646 4.646a.5.5 0 0 1 .708 0L8 10.293l5.646-5.647a.5.5 0 0 1 .708.708l-6 6a.5.5 0 0 1-.708 0l-6-6a.5.5 0 0 1 0-.708z'/%3e%3c/svg%3e");--bs-accordion-btn-icon-width: 1.25rem;--bs-accordion-btn-icon-transform: rotate(-180deg);--bs-accordion-btn-icon-transition: transform 0.2s ease-in-out;--bs-accordion-btn-active-icon: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23052c65'%3e%3cpath fill-rule='evenodd' d='M1.646 4.646a.5.5 0 0 1 .708 0L8 10.293l5.646-5.647a.5.5 0 0 1 .708.708l-6 6a.5.5 0 0 1-.708 0l-6-6a.5.5 0 0 1 0-.708z'/%3e%3c/svg%3e");--bs-accordion-btn-focus-border-color: #86b7fe;--bs-accordion-btn-focus-box-shadow: 0 0 0 0.25rem rgba(13, 110, 253, 0.25);--bs-accordion-body-padding-x: 1.25rem;--bs-accordion-body-padding-y: 1rem;--bs-accordion-active-color: #052c65;--bs-accordion-active-bg: #cfe2ff}.accordion-button{position:relative;display:flex;display:-webkit-flex;align-items:center;-webkit-align-items:center;width:100%;padding:var(--bs-accordion-btn-padding-y) var(--bs-accordion-btn-padding-x);font-size:1rem;color:var(--bs-accordion-btn-color);text-align:left;background-color:var(--bs-accordion-btn-bg);border:0;border-radius:0;overflow-anchor:none;transition:var(--bs-accordion-transition)}@media(prefers-reduced-motion: reduce){.accordion-button{transition:none}}.accordion-button:not(.collapsed){color:var(--bs-accordion-active-color);background-color:var(--bs-accordion-active-bg);box-shadow:inset 0 calc(-1*var(--bs-accordion-border-width)) 0 var(--bs-accordion-border-color)}.accordion-button:not(.collapsed)::after{background-image:var(--bs-accordion-btn-active-icon);transform:var(--bs-accordion-btn-icon-transform)}.accordion-button::after{flex-shrink:0;-webkit-flex-shrink:0;width:var(--bs-accordion-btn-icon-width);height:var(--bs-accordion-btn-icon-width);margin-left:auto;content:"";background-image:var(--bs-accordion-btn-icon);background-repeat:no-repeat;background-size:var(--bs-accordion-btn-icon-width);transition:var(--bs-accordion-btn-icon-transition)}@media(prefers-reduced-motion: reduce){.accordion-button::after{transition:none}}.accordion-button:hover{z-index:2}.accordion-button:focus{z-index:3;border-color:var(--bs-accordion-btn-focus-border-color);outline:0;box-shadow:var(--bs-accordion-btn-focus-box-shadow)}.accordion-header{margin-bottom:0}.accordion-item{color:var(--bs-accordion-color);background-color:var(--bs-accordion-bg);border:var(--bs-accordion-border-width) solid var(--bs-accordion-border-color)}.accordion-item:first-of-type{border-top-left-radius:var(--bs-accordion-border-radius);border-top-right-radius:var(--bs-accordion-border-radius)}.accordion-item:first-of-type .accordion-button{border-top-left-radius:var(--bs-accordion-inner-border-radius);border-top-right-radius:var(--bs-accordion-inner-border-radius)}.accordion-item:not(:first-of-type){border-top:0}.accordion-item:last-of-type{border-bottom-right-radius:var(--bs-accordion-border-radius);border-bottom-left-radius:var(--bs-accordion-border-radius)}.accordion-item:last-of-type .accordion-button.collapsed{border-bottom-right-radius:var(--bs-accordion-inner-border-radius);border-bottom-left-radius:var(--bs-accordion-inner-border-radius)}.accordion-item:last-of-type .accordion-collapse{border-bottom-right-radius:var(--bs-accordion-border-radius);border-bottom-left-radius:var(--bs-accordion-border-radius)}.accordion-body{padding:var(--bs-accordion-body-padding-y) var(--bs-accordion-body-padding-x)}.accordion-flush .accordion-collapse{border-width:0}.accordion-flush .accordion-item{border-right:0;border-left:0;border-radius:0}.accordion-flush .accordion-item:first-child{border-top:0}.accordion-flush .accordion-item:last-child{border-bottom:0}.accordion-flush .accordion-item .accordion-button,.accordion-flush .accordion-item .accordion-button.collapsed{border-radius:0}[data-bs-theme=dark] .accordion-button::after{--bs-accordion-btn-icon: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%236ea8fe'%3e%3cpath fill-rule='evenodd' d='M1.646 4.646a.5.5 0 0 1 .708 0L8 10.293l5.646-5.647a.5.5 0 0 1 .708.708l-6 6a.5.5 0 0 1-.708 0l-6-6a.5.5 0 0 1 0-.708z'/%3e%3c/svg%3e");--bs-accordion-btn-active-icon: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%236ea8fe'%3e%3cpath fill-rule='evenodd' d='M1.646 4.646a.5.5 0 0 1 .708 0L8 10.293l5.646-5.647a.5.5 0 0 1 .708.708l-6 6a.5.5 0 0 1-.708 0l-6-6a.5.5 0 0 1 0-.708z'/%3e%3c/svg%3e")}.breadcrumb{--bs-breadcrumb-padding-x: 0;--bs-breadcrumb-padding-y: 0;--bs-breadcrumb-margin-bottom: 1rem;--bs-breadcrumb-bg: ;--bs-breadcrumb-border-radius: ;--bs-breadcrumb-divider-color: rgba(33, 37, 41, 0.75);--bs-breadcrumb-item-padding-x: 0.5rem;--bs-breadcrumb-item-active-color: rgba(33, 37, 41, 0.75);display:flex;display:-webkit-flex;flex-wrap:wrap;-webkit-flex-wrap:wrap;padding:var(--bs-breadcrumb-padding-y) var(--bs-breadcrumb-padding-x);margin-bottom:var(--bs-breadcrumb-margin-bottom);font-size:var(--bs-breadcrumb-font-size);list-style:none;background-color:var(--bs-breadcrumb-bg);border-radius:var(--bs-breadcrumb-border-radius)}.breadcrumb-item+.breadcrumb-item{padding-left:var(--bs-breadcrumb-item-padding-x)}.breadcrumb-item+.breadcrumb-item::before{float:left;padding-right:var(--bs-breadcrumb-item-padding-x);color:var(--bs-breadcrumb-divider-color);content:var(--bs-breadcrumb-divider, ">") /* rtl: var(--bs-breadcrumb-divider, ">") */}.breadcrumb-item.active{color:var(--bs-breadcrumb-item-active-color)}.pagination{--bs-pagination-padding-x: 0.75rem;--bs-pagination-padding-y: 0.375rem;--bs-pagination-font-size:1rem;--bs-pagination-color: #0d6efd;--bs-pagination-bg: #ffffff;--bs-pagination-border-width: 1px;--bs-pagination-border-color: #dee2e6;--bs-pagination-border-radius: 0.375rem;--bs-pagination-hover-color: #0a58ca;--bs-pagination-hover-bg: #f8f9fa;--bs-pagination-hover-border-color: #dee2e6;--bs-pagination-focus-color: #0a58ca;--bs-pagination-focus-bg: #e9ecef;--bs-pagination-focus-box-shadow: 0 0 0 0.25rem rgba(13, 110, 253, 0.25);--bs-pagination-active-color: #ffffff;--bs-pagination-active-bg: #0d6efd;--bs-pagination-active-border-color: #0d6efd;--bs-pagination-disabled-color: rgba(33, 37, 41, 0.75);--bs-pagination-disabled-bg: #e9ecef;--bs-pagination-disabled-border-color: #dee2e6;display:flex;display:-webkit-flex;padding-left:0;list-style:none}.page-link{position:relative;display:block;padding:var(--bs-pagination-padding-y) var(--bs-pagination-padding-x);font-size:var(--bs-pagination-font-size);color:var(--bs-pagination-color);text-decoration:none;-webkit-text-decoration:none;-moz-text-decoration:none;-ms-text-decoration:none;-o-text-decoration:none;background-color:var(--bs-pagination-bg);border:var(--bs-pagination-border-width) solid var(--bs-pagination-border-color);transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media(prefers-reduced-motion: reduce){.page-link{transition:none}}.page-link:hover{z-index:2;color:var(--bs-pagination-hover-color);background-color:var(--bs-pagination-hover-bg);border-color:var(--bs-pagination-hover-border-color)}.page-link:focus{z-index:3;color:var(--bs-pagination-focus-color);background-color:var(--bs-pagination-focus-bg);outline:0;box-shadow:var(--bs-pagination-focus-box-shadow)}.page-link.active,.active>.page-link{z-index:3;color:var(--bs-pagination-active-color);background-color:var(--bs-pagination-active-bg);border-color:var(--bs-pagination-active-border-color)}.page-link.disabled,.disabled>.page-link{color:var(--bs-pagination-disabled-color);pointer-events:none;background-color:var(--bs-pagination-disabled-bg);border-color:var(--bs-pagination-disabled-border-color)}.page-item:not(:first-child) .page-link{margin-left:calc(1px*-1)}.page-item:first-child .page-link{border-top-left-radius:var(--bs-pagination-border-radius);border-bottom-left-radius:var(--bs-pagination-border-radius)}.page-item:last-child .page-link{border-top-right-radius:var(--bs-pagination-border-radius);border-bottom-right-radius:var(--bs-pagination-border-radius)}.pagination-lg{--bs-pagination-padding-x: 1.5rem;--bs-pagination-padding-y: 0.75rem;--bs-pagination-font-size:1.25rem;--bs-pagination-border-radius: 0.5rem}.pagination-sm{--bs-pagination-padding-x: 0.5rem;--bs-pagination-padding-y: 0.25rem;--bs-pagination-font-size:0.875rem;--bs-pagination-border-radius: 0.25rem}.badge{--bs-badge-padding-x: 0.65em;--bs-badge-padding-y: 0.35em;--bs-badge-font-size:0.75em;--bs-badge-font-weight: 700;--bs-badge-color: #ffffff;--bs-badge-border-radius: 0.375rem;display:inline-block;padding:var(--bs-badge-padding-y) var(--bs-badge-padding-x);font-size:var(--bs-badge-font-size);font-weight:var(--bs-badge-font-weight);line-height:1;color:var(--bs-badge-color);text-align:center;white-space:nowrap;vertical-align:baseline;border-radius:var(--bs-badge-border-radius)}.badge:empty{display:none}.btn .badge{position:relative;top:-1px}.alert{--bs-alert-bg: transparent;--bs-alert-padding-x: 1rem;--bs-alert-padding-y: 1rem;--bs-alert-margin-bottom: 1rem;--bs-alert-color: inherit;--bs-alert-border-color: transparent;--bs-alert-border: 1px solid var(--bs-alert-border-color);--bs-alert-border-radius: 0.375rem;--bs-alert-link-color: inherit;position:relative;padding:var(--bs-alert-padding-y) var(--bs-alert-padding-x);margin-bottom:var(--bs-alert-margin-bottom);color:var(--bs-alert-color);background-color:var(--bs-alert-bg);border:var(--bs-alert-border);border-radius:var(--bs-alert-border-radius)}.alert-heading{color:inherit}.alert-link{font-weight:700;color:var(--bs-alert-link-color)}.alert-dismissible{padding-right:3rem}.alert-dismissible .btn-close{position:absolute;top:0;right:0;z-index:2;padding:1.25rem 1rem}.alert-default{--bs-alert-color: var(--bs-default-text-emphasis);--bs-alert-bg: var(--bs-default-bg-subtle);--bs-alert-border-color: var(--bs-default-border-subtle);--bs-alert-link-color: var(--bs-default-text-emphasis)}.alert-primary{--bs-alert-color: var(--bs-primary-text-emphasis);--bs-alert-bg: var(--bs-primary-bg-subtle);--bs-alert-border-color: var(--bs-primary-border-subtle);--bs-alert-link-color: var(--bs-primary-text-emphasis)}.alert-secondary{--bs-alert-color: var(--bs-secondary-text-emphasis);--bs-alert-bg: var(--bs-secondary-bg-subtle);--bs-alert-border-color: var(--bs-secondary-border-subtle);--bs-alert-link-color: var(--bs-secondary-text-emphasis)}.alert-success{--bs-alert-color: var(--bs-success-text-emphasis);--bs-alert-bg: var(--bs-success-bg-subtle);--bs-alert-border-color: var(--bs-success-border-subtle);--bs-alert-link-color: var(--bs-success-text-emphasis)}.alert-info{--bs-alert-color: var(--bs-info-text-emphasis);--bs-alert-bg: var(--bs-info-bg-subtle);--bs-alert-border-color: var(--bs-info-border-subtle);--bs-alert-link-color: var(--bs-info-text-emphasis)}.alert-warning{--bs-alert-color: var(--bs-warning-text-emphasis);--bs-alert-bg: var(--bs-warning-bg-subtle);--bs-alert-border-color: var(--bs-warning-border-subtle);--bs-alert-link-color: var(--bs-warning-text-emphasis)}.alert-danger{--bs-alert-color: var(--bs-danger-text-emphasis);--bs-alert-bg: var(--bs-danger-bg-subtle);--bs-alert-border-color: var(--bs-danger-border-subtle);--bs-alert-link-color: var(--bs-danger-text-emphasis)}.alert-light{--bs-alert-color: var(--bs-light-text-emphasis);--bs-alert-bg: var(--bs-light-bg-subtle);--bs-alert-border-color: var(--bs-light-border-subtle);--bs-alert-link-color: var(--bs-light-text-emphasis)}.alert-dark{--bs-alert-color: var(--bs-dark-text-emphasis);--bs-alert-bg: var(--bs-dark-bg-subtle);--bs-alert-border-color: var(--bs-dark-border-subtle);--bs-alert-link-color: var(--bs-dark-text-emphasis)}@keyframes progress-bar-stripes{0%{background-position-x:1rem}}.progress,.progress-stacked{--bs-progress-height: 1rem;--bs-progress-font-size:0.75rem;--bs-progress-bg: #e9ecef;--bs-progress-border-radius: 0.375rem;--bs-progress-box-shadow: inset 0 1px 2px rgba(0, 0, 0, 0.075);--bs-progress-bar-color: #ffffff;--bs-progress-bar-bg: #0d6efd;--bs-progress-bar-transition: width 0.6s ease;display:flex;display:-webkit-flex;height:var(--bs-progress-height);overflow:hidden;font-size:var(--bs-progress-font-size);background-color:var(--bs-progress-bg);border-radius:var(--bs-progress-border-radius)}.progress-bar{display:flex;display:-webkit-flex;flex-direction:column;-webkit-flex-direction:column;justify-content:center;-webkit-justify-content:center;overflow:hidden;color:var(--bs-progress-bar-color);text-align:center;white-space:nowrap;background-color:var(--bs-progress-bar-bg);transition:var(--bs-progress-bar-transition)}@media(prefers-reduced-motion: reduce){.progress-bar{transition:none}}.progress-bar-striped{background-image:linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);background-size:var(--bs-progress-height) var(--bs-progress-height)}.progress-stacked>.progress{overflow:visible}.progress-stacked>.progress>.progress-bar{width:100%}.progress-bar-animated{animation:1s linear infinite progress-bar-stripes}@media(prefers-reduced-motion: reduce){.progress-bar-animated{animation:none}}.list-group{--bs-list-group-color: #212529;--bs-list-group-bg: #ffffff;--bs-list-group-border-color: #dee2e6;--bs-list-group-border-width: 1px;--bs-list-group-border-radius: 0.375rem;--bs-list-group-item-padding-x: 1rem;--bs-list-group-item-padding-y: 0.5rem;--bs-list-group-action-color: rgba(33, 37, 41, 0.75);--bs-list-group-action-hover-color: #000;--bs-list-group-action-hover-bg: #f8f9fa;--bs-list-group-action-active-color: #212529;--bs-list-group-action-active-bg: #e9ecef;--bs-list-group-disabled-color: rgba(33, 37, 41, 0.75);--bs-list-group-disabled-bg: #ffffff;--bs-list-group-active-color: #ffffff;--bs-list-group-active-bg: #0d6efd;--bs-list-group-active-border-color: #0d6efd;display:flex;display:-webkit-flex;flex-direction:column;-webkit-flex-direction:column;padding-left:0;margin-bottom:0;border-radius:var(--bs-list-group-border-radius)}.list-group-numbered{list-style-type:none;counter-reset:section}.list-group-numbered>.list-group-item::before{content:counters(section, ".") ". ";counter-increment:section}.list-group-item-action{width:100%;color:var(--bs-list-group-action-color);text-align:inherit}.list-group-item-action:hover,.list-group-item-action:focus{z-index:1;color:var(--bs-list-group-action-hover-color);text-decoration:none;background-color:var(--bs-list-group-action-hover-bg)}.list-group-item-action:active{color:var(--bs-list-group-action-active-color);background-color:var(--bs-list-group-action-active-bg)}.list-group-item{position:relative;display:block;padding:var(--bs-list-group-item-padding-y) var(--bs-list-group-item-padding-x);color:var(--bs-list-group-color);text-decoration:none;-webkit-text-decoration:none;-moz-text-decoration:none;-ms-text-decoration:none;-o-text-decoration:none;background-color:var(--bs-list-group-bg);border:var(--bs-list-group-border-width) solid var(--bs-list-group-border-color)}.list-group-item:first-child{border-top-left-radius:inherit;border-top-right-radius:inherit}.list-group-item:last-child{border-bottom-right-radius:inherit;border-bottom-left-radius:inherit}.list-group-item.disabled,.list-group-item:disabled{color:var(--bs-list-group-disabled-color);pointer-events:none;background-color:var(--bs-list-group-disabled-bg)}.list-group-item.active{z-index:2;color:var(--bs-list-group-active-color);background-color:var(--bs-list-group-active-bg);border-color:var(--bs-list-group-active-border-color)}.list-group-item+.list-group-item{border-top-width:0}.list-group-item+.list-group-item.active{margin-top:calc(-1*var(--bs-list-group-border-width));border-top-width:var(--bs-list-group-border-width)}.list-group-horizontal{flex-direction:row;-webkit-flex-direction:row}.list-group-horizontal>.list-group-item:first-child:not(:last-child){border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal>.list-group-item:last-child:not(:first-child){border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal>.list-group-item.active{margin-top:0}.list-group-horizontal>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal>.list-group-item+.list-group-item.active{margin-left:calc(-1*var(--bs-list-group-border-width));border-left-width:var(--bs-list-group-border-width)}@media(min-width: 576px){.list-group-horizontal-sm{flex-direction:row;-webkit-flex-direction:row}.list-group-horizontal-sm>.list-group-item:first-child:not(:last-child){border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal-sm>.list-group-item:last-child:not(:first-child){border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal-sm>.list-group-item.active{margin-top:0}.list-group-horizontal-sm>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal-sm>.list-group-item+.list-group-item.active{margin-left:calc(-1*var(--bs-list-group-border-width));border-left-width:var(--bs-list-group-border-width)}}@media(min-width: 768px){.list-group-horizontal-md{flex-direction:row;-webkit-flex-direction:row}.list-group-horizontal-md>.list-group-item:first-child:not(:last-child){border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal-md>.list-group-item:last-child:not(:first-child){border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal-md>.list-group-item.active{margin-top:0}.list-group-horizontal-md>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal-md>.list-group-item+.list-group-item.active{margin-left:calc(-1*var(--bs-list-group-border-width));border-left-width:var(--bs-list-group-border-width)}}@media(min-width: 992px){.list-group-horizontal-lg{flex-direction:row;-webkit-flex-direction:row}.list-group-horizontal-lg>.list-group-item:first-child:not(:last-child){border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal-lg>.list-group-item:last-child:not(:first-child){border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal-lg>.list-group-item.active{margin-top:0}.list-group-horizontal-lg>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal-lg>.list-group-item+.list-group-item.active{margin-left:calc(-1*var(--bs-list-group-border-width));border-left-width:var(--bs-list-group-border-width)}}@media(min-width: 1200px){.list-group-horizontal-xl{flex-direction:row;-webkit-flex-direction:row}.list-group-horizontal-xl>.list-group-item:first-child:not(:last-child){border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal-xl>.list-group-item:last-child:not(:first-child){border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal-xl>.list-group-item.active{margin-top:0}.list-group-horizontal-xl>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal-xl>.list-group-item+.list-group-item.active{margin-left:calc(-1*var(--bs-list-group-border-width));border-left-width:var(--bs-list-group-border-width)}}@media(min-width: 1400px){.list-group-horizontal-xxl{flex-direction:row;-webkit-flex-direction:row}.list-group-horizontal-xxl>.list-group-item:first-child:not(:last-child){border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal-xxl>.list-group-item:last-child:not(:first-child){border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal-xxl>.list-group-item.active{margin-top:0}.list-group-horizontal-xxl>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal-xxl>.list-group-item+.list-group-item.active{margin-left:calc(-1*var(--bs-list-group-border-width));border-left-width:var(--bs-list-group-border-width)}}.list-group-flush{border-radius:0}.list-group-flush>.list-group-item{border-width:0 0 var(--bs-list-group-border-width)}.list-group-flush>.list-group-item:last-child{border-bottom-width:0}.list-group-item-default{--bs-list-group-color: var(--bs-default-text-emphasis);--bs-list-group-bg: var(--bs-default-bg-subtle);--bs-list-group-border-color: var(--bs-default-border-subtle);--bs-list-group-action-hover-color: var(--bs-emphasis-color);--bs-list-group-action-hover-bg: var(--bs-default-border-subtle);--bs-list-group-action-active-color: var(--bs-emphasis-color);--bs-list-group-action-active-bg: var(--bs-default-border-subtle);--bs-list-group-active-color: var(--bs-default-bg-subtle);--bs-list-group-active-bg: var(--bs-default-text-emphasis);--bs-list-group-active-border-color: var(--bs-default-text-emphasis)}.list-group-item-primary{--bs-list-group-color: var(--bs-primary-text-emphasis);--bs-list-group-bg: var(--bs-primary-bg-subtle);--bs-list-group-border-color: var(--bs-primary-border-subtle);--bs-list-group-action-hover-color: var(--bs-emphasis-color);--bs-list-group-action-hover-bg: var(--bs-primary-border-subtle);--bs-list-group-action-active-color: var(--bs-emphasis-color);--bs-list-group-action-active-bg: var(--bs-primary-border-subtle);--bs-list-group-active-color: var(--bs-primary-bg-subtle);--bs-list-group-active-bg: var(--bs-primary-text-emphasis);--bs-list-group-active-border-color: var(--bs-primary-text-emphasis)}.list-group-item-secondary{--bs-list-group-color: var(--bs-secondary-text-emphasis);--bs-list-group-bg: var(--bs-secondary-bg-subtle);--bs-list-group-border-color: var(--bs-secondary-border-subtle);--bs-list-group-action-hover-color: var(--bs-emphasis-color);--bs-list-group-action-hover-bg: var(--bs-secondary-border-subtle);--bs-list-group-action-active-color: var(--bs-emphasis-color);--bs-list-group-action-active-bg: var(--bs-secondary-border-subtle);--bs-list-group-active-color: var(--bs-secondary-bg-subtle);--bs-list-group-active-bg: var(--bs-secondary-text-emphasis);--bs-list-group-active-border-color: var(--bs-secondary-text-emphasis)}.list-group-item-success{--bs-list-group-color: var(--bs-success-text-emphasis);--bs-list-group-bg: var(--bs-success-bg-subtle);--bs-list-group-border-color: var(--bs-success-border-subtle);--bs-list-group-action-hover-color: var(--bs-emphasis-color);--bs-list-group-action-hover-bg: var(--bs-success-border-subtle);--bs-list-group-action-active-color: var(--bs-emphasis-color);--bs-list-group-action-active-bg: var(--bs-success-border-subtle);--bs-list-group-active-color: var(--bs-success-bg-subtle);--bs-list-group-active-bg: var(--bs-success-text-emphasis);--bs-list-group-active-border-color: var(--bs-success-text-emphasis)}.list-group-item-info{--bs-list-group-color: var(--bs-info-text-emphasis);--bs-list-group-bg: var(--bs-info-bg-subtle);--bs-list-group-border-color: var(--bs-info-border-subtle);--bs-list-group-action-hover-color: var(--bs-emphasis-color);--bs-list-group-action-hover-bg: var(--bs-info-border-subtle);--bs-list-group-action-active-color: var(--bs-emphasis-color);--bs-list-group-action-active-bg: var(--bs-info-border-subtle);--bs-list-group-active-color: var(--bs-info-bg-subtle);--bs-list-group-active-bg: var(--bs-info-text-emphasis);--bs-list-group-active-border-color: var(--bs-info-text-emphasis)}.list-group-item-warning{--bs-list-group-color: var(--bs-warning-text-emphasis);--bs-list-group-bg: var(--bs-warning-bg-subtle);--bs-list-group-border-color: var(--bs-warning-border-subtle);--bs-list-group-action-hover-color: var(--bs-emphasis-color);--bs-list-group-action-hover-bg: var(--bs-warning-border-subtle);--bs-list-group-action-active-color: var(--bs-emphasis-color);--bs-list-group-action-active-bg: var(--bs-warning-border-subtle);--bs-list-group-active-color: var(--bs-warning-bg-subtle);--bs-list-group-active-bg: var(--bs-warning-text-emphasis);--bs-list-group-active-border-color: var(--bs-warning-text-emphasis)}.list-group-item-danger{--bs-list-group-color: var(--bs-danger-text-emphasis);--bs-list-group-bg: var(--bs-danger-bg-subtle);--bs-list-group-border-color: var(--bs-danger-border-subtle);--bs-list-group-action-hover-color: var(--bs-emphasis-color);--bs-list-group-action-hover-bg: var(--bs-danger-border-subtle);--bs-list-group-action-active-color: var(--bs-emphasis-color);--bs-list-group-action-active-bg: var(--bs-danger-border-subtle);--bs-list-group-active-color: var(--bs-danger-bg-subtle);--bs-list-group-active-bg: var(--bs-danger-text-emphasis);--bs-list-group-active-border-color: var(--bs-danger-text-emphasis)}.list-group-item-light{--bs-list-group-color: var(--bs-light-text-emphasis);--bs-list-group-bg: var(--bs-light-bg-subtle);--bs-list-group-border-color: var(--bs-light-border-subtle);--bs-list-group-action-hover-color: var(--bs-emphasis-color);--bs-list-group-action-hover-bg: var(--bs-light-border-subtle);--bs-list-group-action-active-color: var(--bs-emphasis-color);--bs-list-group-action-active-bg: var(--bs-light-border-subtle);--bs-list-group-active-color: var(--bs-light-bg-subtle);--bs-list-group-active-bg: var(--bs-light-text-emphasis);--bs-list-group-active-border-color: var(--bs-light-text-emphasis)}.list-group-item-dark{--bs-list-group-color: var(--bs-dark-text-emphasis);--bs-list-group-bg: var(--bs-dark-bg-subtle);--bs-list-group-border-color: var(--bs-dark-border-subtle);--bs-list-group-action-hover-color: var(--bs-emphasis-color);--bs-list-group-action-hover-bg: var(--bs-dark-border-subtle);--bs-list-group-action-active-color: var(--bs-emphasis-color);--bs-list-group-action-active-bg: var(--bs-dark-border-subtle);--bs-list-group-active-color: var(--bs-dark-bg-subtle);--bs-list-group-active-bg: var(--bs-dark-text-emphasis);--bs-list-group-active-border-color: var(--bs-dark-text-emphasis)}.btn-close{--bs-btn-close-color: #000;--bs-btn-close-bg: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23000'%3e%3cpath d='M.293.293a1 1 0 0 1 1.414 0L8 6.586 14.293.293a1 1 0 1 1 1.414 1.414L9.414 8l6.293 6.293a1 1 0 0 1-1.414 1.414L8 9.414l-6.293 6.293a1 1 0 0 1-1.414-1.414L6.586 8 .293 1.707a1 1 0 0 1 0-1.414z'/%3e%3c/svg%3e");--bs-btn-close-opacity: 0.5;--bs-btn-close-hover-opacity: 0.75;--bs-btn-close-focus-shadow: 0 0 0 0.25rem rgba(13, 110, 253, 0.25);--bs-btn-close-focus-opacity: 1;--bs-btn-close-disabled-opacity: 0.25;--bs-btn-close-white-filter: invert(1) grayscale(100%) brightness(200%);box-sizing:content-box;width:1em;height:1em;padding:.25em .25em;color:var(--bs-btn-close-color);background:rgba(0,0,0,0) var(--bs-btn-close-bg) center/1em auto no-repeat;border:0;border-radius:.375rem;opacity:var(--bs-btn-close-opacity)}.btn-close:hover{color:var(--bs-btn-close-color);text-decoration:none;opacity:var(--bs-btn-close-hover-opacity)}.btn-close:focus{outline:0;box-shadow:var(--bs-btn-close-focus-shadow);opacity:var(--bs-btn-close-focus-opacity)}.btn-close:disabled,.btn-close.disabled{pointer-events:none;user-select:none;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;-o-user-select:none;opacity:var(--bs-btn-close-disabled-opacity)}.btn-close-white{filter:var(--bs-btn-close-white-filter)}[data-bs-theme=dark] .btn-close{filter:var(--bs-btn-close-white-filter)}.toast{--bs-toast-zindex: 1090;--bs-toast-padding-x: 0.75rem;--bs-toast-padding-y: 0.5rem;--bs-toast-spacing: 1.5rem;--bs-toast-max-width: 350px;--bs-toast-font-size:0.875rem;--bs-toast-color: ;--bs-toast-bg: rgba(255, 255, 255, 0.85);--bs-toast-border-width: 1px;--bs-toast-border-color: rgba(0, 0, 0, 0.175);--bs-toast-border-radius: 0.375rem;--bs-toast-box-shadow: 0 0.5rem 1rem rgba(0, 0, 0, 0.15);--bs-toast-header-color: rgba(33, 37, 41, 0.75);--bs-toast-header-bg: rgba(255, 255, 255, 0.85);--bs-toast-header-border-color: rgba(0, 0, 0, 0.175);width:var(--bs-toast-max-width);max-width:100%;font-size:var(--bs-toast-font-size);color:var(--bs-toast-color);pointer-events:auto;background-color:var(--bs-toast-bg);background-clip:padding-box;border:var(--bs-toast-border-width) solid var(--bs-toast-border-color);box-shadow:var(--bs-toast-box-shadow);border-radius:var(--bs-toast-border-radius)}.toast.showing{opacity:0}.toast:not(.show){display:none}.toast-container{--bs-toast-zindex: 1090;position:absolute;z-index:var(--bs-toast-zindex);width:max-content;width:-webkit-max-content;width:-moz-max-content;width:-ms-max-content;width:-o-max-content;max-width:100%;pointer-events:none}.toast-container>:not(:last-child){margin-bottom:var(--bs-toast-spacing)}.toast-header{display:flex;display:-webkit-flex;align-items:center;-webkit-align-items:center;padding:var(--bs-toast-padding-y) var(--bs-toast-padding-x);color:var(--bs-toast-header-color);background-color:var(--bs-toast-header-bg);background-clip:padding-box;border-bottom:var(--bs-toast-border-width) solid var(--bs-toast-header-border-color);border-top-left-radius:calc(var(--bs-toast-border-radius) - var(--bs-toast-border-width));border-top-right-radius:calc(var(--bs-toast-border-radius) - var(--bs-toast-border-width))}.toast-header .btn-close{margin-right:calc(-0.5*var(--bs-toast-padding-x));margin-left:var(--bs-toast-padding-x)}.toast-body{padding:var(--bs-toast-padding-x);word-wrap:break-word}.modal{--bs-modal-zindex: 1055;--bs-modal-width: 500px;--bs-modal-padding: 1rem;--bs-modal-margin: 0.5rem;--bs-modal-color: ;--bs-modal-bg: #ffffff;--bs-modal-border-color: rgba(0, 0, 0, 0.175);--bs-modal-border-width: 1px;--bs-modal-border-radius: 0.5rem;--bs-modal-box-shadow: 0 0.125rem 0.25rem rgba(0, 0, 0, 0.075);--bs-modal-inner-border-radius: calc(0.5rem - 1px);--bs-modal-header-padding-x: 1rem;--bs-modal-header-padding-y: 1rem;--bs-modal-header-padding: 1rem 1rem;--bs-modal-header-border-color: #dee2e6;--bs-modal-header-border-width: 1px;--bs-modal-title-line-height: 1.5;--bs-modal-footer-gap: 0.5rem;--bs-modal-footer-bg: ;--bs-modal-footer-border-color: #dee2e6;--bs-modal-footer-border-width: 1px;position:fixed;top:0;left:0;z-index:var(--bs-modal-zindex);display:none;width:100%;height:100%;overflow-x:hidden;overflow-y:auto;outline:0}.modal-dialog{position:relative;width:auto;margin:var(--bs-modal-margin);pointer-events:none}.modal.fade .modal-dialog{transition:transform .3s ease-out;transform:translate(0, -50px)}@media(prefers-reduced-motion: reduce){.modal.fade .modal-dialog{transition:none}}.modal.show .modal-dialog{transform:none}.modal.modal-static .modal-dialog{transform:scale(1.02)}.modal-dialog-scrollable{height:calc(100% - var(--bs-modal-margin)*2)}.modal-dialog-scrollable .modal-content{max-height:100%;overflow:hidden}.modal-dialog-scrollable .modal-body{overflow-y:auto}.modal-dialog-centered{display:flex;display:-webkit-flex;align-items:center;-webkit-align-items:center;min-height:calc(100% - var(--bs-modal-margin)*2)}.modal-content{position:relative;display:flex;display:-webkit-flex;flex-direction:column;-webkit-flex-direction:column;width:100%;color:var(--bs-modal-color);pointer-events:auto;background-color:var(--bs-modal-bg);background-clip:padding-box;border:var(--bs-modal-border-width) solid var(--bs-modal-border-color);border-radius:var(--bs-modal-border-radius);outline:0}.modal-backdrop{--bs-backdrop-zindex: 1050;--bs-backdrop-bg: #000;--bs-backdrop-opacity: 0.5;position:fixed;top:0;left:0;z-index:var(--bs-backdrop-zindex);width:100vw;height:100vh;background-color:var(--bs-backdrop-bg)}.modal-backdrop.fade{opacity:0}.modal-backdrop.show{opacity:var(--bs-backdrop-opacity)}.modal-header{display:flex;display:-webkit-flex;flex-shrink:0;-webkit-flex-shrink:0;align-items:center;-webkit-align-items:center;justify-content:space-between;-webkit-justify-content:space-between;padding:var(--bs-modal-header-padding);border-bottom:var(--bs-modal-header-border-width) solid var(--bs-modal-header-border-color);border-top-left-radius:var(--bs-modal-inner-border-radius);border-top-right-radius:var(--bs-modal-inner-border-radius)}.modal-header .btn-close{padding:calc(var(--bs-modal-header-padding-y)*.5) calc(var(--bs-modal-header-padding-x)*.5);margin:calc(-0.5*var(--bs-modal-header-padding-y)) calc(-0.5*var(--bs-modal-header-padding-x)) calc(-0.5*var(--bs-modal-header-padding-y)) auto}.modal-title{margin-bottom:0;line-height:var(--bs-modal-title-line-height)}.modal-body{position:relative;flex:1 1 auto;-webkit-flex:1 1 auto;padding:var(--bs-modal-padding)}.modal-footer{display:flex;display:-webkit-flex;flex-shrink:0;-webkit-flex-shrink:0;flex-wrap:wrap;-webkit-flex-wrap:wrap;align-items:center;-webkit-align-items:center;justify-content:flex-end;-webkit-justify-content:flex-end;padding:calc(var(--bs-modal-padding) - var(--bs-modal-footer-gap)*.5);background-color:var(--bs-modal-footer-bg);border-top:var(--bs-modal-footer-border-width) solid var(--bs-modal-footer-border-color);border-bottom-right-radius:var(--bs-modal-inner-border-radius);border-bottom-left-radius:var(--bs-modal-inner-border-radius)}.modal-footer>*{margin:calc(var(--bs-modal-footer-gap)*.5)}@media(min-width: 576px){.modal{--bs-modal-margin: 1.75rem;--bs-modal-box-shadow: 0 0.5rem 1rem rgba(0, 0, 0, 0.15)}.modal-dialog{max-width:var(--bs-modal-width);margin-right:auto;margin-left:auto}.modal-sm{--bs-modal-width: 300px}}@media(min-width: 992px){.modal-lg,.modal-xl{--bs-modal-width: 800px}}@media(min-width: 1200px){.modal-xl{--bs-modal-width: 1140px}}.modal-fullscreen{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen .modal-header,.modal-fullscreen .modal-footer{border-radius:0}.modal-fullscreen .modal-body{overflow-y:auto}@media(max-width: 575.98px){.modal-fullscreen-sm-down{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen-sm-down .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen-sm-down .modal-header,.modal-fullscreen-sm-down .modal-footer{border-radius:0}.modal-fullscreen-sm-down .modal-body{overflow-y:auto}}@media(max-width: 767.98px){.modal-fullscreen-md-down{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen-md-down .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen-md-down .modal-header,.modal-fullscreen-md-down .modal-footer{border-radius:0}.modal-fullscreen-md-down .modal-body{overflow-y:auto}}@media(max-width: 991.98px){.modal-fullscreen-lg-down{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen-lg-down .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen-lg-down .modal-header,.modal-fullscreen-lg-down .modal-footer{border-radius:0}.modal-fullscreen-lg-down .modal-body{overflow-y:auto}}@media(max-width: 1199.98px){.modal-fullscreen-xl-down{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen-xl-down .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen-xl-down .modal-header,.modal-fullscreen-xl-down .modal-footer{border-radius:0}.modal-fullscreen-xl-down .modal-body{overflow-y:auto}}@media(max-width: 1399.98px){.modal-fullscreen-xxl-down{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen-xxl-down .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen-xxl-down .modal-header,.modal-fullscreen-xxl-down .modal-footer{border-radius:0}.modal-fullscreen-xxl-down .modal-body{overflow-y:auto}}.tooltip{--bs-tooltip-zindex: 1080;--bs-tooltip-max-width: 200px;--bs-tooltip-padding-x: 0.5rem;--bs-tooltip-padding-y: 0.25rem;--bs-tooltip-margin: ;--bs-tooltip-font-size:0.875rem;--bs-tooltip-color: #ffffff;--bs-tooltip-bg: #000;--bs-tooltip-border-radius: 0.375rem;--bs-tooltip-opacity: 0.9;--bs-tooltip-arrow-width: 0.8rem;--bs-tooltip-arrow-height: 0.4rem;z-index:var(--bs-tooltip-zindex);display:block;margin:var(--bs-tooltip-margin);font-family:system-ui,-apple-system,"Segoe UI",Roboto,"Helvetica Neue","Noto Sans","Liberation Sans",Arial,sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol","Noto Color Emoji";font-style:normal;font-weight:400;line-height:1.5;text-align:left;text-align:start;text-decoration:none;text-shadow:none;text-transform:none;letter-spacing:normal;word-break:normal;white-space:normal;word-spacing:normal;line-break:auto;font-size:var(--bs-tooltip-font-size);word-wrap:break-word;opacity:0}.tooltip.show{opacity:var(--bs-tooltip-opacity)}.tooltip .tooltip-arrow{display:block;width:var(--bs-tooltip-arrow-width);height:var(--bs-tooltip-arrow-height)}.tooltip .tooltip-arrow::before{position:absolute;content:"";border-color:rgba(0,0,0,0);border-style:solid}.bs-tooltip-top .tooltip-arrow,.bs-tooltip-auto[data-popper-placement^=top] .tooltip-arrow{bottom:calc(-1*var(--bs-tooltip-arrow-height))}.bs-tooltip-top .tooltip-arrow::before,.bs-tooltip-auto[data-popper-placement^=top] .tooltip-arrow::before{top:-1px;border-width:var(--bs-tooltip-arrow-height) calc(var(--bs-tooltip-arrow-width)*.5) 0;border-top-color:var(--bs-tooltip-bg)}.bs-tooltip-end .tooltip-arrow,.bs-tooltip-auto[data-popper-placement^=right] .tooltip-arrow{left:calc(-1*var(--bs-tooltip-arrow-height));width:var(--bs-tooltip-arrow-height);height:var(--bs-tooltip-arrow-width)}.bs-tooltip-end .tooltip-arrow::before,.bs-tooltip-auto[data-popper-placement^=right] .tooltip-arrow::before{right:-1px;border-width:calc(var(--bs-tooltip-arrow-width)*.5) var(--bs-tooltip-arrow-height) calc(var(--bs-tooltip-arrow-width)*.5) 0;border-right-color:var(--bs-tooltip-bg)}.bs-tooltip-bottom .tooltip-arrow,.bs-tooltip-auto[data-popper-placement^=bottom] .tooltip-arrow{top:calc(-1*var(--bs-tooltip-arrow-height))}.bs-tooltip-bottom .tooltip-arrow::before,.bs-tooltip-auto[data-popper-placement^=bottom] .tooltip-arrow::before{bottom:-1px;border-width:0 calc(var(--bs-tooltip-arrow-width)*.5) var(--bs-tooltip-arrow-height);border-bottom-color:var(--bs-tooltip-bg)}.bs-tooltip-start .tooltip-arrow,.bs-tooltip-auto[data-popper-placement^=left] .tooltip-arrow{right:calc(-1*var(--bs-tooltip-arrow-height));width:var(--bs-tooltip-arrow-height);height:var(--bs-tooltip-arrow-width)}.bs-tooltip-start .tooltip-arrow::before,.bs-tooltip-auto[data-popper-placement^=left] .tooltip-arrow::before{left:-1px;border-width:calc(var(--bs-tooltip-arrow-width)*.5) 0 calc(var(--bs-tooltip-arrow-width)*.5) var(--bs-tooltip-arrow-height);border-left-color:var(--bs-tooltip-bg)}.tooltip-inner{max-width:var(--bs-tooltip-max-width);padding:var(--bs-tooltip-padding-y) var(--bs-tooltip-padding-x);color:var(--bs-tooltip-color);text-align:center;background-color:var(--bs-tooltip-bg);border-radius:var(--bs-tooltip-border-radius)}.popover{--bs-popover-zindex: 1070;--bs-popover-max-width: 276px;--bs-popover-font-size:0.875rem;--bs-popover-bg: #ffffff;--bs-popover-border-width: 1px;--bs-popover-border-color: rgba(0, 0, 0, 0.175);--bs-popover-border-radius: 0.5rem;--bs-popover-inner-border-radius: calc(0.5rem - 1px);--bs-popover-box-shadow: 0 0.5rem 1rem rgba(0, 0, 0, 0.15);--bs-popover-header-padding-x: 1rem;--bs-popover-header-padding-y: 0.5rem;--bs-popover-header-font-size:1rem;--bs-popover-header-color: inherit;--bs-popover-header-bg: #e9ecef;--bs-popover-body-padding-x: 1rem;--bs-popover-body-padding-y: 1rem;--bs-popover-body-color: #212529;--bs-popover-arrow-width: 1rem;--bs-popover-arrow-height: 0.5rem;--bs-popover-arrow-border: var(--bs-popover-border-color);z-index:var(--bs-popover-zindex);display:block;max-width:var(--bs-popover-max-width);font-family:system-ui,-apple-system,"Segoe UI",Roboto,"Helvetica Neue","Noto Sans","Liberation Sans",Arial,sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol","Noto Color Emoji";font-style:normal;font-weight:400;line-height:1.5;text-align:left;text-align:start;text-decoration:none;text-shadow:none;text-transform:none;letter-spacing:normal;word-break:normal;white-space:normal;word-spacing:normal;line-break:auto;font-size:var(--bs-popover-font-size);word-wrap:break-word;background-color:var(--bs-popover-bg);background-clip:padding-box;border:var(--bs-popover-border-width) solid var(--bs-popover-border-color);border-radius:var(--bs-popover-border-radius)}.popover .popover-arrow{display:block;width:var(--bs-popover-arrow-width);height:var(--bs-popover-arrow-height)}.popover .popover-arrow::before,.popover .popover-arrow::after{position:absolute;display:block;content:"";border-color:rgba(0,0,0,0);border-style:solid;border-width:0}.bs-popover-top>.popover-arrow,.bs-popover-auto[data-popper-placement^=top]>.popover-arrow{bottom:calc(-1*(var(--bs-popover-arrow-height)) - var(--bs-popover-border-width))}.bs-popover-top>.popover-arrow::before,.bs-popover-auto[data-popper-placement^=top]>.popover-arrow::before,.bs-popover-top>.popover-arrow::after,.bs-popover-auto[data-popper-placement^=top]>.popover-arrow::after{border-width:var(--bs-popover-arrow-height) calc(var(--bs-popover-arrow-width)*.5) 0}.bs-popover-top>.popover-arrow::before,.bs-popover-auto[data-popper-placement^=top]>.popover-arrow::before{bottom:0;border-top-color:var(--bs-popover-arrow-border)}.bs-popover-top>.popover-arrow::after,.bs-popover-auto[data-popper-placement^=top]>.popover-arrow::after{bottom:var(--bs-popover-border-width);border-top-color:var(--bs-popover-bg)}.bs-popover-end>.popover-arrow,.bs-popover-auto[data-popper-placement^=right]>.popover-arrow{left:calc(-1*(var(--bs-popover-arrow-height)) - var(--bs-popover-border-width));width:var(--bs-popover-arrow-height);height:var(--bs-popover-arrow-width)}.bs-popover-end>.popover-arrow::before,.bs-popover-auto[data-popper-placement^=right]>.popover-arrow::before,.bs-popover-end>.popover-arrow::after,.bs-popover-auto[data-popper-placement^=right]>.popover-arrow::after{border-width:calc(var(--bs-popover-arrow-width)*.5) var(--bs-popover-arrow-height) calc(var(--bs-popover-arrow-width)*.5) 0}.bs-popover-end>.popover-arrow::before,.bs-popover-auto[data-popper-placement^=right]>.popover-arrow::before{left:0;border-right-color:var(--bs-popover-arrow-border)}.bs-popover-end>.popover-arrow::after,.bs-popover-auto[data-popper-placement^=right]>.popover-arrow::after{left:var(--bs-popover-border-width);border-right-color:var(--bs-popover-bg)}.bs-popover-bottom>.popover-arrow,.bs-popover-auto[data-popper-placement^=bottom]>.popover-arrow{top:calc(-1*(var(--bs-popover-arrow-height)) - var(--bs-popover-border-width))}.bs-popover-bottom>.popover-arrow::before,.bs-popover-auto[data-popper-placement^=bottom]>.popover-arrow::before,.bs-popover-bottom>.popover-arrow::after,.bs-popover-auto[data-popper-placement^=bottom]>.popover-arrow::after{border-width:0 calc(var(--bs-popover-arrow-width)*.5) var(--bs-popover-arrow-height)}.bs-popover-bottom>.popover-arrow::before,.bs-popover-auto[data-popper-placement^=bottom]>.popover-arrow::before{top:0;border-bottom-color:var(--bs-popover-arrow-border)}.bs-popover-bottom>.popover-arrow::after,.bs-popover-auto[data-popper-placement^=bottom]>.popover-arrow::after{top:var(--bs-popover-border-width);border-bottom-color:var(--bs-popover-bg)}.bs-popover-bottom .popover-header::before,.bs-popover-auto[data-popper-placement^=bottom] .popover-header::before{position:absolute;top:0;left:50%;display:block;width:var(--bs-popover-arrow-width);margin-left:calc(-0.5*var(--bs-popover-arrow-width));content:"";border-bottom:var(--bs-popover-border-width) solid var(--bs-popover-header-bg)}.bs-popover-start>.popover-arrow,.bs-popover-auto[data-popper-placement^=left]>.popover-arrow{right:calc(-1*(var(--bs-popover-arrow-height)) - var(--bs-popover-border-width));width:var(--bs-popover-arrow-height);height:var(--bs-popover-arrow-width)}.bs-popover-start>.popover-arrow::before,.bs-popover-auto[data-popper-placement^=left]>.popover-arrow::before,.bs-popover-start>.popover-arrow::after,.bs-popover-auto[data-popper-placement^=left]>.popover-arrow::after{border-width:calc(var(--bs-popover-arrow-width)*.5) 0 calc(var(--bs-popover-arrow-width)*.5) var(--bs-popover-arrow-height)}.bs-popover-start>.popover-arrow::before,.bs-popover-auto[data-popper-placement^=left]>.popover-arrow::before{right:0;border-left-color:var(--bs-popover-arrow-border)}.bs-popover-start>.popover-arrow::after,.bs-popover-auto[data-popper-placement^=left]>.popover-arrow::after{right:var(--bs-popover-border-width);border-left-color:var(--bs-popover-bg)}.popover-header{padding:var(--bs-popover-header-padding-y) var(--bs-popover-header-padding-x);margin-bottom:0;font-size:var(--bs-popover-header-font-size);color:var(--bs-popover-header-color);background-color:var(--bs-popover-header-bg);border-bottom:var(--bs-popover-border-width) solid var(--bs-popover-border-color);border-top-left-radius:var(--bs-popover-inner-border-radius);border-top-right-radius:var(--bs-popover-inner-border-radius)}.popover-header:empty{display:none}.popover-body{padding:var(--bs-popover-body-padding-y) var(--bs-popover-body-padding-x);color:var(--bs-popover-body-color)}.carousel{position:relative}.carousel.pointer-event{touch-action:pan-y;-webkit-touch-action:pan-y;-moz-touch-action:pan-y;-ms-touch-action:pan-y;-o-touch-action:pan-y}.carousel-inner{position:relative;width:100%;overflow:hidden}.carousel-inner::after{display:block;clear:both;content:""}.carousel-item{position:relative;display:none;float:left;width:100%;margin-right:-100%;backface-visibility:hidden;-webkit-backface-visibility:hidden;-moz-backface-visibility:hidden;-ms-backface-visibility:hidden;-o-backface-visibility:hidden;transition:transform .6s ease-in-out}@media(prefers-reduced-motion: reduce){.carousel-item{transition:none}}.carousel-item.active,.carousel-item-next,.carousel-item-prev{display:block}.carousel-item-next:not(.carousel-item-start),.active.carousel-item-end{transform:translateX(100%)}.carousel-item-prev:not(.carousel-item-end),.active.carousel-item-start{transform:translateX(-100%)}.carousel-fade .carousel-item{opacity:0;transition-property:opacity;transform:none}.carousel-fade .carousel-item.active,.carousel-fade .carousel-item-next.carousel-item-start,.carousel-fade .carousel-item-prev.carousel-item-end{z-index:1;opacity:1}.carousel-fade .active.carousel-item-start,.carousel-fade .active.carousel-item-end{z-index:0;opacity:0;transition:opacity 0s .6s}@media(prefers-reduced-motion: reduce){.carousel-fade .active.carousel-item-start,.carousel-fade .active.carousel-item-end{transition:none}}.carousel-control-prev,.carousel-control-next{position:absolute;top:0;bottom:0;z-index:1;display:flex;display:-webkit-flex;align-items:center;-webkit-align-items:center;justify-content:center;-webkit-justify-content:center;width:15%;padding:0;color:#fff;text-align:center;background:none;border:0;opacity:.5;transition:opacity .15s ease}@media(prefers-reduced-motion: reduce){.carousel-control-prev,.carousel-control-next{transition:none}}.carousel-control-prev:hover,.carousel-control-prev:focus,.carousel-control-next:hover,.carousel-control-next:focus{color:#fff;text-decoration:none;outline:0;opacity:.9}.carousel-control-prev{left:0}.carousel-control-next{right:0}.carousel-control-prev-icon,.carousel-control-next-icon{display:inline-block;width:2rem;height:2rem;background-repeat:no-repeat;background-position:50%;background-size:100% 100%}.carousel-control-prev-icon{background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23ffffff'%3e%3cpath d='M11.354 1.646a.5.5 0 0 1 0 .708L5.707 8l5.647 5.646a.5.5 0 0 1-.708.708l-6-6a.5.5 0 0 1 0-.708l6-6a.5.5 0 0 1 .708 0z'/%3e%3c/svg%3e")}.carousel-control-next-icon{background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23ffffff'%3e%3cpath d='M4.646 1.646a.5.5 0 0 1 .708 0l6 6a.5.5 0 0 1 0 .708l-6 6a.5.5 0 0 1-.708-.708L10.293 8 4.646 2.354a.5.5 0 0 1 0-.708z'/%3e%3c/svg%3e")}.carousel-indicators{position:absolute;right:0;bottom:0;left:0;z-index:2;display:flex;display:-webkit-flex;justify-content:center;-webkit-justify-content:center;padding:0;margin-right:15%;margin-bottom:1rem;margin-left:15%}.carousel-indicators [data-bs-target]{box-sizing:content-box;flex:0 1 auto;-webkit-flex:0 1 auto;width:30px;height:3px;padding:0;margin-right:3px;margin-left:3px;text-indent:-999px;cursor:pointer;background-color:#fff;background-clip:padding-box;border:0;border-top:10px solid rgba(0,0,0,0);border-bottom:10px solid rgba(0,0,0,0);opacity:.5;transition:opacity .6s ease}@media(prefers-reduced-motion: reduce){.carousel-indicators [data-bs-target]{transition:none}}.carousel-indicators .active{opacity:1}.carousel-caption{position:absolute;right:15%;bottom:1.25rem;left:15%;padding-top:1.25rem;padding-bottom:1.25rem;color:#fff;text-align:center}.carousel-dark .carousel-control-prev-icon,.carousel-dark .carousel-control-next-icon{filter:invert(1) grayscale(100)}.carousel-dark .carousel-indicators [data-bs-target]{background-color:#000}.carousel-dark .carousel-caption{color:#000}[data-bs-theme=dark] .carousel .carousel-control-prev-icon,[data-bs-theme=dark] .carousel .carousel-control-next-icon,[data-bs-theme=dark].carousel .carousel-control-prev-icon,[data-bs-theme=dark].carousel .carousel-control-next-icon{filter:invert(1) grayscale(100)}[data-bs-theme=dark] .carousel .carousel-indicators [data-bs-target],[data-bs-theme=dark].carousel .carousel-indicators [data-bs-target]{background-color:#000}[data-bs-theme=dark] .carousel .carousel-caption,[data-bs-theme=dark].carousel .carousel-caption{color:#000}.spinner-grow,.spinner-border{display:inline-block;width:var(--bs-spinner-width);height:var(--bs-spinner-height);vertical-align:var(--bs-spinner-vertical-align);border-radius:50%;animation:var(--bs-spinner-animation-speed) linear infinite var(--bs-spinner-animation-name)}@keyframes spinner-border{to{transform:rotate(360deg) /* rtl:ignore */}}.spinner-border{--bs-spinner-width: 2rem;--bs-spinner-height: 2rem;--bs-spinner-vertical-align: -0.125em;--bs-spinner-border-width: 0.25em;--bs-spinner-animation-speed: 0.75s;--bs-spinner-animation-name: spinner-border;border:var(--bs-spinner-border-width) solid currentcolor;border-right-color:rgba(0,0,0,0)}.spinner-border-sm{--bs-spinner-width: 1rem;--bs-spinner-height: 1rem;--bs-spinner-border-width: 0.2em}@keyframes spinner-grow{0%{transform:scale(0)}50%{opacity:1;transform:none}}.spinner-grow{--bs-spinner-width: 2rem;--bs-spinner-height: 2rem;--bs-spinner-vertical-align: -0.125em;--bs-spinner-animation-speed: 0.75s;--bs-spinner-animation-name: spinner-grow;background-color:currentcolor;opacity:0}.spinner-grow-sm{--bs-spinner-width: 1rem;--bs-spinner-height: 1rem}@media(prefers-reduced-motion: reduce){.spinner-border,.spinner-grow{--bs-spinner-animation-speed: 1.5s}}.offcanvas,.offcanvas-xxl,.offcanvas-xl,.offcanvas-lg,.offcanvas-md,.offcanvas-sm{--bs-offcanvas-zindex: 1045;--bs-offcanvas-width: 400px;--bs-offcanvas-height: 30vh;--bs-offcanvas-padding-x: 1rem;--bs-offcanvas-padding-y: 1rem;--bs-offcanvas-color: #212529;--bs-offcanvas-bg: #ffffff;--bs-offcanvas-border-width: 1px;--bs-offcanvas-border-color: rgba(0, 0, 0, 0.175);--bs-offcanvas-box-shadow: 0 0.125rem 0.25rem rgba(0, 0, 0, 0.075);--bs-offcanvas-transition: transform 0.3s ease-in-out;--bs-offcanvas-title-line-height: 1.5}@media(max-width: 575.98px){.offcanvas-sm{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;display:-webkit-flex;flex-direction:column;-webkit-flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:var(--bs-offcanvas-transition)}}@media(max-width: 575.98px)and (prefers-reduced-motion: reduce){.offcanvas-sm{transition:none}}@media(max-width: 575.98px){.offcanvas-sm.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}.offcanvas-sm.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}.offcanvas-sm.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}.offcanvas-sm.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}.offcanvas-sm.showing,.offcanvas-sm.show:not(.hiding){transform:none}.offcanvas-sm.showing,.offcanvas-sm.hiding,.offcanvas-sm.show{visibility:visible}}@media(min-width: 576px){.offcanvas-sm{--bs-offcanvas-height: auto;--bs-offcanvas-border-width: 0;background-color:rgba(0,0,0,0) !important}.offcanvas-sm .offcanvas-header{display:none}.offcanvas-sm .offcanvas-body{display:flex;display:-webkit-flex;flex-grow:0;-webkit-flex-grow:0;padding:0;overflow-y:visible;background-color:rgba(0,0,0,0) !important}}@media(max-width: 767.98px){.offcanvas-md{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;display:-webkit-flex;flex-direction:column;-webkit-flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:var(--bs-offcanvas-transition)}}@media(max-width: 767.98px)and (prefers-reduced-motion: reduce){.offcanvas-md{transition:none}}@media(max-width: 767.98px){.offcanvas-md.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}.offcanvas-md.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}.offcanvas-md.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}.offcanvas-md.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}.offcanvas-md.showing,.offcanvas-md.show:not(.hiding){transform:none}.offcanvas-md.showing,.offcanvas-md.hiding,.offcanvas-md.show{visibility:visible}}@media(min-width: 768px){.offcanvas-md{--bs-offcanvas-height: auto;--bs-offcanvas-border-width: 0;background-color:rgba(0,0,0,0) !important}.offcanvas-md .offcanvas-header{display:none}.offcanvas-md .offcanvas-body{display:flex;display:-webkit-flex;flex-grow:0;-webkit-flex-grow:0;padding:0;overflow-y:visible;background-color:rgba(0,0,0,0) !important}}@media(max-width: 991.98px){.offcanvas-lg{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;display:-webkit-flex;flex-direction:column;-webkit-flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:var(--bs-offcanvas-transition)}}@media(max-width: 991.98px)and (prefers-reduced-motion: reduce){.offcanvas-lg{transition:none}}@media(max-width: 991.98px){.offcanvas-lg.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}.offcanvas-lg.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}.offcanvas-lg.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}.offcanvas-lg.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}.offcanvas-lg.showing,.offcanvas-lg.show:not(.hiding){transform:none}.offcanvas-lg.showing,.offcanvas-lg.hiding,.offcanvas-lg.show{visibility:visible}}@media(min-width: 992px){.offcanvas-lg{--bs-offcanvas-height: auto;--bs-offcanvas-border-width: 0;background-color:rgba(0,0,0,0) !important}.offcanvas-lg .offcanvas-header{display:none}.offcanvas-lg .offcanvas-body{display:flex;display:-webkit-flex;flex-grow:0;-webkit-flex-grow:0;padding:0;overflow-y:visible;background-color:rgba(0,0,0,0) !important}}@media(max-width: 1199.98px){.offcanvas-xl{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;display:-webkit-flex;flex-direction:column;-webkit-flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:var(--bs-offcanvas-transition)}}@media(max-width: 1199.98px)and (prefers-reduced-motion: reduce){.offcanvas-xl{transition:none}}@media(max-width: 1199.98px){.offcanvas-xl.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}.offcanvas-xl.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}.offcanvas-xl.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}.offcanvas-xl.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}.offcanvas-xl.showing,.offcanvas-xl.show:not(.hiding){transform:none}.offcanvas-xl.showing,.offcanvas-xl.hiding,.offcanvas-xl.show{visibility:visible}}@media(min-width: 1200px){.offcanvas-xl{--bs-offcanvas-height: auto;--bs-offcanvas-border-width: 0;background-color:rgba(0,0,0,0) !important}.offcanvas-xl .offcanvas-header{display:none}.offcanvas-xl .offcanvas-body{display:flex;display:-webkit-flex;flex-grow:0;-webkit-flex-grow:0;padding:0;overflow-y:visible;background-color:rgba(0,0,0,0) !important}}@media(max-width: 1399.98px){.offcanvas-xxl{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;display:-webkit-flex;flex-direction:column;-webkit-flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:var(--bs-offcanvas-transition)}}@media(max-width: 1399.98px)and (prefers-reduced-motion: reduce){.offcanvas-xxl{transition:none}}@media(max-width: 1399.98px){.offcanvas-xxl.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}.offcanvas-xxl.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}.offcanvas-xxl.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}.offcanvas-xxl.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}.offcanvas-xxl.showing,.offcanvas-xxl.show:not(.hiding){transform:none}.offcanvas-xxl.showing,.offcanvas-xxl.hiding,.offcanvas-xxl.show{visibility:visible}}@media(min-width: 1400px){.offcanvas-xxl{--bs-offcanvas-height: auto;--bs-offcanvas-border-width: 0;background-color:rgba(0,0,0,0) !important}.offcanvas-xxl .offcanvas-header{display:none}.offcanvas-xxl .offcanvas-body{display:flex;display:-webkit-flex;flex-grow:0;-webkit-flex-grow:0;padding:0;overflow-y:visible;background-color:rgba(0,0,0,0) !important}}.offcanvas{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;display:-webkit-flex;flex-direction:column;-webkit-flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:var(--bs-offcanvas-transition)}@media(prefers-reduced-motion: reduce){.offcanvas{transition:none}}.offcanvas.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}.offcanvas.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}.offcanvas.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}.offcanvas.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}.offcanvas.showing,.offcanvas.show:not(.hiding){transform:none}.offcanvas.showing,.offcanvas.hiding,.offcanvas.show{visibility:visible}.offcanvas-backdrop{position:fixed;top:0;left:0;z-index:1040;width:100vw;height:100vh;background-color:#000}.offcanvas-backdrop.fade{opacity:0}.offcanvas-backdrop.show{opacity:.5}.offcanvas-header{display:flex;display:-webkit-flex;align-items:center;-webkit-align-items:center;justify-content:space-between;-webkit-justify-content:space-between;padding:var(--bs-offcanvas-padding-y) var(--bs-offcanvas-padding-x)}.offcanvas-header .btn-close{padding:calc(var(--bs-offcanvas-padding-y)*.5) calc(var(--bs-offcanvas-padding-x)*.5);margin-top:calc(-0.5*var(--bs-offcanvas-padding-y));margin-right:calc(-0.5*var(--bs-offcanvas-padding-x));margin-bottom:calc(-0.5*var(--bs-offcanvas-padding-y))}.offcanvas-title{margin-bottom:0;line-height:var(--bs-offcanvas-title-line-height)}.offcanvas-body{flex-grow:1;-webkit-flex-grow:1;padding:var(--bs-offcanvas-padding-y) var(--bs-offcanvas-padding-x);overflow-y:auto}.placeholder{display:inline-block;min-height:1em;vertical-align:middle;cursor:wait;background-color:currentcolor;opacity:.5}.placeholder.btn::before{display:inline-block;content:""}.placeholder-xs{min-height:.6em}.placeholder-sm{min-height:.8em}.placeholder-lg{min-height:1.2em}.placeholder-glow .placeholder{animation:placeholder-glow 2s ease-in-out infinite}@keyframes placeholder-glow{50%{opacity:.2}}.placeholder-wave{mask-image:linear-gradient(130deg, #000 55%, rgba(0, 0, 0, 0.8) 75%, #000 95%);-webkit-mask-image:linear-gradient(130deg, #000 55%, rgba(0, 0, 0, 0.8) 75%, #000 95%);mask-size:200% 100%;-webkit-mask-size:200% 100%;animation:placeholder-wave 2s linear infinite}@keyframes placeholder-wave{100%{mask-position:-200% 0%;-webkit-mask-position:-200% 0%}}.clearfix::after{display:block;clear:both;content:""}.text-bg-default{color:#000 !important;background-color:RGBA(var(--bs-default-rgb), var(--bs-bg-opacity, 1)) !important}.text-bg-primary{color:#fff !important;background-color:RGBA(var(--bs-primary-rgb), var(--bs-bg-opacity, 1)) !important}.text-bg-secondary{color:#fff !important;background-color:RGBA(var(--bs-secondary-rgb), var(--bs-bg-opacity, 1)) !important}.text-bg-success{color:#fff !important;background-color:RGBA(var(--bs-success-rgb), var(--bs-bg-opacity, 1)) !important}.text-bg-info{color:#000 !important;background-color:RGBA(var(--bs-info-rgb), var(--bs-bg-opacity, 1)) !important}.text-bg-warning{color:#000 !important;background-color:RGBA(var(--bs-warning-rgb), var(--bs-bg-opacity, 1)) !important}.text-bg-danger{color:#fff !important;background-color:RGBA(var(--bs-danger-rgb), var(--bs-bg-opacity, 1)) !important}.text-bg-light{color:#000 !important;background-color:RGBA(var(--bs-light-rgb), var(--bs-bg-opacity, 1)) !important}.text-bg-dark{color:#fff !important;background-color:RGBA(var(--bs-dark-rgb), var(--bs-bg-opacity, 1)) !important}.link-default{color:RGBA(var(--bs-default-rgb), var(--bs-link-opacity, 1)) !important;text-decoration-color:RGBA(var(--bs-default-rgb), var(--bs-link-underline-opacity, 1)) !important}.link-default:hover,.link-default:focus{color:RGBA(229, 232, 235, var(--bs-link-opacity, 1)) !important;text-decoration-color:RGBA(229, 232, 235, var(--bs-link-underline-opacity, 1)) !important}.link-primary{color:RGBA(var(--bs-primary-rgb), var(--bs-link-opacity, 1)) !important;text-decoration-color:RGBA(var(--bs-primary-rgb), var(--bs-link-underline-opacity, 1)) !important}.link-primary:hover,.link-primary:focus{color:RGBA(10, 88, 202, var(--bs-link-opacity, 1)) !important;text-decoration-color:RGBA(10, 88, 202, var(--bs-link-underline-opacity, 1)) !important}.link-secondary{color:RGBA(var(--bs-secondary-rgb), var(--bs-link-opacity, 1)) !important;text-decoration-color:RGBA(var(--bs-secondary-rgb), var(--bs-link-underline-opacity, 1)) !important}.link-secondary:hover,.link-secondary:focus{color:RGBA(86, 94, 100, var(--bs-link-opacity, 1)) !important;text-decoration-color:RGBA(86, 94, 100, var(--bs-link-underline-opacity, 1)) !important}.link-success{color:RGBA(var(--bs-success-rgb), var(--bs-link-opacity, 1)) !important;text-decoration-color:RGBA(var(--bs-success-rgb), var(--bs-link-underline-opacity, 1)) !important}.link-success:hover,.link-success:focus{color:RGBA(20, 108, 67, var(--bs-link-opacity, 1)) !important;text-decoration-color:RGBA(20, 108, 67, var(--bs-link-underline-opacity, 1)) !important}.link-info{color:RGBA(var(--bs-info-rgb), var(--bs-link-opacity, 1)) !important;text-decoration-color:RGBA(var(--bs-info-rgb), var(--bs-link-underline-opacity, 1)) !important}.link-info:hover,.link-info:focus{color:RGBA(61, 213, 243, var(--bs-link-opacity, 1)) !important;text-decoration-color:RGBA(61, 213, 243, var(--bs-link-underline-opacity, 1)) !important}.link-warning{color:RGBA(var(--bs-warning-rgb), var(--bs-link-opacity, 1)) !important;text-decoration-color:RGBA(var(--bs-warning-rgb), var(--bs-link-underline-opacity, 1)) !important}.link-warning:hover,.link-warning:focus{color:RGBA(255, 205, 57, var(--bs-link-opacity, 1)) !important;text-decoration-color:RGBA(255, 205, 57, var(--bs-link-underline-opacity, 1)) !important}.link-danger{color:RGBA(var(--bs-danger-rgb), var(--bs-link-opacity, 1)) !important;text-decoration-color:RGBA(var(--bs-danger-rgb), var(--bs-link-underline-opacity, 1)) !important}.link-danger:hover,.link-danger:focus{color:RGBA(176, 42, 55, var(--bs-link-opacity, 1)) !important;text-decoration-color:RGBA(176, 42, 55, var(--bs-link-underline-opacity, 1)) !important}.link-light{color:RGBA(var(--bs-light-rgb), var(--bs-link-opacity, 1)) !important;text-decoration-color:RGBA(var(--bs-light-rgb), var(--bs-link-underline-opacity, 1)) !important}.link-light:hover,.link-light:focus{color:RGBA(249, 250, 251, var(--bs-link-opacity, 1)) !important;text-decoration-color:RGBA(249, 250, 251, var(--bs-link-underline-opacity, 1)) !important}.link-dark{color:RGBA(var(--bs-dark-rgb), var(--bs-link-opacity, 1)) !important;text-decoration-color:RGBA(var(--bs-dark-rgb), var(--bs-link-underline-opacity, 1)) !important}.link-dark:hover,.link-dark:focus{color:RGBA(26, 30, 33, var(--bs-link-opacity, 1)) !important;text-decoration-color:RGBA(26, 30, 33, var(--bs-link-underline-opacity, 1)) !important}.link-body-emphasis{color:RGBA(var(--bs-emphasis-color-rgb), var(--bs-link-opacity, 1)) !important;text-decoration-color:RGBA(var(--bs-emphasis-color-rgb), var(--bs-link-underline-opacity, 1)) !important}.link-body-emphasis:hover,.link-body-emphasis:focus{color:RGBA(var(--bs-emphasis-color-rgb), var(--bs-link-opacity, 0.75)) !important;text-decoration-color:RGBA(var(--bs-emphasis-color-rgb), var(--bs-link-underline-opacity, 0.75)) !important}.focus-ring:focus{outline:0;box-shadow:var(--bs-focus-ring-x, 0) var(--bs-focus-ring-y, 0) var(--bs-focus-ring-blur, 0) var(--bs-focus-ring-width) var(--bs-focus-ring-color)}.icon-link{display:inline-flex;gap:.375rem;align-items:center;-webkit-align-items:center;text-decoration-color:rgba(var(--bs-link-color-rgb), var(--bs-link-opacity, 0.5));text-underline-offset:.25em;backface-visibility:hidden;-webkit-backface-visibility:hidden;-moz-backface-visibility:hidden;-ms-backface-visibility:hidden;-o-backface-visibility:hidden}.icon-link>.bi{flex-shrink:0;-webkit-flex-shrink:0;width:1em;height:1em;fill:currentcolor;transition:.2s ease-in-out transform}@media(prefers-reduced-motion: reduce){.icon-link>.bi{transition:none}}.icon-link-hover:hover>.bi,.icon-link-hover:focus-visible>.bi{transform:var(--bs-icon-link-transform, translate3d(0.25em, 0, 0))}.ratio{position:relative;width:100%}.ratio::before{display:block;padding-top:var(--bs-aspect-ratio);content:""}.ratio>*{position:absolute;top:0;left:0;width:100%;height:100%}.ratio-1x1{--bs-aspect-ratio: 100%}.ratio-4x3{--bs-aspect-ratio: 75%}.ratio-16x9{--bs-aspect-ratio: 56.25%}.ratio-21x9{--bs-aspect-ratio: 42.8571428571%}.fixed-top{position:fixed;top:0;right:0;left:0;z-index:1030}.fixed-bottom{position:fixed;right:0;bottom:0;left:0;z-index:1030}.sticky-top{position:sticky;top:0;z-index:1020}.sticky-bottom{position:sticky;bottom:0;z-index:1020}@media(min-width: 576px){.sticky-sm-top{position:sticky;top:0;z-index:1020}.sticky-sm-bottom{position:sticky;bottom:0;z-index:1020}}@media(min-width: 768px){.sticky-md-top{position:sticky;top:0;z-index:1020}.sticky-md-bottom{position:sticky;bottom:0;z-index:1020}}@media(min-width: 992px){.sticky-lg-top{position:sticky;top:0;z-index:1020}.sticky-lg-bottom{position:sticky;bottom:0;z-index:1020}}@media(min-width: 1200px){.sticky-xl-top{position:sticky;top:0;z-index:1020}.sticky-xl-bottom{position:sticky;bottom:0;z-index:1020}}@media(min-width: 1400px){.sticky-xxl-top{position:sticky;top:0;z-index:1020}.sticky-xxl-bottom{position:sticky;bottom:0;z-index:1020}}.hstack{display:flex;display:-webkit-flex;flex-direction:row;-webkit-flex-direction:row;align-items:center;-webkit-align-items:center;align-self:stretch;-webkit-align-self:stretch}.vstack{display:flex;display:-webkit-flex;flex:1 1 auto;-webkit-flex:1 1 auto;flex-direction:column;-webkit-flex-direction:column;align-self:stretch;-webkit-align-self:stretch}.visually-hidden,.visually-hidden-focusable:not(:focus):not(:focus-within){width:1px !important;height:1px !important;padding:0 !important;margin:-1px !important;overflow:hidden !important;clip:rect(0, 0, 0, 0) !important;white-space:nowrap !important;border:0 !important}.visually-hidden:not(caption),.visually-hidden-focusable:not(:focus):not(:focus-within):not(caption){position:absolute !important}.stretched-link::after{position:absolute;top:0;right:0;bottom:0;left:0;z-index:1;content:""}.text-truncate{overflow:hidden;text-overflow:ellipsis;white-space:nowrap}.vr{display:inline-block;align-self:stretch;-webkit-align-self:stretch;width:1px;min-height:1em;background-color:currentcolor;opacity:.25}.align-baseline{vertical-align:baseline !important}.align-top{vertical-align:top !important}.align-middle{vertical-align:middle !important}.align-bottom{vertical-align:bottom !important}.align-text-bottom{vertical-align:text-bottom !important}.align-text-top{vertical-align:text-top !important}.float-start{float:left !important}.float-end{float:right !important}.float-none{float:none !important}.object-fit-contain{object-fit:contain !important}.object-fit-cover{object-fit:cover !important}.object-fit-fill{object-fit:fill !important}.object-fit-scale{object-fit:scale-down !important}.object-fit-none{object-fit:none !important}.opacity-0{opacity:0 !important}.opacity-25{opacity:.25 !important}.opacity-50{opacity:.5 !important}.opacity-75{opacity:.75 !important}.opacity-100{opacity:1 !important}.overflow-auto{overflow:auto !important}.overflow-hidden{overflow:hidden !important}.overflow-visible{overflow:visible !important}.overflow-scroll{overflow:scroll !important}.overflow-x-auto{overflow-x:auto !important}.overflow-x-hidden{overflow-x:hidden !important}.overflow-x-visible{overflow-x:visible !important}.overflow-x-scroll{overflow-x:scroll !important}.overflow-y-auto{overflow-y:auto !important}.overflow-y-hidden{overflow-y:hidden !important}.overflow-y-visible{overflow-y:visible !important}.overflow-y-scroll{overflow-y:scroll !important}.d-inline{display:inline !important}.d-inline-block{display:inline-block !important}.d-block{display:block !important}.d-grid{display:grid !important}.d-inline-grid{display:inline-grid !important}.d-table{display:table !important}.d-table-row{display:table-row !important}.d-table-cell{display:table-cell !important}.d-flex{display:flex !important}.d-inline-flex{display:inline-flex !important}.d-none{display:none !important}.shadow{box-shadow:0 .5rem 1rem rgba(0,0,0,.15) !important}.shadow-sm{box-shadow:0 .125rem .25rem rgba(0,0,0,.075) !important}.shadow-lg{box-shadow:0 1rem 3rem rgba(0,0,0,.175) !important}.shadow-none{box-shadow:none !important}.focus-ring-default{--bs-focus-ring-color: rgba(var(--bs-default-rgb), var(--bs-focus-ring-opacity))}.focus-ring-primary{--bs-focus-ring-color: rgba(var(--bs-primary-rgb), var(--bs-focus-ring-opacity))}.focus-ring-secondary{--bs-focus-ring-color: rgba(var(--bs-secondary-rgb), var(--bs-focus-ring-opacity))}.focus-ring-success{--bs-focus-ring-color: rgba(var(--bs-success-rgb), var(--bs-focus-ring-opacity))}.focus-ring-info{--bs-focus-ring-color: rgba(var(--bs-info-rgb), var(--bs-focus-ring-opacity))}.focus-ring-warning{--bs-focus-ring-color: rgba(var(--bs-warning-rgb), var(--bs-focus-ring-opacity))}.focus-ring-danger{--bs-focus-ring-color: rgba(var(--bs-danger-rgb), var(--bs-focus-ring-opacity))}.focus-ring-light{--bs-focus-ring-color: rgba(var(--bs-light-rgb), var(--bs-focus-ring-opacity))}.focus-ring-dark{--bs-focus-ring-color: rgba(var(--bs-dark-rgb), var(--bs-focus-ring-opacity))}.position-static{position:static !important}.position-relative{position:relative !important}.position-absolute{position:absolute !important}.position-fixed{position:fixed !important}.position-sticky{position:sticky !important}.top-0{top:0 !important}.top-50{top:50% !important}.top-100{top:100% !important}.bottom-0{bottom:0 !important}.bottom-50{bottom:50% !important}.bottom-100{bottom:100% !important}.start-0{left:0 !important}.start-50{left:50% !important}.start-100{left:100% !important}.end-0{right:0 !important}.end-50{right:50% !important}.end-100{right:100% !important}.translate-middle{transform:translate(-50%, -50%) !important}.translate-middle-x{transform:translateX(-50%) !important}.translate-middle-y{transform:translateY(-50%) !important}.border{border:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color) !important}.border-0{border:0 !important}.border-top{border-top:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color) !important}.border-top-0{border-top:0 !important}.border-end{border-right:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color) !important}.border-end-0{border-right:0 !important}.border-bottom{border-bottom:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color) !important}.border-bottom-0{border-bottom:0 !important}.border-start{border-left:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color) !important}.border-start-0{border-left:0 !important}.border-default{--bs-border-opacity: 1;border-color:rgba(var(--bs-default-rgb), var(--bs-border-opacity)) !important}.border-primary{--bs-border-opacity: 1;border-color:rgba(var(--bs-primary-rgb), var(--bs-border-opacity)) !important}.border-secondary{--bs-border-opacity: 1;border-color:rgba(var(--bs-secondary-rgb), var(--bs-border-opacity)) !important}.border-success{--bs-border-opacity: 1;border-color:rgba(var(--bs-success-rgb), var(--bs-border-opacity)) !important}.border-info{--bs-border-opacity: 1;border-color:rgba(var(--bs-info-rgb), var(--bs-border-opacity)) !important}.border-warning{--bs-border-opacity: 1;border-color:rgba(var(--bs-warning-rgb), var(--bs-border-opacity)) !important}.border-danger{--bs-border-opacity: 1;border-color:rgba(var(--bs-danger-rgb), var(--bs-border-opacity)) !important}.border-light{--bs-border-opacity: 1;border-color:rgba(var(--bs-light-rgb), var(--bs-border-opacity)) !important}.border-dark{--bs-border-opacity: 1;border-color:rgba(var(--bs-dark-rgb), var(--bs-border-opacity)) !important}.border-black{--bs-border-opacity: 1;border-color:rgba(var(--bs-black-rgb), var(--bs-border-opacity)) !important}.border-white{--bs-border-opacity: 1;border-color:rgba(var(--bs-white-rgb), var(--bs-border-opacity)) !important}.border-primary-subtle{border-color:var(--bs-primary-border-subtle) !important}.border-secondary-subtle{border-color:var(--bs-secondary-border-subtle) !important}.border-success-subtle{border-color:var(--bs-success-border-subtle) !important}.border-info-subtle{border-color:var(--bs-info-border-subtle) !important}.border-warning-subtle{border-color:var(--bs-warning-border-subtle) !important}.border-danger-subtle{border-color:var(--bs-danger-border-subtle) !important}.border-light-subtle{border-color:var(--bs-light-border-subtle) !important}.border-dark-subtle{border-color:var(--bs-dark-border-subtle) !important}.border-1{border-width:1px !important}.border-2{border-width:2px !important}.border-3{border-width:3px !important}.border-4{border-width:4px !important}.border-5{border-width:5px !important}.border-opacity-10{--bs-border-opacity: 0.1}.border-opacity-25{--bs-border-opacity: 0.25}.border-opacity-50{--bs-border-opacity: 0.5}.border-opacity-75{--bs-border-opacity: 0.75}.border-opacity-100{--bs-border-opacity: 1}.w-25{width:25% !important}.w-50{width:50% !important}.w-75{width:75% !important}.w-100{width:100% !important}.w-auto{width:auto !important}.mw-100{max-width:100% !important}.vw-100{width:100vw !important}.min-vw-100{min-width:100vw !important}.h-25{height:25% !important}.h-50{height:50% !important}.h-75{height:75% !important}.h-100{height:100% !important}.h-auto{height:auto !important}.mh-100{max-height:100% !important}.vh-100{height:100vh !important}.min-vh-100{min-height:100vh !important}.flex-fill{flex:1 1 auto !important}.flex-row{flex-direction:row !important}.flex-column{flex-direction:column !important}.flex-row-reverse{flex-direction:row-reverse !important}.flex-column-reverse{flex-direction:column-reverse !important}.flex-grow-0{flex-grow:0 !important}.flex-grow-1{flex-grow:1 !important}.flex-shrink-0{flex-shrink:0 !important}.flex-shrink-1{flex-shrink:1 !important}.flex-wrap{flex-wrap:wrap !important}.flex-nowrap{flex-wrap:nowrap !important}.flex-wrap-reverse{flex-wrap:wrap-reverse !important}.justify-content-start{justify-content:flex-start !important}.justify-content-end{justify-content:flex-end !important}.justify-content-center{justify-content:center !important}.justify-content-between{justify-content:space-between !important}.justify-content-around{justify-content:space-around !important}.justify-content-evenly{justify-content:space-evenly !important}.align-items-start{align-items:flex-start !important}.align-items-end{align-items:flex-end !important}.align-items-center{align-items:center !important}.align-items-baseline{align-items:baseline !important}.align-items-stretch{align-items:stretch !important}.align-content-start{align-content:flex-start !important}.align-content-end{align-content:flex-end !important}.align-content-center{align-content:center !important}.align-content-between{align-content:space-between !important}.align-content-around{align-content:space-around !important}.align-content-stretch{align-content:stretch !important}.align-self-auto{align-self:auto !important}.align-self-start{align-self:flex-start !important}.align-self-end{align-self:flex-end !important}.align-self-center{align-self:center !important}.align-self-baseline{align-self:baseline !important}.align-self-stretch{align-self:stretch !important}.order-first{order:-1 !important}.order-0{order:0 !important}.order-1{order:1 !important}.order-2{order:2 !important}.order-3{order:3 !important}.order-4{order:4 !important}.order-5{order:5 !important}.order-last{order:6 !important}.m-0{margin:0 !important}.m-1{margin:.25rem !important}.m-2{margin:.5rem !important}.m-3{margin:1rem !important}.m-4{margin:1.5rem !important}.m-5{margin:3rem !important}.m-auto{margin:auto !important}.mx-0{margin-right:0 !important;margin-left:0 !important}.mx-1{margin-right:.25rem !important;margin-left:.25rem !important}.mx-2{margin-right:.5rem !important;margin-left:.5rem !important}.mx-3{margin-right:1rem !important;margin-left:1rem !important}.mx-4{margin-right:1.5rem !important;margin-left:1.5rem !important}.mx-5{margin-right:3rem !important;margin-left:3rem !important}.mx-auto{margin-right:auto !important;margin-left:auto !important}.my-0{margin-top:0 !important;margin-bottom:0 !important}.my-1{margin-top:.25rem !important;margin-bottom:.25rem !important}.my-2{margin-top:.5rem !important;margin-bottom:.5rem !important}.my-3{margin-top:1rem !important;margin-bottom:1rem !important}.my-4{margin-top:1.5rem !important;margin-bottom:1.5rem !important}.my-5{margin-top:3rem !important;margin-bottom:3rem !important}.my-auto{margin-top:auto !important;margin-bottom:auto !important}.mt-0{margin-top:0 !important}.mt-1{margin-top:.25rem !important}.mt-2{margin-top:.5rem !important}.mt-3{margin-top:1rem !important}.mt-4{margin-top:1.5rem !important}.mt-5{margin-top:3rem !important}.mt-auto{margin-top:auto !important}.me-0{margin-right:0 !important}.me-1{margin-right:.25rem !important}.me-2{margin-right:.5rem !important}.me-3{margin-right:1rem !important}.me-4{margin-right:1.5rem !important}.me-5{margin-right:3rem !important}.me-auto{margin-right:auto !important}.mb-0{margin-bottom:0 !important}.mb-1{margin-bottom:.25rem !important}.mb-2{margin-bottom:.5rem !important}.mb-3{margin-bottom:1rem !important}.mb-4{margin-bottom:1.5rem !important}.mb-5{margin-bottom:3rem !important}.mb-auto{margin-bottom:auto !important}.ms-0{margin-left:0 !important}.ms-1{margin-left:.25rem !important}.ms-2{margin-left:.5rem !important}.ms-3{margin-left:1rem !important}.ms-4{margin-left:1.5rem !important}.ms-5{margin-left:3rem !important}.ms-auto{margin-left:auto !important}.p-0{padding:0 !important}.p-1{padding:.25rem !important}.p-2{padding:.5rem !important}.p-3{padding:1rem !important}.p-4{padding:1.5rem !important}.p-5{padding:3rem !important}.px-0{padding-right:0 !important;padding-left:0 !important}.px-1{padding-right:.25rem !important;padding-left:.25rem !important}.px-2{padding-right:.5rem !important;padding-left:.5rem !important}.px-3{padding-right:1rem !important;padding-left:1rem !important}.px-4{padding-right:1.5rem !important;padding-left:1.5rem !important}.px-5{padding-right:3rem !important;padding-left:3rem !important}.py-0{padding-top:0 !important;padding-bottom:0 !important}.py-1{padding-top:.25rem !important;padding-bottom:.25rem !important}.py-2{padding-top:.5rem !important;padding-bottom:.5rem !important}.py-3{padding-top:1rem !important;padding-bottom:1rem !important}.py-4{padding-top:1.5rem !important;padding-bottom:1.5rem !important}.py-5{padding-top:3rem !important;padding-bottom:3rem !important}.pt-0{padding-top:0 !important}.pt-1{padding-top:.25rem !important}.pt-2{padding-top:.5rem !important}.pt-3{padding-top:1rem !important}.pt-4{padding-top:1.5rem !important}.pt-5{padding-top:3rem !important}.pe-0{padding-right:0 !important}.pe-1{padding-right:.25rem !important}.pe-2{padding-right:.5rem !important}.pe-3{padding-right:1rem !important}.pe-4{padding-right:1.5rem !important}.pe-5{padding-right:3rem !important}.pb-0{padding-bottom:0 !important}.pb-1{padding-bottom:.25rem !important}.pb-2{padding-bottom:.5rem !important}.pb-3{padding-bottom:1rem !important}.pb-4{padding-bottom:1.5rem !important}.pb-5{padding-bottom:3rem !important}.ps-0{padding-left:0 !important}.ps-1{padding-left:.25rem !important}.ps-2{padding-left:.5rem !important}.ps-3{padding-left:1rem !important}.ps-4{padding-left:1.5rem !important}.ps-5{padding-left:3rem !important}.gap-0{gap:0 !important}.gap-1{gap:.25rem !important}.gap-2{gap:.5rem !important}.gap-3{gap:1rem !important}.gap-4{gap:1.5rem !important}.gap-5{gap:3rem !important}.row-gap-0{row-gap:0 !important}.row-gap-1{row-gap:.25rem !important}.row-gap-2{row-gap:.5rem !important}.row-gap-3{row-gap:1rem !important}.row-gap-4{row-gap:1.5rem !important}.row-gap-5{row-gap:3rem !important}.column-gap-0{column-gap:0 !important}.column-gap-1{column-gap:.25rem !important}.column-gap-2{column-gap:.5rem !important}.column-gap-3{column-gap:1rem !important}.column-gap-4{column-gap:1.5rem !important}.column-gap-5{column-gap:3rem !important}.font-monospace{font-family:var(--bs-font-monospace) !important}.fs-1{font-size:calc(1.325rem + 0.9vw) !important}.fs-2{font-size:calc(1.29rem + 0.48vw) !important}.fs-3{font-size:calc(1.27rem + 0.24vw) !important}.fs-4{font-size:1.25rem !important}.fs-5{font-size:1.1rem !important}.fs-6{font-size:1rem !important}.fst-italic{font-style:italic !important}.fst-normal{font-style:normal !important}.fw-lighter{font-weight:lighter !important}.fw-light{font-weight:300 !important}.fw-normal{font-weight:400 !important}.fw-medium{font-weight:500 !important}.fw-semibold{font-weight:600 !important}.fw-bold{font-weight:700 !important}.fw-bolder{font-weight:bolder !important}.lh-1{line-height:1 !important}.lh-sm{line-height:1.25 !important}.lh-base{line-height:1.5 !important}.lh-lg{line-height:2 !important}.text-start{text-align:left !important}.text-end{text-align:right !important}.text-center{text-align:center !important}.text-decoration-none{text-decoration:none !important}.text-decoration-underline{text-decoration:underline !important}.text-decoration-line-through{text-decoration:line-through !important}.text-lowercase{text-transform:lowercase !important}.text-uppercase{text-transform:uppercase !important}.text-capitalize{text-transform:capitalize !important}.text-wrap{white-space:normal !important}.text-nowrap{white-space:nowrap !important}.text-break{word-wrap:break-word !important;word-break:break-word !important}.text-default{--bs-text-opacity: 1;color:rgba(var(--bs-default-rgb), var(--bs-text-opacity)) !important}.text-primary{--bs-text-opacity: 1;color:rgba(var(--bs-primary-rgb), var(--bs-text-opacity)) !important}.text-secondary{--bs-text-opacity: 1;color:rgba(var(--bs-secondary-rgb), var(--bs-text-opacity)) !important}.text-success{--bs-text-opacity: 1;color:rgba(var(--bs-success-rgb), var(--bs-text-opacity)) !important}.text-info{--bs-text-opacity: 1;color:rgba(var(--bs-info-rgb), var(--bs-text-opacity)) !important}.text-warning{--bs-text-opacity: 1;color:rgba(var(--bs-warning-rgb), var(--bs-text-opacity)) !important}.text-danger{--bs-text-opacity: 1;color:rgba(var(--bs-danger-rgb), var(--bs-text-opacity)) !important}.text-light{--bs-text-opacity: 1;color:rgba(var(--bs-light-rgb), var(--bs-text-opacity)) !important}.text-dark{--bs-text-opacity: 1;color:rgba(var(--bs-dark-rgb), var(--bs-text-opacity)) !important}.text-black{--bs-text-opacity: 1;color:rgba(var(--bs-black-rgb), var(--bs-text-opacity)) !important}.text-white{--bs-text-opacity: 1;color:rgba(var(--bs-white-rgb), var(--bs-text-opacity)) !important}.text-body{--bs-text-opacity: 1;color:rgba(var(--bs-body-color-rgb), var(--bs-text-opacity)) !important}.text-muted{--bs-text-opacity: 1;color:var(--bs-secondary-color) !important}.text-black-50{--bs-text-opacity: 1;color:rgba(0,0,0,.5) !important}.text-white-50{--bs-text-opacity: 1;color:rgba(255,255,255,.5) !important}.text-body-secondary{--bs-text-opacity: 1;color:var(--bs-secondary-color) !important}.text-body-tertiary{--bs-text-opacity: 1;color:var(--bs-tertiary-color) !important}.text-body-emphasis{--bs-text-opacity: 1;color:var(--bs-emphasis-color) !important}.text-reset{--bs-text-opacity: 1;color:inherit !important}.text-opacity-25{--bs-text-opacity: 0.25}.text-opacity-50{--bs-text-opacity: 0.5}.text-opacity-75{--bs-text-opacity: 0.75}.text-opacity-100{--bs-text-opacity: 1}.text-primary-emphasis{color:var(--bs-primary-text-emphasis) !important}.text-secondary-emphasis{color:var(--bs-secondary-text-emphasis) !important}.text-success-emphasis{color:var(--bs-success-text-emphasis) !important}.text-info-emphasis{color:var(--bs-info-text-emphasis) !important}.text-warning-emphasis{color:var(--bs-warning-text-emphasis) !important}.text-danger-emphasis{color:var(--bs-danger-text-emphasis) !important}.text-light-emphasis{color:var(--bs-light-text-emphasis) !important}.text-dark-emphasis{color:var(--bs-dark-text-emphasis) !important}.link-opacity-10{--bs-link-opacity: 0.1}.link-opacity-10-hover:hover{--bs-link-opacity: 0.1}.link-opacity-25{--bs-link-opacity: 0.25}.link-opacity-25-hover:hover{--bs-link-opacity: 0.25}.link-opacity-50{--bs-link-opacity: 0.5}.link-opacity-50-hover:hover{--bs-link-opacity: 0.5}.link-opacity-75{--bs-link-opacity: 0.75}.link-opacity-75-hover:hover{--bs-link-opacity: 0.75}.link-opacity-100{--bs-link-opacity: 1}.link-opacity-100-hover:hover{--bs-link-opacity: 1}.link-offset-1{text-underline-offset:.125em !important}.link-offset-1-hover:hover{text-underline-offset:.125em !important}.link-offset-2{text-underline-offset:.25em !important}.link-offset-2-hover:hover{text-underline-offset:.25em !important}.link-offset-3{text-underline-offset:.375em !important}.link-offset-3-hover:hover{text-underline-offset:.375em !important}.link-underline-default{--bs-link-underline-opacity: 1;text-decoration-color:rgba(var(--bs-default-rgb), var(--bs-link-underline-opacity)) !important}.link-underline-primary{--bs-link-underline-opacity: 1;text-decoration-color:rgba(var(--bs-primary-rgb), var(--bs-link-underline-opacity)) !important}.link-underline-secondary{--bs-link-underline-opacity: 1;text-decoration-color:rgba(var(--bs-secondary-rgb), var(--bs-link-underline-opacity)) !important}.link-underline-success{--bs-link-underline-opacity: 1;text-decoration-color:rgba(var(--bs-success-rgb), var(--bs-link-underline-opacity)) !important}.link-underline-info{--bs-link-underline-opacity: 1;text-decoration-color:rgba(var(--bs-info-rgb), var(--bs-link-underline-opacity)) !important}.link-underline-warning{--bs-link-underline-opacity: 1;text-decoration-color:rgba(var(--bs-warning-rgb), var(--bs-link-underline-opacity)) !important}.link-underline-danger{--bs-link-underline-opacity: 1;text-decoration-color:rgba(var(--bs-danger-rgb), var(--bs-link-underline-opacity)) !important}.link-underline-light{--bs-link-underline-opacity: 1;text-decoration-color:rgba(var(--bs-light-rgb), var(--bs-link-underline-opacity)) !important}.link-underline-dark{--bs-link-underline-opacity: 1;text-decoration-color:rgba(var(--bs-dark-rgb), var(--bs-link-underline-opacity)) !important}.link-underline{--bs-link-underline-opacity: 1;text-decoration-color:rgba(var(--bs-link-color-rgb), var(--bs-link-underline-opacity, 1)) !important}.link-underline-opacity-0{--bs-link-underline-opacity: 0}.link-underline-opacity-0-hover:hover{--bs-link-underline-opacity: 0}.link-underline-opacity-10{--bs-link-underline-opacity: 0.1}.link-underline-opacity-10-hover:hover{--bs-link-underline-opacity: 0.1}.link-underline-opacity-25{--bs-link-underline-opacity: 0.25}.link-underline-opacity-25-hover:hover{--bs-link-underline-opacity: 0.25}.link-underline-opacity-50{--bs-link-underline-opacity: 0.5}.link-underline-opacity-50-hover:hover{--bs-link-underline-opacity: 0.5}.link-underline-opacity-75{--bs-link-underline-opacity: 0.75}.link-underline-opacity-75-hover:hover{--bs-link-underline-opacity: 0.75}.link-underline-opacity-100{--bs-link-underline-opacity: 1}.link-underline-opacity-100-hover:hover{--bs-link-underline-opacity: 1}.bg-default{--bs-bg-opacity: 1;background-color:rgba(var(--bs-default-rgb), var(--bs-bg-opacity)) !important}.bg-primary{--bs-bg-opacity: 1;background-color:rgba(var(--bs-primary-rgb), var(--bs-bg-opacity)) !important}.bg-secondary{--bs-bg-opacity: 1;background-color:rgba(var(--bs-secondary-rgb), var(--bs-bg-opacity)) !important}.bg-success{--bs-bg-opacity: 1;background-color:rgba(var(--bs-success-rgb), var(--bs-bg-opacity)) !important}.bg-info{--bs-bg-opacity: 1;background-color:rgba(var(--bs-info-rgb), var(--bs-bg-opacity)) !important}.bg-warning{--bs-bg-opacity: 1;background-color:rgba(var(--bs-warning-rgb), var(--bs-bg-opacity)) !important}.bg-danger{--bs-bg-opacity: 1;background-color:rgba(var(--bs-danger-rgb), var(--bs-bg-opacity)) !important}.bg-light{--bs-bg-opacity: 1;background-color:rgba(var(--bs-light-rgb), var(--bs-bg-opacity)) !important}.bg-dark{--bs-bg-opacity: 1;background-color:rgba(var(--bs-dark-rgb), var(--bs-bg-opacity)) !important}.bg-black{--bs-bg-opacity: 1;background-color:rgba(var(--bs-black-rgb), var(--bs-bg-opacity)) !important}.bg-white{--bs-bg-opacity: 1;background-color:rgba(var(--bs-white-rgb), var(--bs-bg-opacity)) !important}.bg-body{--bs-bg-opacity: 1;background-color:rgba(var(--bs-body-bg-rgb), var(--bs-bg-opacity)) !important}.bg-transparent{--bs-bg-opacity: 1;background-color:rgba(0,0,0,0) !important}.bg-body-secondary{--bs-bg-opacity: 1;background-color:rgba(var(--bs-secondary-bg-rgb), var(--bs-bg-opacity)) !important}.bg-body-tertiary{--bs-bg-opacity: 1;background-color:rgba(var(--bs-tertiary-bg-rgb), var(--bs-bg-opacity)) !important}.bg-opacity-10{--bs-bg-opacity: 0.1}.bg-opacity-25{--bs-bg-opacity: 0.25}.bg-opacity-50{--bs-bg-opacity: 0.5}.bg-opacity-75{--bs-bg-opacity: 0.75}.bg-opacity-100{--bs-bg-opacity: 1}.bg-primary-subtle{background-color:var(--bs-primary-bg-subtle) !important}.bg-secondary-subtle{background-color:var(--bs-secondary-bg-subtle) !important}.bg-success-subtle{background-color:var(--bs-success-bg-subtle) !important}.bg-info-subtle{background-color:var(--bs-info-bg-subtle) !important}.bg-warning-subtle{background-color:var(--bs-warning-bg-subtle) !important}.bg-danger-subtle{background-color:var(--bs-danger-bg-subtle) !important}.bg-light-subtle{background-color:var(--bs-light-bg-subtle) !important}.bg-dark-subtle{background-color:var(--bs-dark-bg-subtle) !important}.bg-gradient{background-image:var(--bs-gradient) !important}.user-select-all{user-select:all !important}.user-select-auto{user-select:auto !important}.user-select-none{user-select:none !important}.pe-none{pointer-events:none !important}.pe-auto{pointer-events:auto !important}.rounded{border-radius:var(--bs-border-radius) !important}.rounded-0{border-radius:0 !important}.rounded-1{border-radius:var(--bs-border-radius-sm) !important}.rounded-2{border-radius:var(--bs-border-radius) !important}.rounded-3{border-radius:var(--bs-border-radius-lg) !important}.rounded-4{border-radius:var(--bs-border-radius-xl) !important}.rounded-5{border-radius:var(--bs-border-radius-xxl) !important}.rounded-circle{border-radius:50% !important}.rounded-pill{border-radius:var(--bs-border-radius-pill) !important}.rounded-top{border-top-left-radius:var(--bs-border-radius) !important;border-top-right-radius:var(--bs-border-radius) !important}.rounded-top-0{border-top-left-radius:0 !important;border-top-right-radius:0 !important}.rounded-top-1{border-top-left-radius:var(--bs-border-radius-sm) !important;border-top-right-radius:var(--bs-border-radius-sm) !important}.rounded-top-2{border-top-left-radius:var(--bs-border-radius) !important;border-top-right-radius:var(--bs-border-radius) !important}.rounded-top-3{border-top-left-radius:var(--bs-border-radius-lg) !important;border-top-right-radius:var(--bs-border-radius-lg) !important}.rounded-top-4{border-top-left-radius:var(--bs-border-radius-xl) !important;border-top-right-radius:var(--bs-border-radius-xl) !important}.rounded-top-5{border-top-left-radius:var(--bs-border-radius-xxl) !important;border-top-right-radius:var(--bs-border-radius-xxl) !important}.rounded-top-circle{border-top-left-radius:50% !important;border-top-right-radius:50% !important}.rounded-top-pill{border-top-left-radius:var(--bs-border-radius-pill) !important;border-top-right-radius:var(--bs-border-radius-pill) !important}.rounded-end{border-top-right-radius:var(--bs-border-radius) !important;border-bottom-right-radius:var(--bs-border-radius) !important}.rounded-end-0{border-top-right-radius:0 !important;border-bottom-right-radius:0 !important}.rounded-end-1{border-top-right-radius:var(--bs-border-radius-sm) !important;border-bottom-right-radius:var(--bs-border-radius-sm) !important}.rounded-end-2{border-top-right-radius:var(--bs-border-radius) !important;border-bottom-right-radius:var(--bs-border-radius) !important}.rounded-end-3{border-top-right-radius:var(--bs-border-radius-lg) !important;border-bottom-right-radius:var(--bs-border-radius-lg) !important}.rounded-end-4{border-top-right-radius:var(--bs-border-radius-xl) !important;border-bottom-right-radius:var(--bs-border-radius-xl) !important}.rounded-end-5{border-top-right-radius:var(--bs-border-radius-xxl) !important;border-bottom-right-radius:var(--bs-border-radius-xxl) !important}.rounded-end-circle{border-top-right-radius:50% !important;border-bottom-right-radius:50% !important}.rounded-end-pill{border-top-right-radius:var(--bs-border-radius-pill) !important;border-bottom-right-radius:var(--bs-border-radius-pill) !important}.rounded-bottom{border-bottom-right-radius:var(--bs-border-radius) !important;border-bottom-left-radius:var(--bs-border-radius) !important}.rounded-bottom-0{border-bottom-right-radius:0 !important;border-bottom-left-radius:0 !important}.rounded-bottom-1{border-bottom-right-radius:var(--bs-border-radius-sm) !important;border-bottom-left-radius:var(--bs-border-radius-sm) !important}.rounded-bottom-2{border-bottom-right-radius:var(--bs-border-radius) !important;border-bottom-left-radius:var(--bs-border-radius) !important}.rounded-bottom-3{border-bottom-right-radius:var(--bs-border-radius-lg) !important;border-bottom-left-radius:var(--bs-border-radius-lg) !important}.rounded-bottom-4{border-bottom-right-radius:var(--bs-border-radius-xl) !important;border-bottom-left-radius:var(--bs-border-radius-xl) !important}.rounded-bottom-5{border-bottom-right-radius:var(--bs-border-radius-xxl) !important;border-bottom-left-radius:var(--bs-border-radius-xxl) !important}.rounded-bottom-circle{border-bottom-right-radius:50% !important;border-bottom-left-radius:50% !important}.rounded-bottom-pill{border-bottom-right-radius:var(--bs-border-radius-pill) !important;border-bottom-left-radius:var(--bs-border-radius-pill) !important}.rounded-start{border-bottom-left-radius:var(--bs-border-radius) !important;border-top-left-radius:var(--bs-border-radius) !important}.rounded-start-0{border-bottom-left-radius:0 !important;border-top-left-radius:0 !important}.rounded-start-1{border-bottom-left-radius:var(--bs-border-radius-sm) !important;border-top-left-radius:var(--bs-border-radius-sm) !important}.rounded-start-2{border-bottom-left-radius:var(--bs-border-radius) !important;border-top-left-radius:var(--bs-border-radius) !important}.rounded-start-3{border-bottom-left-radius:var(--bs-border-radius-lg) !important;border-top-left-radius:var(--bs-border-radius-lg) !important}.rounded-start-4{border-bottom-left-radius:var(--bs-border-radius-xl) !important;border-top-left-radius:var(--bs-border-radius-xl) !important}.rounded-start-5{border-bottom-left-radius:var(--bs-border-radius-xxl) !important;border-top-left-radius:var(--bs-border-radius-xxl) !important}.rounded-start-circle{border-bottom-left-radius:50% !important;border-top-left-radius:50% !important}.rounded-start-pill{border-bottom-left-radius:var(--bs-border-radius-pill) !important;border-top-left-radius:var(--bs-border-radius-pill) !important}.visible{visibility:visible !important}.invisible{visibility:hidden !important}.z-n1{z-index:-1 !important}.z-0{z-index:0 !important}.z-1{z-index:1 !important}.z-2{z-index:2 !important}.z-3{z-index:3 !important}@media(min-width: 576px){.float-sm-start{float:left !important}.float-sm-end{float:right !important}.float-sm-none{float:none !important}.object-fit-sm-contain{object-fit:contain !important}.object-fit-sm-cover{object-fit:cover !important}.object-fit-sm-fill{object-fit:fill !important}.object-fit-sm-scale{object-fit:scale-down !important}.object-fit-sm-none{object-fit:none !important}.d-sm-inline{display:inline !important}.d-sm-inline-block{display:inline-block !important}.d-sm-block{display:block !important}.d-sm-grid{display:grid !important}.d-sm-inline-grid{display:inline-grid !important}.d-sm-table{display:table !important}.d-sm-table-row{display:table-row !important}.d-sm-table-cell{display:table-cell !important}.d-sm-flex{display:flex !important}.d-sm-inline-flex{display:inline-flex !important}.d-sm-none{display:none !important}.flex-sm-fill{flex:1 1 auto !important}.flex-sm-row{flex-direction:row !important}.flex-sm-column{flex-direction:column !important}.flex-sm-row-reverse{flex-direction:row-reverse !important}.flex-sm-column-reverse{flex-direction:column-reverse !important}.flex-sm-grow-0{flex-grow:0 !important}.flex-sm-grow-1{flex-grow:1 !important}.flex-sm-shrink-0{flex-shrink:0 !important}.flex-sm-shrink-1{flex-shrink:1 !important}.flex-sm-wrap{flex-wrap:wrap !important}.flex-sm-nowrap{flex-wrap:nowrap !important}.flex-sm-wrap-reverse{flex-wrap:wrap-reverse !important}.justify-content-sm-start{justify-content:flex-start !important}.justify-content-sm-end{justify-content:flex-end !important}.justify-content-sm-center{justify-content:center !important}.justify-content-sm-between{justify-content:space-between !important}.justify-content-sm-around{justify-content:space-around !important}.justify-content-sm-evenly{justify-content:space-evenly !important}.align-items-sm-start{align-items:flex-start !important}.align-items-sm-end{align-items:flex-end !important}.align-items-sm-center{align-items:center !important}.align-items-sm-baseline{align-items:baseline !important}.align-items-sm-stretch{align-items:stretch !important}.align-content-sm-start{align-content:flex-start !important}.align-content-sm-end{align-content:flex-end !important}.align-content-sm-center{align-content:center !important}.align-content-sm-between{align-content:space-between !important}.align-content-sm-around{align-content:space-around !important}.align-content-sm-stretch{align-content:stretch !important}.align-self-sm-auto{align-self:auto !important}.align-self-sm-start{align-self:flex-start !important}.align-self-sm-end{align-self:flex-end !important}.align-self-sm-center{align-self:center !important}.align-self-sm-baseline{align-self:baseline !important}.align-self-sm-stretch{align-self:stretch !important}.order-sm-first{order:-1 !important}.order-sm-0{order:0 !important}.order-sm-1{order:1 !important}.order-sm-2{order:2 !important}.order-sm-3{order:3 !important}.order-sm-4{order:4 !important}.order-sm-5{order:5 !important}.order-sm-last{order:6 !important}.m-sm-0{margin:0 !important}.m-sm-1{margin:.25rem !important}.m-sm-2{margin:.5rem !important}.m-sm-3{margin:1rem !important}.m-sm-4{margin:1.5rem !important}.m-sm-5{margin:3rem !important}.m-sm-auto{margin:auto !important}.mx-sm-0{margin-right:0 !important;margin-left:0 !important}.mx-sm-1{margin-right:.25rem !important;margin-left:.25rem !important}.mx-sm-2{margin-right:.5rem !important;margin-left:.5rem !important}.mx-sm-3{margin-right:1rem !important;margin-left:1rem !important}.mx-sm-4{margin-right:1.5rem !important;margin-left:1.5rem !important}.mx-sm-5{margin-right:3rem !important;margin-left:3rem !important}.mx-sm-auto{margin-right:auto !important;margin-left:auto !important}.my-sm-0{margin-top:0 !important;margin-bottom:0 !important}.my-sm-1{margin-top:.25rem !important;margin-bottom:.25rem !important}.my-sm-2{margin-top:.5rem !important;margin-bottom:.5rem !important}.my-sm-3{margin-top:1rem !important;margin-bottom:1rem !important}.my-sm-4{margin-top:1.5rem !important;margin-bottom:1.5rem !important}.my-sm-5{margin-top:3rem !important;margin-bottom:3rem !important}.my-sm-auto{margin-top:auto !important;margin-bottom:auto !important}.mt-sm-0{margin-top:0 !important}.mt-sm-1{margin-top:.25rem !important}.mt-sm-2{margin-top:.5rem !important}.mt-sm-3{margin-top:1rem !important}.mt-sm-4{margin-top:1.5rem !important}.mt-sm-5{margin-top:3rem !important}.mt-sm-auto{margin-top:auto !important}.me-sm-0{margin-right:0 !important}.me-sm-1{margin-right:.25rem !important}.me-sm-2{margin-right:.5rem !important}.me-sm-3{margin-right:1rem !important}.me-sm-4{margin-right:1.5rem !important}.me-sm-5{margin-right:3rem !important}.me-sm-auto{margin-right:auto !important}.mb-sm-0{margin-bottom:0 !important}.mb-sm-1{margin-bottom:.25rem !important}.mb-sm-2{margin-bottom:.5rem !important}.mb-sm-3{margin-bottom:1rem !important}.mb-sm-4{margin-bottom:1.5rem !important}.mb-sm-5{margin-bottom:3rem !important}.mb-sm-auto{margin-bottom:auto !important}.ms-sm-0{margin-left:0 !important}.ms-sm-1{margin-left:.25rem !important}.ms-sm-2{margin-left:.5rem !important}.ms-sm-3{margin-left:1rem !important}.ms-sm-4{margin-left:1.5rem !important}.ms-sm-5{margin-left:3rem !important}.ms-sm-auto{margin-left:auto !important}.p-sm-0{padding:0 !important}.p-sm-1{padding:.25rem !important}.p-sm-2{padding:.5rem !important}.p-sm-3{padding:1rem !important}.p-sm-4{padding:1.5rem !important}.p-sm-5{padding:3rem !important}.px-sm-0{padding-right:0 !important;padding-left:0 !important}.px-sm-1{padding-right:.25rem !important;padding-left:.25rem !important}.px-sm-2{padding-right:.5rem !important;padding-left:.5rem !important}.px-sm-3{padding-right:1rem !important;padding-left:1rem !important}.px-sm-4{padding-right:1.5rem !important;padding-left:1.5rem !important}.px-sm-5{padding-right:3rem !important;padding-left:3rem !important}.py-sm-0{padding-top:0 !important;padding-bottom:0 !important}.py-sm-1{padding-top:.25rem !important;padding-bottom:.25rem !important}.py-sm-2{padding-top:.5rem !important;padding-bottom:.5rem !important}.py-sm-3{padding-top:1rem !important;padding-bottom:1rem !important}.py-sm-4{padding-top:1.5rem !important;padding-bottom:1.5rem !important}.py-sm-5{padding-top:3rem !important;padding-bottom:3rem !important}.pt-sm-0{padding-top:0 !important}.pt-sm-1{padding-top:.25rem !important}.pt-sm-2{padding-top:.5rem !important}.pt-sm-3{padding-top:1rem !important}.pt-sm-4{padding-top:1.5rem !important}.pt-sm-5{padding-top:3rem !important}.pe-sm-0{padding-right:0 !important}.pe-sm-1{padding-right:.25rem !important}.pe-sm-2{padding-right:.5rem !important}.pe-sm-3{padding-right:1rem !important}.pe-sm-4{padding-right:1.5rem !important}.pe-sm-5{padding-right:3rem !important}.pb-sm-0{padding-bottom:0 !important}.pb-sm-1{padding-bottom:.25rem !important}.pb-sm-2{padding-bottom:.5rem !important}.pb-sm-3{padding-bottom:1rem !important}.pb-sm-4{padding-bottom:1.5rem !important}.pb-sm-5{padding-bottom:3rem !important}.ps-sm-0{padding-left:0 !important}.ps-sm-1{padding-left:.25rem !important}.ps-sm-2{padding-left:.5rem !important}.ps-sm-3{padding-left:1rem !important}.ps-sm-4{padding-left:1.5rem !important}.ps-sm-5{padding-left:3rem !important}.gap-sm-0{gap:0 !important}.gap-sm-1{gap:.25rem !important}.gap-sm-2{gap:.5rem !important}.gap-sm-3{gap:1rem !important}.gap-sm-4{gap:1.5rem !important}.gap-sm-5{gap:3rem !important}.row-gap-sm-0{row-gap:0 !important}.row-gap-sm-1{row-gap:.25rem !important}.row-gap-sm-2{row-gap:.5rem !important}.row-gap-sm-3{row-gap:1rem !important}.row-gap-sm-4{row-gap:1.5rem !important}.row-gap-sm-5{row-gap:3rem !important}.column-gap-sm-0{column-gap:0 !important}.column-gap-sm-1{column-gap:.25rem !important}.column-gap-sm-2{column-gap:.5rem !important}.column-gap-sm-3{column-gap:1rem !important}.column-gap-sm-4{column-gap:1.5rem !important}.column-gap-sm-5{column-gap:3rem !important}.text-sm-start{text-align:left !important}.text-sm-end{text-align:right !important}.text-sm-center{text-align:center !important}}@media(min-width: 768px){.float-md-start{float:left !important}.float-md-end{float:right !important}.float-md-none{float:none !important}.object-fit-md-contain{object-fit:contain !important}.object-fit-md-cover{object-fit:cover !important}.object-fit-md-fill{object-fit:fill !important}.object-fit-md-scale{object-fit:scale-down !important}.object-fit-md-none{object-fit:none !important}.d-md-inline{display:inline !important}.d-md-inline-block{display:inline-block !important}.d-md-block{display:block !important}.d-md-grid{display:grid !important}.d-md-inline-grid{display:inline-grid !important}.d-md-table{display:table !important}.d-md-table-row{display:table-row !important}.d-md-table-cell{display:table-cell !important}.d-md-flex{display:flex !important}.d-md-inline-flex{display:inline-flex !important}.d-md-none{display:none !important}.flex-md-fill{flex:1 1 auto !important}.flex-md-row{flex-direction:row !important}.flex-md-column{flex-direction:column !important}.flex-md-row-reverse{flex-direction:row-reverse !important}.flex-md-column-reverse{flex-direction:column-reverse !important}.flex-md-grow-0{flex-grow:0 !important}.flex-md-grow-1{flex-grow:1 !important}.flex-md-shrink-0{flex-shrink:0 !important}.flex-md-shrink-1{flex-shrink:1 !important}.flex-md-wrap{flex-wrap:wrap !important}.flex-md-nowrap{flex-wrap:nowrap !important}.flex-md-wrap-reverse{flex-wrap:wrap-reverse !important}.justify-content-md-start{justify-content:flex-start !important}.justify-content-md-end{justify-content:flex-end !important}.justify-content-md-center{justify-content:center !important}.justify-content-md-between{justify-content:space-between !important}.justify-content-md-around{justify-content:space-around !important}.justify-content-md-evenly{justify-content:space-evenly !important}.align-items-md-start{align-items:flex-start !important}.align-items-md-end{align-items:flex-end !important}.align-items-md-center{align-items:center !important}.align-items-md-baseline{align-items:baseline !important}.align-items-md-stretch{align-items:stretch !important}.align-content-md-start{align-content:flex-start !important}.align-content-md-end{align-content:flex-end !important}.align-content-md-center{align-content:center !important}.align-content-md-between{align-content:space-between !important}.align-content-md-around{align-content:space-around !important}.align-content-md-stretch{align-content:stretch !important}.align-self-md-auto{align-self:auto !important}.align-self-md-start{align-self:flex-start !important}.align-self-md-end{align-self:flex-end !important}.align-self-md-center{align-self:center !important}.align-self-md-baseline{align-self:baseline !important}.align-self-md-stretch{align-self:stretch !important}.order-md-first{order:-1 !important}.order-md-0{order:0 !important}.order-md-1{order:1 !important}.order-md-2{order:2 !important}.order-md-3{order:3 !important}.order-md-4{order:4 !important}.order-md-5{order:5 !important}.order-md-last{order:6 !important}.m-md-0{margin:0 !important}.m-md-1{margin:.25rem !important}.m-md-2{margin:.5rem !important}.m-md-3{margin:1rem !important}.m-md-4{margin:1.5rem !important}.m-md-5{margin:3rem !important}.m-md-auto{margin:auto !important}.mx-md-0{margin-right:0 !important;margin-left:0 !important}.mx-md-1{margin-right:.25rem !important;margin-left:.25rem !important}.mx-md-2{margin-right:.5rem !important;margin-left:.5rem !important}.mx-md-3{margin-right:1rem !important;margin-left:1rem !important}.mx-md-4{margin-right:1.5rem !important;margin-left:1.5rem !important}.mx-md-5{margin-right:3rem !important;margin-left:3rem !important}.mx-md-auto{margin-right:auto !important;margin-left:auto !important}.my-md-0{margin-top:0 !important;margin-bottom:0 !important}.my-md-1{margin-top:.25rem !important;margin-bottom:.25rem !important}.my-md-2{margin-top:.5rem !important;margin-bottom:.5rem !important}.my-md-3{margin-top:1rem !important;margin-bottom:1rem !important}.my-md-4{margin-top:1.5rem !important;margin-bottom:1.5rem !important}.my-md-5{margin-top:3rem !important;margin-bottom:3rem !important}.my-md-auto{margin-top:auto !important;margin-bottom:auto !important}.mt-md-0{margin-top:0 !important}.mt-md-1{margin-top:.25rem !important}.mt-md-2{margin-top:.5rem !important}.mt-md-3{margin-top:1rem !important}.mt-md-4{margin-top:1.5rem !important}.mt-md-5{margin-top:3rem !important}.mt-md-auto{margin-top:auto !important}.me-md-0{margin-right:0 !important}.me-md-1{margin-right:.25rem !important}.me-md-2{margin-right:.5rem !important}.me-md-3{margin-right:1rem !important}.me-md-4{margin-right:1.5rem !important}.me-md-5{margin-right:3rem !important}.me-md-auto{margin-right:auto !important}.mb-md-0{margin-bottom:0 !important}.mb-md-1{margin-bottom:.25rem !important}.mb-md-2{margin-bottom:.5rem !important}.mb-md-3{margin-bottom:1rem !important}.mb-md-4{margin-bottom:1.5rem !important}.mb-md-5{margin-bottom:3rem !important}.mb-md-auto{margin-bottom:auto !important}.ms-md-0{margin-left:0 !important}.ms-md-1{margin-left:.25rem !important}.ms-md-2{margin-left:.5rem !important}.ms-md-3{margin-left:1rem !important}.ms-md-4{margin-left:1.5rem !important}.ms-md-5{margin-left:3rem !important}.ms-md-auto{margin-left:auto !important}.p-md-0{padding:0 !important}.p-md-1{padding:.25rem !important}.p-md-2{padding:.5rem !important}.p-md-3{padding:1rem !important}.p-md-4{padding:1.5rem !important}.p-md-5{padding:3rem !important}.px-md-0{padding-right:0 !important;padding-left:0 !important}.px-md-1{padding-right:.25rem !important;padding-left:.25rem !important}.px-md-2{padding-right:.5rem !important;padding-left:.5rem !important}.px-md-3{padding-right:1rem !important;padding-left:1rem !important}.px-md-4{padding-right:1.5rem !important;padding-left:1.5rem !important}.px-md-5{padding-right:3rem !important;padding-left:3rem !important}.py-md-0{padding-top:0 !important;padding-bottom:0 !important}.py-md-1{padding-top:.25rem !important;padding-bottom:.25rem !important}.py-md-2{padding-top:.5rem !important;padding-bottom:.5rem !important}.py-md-3{padding-top:1rem !important;padding-bottom:1rem !important}.py-md-4{padding-top:1.5rem !important;padding-bottom:1.5rem !important}.py-md-5{padding-top:3rem !important;padding-bottom:3rem !important}.pt-md-0{padding-top:0 !important}.pt-md-1{padding-top:.25rem !important}.pt-md-2{padding-top:.5rem !important}.pt-md-3{padding-top:1rem !important}.pt-md-4{padding-top:1.5rem !important}.pt-md-5{padding-top:3rem !important}.pe-md-0{padding-right:0 !important}.pe-md-1{padding-right:.25rem !important}.pe-md-2{padding-right:.5rem !important}.pe-md-3{padding-right:1rem !important}.pe-md-4{padding-right:1.5rem !important}.pe-md-5{padding-right:3rem !important}.pb-md-0{padding-bottom:0 !important}.pb-md-1{padding-bottom:.25rem !important}.pb-md-2{padding-bottom:.5rem !important}.pb-md-3{padding-bottom:1rem !important}.pb-md-4{padding-bottom:1.5rem !important}.pb-md-5{padding-bottom:3rem !important}.ps-md-0{padding-left:0 !important}.ps-md-1{padding-left:.25rem !important}.ps-md-2{padding-left:.5rem !important}.ps-md-3{padding-left:1rem !important}.ps-md-4{padding-left:1.5rem !important}.ps-md-5{padding-left:3rem !important}.gap-md-0{gap:0 !important}.gap-md-1{gap:.25rem !important}.gap-md-2{gap:.5rem !important}.gap-md-3{gap:1rem !important}.gap-md-4{gap:1.5rem !important}.gap-md-5{gap:3rem !important}.row-gap-md-0{row-gap:0 !important}.row-gap-md-1{row-gap:.25rem !important}.row-gap-md-2{row-gap:.5rem !important}.row-gap-md-3{row-gap:1rem !important}.row-gap-md-4{row-gap:1.5rem !important}.row-gap-md-5{row-gap:3rem !important}.column-gap-md-0{column-gap:0 !important}.column-gap-md-1{column-gap:.25rem !important}.column-gap-md-2{column-gap:.5rem !important}.column-gap-md-3{column-gap:1rem !important}.column-gap-md-4{column-gap:1.5rem !important}.column-gap-md-5{column-gap:3rem !important}.text-md-start{text-align:left !important}.text-md-end{text-align:right !important}.text-md-center{text-align:center !important}}@media(min-width: 992px){.float-lg-start{float:left !important}.float-lg-end{float:right !important}.float-lg-none{float:none !important}.object-fit-lg-contain{object-fit:contain !important}.object-fit-lg-cover{object-fit:cover !important}.object-fit-lg-fill{object-fit:fill !important}.object-fit-lg-scale{object-fit:scale-down !important}.object-fit-lg-none{object-fit:none !important}.d-lg-inline{display:inline !important}.d-lg-inline-block{display:inline-block !important}.d-lg-block{display:block !important}.d-lg-grid{display:grid !important}.d-lg-inline-grid{display:inline-grid !important}.d-lg-table{display:table !important}.d-lg-table-row{display:table-row !important}.d-lg-table-cell{display:table-cell !important}.d-lg-flex{display:flex !important}.d-lg-inline-flex{display:inline-flex !important}.d-lg-none{display:none !important}.flex-lg-fill{flex:1 1 auto !important}.flex-lg-row{flex-direction:row !important}.flex-lg-column{flex-direction:column !important}.flex-lg-row-reverse{flex-direction:row-reverse !important}.flex-lg-column-reverse{flex-direction:column-reverse !important}.flex-lg-grow-0{flex-grow:0 !important}.flex-lg-grow-1{flex-grow:1 !important}.flex-lg-shrink-0{flex-shrink:0 !important}.flex-lg-shrink-1{flex-shrink:1 !important}.flex-lg-wrap{flex-wrap:wrap !important}.flex-lg-nowrap{flex-wrap:nowrap !important}.flex-lg-wrap-reverse{flex-wrap:wrap-reverse !important}.justify-content-lg-start{justify-content:flex-start !important}.justify-content-lg-end{justify-content:flex-end !important}.justify-content-lg-center{justify-content:center !important}.justify-content-lg-between{justify-content:space-between !important}.justify-content-lg-around{justify-content:space-around !important}.justify-content-lg-evenly{justify-content:space-evenly !important}.align-items-lg-start{align-items:flex-start !important}.align-items-lg-end{align-items:flex-end !important}.align-items-lg-center{align-items:center !important}.align-items-lg-baseline{align-items:baseline !important}.align-items-lg-stretch{align-items:stretch !important}.align-content-lg-start{align-content:flex-start !important}.align-content-lg-end{align-content:flex-end !important}.align-content-lg-center{align-content:center !important}.align-content-lg-between{align-content:space-between !important}.align-content-lg-around{align-content:space-around !important}.align-content-lg-stretch{align-content:stretch !important}.align-self-lg-auto{align-self:auto !important}.align-self-lg-start{align-self:flex-start !important}.align-self-lg-end{align-self:flex-end !important}.align-self-lg-center{align-self:center !important}.align-self-lg-baseline{align-self:baseline !important}.align-self-lg-stretch{align-self:stretch !important}.order-lg-first{order:-1 !important}.order-lg-0{order:0 !important}.order-lg-1{order:1 !important}.order-lg-2{order:2 !important}.order-lg-3{order:3 !important}.order-lg-4{order:4 !important}.order-lg-5{order:5 !important}.order-lg-last{order:6 !important}.m-lg-0{margin:0 !important}.m-lg-1{margin:.25rem !important}.m-lg-2{margin:.5rem !important}.m-lg-3{margin:1rem !important}.m-lg-4{margin:1.5rem !important}.m-lg-5{margin:3rem !important}.m-lg-auto{margin:auto !important}.mx-lg-0{margin-right:0 !important;margin-left:0 !important}.mx-lg-1{margin-right:.25rem !important;margin-left:.25rem !important}.mx-lg-2{margin-right:.5rem !important;margin-left:.5rem !important}.mx-lg-3{margin-right:1rem !important;margin-left:1rem !important}.mx-lg-4{margin-right:1.5rem !important;margin-left:1.5rem !important}.mx-lg-5{margin-right:3rem !important;margin-left:3rem !important}.mx-lg-auto{margin-right:auto !important;margin-left:auto !important}.my-lg-0{margin-top:0 !important;margin-bottom:0 !important}.my-lg-1{margin-top:.25rem !important;margin-bottom:.25rem !important}.my-lg-2{margin-top:.5rem !important;margin-bottom:.5rem !important}.my-lg-3{margin-top:1rem !important;margin-bottom:1rem !important}.my-lg-4{margin-top:1.5rem !important;margin-bottom:1.5rem !important}.my-lg-5{margin-top:3rem !important;margin-bottom:3rem !important}.my-lg-auto{margin-top:auto !important;margin-bottom:auto !important}.mt-lg-0{margin-top:0 !important}.mt-lg-1{margin-top:.25rem !important}.mt-lg-2{margin-top:.5rem !important}.mt-lg-3{margin-top:1rem !important}.mt-lg-4{margin-top:1.5rem !important}.mt-lg-5{margin-top:3rem !important}.mt-lg-auto{margin-top:auto !important}.me-lg-0{margin-right:0 !important}.me-lg-1{margin-right:.25rem !important}.me-lg-2{margin-right:.5rem !important}.me-lg-3{margin-right:1rem !important}.me-lg-4{margin-right:1.5rem !important}.me-lg-5{margin-right:3rem !important}.me-lg-auto{margin-right:auto !important}.mb-lg-0{margin-bottom:0 !important}.mb-lg-1{margin-bottom:.25rem !important}.mb-lg-2{margin-bottom:.5rem !important}.mb-lg-3{margin-bottom:1rem !important}.mb-lg-4{margin-bottom:1.5rem !important}.mb-lg-5{margin-bottom:3rem !important}.mb-lg-auto{margin-bottom:auto !important}.ms-lg-0{margin-left:0 !important}.ms-lg-1{margin-left:.25rem !important}.ms-lg-2{margin-left:.5rem !important}.ms-lg-3{margin-left:1rem !important}.ms-lg-4{margin-left:1.5rem !important}.ms-lg-5{margin-left:3rem !important}.ms-lg-auto{margin-left:auto !important}.p-lg-0{padding:0 !important}.p-lg-1{padding:.25rem !important}.p-lg-2{padding:.5rem !important}.p-lg-3{padding:1rem !important}.p-lg-4{padding:1.5rem !important}.p-lg-5{padding:3rem !important}.px-lg-0{padding-right:0 !important;padding-left:0 !important}.px-lg-1{padding-right:.25rem !important;padding-left:.25rem !important}.px-lg-2{padding-right:.5rem !important;padding-left:.5rem !important}.px-lg-3{padding-right:1rem !important;padding-left:1rem !important}.px-lg-4{padding-right:1.5rem !important;padding-left:1.5rem !important}.px-lg-5{padding-right:3rem !important;padding-left:3rem !important}.py-lg-0{padding-top:0 !important;padding-bottom:0 !important}.py-lg-1{padding-top:.25rem !important;padding-bottom:.25rem !important}.py-lg-2{padding-top:.5rem !important;padding-bottom:.5rem !important}.py-lg-3{padding-top:1rem !important;padding-bottom:1rem !important}.py-lg-4{padding-top:1.5rem !important;padding-bottom:1.5rem !important}.py-lg-5{padding-top:3rem !important;padding-bottom:3rem !important}.pt-lg-0{padding-top:0 !important}.pt-lg-1{padding-top:.25rem !important}.pt-lg-2{padding-top:.5rem !important}.pt-lg-3{padding-top:1rem !important}.pt-lg-4{padding-top:1.5rem !important}.pt-lg-5{padding-top:3rem !important}.pe-lg-0{padding-right:0 !important}.pe-lg-1{padding-right:.25rem !important}.pe-lg-2{padding-right:.5rem !important}.pe-lg-3{padding-right:1rem !important}.pe-lg-4{padding-right:1.5rem !important}.pe-lg-5{padding-right:3rem !important}.pb-lg-0{padding-bottom:0 !important}.pb-lg-1{padding-bottom:.25rem !important}.pb-lg-2{padding-bottom:.5rem !important}.pb-lg-3{padding-bottom:1rem !important}.pb-lg-4{padding-bottom:1.5rem !important}.pb-lg-5{padding-bottom:3rem !important}.ps-lg-0{padding-left:0 !important}.ps-lg-1{padding-left:.25rem !important}.ps-lg-2{padding-left:.5rem !important}.ps-lg-3{padding-left:1rem !important}.ps-lg-4{padding-left:1.5rem !important}.ps-lg-5{padding-left:3rem !important}.gap-lg-0{gap:0 !important}.gap-lg-1{gap:.25rem !important}.gap-lg-2{gap:.5rem !important}.gap-lg-3{gap:1rem !important}.gap-lg-4{gap:1.5rem !important}.gap-lg-5{gap:3rem !important}.row-gap-lg-0{row-gap:0 !important}.row-gap-lg-1{row-gap:.25rem !important}.row-gap-lg-2{row-gap:.5rem !important}.row-gap-lg-3{row-gap:1rem !important}.row-gap-lg-4{row-gap:1.5rem !important}.row-gap-lg-5{row-gap:3rem !important}.column-gap-lg-0{column-gap:0 !important}.column-gap-lg-1{column-gap:.25rem !important}.column-gap-lg-2{column-gap:.5rem !important}.column-gap-lg-3{column-gap:1rem !important}.column-gap-lg-4{column-gap:1.5rem !important}.column-gap-lg-5{column-gap:3rem !important}.text-lg-start{text-align:left !important}.text-lg-end{text-align:right !important}.text-lg-center{text-align:center !important}}@media(min-width: 1200px){.float-xl-start{float:left !important}.float-xl-end{float:right !important}.float-xl-none{float:none !important}.object-fit-xl-contain{object-fit:contain !important}.object-fit-xl-cover{object-fit:cover !important}.object-fit-xl-fill{object-fit:fill !important}.object-fit-xl-scale{object-fit:scale-down !important}.object-fit-xl-none{object-fit:none !important}.d-xl-inline{display:inline !important}.d-xl-inline-block{display:inline-block !important}.d-xl-block{display:block !important}.d-xl-grid{display:grid !important}.d-xl-inline-grid{display:inline-grid !important}.d-xl-table{display:table !important}.d-xl-table-row{display:table-row !important}.d-xl-table-cell{display:table-cell !important}.d-xl-flex{display:flex !important}.d-xl-inline-flex{display:inline-flex !important}.d-xl-none{display:none !important}.flex-xl-fill{flex:1 1 auto !important}.flex-xl-row{flex-direction:row !important}.flex-xl-column{flex-direction:column !important}.flex-xl-row-reverse{flex-direction:row-reverse !important}.flex-xl-column-reverse{flex-direction:column-reverse !important}.flex-xl-grow-0{flex-grow:0 !important}.flex-xl-grow-1{flex-grow:1 !important}.flex-xl-shrink-0{flex-shrink:0 !important}.flex-xl-shrink-1{flex-shrink:1 !important}.flex-xl-wrap{flex-wrap:wrap !important}.flex-xl-nowrap{flex-wrap:nowrap !important}.flex-xl-wrap-reverse{flex-wrap:wrap-reverse !important}.justify-content-xl-start{justify-content:flex-start !important}.justify-content-xl-end{justify-content:flex-end !important}.justify-content-xl-center{justify-content:center !important}.justify-content-xl-between{justify-content:space-between !important}.justify-content-xl-around{justify-content:space-around !important}.justify-content-xl-evenly{justify-content:space-evenly !important}.align-items-xl-start{align-items:flex-start !important}.align-items-xl-end{align-items:flex-end !important}.align-items-xl-center{align-items:center !important}.align-items-xl-baseline{align-items:baseline !important}.align-items-xl-stretch{align-items:stretch !important}.align-content-xl-start{align-content:flex-start !important}.align-content-xl-end{align-content:flex-end !important}.align-content-xl-center{align-content:center !important}.align-content-xl-between{align-content:space-between !important}.align-content-xl-around{align-content:space-around !important}.align-content-xl-stretch{align-content:stretch !important}.align-self-xl-auto{align-self:auto !important}.align-self-xl-start{align-self:flex-start !important}.align-self-xl-end{align-self:flex-end !important}.align-self-xl-center{align-self:center !important}.align-self-xl-baseline{align-self:baseline !important}.align-self-xl-stretch{align-self:stretch !important}.order-xl-first{order:-1 !important}.order-xl-0{order:0 !important}.order-xl-1{order:1 !important}.order-xl-2{order:2 !important}.order-xl-3{order:3 !important}.order-xl-4{order:4 !important}.order-xl-5{order:5 !important}.order-xl-last{order:6 !important}.m-xl-0{margin:0 !important}.m-xl-1{margin:.25rem !important}.m-xl-2{margin:.5rem !important}.m-xl-3{margin:1rem !important}.m-xl-4{margin:1.5rem !important}.m-xl-5{margin:3rem !important}.m-xl-auto{margin:auto !important}.mx-xl-0{margin-right:0 !important;margin-left:0 !important}.mx-xl-1{margin-right:.25rem !important;margin-left:.25rem !important}.mx-xl-2{margin-right:.5rem !important;margin-left:.5rem !important}.mx-xl-3{margin-right:1rem !important;margin-left:1rem !important}.mx-xl-4{margin-right:1.5rem !important;margin-left:1.5rem !important}.mx-xl-5{margin-right:3rem !important;margin-left:3rem !important}.mx-xl-auto{margin-right:auto !important;margin-left:auto !important}.my-xl-0{margin-top:0 !important;margin-bottom:0 !important}.my-xl-1{margin-top:.25rem !important;margin-bottom:.25rem !important}.my-xl-2{margin-top:.5rem !important;margin-bottom:.5rem !important}.my-xl-3{margin-top:1rem !important;margin-bottom:1rem !important}.my-xl-4{margin-top:1.5rem !important;margin-bottom:1.5rem !important}.my-xl-5{margin-top:3rem !important;margin-bottom:3rem !important}.my-xl-auto{margin-top:auto !important;margin-bottom:auto !important}.mt-xl-0{margin-top:0 !important}.mt-xl-1{margin-top:.25rem !important}.mt-xl-2{margin-top:.5rem !important}.mt-xl-3{margin-top:1rem !important}.mt-xl-4{margin-top:1.5rem !important}.mt-xl-5{margin-top:3rem !important}.mt-xl-auto{margin-top:auto !important}.me-xl-0{margin-right:0 !important}.me-xl-1{margin-right:.25rem !important}.me-xl-2{margin-right:.5rem !important}.me-xl-3{margin-right:1rem !important}.me-xl-4{margin-right:1.5rem !important}.me-xl-5{margin-right:3rem !important}.me-xl-auto{margin-right:auto !important}.mb-xl-0{margin-bottom:0 !important}.mb-xl-1{margin-bottom:.25rem !important}.mb-xl-2{margin-bottom:.5rem !important}.mb-xl-3{margin-bottom:1rem !important}.mb-xl-4{margin-bottom:1.5rem !important}.mb-xl-5{margin-bottom:3rem !important}.mb-xl-auto{margin-bottom:auto !important}.ms-xl-0{margin-left:0 !important}.ms-xl-1{margin-left:.25rem !important}.ms-xl-2{margin-left:.5rem !important}.ms-xl-3{margin-left:1rem !important}.ms-xl-4{margin-left:1.5rem !important}.ms-xl-5{margin-left:3rem !important}.ms-xl-auto{margin-left:auto !important}.p-xl-0{padding:0 !important}.p-xl-1{padding:.25rem !important}.p-xl-2{padding:.5rem !important}.p-xl-3{padding:1rem !important}.p-xl-4{padding:1.5rem !important}.p-xl-5{padding:3rem !important}.px-xl-0{padding-right:0 !important;padding-left:0 !important}.px-xl-1{padding-right:.25rem !important;padding-left:.25rem !important}.px-xl-2{padding-right:.5rem !important;padding-left:.5rem !important}.px-xl-3{padding-right:1rem !important;padding-left:1rem !important}.px-xl-4{padding-right:1.5rem !important;padding-left:1.5rem !important}.px-xl-5{padding-right:3rem !important;padding-left:3rem !important}.py-xl-0{padding-top:0 !important;padding-bottom:0 !important}.py-xl-1{padding-top:.25rem !important;padding-bottom:.25rem !important}.py-xl-2{padding-top:.5rem !important;padding-bottom:.5rem !important}.py-xl-3{padding-top:1rem !important;padding-bottom:1rem !important}.py-xl-4{padding-top:1.5rem !important;padding-bottom:1.5rem !important}.py-xl-5{padding-top:3rem !important;padding-bottom:3rem !important}.pt-xl-0{padding-top:0 !important}.pt-xl-1{padding-top:.25rem !important}.pt-xl-2{padding-top:.5rem !important}.pt-xl-3{padding-top:1rem !important}.pt-xl-4{padding-top:1.5rem !important}.pt-xl-5{padding-top:3rem !important}.pe-xl-0{padding-right:0 !important}.pe-xl-1{padding-right:.25rem !important}.pe-xl-2{padding-right:.5rem !important}.pe-xl-3{padding-right:1rem !important}.pe-xl-4{padding-right:1.5rem !important}.pe-xl-5{padding-right:3rem !important}.pb-xl-0{padding-bottom:0 !important}.pb-xl-1{padding-bottom:.25rem !important}.pb-xl-2{padding-bottom:.5rem !important}.pb-xl-3{padding-bottom:1rem !important}.pb-xl-4{padding-bottom:1.5rem !important}.pb-xl-5{padding-bottom:3rem !important}.ps-xl-0{padding-left:0 !important}.ps-xl-1{padding-left:.25rem !important}.ps-xl-2{padding-left:.5rem !important}.ps-xl-3{padding-left:1rem !important}.ps-xl-4{padding-left:1.5rem !important}.ps-xl-5{padding-left:3rem !important}.gap-xl-0{gap:0 !important}.gap-xl-1{gap:.25rem !important}.gap-xl-2{gap:.5rem !important}.gap-xl-3{gap:1rem !important}.gap-xl-4{gap:1.5rem !important}.gap-xl-5{gap:3rem !important}.row-gap-xl-0{row-gap:0 !important}.row-gap-xl-1{row-gap:.25rem !important}.row-gap-xl-2{row-gap:.5rem !important}.row-gap-xl-3{row-gap:1rem !important}.row-gap-xl-4{row-gap:1.5rem !important}.row-gap-xl-5{row-gap:3rem !important}.column-gap-xl-0{column-gap:0 !important}.column-gap-xl-1{column-gap:.25rem !important}.column-gap-xl-2{column-gap:.5rem !important}.column-gap-xl-3{column-gap:1rem !important}.column-gap-xl-4{column-gap:1.5rem !important}.column-gap-xl-5{column-gap:3rem !important}.text-xl-start{text-align:left !important}.text-xl-end{text-align:right !important}.text-xl-center{text-align:center !important}}@media(min-width: 1400px){.float-xxl-start{float:left !important}.float-xxl-end{float:right !important}.float-xxl-none{float:none !important}.object-fit-xxl-contain{object-fit:contain !important}.object-fit-xxl-cover{object-fit:cover !important}.object-fit-xxl-fill{object-fit:fill !important}.object-fit-xxl-scale{object-fit:scale-down !important}.object-fit-xxl-none{object-fit:none !important}.d-xxl-inline{display:inline !important}.d-xxl-inline-block{display:inline-block !important}.d-xxl-block{display:block !important}.d-xxl-grid{display:grid !important}.d-xxl-inline-grid{display:inline-grid !important}.d-xxl-table{display:table !important}.d-xxl-table-row{display:table-row !important}.d-xxl-table-cell{display:table-cell !important}.d-xxl-flex{display:flex !important}.d-xxl-inline-flex{display:inline-flex !important}.d-xxl-none{display:none !important}.flex-xxl-fill{flex:1 1 auto !important}.flex-xxl-row{flex-direction:row !important}.flex-xxl-column{flex-direction:column !important}.flex-xxl-row-reverse{flex-direction:row-reverse !important}.flex-xxl-column-reverse{flex-direction:column-reverse !important}.flex-xxl-grow-0{flex-grow:0 !important}.flex-xxl-grow-1{flex-grow:1 !important}.flex-xxl-shrink-0{flex-shrink:0 !important}.flex-xxl-shrink-1{flex-shrink:1 !important}.flex-xxl-wrap{flex-wrap:wrap !important}.flex-xxl-nowrap{flex-wrap:nowrap !important}.flex-xxl-wrap-reverse{flex-wrap:wrap-reverse !important}.justify-content-xxl-start{justify-content:flex-start !important}.justify-content-xxl-end{justify-content:flex-end !important}.justify-content-xxl-center{justify-content:center !important}.justify-content-xxl-between{justify-content:space-between !important}.justify-content-xxl-around{justify-content:space-around !important}.justify-content-xxl-evenly{justify-content:space-evenly !important}.align-items-xxl-start{align-items:flex-start !important}.align-items-xxl-end{align-items:flex-end !important}.align-items-xxl-center{align-items:center !important}.align-items-xxl-baseline{align-items:baseline !important}.align-items-xxl-stretch{align-items:stretch !important}.align-content-xxl-start{align-content:flex-start !important}.align-content-xxl-end{align-content:flex-end !important}.align-content-xxl-center{align-content:center !important}.align-content-xxl-between{align-content:space-between !important}.align-content-xxl-around{align-content:space-around !important}.align-content-xxl-stretch{align-content:stretch !important}.align-self-xxl-auto{align-self:auto !important}.align-self-xxl-start{align-self:flex-start !important}.align-self-xxl-end{align-self:flex-end !important}.align-self-xxl-center{align-self:center !important}.align-self-xxl-baseline{align-self:baseline !important}.align-self-xxl-stretch{align-self:stretch !important}.order-xxl-first{order:-1 !important}.order-xxl-0{order:0 !important}.order-xxl-1{order:1 !important}.order-xxl-2{order:2 !important}.order-xxl-3{order:3 !important}.order-xxl-4{order:4 !important}.order-xxl-5{order:5 !important}.order-xxl-last{order:6 !important}.m-xxl-0{margin:0 !important}.m-xxl-1{margin:.25rem !important}.m-xxl-2{margin:.5rem !important}.m-xxl-3{margin:1rem !important}.m-xxl-4{margin:1.5rem !important}.m-xxl-5{margin:3rem !important}.m-xxl-auto{margin:auto !important}.mx-xxl-0{margin-right:0 !important;margin-left:0 !important}.mx-xxl-1{margin-right:.25rem !important;margin-left:.25rem !important}.mx-xxl-2{margin-right:.5rem !important;margin-left:.5rem !important}.mx-xxl-3{margin-right:1rem !important;margin-left:1rem !important}.mx-xxl-4{margin-right:1.5rem !important;margin-left:1.5rem !important}.mx-xxl-5{margin-right:3rem !important;margin-left:3rem !important}.mx-xxl-auto{margin-right:auto !important;margin-left:auto !important}.my-xxl-0{margin-top:0 !important;margin-bottom:0 !important}.my-xxl-1{margin-top:.25rem !important;margin-bottom:.25rem !important}.my-xxl-2{margin-top:.5rem !important;margin-bottom:.5rem !important}.my-xxl-3{margin-top:1rem !important;margin-bottom:1rem !important}.my-xxl-4{margin-top:1.5rem !important;margin-bottom:1.5rem !important}.my-xxl-5{margin-top:3rem !important;margin-bottom:3rem !important}.my-xxl-auto{margin-top:auto !important;margin-bottom:auto !important}.mt-xxl-0{margin-top:0 !important}.mt-xxl-1{margin-top:.25rem !important}.mt-xxl-2{margin-top:.5rem !important}.mt-xxl-3{margin-top:1rem !important}.mt-xxl-4{margin-top:1.5rem !important}.mt-xxl-5{margin-top:3rem !important}.mt-xxl-auto{margin-top:auto !important}.me-xxl-0{margin-right:0 !important}.me-xxl-1{margin-right:.25rem !important}.me-xxl-2{margin-right:.5rem !important}.me-xxl-3{margin-right:1rem !important}.me-xxl-4{margin-right:1.5rem !important}.me-xxl-5{margin-right:3rem !important}.me-xxl-auto{margin-right:auto !important}.mb-xxl-0{margin-bottom:0 !important}.mb-xxl-1{margin-bottom:.25rem !important}.mb-xxl-2{margin-bottom:.5rem !important}.mb-xxl-3{margin-bottom:1rem !important}.mb-xxl-4{margin-bottom:1.5rem !important}.mb-xxl-5{margin-bottom:3rem !important}.mb-xxl-auto{margin-bottom:auto !important}.ms-xxl-0{margin-left:0 !important}.ms-xxl-1{margin-left:.25rem !important}.ms-xxl-2{margin-left:.5rem !important}.ms-xxl-3{margin-left:1rem !important}.ms-xxl-4{margin-left:1.5rem !important}.ms-xxl-5{margin-left:3rem !important}.ms-xxl-auto{margin-left:auto !important}.p-xxl-0{padding:0 !important}.p-xxl-1{padding:.25rem !important}.p-xxl-2{padding:.5rem !important}.p-xxl-3{padding:1rem !important}.p-xxl-4{padding:1.5rem !important}.p-xxl-5{padding:3rem !important}.px-xxl-0{padding-right:0 !important;padding-left:0 !important}.px-xxl-1{padding-right:.25rem !important;padding-left:.25rem !important}.px-xxl-2{padding-right:.5rem !important;padding-left:.5rem !important}.px-xxl-3{padding-right:1rem !important;padding-left:1rem !important}.px-xxl-4{padding-right:1.5rem !important;padding-left:1.5rem !important}.px-xxl-5{padding-right:3rem !important;padding-left:3rem !important}.py-xxl-0{padding-top:0 !important;padding-bottom:0 !important}.py-xxl-1{padding-top:.25rem !important;padding-bottom:.25rem !important}.py-xxl-2{padding-top:.5rem !important;padding-bottom:.5rem !important}.py-xxl-3{padding-top:1rem !important;padding-bottom:1rem !important}.py-xxl-4{padding-top:1.5rem !important;padding-bottom:1.5rem !important}.py-xxl-5{padding-top:3rem !important;padding-bottom:3rem !important}.pt-xxl-0{padding-top:0 !important}.pt-xxl-1{padding-top:.25rem !important}.pt-xxl-2{padding-top:.5rem !important}.pt-xxl-3{padding-top:1rem !important}.pt-xxl-4{padding-top:1.5rem !important}.pt-xxl-5{padding-top:3rem !important}.pe-xxl-0{padding-right:0 !important}.pe-xxl-1{padding-right:.25rem !important}.pe-xxl-2{padding-right:.5rem !important}.pe-xxl-3{padding-right:1rem !important}.pe-xxl-4{padding-right:1.5rem !important}.pe-xxl-5{padding-right:3rem !important}.pb-xxl-0{padding-bottom:0 !important}.pb-xxl-1{padding-bottom:.25rem !important}.pb-xxl-2{padding-bottom:.5rem !important}.pb-xxl-3{padding-bottom:1rem !important}.pb-xxl-4{padding-bottom:1.5rem !important}.pb-xxl-5{padding-bottom:3rem !important}.ps-xxl-0{padding-left:0 !important}.ps-xxl-1{padding-left:.25rem !important}.ps-xxl-2{padding-left:.5rem !important}.ps-xxl-3{padding-left:1rem !important}.ps-xxl-4{padding-left:1.5rem !important}.ps-xxl-5{padding-left:3rem !important}.gap-xxl-0{gap:0 !important}.gap-xxl-1{gap:.25rem !important}.gap-xxl-2{gap:.5rem !important}.gap-xxl-3{gap:1rem !important}.gap-xxl-4{gap:1.5rem !important}.gap-xxl-5{gap:3rem !important}.row-gap-xxl-0{row-gap:0 !important}.row-gap-xxl-1{row-gap:.25rem !important}.row-gap-xxl-2{row-gap:.5rem !important}.row-gap-xxl-3{row-gap:1rem !important}.row-gap-xxl-4{row-gap:1.5rem !important}.row-gap-xxl-5{row-gap:3rem !important}.column-gap-xxl-0{column-gap:0 !important}.column-gap-xxl-1{column-gap:.25rem !important}.column-gap-xxl-2{column-gap:.5rem !important}.column-gap-xxl-3{column-gap:1rem !important}.column-gap-xxl-4{column-gap:1.5rem !important}.column-gap-xxl-5{column-gap:3rem !important}.text-xxl-start{text-align:left !important}.text-xxl-end{text-align:right !important}.text-xxl-center{text-align:center !important}}.bg-default{color:#000}.bg-primary{color:#fff}.bg-secondary{color:#fff}.bg-success{color:#fff}.bg-info{color:#000}.bg-warning{color:#000}.bg-danger{color:#fff}.bg-light{color:#000}.bg-dark{color:#fff}@media(min-width: 1200px){.fs-1{font-size:2rem !important}.fs-2{font-size:1.65rem !important}.fs-3{font-size:1.45rem !important}}@media print{.d-print-inline{display:inline !important}.d-print-inline-block{display:inline-block !important}.d-print-block{display:block !important}.d-print-grid{display:grid !important}.d-print-inline-grid{display:inline-grid !important}.d-print-table{display:table !important}.d-print-table-row{display:table-row !important}.d-print-table-cell{display:table-cell !important}.d-print-flex{display:flex !important}.d-print-inline-flex{display:inline-flex !important}.d-print-none{display:none !important}}:root{--bslib-spacer: 1rem;--bslib-mb-spacer: var(--bslib-spacer, 1rem)}.bslib-mb-spacing{margin-bottom:var(--bslib-mb-spacer)}.bslib-gap-spacing{gap:var(--bslib-mb-spacer)}.bslib-gap-spacing>.bslib-mb-spacing,.bslib-gap-spacing>.form-group,.bslib-gap-spacing>p,.bslib-gap-spacing>pre{margin-bottom:0}.html-fill-container>.html-fill-item.bslib-mb-spacing{margin-bottom:0}.tab-content>.tab-pane.html-fill-container{display:none}.tab-content>.active.html-fill-container{display:flex}.tab-content.html-fill-container{padding:0}.bg-blue{--bslib-color-bg: #0d6efd;--bslib-color-fg: #ffffff;background-color:var(--bslib-color-bg);color:var(--bslib-color-fg)}.text-blue{--bslib-color-fg: #0d6efd;color:var(--bslib-color-fg)}.bg-indigo{--bslib-color-bg: #6610f2;--bslib-color-fg: #ffffff;background-color:var(--bslib-color-bg);color:var(--bslib-color-fg)}.text-indigo{--bslib-color-fg: #6610f2;color:var(--bslib-color-fg)}.bg-purple{--bslib-color-bg: #6f42c1;--bslib-color-fg: #ffffff;background-color:var(--bslib-color-bg);color:var(--bslib-color-fg)}.text-purple{--bslib-color-fg: #6f42c1;color:var(--bslib-color-fg)}.bg-pink{--bslib-color-bg: #d63384;--bslib-color-fg: #ffffff;background-color:var(--bslib-color-bg);color:var(--bslib-color-fg)}.text-pink{--bslib-color-fg: #d63384;color:var(--bslib-color-fg)}.bg-red{--bslib-color-bg: #dc3545;--bslib-color-fg: #ffffff;background-color:var(--bslib-color-bg);color:var(--bslib-color-fg)}.text-red{--bslib-color-fg: #dc3545;color:var(--bslib-color-fg)}.bg-orange{--bslib-color-bg: #fd7e14;--bslib-color-fg: #000;background-color:var(--bslib-color-bg);color:var(--bslib-color-fg)}.text-orange{--bslib-color-fg: #fd7e14;color:var(--bslib-color-fg)}.bg-yellow{--bslib-color-bg: #ffc107;--bslib-color-fg: #000;background-color:var(--bslib-color-bg);color:var(--bslib-color-fg)}.text-yellow{--bslib-color-fg: #ffc107;color:var(--bslib-color-fg)}.bg-green{--bslib-color-bg: #198754;--bslib-color-fg: #ffffff;background-color:var(--bslib-color-bg);color:var(--bslib-color-fg)}.text-green{--bslib-color-fg: #198754;color:var(--bslib-color-fg)}.bg-teal{--bslib-color-bg: #20c997;--bslib-color-fg: #000;background-color:var(--bslib-color-bg);color:var(--bslib-color-fg)}.text-teal{--bslib-color-fg: #20c997;color:var(--bslib-color-fg)}.bg-cyan{--bslib-color-bg: #0dcaf0;--bslib-color-fg: #000;background-color:var(--bslib-color-bg);color:var(--bslib-color-fg)}.text-cyan{--bslib-color-fg: #0dcaf0;color:var(--bslib-color-fg)}.text-default{--bslib-color-fg: #dee2e6}.bg-default{--bslib-color-bg: #dee2e6;--bslib-color-fg: #000}.text-primary{--bslib-color-fg: #0d6efd}.bg-primary{--bslib-color-bg: #0d6efd;--bslib-color-fg: #ffffff}.text-secondary{--bslib-color-fg: #6c757d}.bg-secondary{--bslib-color-bg: #6c757d;--bslib-color-fg: #ffffff}.text-success{--bslib-color-fg: #198754}.bg-success{--bslib-color-bg: #198754;--bslib-color-fg: #ffffff}.text-info{--bslib-color-fg: #0dcaf0}.bg-info{--bslib-color-bg: #0dcaf0;--bslib-color-fg: #000}.text-warning{--bslib-color-fg: #ffc107}.bg-warning{--bslib-color-bg: #ffc107;--bslib-color-fg: #000}.text-danger{--bslib-color-fg: #dc3545}.bg-danger{--bslib-color-bg: #dc3545;--bslib-color-fg: #ffffff}.text-light{--bslib-color-fg: #f8f9fa}.bg-light{--bslib-color-bg: #f8f9fa;--bslib-color-fg: #000}.text-dark{--bslib-color-fg: #212529}.bg-dark{--bslib-color-bg: #212529;--bslib-color-fg: #ffffff}.bg-gradient-blue-indigo{--bslib-color-fg: #ffffff;--bslib-color-bg: #3148f9;background:linear-gradient(var(--bg-gradient-deg, 140deg), #0d6efd var(--bg-gradient-start, 36%), #6610f2 var(--bg-gradient-end, 180%)) #3148f9;color:#fff}.bg-gradient-blue-purple{--bslib-color-fg: #ffffff;--bslib-color-bg: #345ce5;background:linear-gradient(var(--bg-gradient-deg, 140deg), #0d6efd var(--bg-gradient-start, 36%), #6f42c1 var(--bg-gradient-end, 180%)) #345ce5;color:#fff}.bg-gradient-blue-pink{--bslib-color-fg: #ffffff;--bslib-color-bg: #5d56cd;background:linear-gradient(var(--bg-gradient-deg, 140deg), #0d6efd var(--bg-gradient-start, 36%), #d63384 var(--bg-gradient-end, 180%)) #5d56cd;color:#fff}.bg-gradient-blue-red{--bslib-color-fg: #ffffff;--bslib-color-bg: #6057b3;background:linear-gradient(var(--bg-gradient-deg, 140deg), #0d6efd var(--bg-gradient-start, 36%), #dc3545 var(--bg-gradient-end, 180%)) #6057b3;color:#fff}.bg-gradient-blue-orange{--bslib-color-fg: #ffffff;--bslib-color-bg: #6d74a0;background:linear-gradient(var(--bg-gradient-deg, 140deg), #0d6efd var(--bg-gradient-start, 36%), #fd7e14 var(--bg-gradient-end, 180%)) #6d74a0;color:#fff}.bg-gradient-blue-yellow{--bslib-color-fg: #000;--bslib-color-bg: #6e8f9b;background:linear-gradient(var(--bg-gradient-deg, 140deg), #0d6efd var(--bg-gradient-start, 36%), #ffc107 var(--bg-gradient-end, 180%)) #6e8f9b;color:#000}.bg-gradient-blue-green{--bslib-color-fg: #ffffff;--bslib-color-bg: #1278b9;background:linear-gradient(var(--bg-gradient-deg, 140deg), #0d6efd var(--bg-gradient-start, 36%), #198754 var(--bg-gradient-end, 180%)) #1278b9;color:#fff}.bg-gradient-blue-teal{--bslib-color-fg: #000;--bslib-color-bg: #1592d4;background:linear-gradient(var(--bg-gradient-deg, 140deg), #0d6efd var(--bg-gradient-start, 36%), #20c997 var(--bg-gradient-end, 180%)) #1592d4;color:#000}.bg-gradient-blue-cyan{--bslib-color-fg: #000;--bslib-color-bg: #0d93f8;background:linear-gradient(var(--bg-gradient-deg, 140deg), #0d6efd var(--bg-gradient-start, 36%), #0dcaf0 var(--bg-gradient-end, 180%)) #0d93f8;color:#000}.bg-gradient-indigo-blue{--bslib-color-fg: #ffffff;--bslib-color-bg: #4236f6;background:linear-gradient(var(--bg-gradient-deg, 140deg), #6610f2 var(--bg-gradient-start, 36%), #0d6efd var(--bg-gradient-end, 180%)) #4236f6;color:#fff}.bg-gradient-indigo-purple{--bslib-color-fg: #ffffff;--bslib-color-bg: #6a24de;background:linear-gradient(var(--bg-gradient-deg, 140deg), #6610f2 var(--bg-gradient-start, 36%), #6f42c1 var(--bg-gradient-end, 180%)) #6a24de;color:#fff}.bg-gradient-indigo-pink{--bslib-color-fg: #ffffff;--bslib-color-bg: #931ec6;background:linear-gradient(var(--bg-gradient-deg, 140deg), #6610f2 var(--bg-gradient-start, 36%), #d63384 var(--bg-gradient-end, 180%)) #931ec6;color:#fff}.bg-gradient-indigo-red{--bslib-color-fg: #ffffff;--bslib-color-bg: #951fad;background:linear-gradient(var(--bg-gradient-deg, 140deg), #6610f2 var(--bg-gradient-start, 36%), #dc3545 var(--bg-gradient-end, 180%)) #951fad;color:#fff}.bg-gradient-indigo-orange{--bslib-color-fg: #ffffff;--bslib-color-bg: #a23c99;background:linear-gradient(var(--bg-gradient-deg, 140deg), #6610f2 var(--bg-gradient-start, 36%), #fd7e14 var(--bg-gradient-end, 180%)) #a23c99;color:#fff}.bg-gradient-indigo-yellow{--bslib-color-fg: #ffffff;--bslib-color-bg: #a35794;background:linear-gradient(var(--bg-gradient-deg, 140deg), #6610f2 var(--bg-gradient-start, 36%), #ffc107 var(--bg-gradient-end, 180%)) #a35794;color:#fff}.bg-gradient-indigo-green{--bslib-color-fg: #ffffff;--bslib-color-bg: #4740b3;background:linear-gradient(var(--bg-gradient-deg, 140deg), #6610f2 var(--bg-gradient-start, 36%), #198754 var(--bg-gradient-end, 180%)) #4740b3;color:#fff}.bg-gradient-indigo-teal{--bslib-color-fg: #ffffff;--bslib-color-bg: #4a5ace;background:linear-gradient(var(--bg-gradient-deg, 140deg), #6610f2 var(--bg-gradient-start, 36%), #20c997 var(--bg-gradient-end, 180%)) #4a5ace;color:#fff}.bg-gradient-indigo-cyan{--bslib-color-fg: #ffffff;--bslib-color-bg: #425af1;background:linear-gradient(var(--bg-gradient-deg, 140deg), #6610f2 var(--bg-gradient-start, 36%), #0dcaf0 var(--bg-gradient-end, 180%)) #425af1;color:#fff}.bg-gradient-purple-blue{--bslib-color-fg: #ffffff;--bslib-color-bg: #4854d9;background:linear-gradient(var(--bg-gradient-deg, 140deg), #6f42c1 var(--bg-gradient-start, 36%), #0d6efd var(--bg-gradient-end, 180%)) #4854d9;color:#fff}.bg-gradient-purple-indigo{--bslib-color-fg: #ffffff;--bslib-color-bg: #6b2ed5;background:linear-gradient(var(--bg-gradient-deg, 140deg), #6f42c1 var(--bg-gradient-start, 36%), #6610f2 var(--bg-gradient-end, 180%)) #6b2ed5;color:#fff}.bg-gradient-purple-pink{--bslib-color-fg: #ffffff;--bslib-color-bg: #983ca9;background:linear-gradient(var(--bg-gradient-deg, 140deg), #6f42c1 var(--bg-gradient-start, 36%), #d63384 var(--bg-gradient-end, 180%)) #983ca9;color:#fff}.bg-gradient-purple-red{--bslib-color-fg: #ffffff;--bslib-color-bg: #9b3d8f;background:linear-gradient(var(--bg-gradient-deg, 140deg), #6f42c1 var(--bg-gradient-start, 36%), #dc3545 var(--bg-gradient-end, 180%)) #9b3d8f;color:#fff}.bg-gradient-purple-orange{--bslib-color-fg: #ffffff;--bslib-color-bg: #a85a7c;background:linear-gradient(var(--bg-gradient-deg, 140deg), #6f42c1 var(--bg-gradient-start, 36%), #fd7e14 var(--bg-gradient-end, 180%)) #a85a7c;color:#fff}.bg-gradient-purple-yellow{--bslib-color-fg: #000;--bslib-color-bg: #a97577;background:linear-gradient(var(--bg-gradient-deg, 140deg), #6f42c1 var(--bg-gradient-start, 36%), #ffc107 var(--bg-gradient-end, 180%)) #a97577;color:#000}.bg-gradient-purple-green{--bslib-color-fg: #ffffff;--bslib-color-bg: #4d5e95;background:linear-gradient(var(--bg-gradient-deg, 140deg), #6f42c1 var(--bg-gradient-start, 36%), #198754 var(--bg-gradient-end, 180%)) #4d5e95;color:#fff}.bg-gradient-purple-teal{--bslib-color-fg: #ffffff;--bslib-color-bg: #4f78b0;background:linear-gradient(var(--bg-gradient-deg, 140deg), #6f42c1 var(--bg-gradient-start, 36%), #20c997 var(--bg-gradient-end, 180%)) #4f78b0;color:#fff}.bg-gradient-purple-cyan{--bslib-color-fg: #000;--bslib-color-bg: #4878d4;background:linear-gradient(var(--bg-gradient-deg, 140deg), #6f42c1 var(--bg-gradient-start, 36%), #0dcaf0 var(--bg-gradient-end, 180%)) #4878d4;color:#000}.bg-gradient-pink-blue{--bslib-color-fg: #ffffff;--bslib-color-bg: #864bb4;background:linear-gradient(var(--bg-gradient-deg, 140deg), #d63384 var(--bg-gradient-start, 36%), #0d6efd var(--bg-gradient-end, 180%)) #864bb4;color:#fff}.bg-gradient-pink-indigo{--bslib-color-fg: #ffffff;--bslib-color-bg: #a925b0;background:linear-gradient(var(--bg-gradient-deg, 140deg), #d63384 var(--bg-gradient-start, 36%), #6610f2 var(--bg-gradient-end, 180%)) #a925b0;color:#fff}.bg-gradient-pink-purple{--bslib-color-fg: #ffffff;--bslib-color-bg: #ad399c;background:linear-gradient(var(--bg-gradient-deg, 140deg), #d63384 var(--bg-gradient-start, 36%), #6f42c1 var(--bg-gradient-end, 180%)) #ad399c;color:#fff}.bg-gradient-pink-red{--bslib-color-fg: #ffffff;--bslib-color-bg: #d8346b;background:linear-gradient(var(--bg-gradient-deg, 140deg), #d63384 var(--bg-gradient-start, 36%), #dc3545 var(--bg-gradient-end, 180%)) #d8346b;color:#fff}.bg-gradient-pink-orange{--bslib-color-fg: #000;--bslib-color-bg: #e65157;background:linear-gradient(var(--bg-gradient-deg, 140deg), #d63384 var(--bg-gradient-start, 36%), #fd7e14 var(--bg-gradient-end, 180%)) #e65157;color:#000}.bg-gradient-pink-yellow{--bslib-color-fg: #000;--bslib-color-bg: #e66c52;background:linear-gradient(var(--bg-gradient-deg, 140deg), #d63384 var(--bg-gradient-start, 36%), #ffc107 var(--bg-gradient-end, 180%)) #e66c52;color:#000}.bg-gradient-pink-green{--bslib-color-fg: #ffffff;--bslib-color-bg: #8a5571;background:linear-gradient(var(--bg-gradient-deg, 140deg), #d63384 var(--bg-gradient-start, 36%), #198754 var(--bg-gradient-end, 180%)) #8a5571;color:#fff}.bg-gradient-pink-teal{--bslib-color-fg: #000;--bslib-color-bg: #8d6f8c;background:linear-gradient(var(--bg-gradient-deg, 140deg), #d63384 var(--bg-gradient-start, 36%), #20c997 var(--bg-gradient-end, 180%)) #8d6f8c;color:#000}.bg-gradient-pink-cyan{--bslib-color-fg: #000;--bslib-color-bg: #866faf;background:linear-gradient(var(--bg-gradient-deg, 140deg), #d63384 var(--bg-gradient-start, 36%), #0dcaf0 var(--bg-gradient-end, 180%)) #866faf;color:#000}.bg-gradient-red-blue{--bslib-color-fg: #ffffff;--bslib-color-bg: #894c8f;background:linear-gradient(var(--bg-gradient-deg, 140deg), #dc3545 var(--bg-gradient-start, 36%), #0d6efd var(--bg-gradient-end, 180%)) #894c8f;color:#fff}.bg-gradient-red-indigo{--bslib-color-fg: #ffffff;--bslib-color-bg: #ad268a;background:linear-gradient(var(--bg-gradient-deg, 140deg), #dc3545 var(--bg-gradient-start, 36%), #6610f2 var(--bg-gradient-end, 180%)) #ad268a;color:#fff}.bg-gradient-red-purple{--bslib-color-fg: #ffffff;--bslib-color-bg: #b03a77;background:linear-gradient(var(--bg-gradient-deg, 140deg), #dc3545 var(--bg-gradient-start, 36%), #6f42c1 var(--bg-gradient-end, 180%)) #b03a77;color:#fff}.bg-gradient-red-pink{--bslib-color-fg: #ffffff;--bslib-color-bg: #da345e;background:linear-gradient(var(--bg-gradient-deg, 140deg), #dc3545 var(--bg-gradient-start, 36%), #d63384 var(--bg-gradient-end, 180%)) #da345e;color:#fff}.bg-gradient-red-orange{--bslib-color-fg: #000;--bslib-color-bg: #e95231;background:linear-gradient(var(--bg-gradient-deg, 140deg), #dc3545 var(--bg-gradient-start, 36%), #fd7e14 var(--bg-gradient-end, 180%)) #e95231;color:#000}.bg-gradient-red-yellow{--bslib-color-fg: #000;--bslib-color-bg: #ea6d2c;background:linear-gradient(var(--bg-gradient-deg, 140deg), #dc3545 var(--bg-gradient-start, 36%), #ffc107 var(--bg-gradient-end, 180%)) #ea6d2c;color:#000}.bg-gradient-red-green{--bslib-color-fg: #ffffff;--bslib-color-bg: #8e564b;background:linear-gradient(var(--bg-gradient-deg, 140deg), #dc3545 var(--bg-gradient-start, 36%), #198754 var(--bg-gradient-end, 180%)) #8e564b;color:#fff}.bg-gradient-red-teal{--bslib-color-fg: #000;--bslib-color-bg: #917066;background:linear-gradient(var(--bg-gradient-deg, 140deg), #dc3545 var(--bg-gradient-start, 36%), #20c997 var(--bg-gradient-end, 180%)) #917066;color:#000}.bg-gradient-red-cyan{--bslib-color-fg: #000;--bslib-color-bg: #897189;background:linear-gradient(var(--bg-gradient-deg, 140deg), #dc3545 var(--bg-gradient-start, 36%), #0dcaf0 var(--bg-gradient-end, 180%)) #897189;color:#000}.bg-gradient-orange-blue{--bslib-color-fg: #000;--bslib-color-bg: #9d7871;background:linear-gradient(var(--bg-gradient-deg, 140deg), #fd7e14 var(--bg-gradient-start, 36%), #0d6efd var(--bg-gradient-end, 180%)) #9d7871;color:#000}.bg-gradient-orange-indigo{--bslib-color-fg: #000;--bslib-color-bg: #c1526d;background:linear-gradient(var(--bg-gradient-deg, 140deg), #fd7e14 var(--bg-gradient-start, 36%), #6610f2 var(--bg-gradient-end, 180%)) #c1526d;color:#000}.bg-gradient-orange-purple{--bslib-color-fg: #000;--bslib-color-bg: #c46659;background:linear-gradient(var(--bg-gradient-deg, 140deg), #fd7e14 var(--bg-gradient-start, 36%), #6f42c1 var(--bg-gradient-end, 180%)) #c46659;color:#000}.bg-gradient-orange-pink{--bslib-color-fg: #000;--bslib-color-bg: #ed6041;background:linear-gradient(var(--bg-gradient-deg, 140deg), #fd7e14 var(--bg-gradient-start, 36%), #d63384 var(--bg-gradient-end, 180%)) #ed6041;color:#000}.bg-gradient-orange-red{--bslib-color-fg: #000;--bslib-color-bg: #f06128;background:linear-gradient(var(--bg-gradient-deg, 140deg), #fd7e14 var(--bg-gradient-start, 36%), #dc3545 var(--bg-gradient-end, 180%)) #f06128;color:#000}.bg-gradient-orange-yellow{--bslib-color-fg: #000;--bslib-color-bg: #fe990f;background:linear-gradient(var(--bg-gradient-deg, 140deg), #fd7e14 var(--bg-gradient-start, 36%), #ffc107 var(--bg-gradient-end, 180%)) #fe990f;color:#000}.bg-gradient-orange-green{--bslib-color-fg: #000;--bslib-color-bg: #a2822e;background:linear-gradient(var(--bg-gradient-deg, 140deg), #fd7e14 var(--bg-gradient-start, 36%), #198754 var(--bg-gradient-end, 180%)) #a2822e;color:#000}.bg-gradient-orange-teal{--bslib-color-fg: #000;--bslib-color-bg: #a59c48;background:linear-gradient(var(--bg-gradient-deg, 140deg), #fd7e14 var(--bg-gradient-start, 36%), #20c997 var(--bg-gradient-end, 180%)) #a59c48;color:#000}.bg-gradient-orange-cyan{--bslib-color-fg: #000;--bslib-color-bg: #9d9c6c;background:linear-gradient(var(--bg-gradient-deg, 140deg), #fd7e14 var(--bg-gradient-start, 36%), #0dcaf0 var(--bg-gradient-end, 180%)) #9d9c6c;color:#000}.bg-gradient-yellow-blue{--bslib-color-fg: #000;--bslib-color-bg: #9ea069;background:linear-gradient(var(--bg-gradient-deg, 140deg), #ffc107 var(--bg-gradient-start, 36%), #0d6efd var(--bg-gradient-end, 180%)) #9ea069;color:#000}.bg-gradient-yellow-indigo{--bslib-color-fg: #000;--bslib-color-bg: #c27a65;background:linear-gradient(var(--bg-gradient-deg, 140deg), #ffc107 var(--bg-gradient-start, 36%), #6610f2 var(--bg-gradient-end, 180%)) #c27a65;color:#000}.bg-gradient-yellow-purple{--bslib-color-fg: #000;--bslib-color-bg: #c58e51;background:linear-gradient(var(--bg-gradient-deg, 140deg), #ffc107 var(--bg-gradient-start, 36%), #6f42c1 var(--bg-gradient-end, 180%)) #c58e51;color:#000}.bg-gradient-yellow-pink{--bslib-color-fg: #000;--bslib-color-bg: #ef8839;background:linear-gradient(var(--bg-gradient-deg, 140deg), #ffc107 var(--bg-gradient-start, 36%), #d63384 var(--bg-gradient-end, 180%)) #ef8839;color:#000}.bg-gradient-yellow-red{--bslib-color-fg: #000;--bslib-color-bg: #f18920;background:linear-gradient(var(--bg-gradient-deg, 140deg), #ffc107 var(--bg-gradient-start, 36%), #dc3545 var(--bg-gradient-end, 180%)) #f18920;color:#000}.bg-gradient-yellow-orange{--bslib-color-fg: #000;--bslib-color-bg: #fea60c;background:linear-gradient(var(--bg-gradient-deg, 140deg), #ffc107 var(--bg-gradient-start, 36%), #fd7e14 var(--bg-gradient-end, 180%)) #fea60c;color:#000}.bg-gradient-yellow-green{--bslib-color-fg: #000;--bslib-color-bg: #a3aa26;background:linear-gradient(var(--bg-gradient-deg, 140deg), #ffc107 var(--bg-gradient-start, 36%), #198754 var(--bg-gradient-end, 180%)) #a3aa26;color:#000}.bg-gradient-yellow-teal{--bslib-color-fg: #000;--bslib-color-bg: #a6c441;background:linear-gradient(var(--bg-gradient-deg, 140deg), #ffc107 var(--bg-gradient-start, 36%), #20c997 var(--bg-gradient-end, 180%)) #a6c441;color:#000}.bg-gradient-yellow-cyan{--bslib-color-fg: #000;--bslib-color-bg: #9ec564;background:linear-gradient(var(--bg-gradient-deg, 140deg), #ffc107 var(--bg-gradient-start, 36%), #0dcaf0 var(--bg-gradient-end, 180%)) #9ec564;color:#000}.bg-gradient-green-blue{--bslib-color-fg: #ffffff;--bslib-color-bg: #147d98;background:linear-gradient(var(--bg-gradient-deg, 140deg), #198754 var(--bg-gradient-start, 36%), #0d6efd var(--bg-gradient-end, 180%)) #147d98;color:#fff}.bg-gradient-green-indigo{--bslib-color-fg: #ffffff;--bslib-color-bg: #385793;background:linear-gradient(var(--bg-gradient-deg, 140deg), #198754 var(--bg-gradient-start, 36%), #6610f2 var(--bg-gradient-end, 180%)) #385793;color:#fff}.bg-gradient-green-purple{--bslib-color-fg: #ffffff;--bslib-color-bg: #3b6b80;background:linear-gradient(var(--bg-gradient-deg, 140deg), #198754 var(--bg-gradient-start, 36%), #6f42c1 var(--bg-gradient-end, 180%)) #3b6b80;color:#fff}.bg-gradient-green-pink{--bslib-color-fg: #ffffff;--bslib-color-bg: #656567;background:linear-gradient(var(--bg-gradient-deg, 140deg), #198754 var(--bg-gradient-start, 36%), #d63384 var(--bg-gradient-end, 180%)) #656567;color:#fff}.bg-gradient-green-red{--bslib-color-fg: #ffffff;--bslib-color-bg: #67664e;background:linear-gradient(var(--bg-gradient-deg, 140deg), #198754 var(--bg-gradient-start, 36%), #dc3545 var(--bg-gradient-end, 180%)) #67664e;color:#fff}.bg-gradient-green-orange{--bslib-color-fg: #000;--bslib-color-bg: #74833a;background:linear-gradient(var(--bg-gradient-deg, 140deg), #198754 var(--bg-gradient-start, 36%), #fd7e14 var(--bg-gradient-end, 180%)) #74833a;color:#000}.bg-gradient-green-yellow{--bslib-color-fg: #000;--bslib-color-bg: #759e35;background:linear-gradient(var(--bg-gradient-deg, 140deg), #198754 var(--bg-gradient-start, 36%), #ffc107 var(--bg-gradient-end, 180%)) #759e35;color:#000}.bg-gradient-green-teal{--bslib-color-fg: #000;--bslib-color-bg: #1ca16f;background:linear-gradient(var(--bg-gradient-deg, 140deg), #198754 var(--bg-gradient-start, 36%), #20c997 var(--bg-gradient-end, 180%)) #1ca16f;color:#000}.bg-gradient-green-cyan{--bslib-color-fg: #000;--bslib-color-bg: #14a292;background:linear-gradient(var(--bg-gradient-deg, 140deg), #198754 var(--bg-gradient-start, 36%), #0dcaf0 var(--bg-gradient-end, 180%)) #14a292;color:#000}.bg-gradient-teal-blue{--bslib-color-fg: #000;--bslib-color-bg: #18a5c0;background:linear-gradient(var(--bg-gradient-deg, 140deg), #20c997 var(--bg-gradient-start, 36%), #0d6efd var(--bg-gradient-end, 180%)) #18a5c0;color:#000}.bg-gradient-teal-indigo{--bslib-color-fg: #000;--bslib-color-bg: #3c7fbb;background:linear-gradient(var(--bg-gradient-deg, 140deg), #20c997 var(--bg-gradient-start, 36%), #6610f2 var(--bg-gradient-end, 180%)) #3c7fbb;color:#000}.bg-gradient-teal-purple{--bslib-color-fg: #000;--bslib-color-bg: #4093a8;background:linear-gradient(var(--bg-gradient-deg, 140deg), #20c997 var(--bg-gradient-start, 36%), #6f42c1 var(--bg-gradient-end, 180%)) #4093a8;color:#000}.bg-gradient-teal-pink{--bslib-color-fg: #000;--bslib-color-bg: #698d8f;background:linear-gradient(var(--bg-gradient-deg, 140deg), #20c997 var(--bg-gradient-start, 36%), #d63384 var(--bg-gradient-end, 180%)) #698d8f;color:#000}.bg-gradient-teal-red{--bslib-color-fg: #000;--bslib-color-bg: #6b8e76;background:linear-gradient(var(--bg-gradient-deg, 140deg), #20c997 var(--bg-gradient-start, 36%), #dc3545 var(--bg-gradient-end, 180%)) #6b8e76;color:#000}.bg-gradient-teal-orange{--bslib-color-fg: #000;--bslib-color-bg: #78ab63;background:linear-gradient(var(--bg-gradient-deg, 140deg), #20c997 var(--bg-gradient-start, 36%), #fd7e14 var(--bg-gradient-end, 180%)) #78ab63;color:#000}.bg-gradient-teal-yellow{--bslib-color-fg: #000;--bslib-color-bg: #79c65d;background:linear-gradient(var(--bg-gradient-deg, 140deg), #20c997 var(--bg-gradient-start, 36%), #ffc107 var(--bg-gradient-end, 180%)) #79c65d;color:#000}.bg-gradient-teal-green{--bslib-color-fg: #000;--bslib-color-bg: #1daf7c;background:linear-gradient(var(--bg-gradient-deg, 140deg), #20c997 var(--bg-gradient-start, 36%), #198754 var(--bg-gradient-end, 180%)) #1daf7c;color:#000}.bg-gradient-teal-cyan{--bslib-color-fg: #000;--bslib-color-bg: #18c9bb;background:linear-gradient(var(--bg-gradient-deg, 140deg), #20c997 var(--bg-gradient-start, 36%), #0dcaf0 var(--bg-gradient-end, 180%)) #18c9bb;color:#000}.bg-gradient-cyan-blue{--bslib-color-fg: #000;--bslib-color-bg: #0da5f5;background:linear-gradient(var(--bg-gradient-deg, 140deg), #0dcaf0 var(--bg-gradient-start, 36%), #0d6efd var(--bg-gradient-end, 180%)) #0da5f5;color:#000}.bg-gradient-cyan-indigo{--bslib-color-fg: #000;--bslib-color-bg: #3180f1;background:linear-gradient(var(--bg-gradient-deg, 140deg), #0dcaf0 var(--bg-gradient-start, 36%), #6610f2 var(--bg-gradient-end, 180%)) #3180f1;color:#000}.bg-gradient-cyan-purple{--bslib-color-fg: #000;--bslib-color-bg: #3494dd;background:linear-gradient(var(--bg-gradient-deg, 140deg), #0dcaf0 var(--bg-gradient-start, 36%), #6f42c1 var(--bg-gradient-end, 180%)) #3494dd;color:#000}.bg-gradient-cyan-pink{--bslib-color-fg: #000;--bslib-color-bg: #5d8ec5;background:linear-gradient(var(--bg-gradient-deg, 140deg), #0dcaf0 var(--bg-gradient-start, 36%), #d63384 var(--bg-gradient-end, 180%)) #5d8ec5;color:#000}.bg-gradient-cyan-red{--bslib-color-fg: #000;--bslib-color-bg: #608eac;background:linear-gradient(var(--bg-gradient-deg, 140deg), #0dcaf0 var(--bg-gradient-start, 36%), #dc3545 var(--bg-gradient-end, 180%)) #608eac;color:#000}.bg-gradient-cyan-orange{--bslib-color-fg: #000;--bslib-color-bg: #6dac98;background:linear-gradient(var(--bg-gradient-deg, 140deg), #0dcaf0 var(--bg-gradient-start, 36%), #fd7e14 var(--bg-gradient-end, 180%)) #6dac98;color:#000}.bg-gradient-cyan-yellow{--bslib-color-fg: #000;--bslib-color-bg: #6ec693;background:linear-gradient(var(--bg-gradient-deg, 140deg), #0dcaf0 var(--bg-gradient-start, 36%), #ffc107 var(--bg-gradient-end, 180%)) #6ec693;color:#000}.bg-gradient-cyan-green{--bslib-color-fg: #000;--bslib-color-bg: #12afb2;background:linear-gradient(var(--bg-gradient-deg, 140deg), #0dcaf0 var(--bg-gradient-start, 36%), #198754 var(--bg-gradient-end, 180%)) #12afb2;color:#000}.bg-gradient-cyan-teal{--bslib-color-fg: #000;--bslib-color-bg: #15cacc;background:linear-gradient(var(--bg-gradient-deg, 140deg), #0dcaf0 var(--bg-gradient-start, 36%), #20c997 var(--bg-gradient-end, 180%)) #15cacc;color:#000}.bg-blue{--bslib-color-bg: #0d6efd;--bslib-color-fg: #ffffff;background-color:var(--bslib-color-bg);color:var(--bslib-color-fg)}.text-blue{--bslib-color-fg: #0d6efd;color:var(--bslib-color-fg)}.bg-indigo{--bslib-color-bg: #6610f2;--bslib-color-fg: #ffffff;background-color:var(--bslib-color-bg);color:var(--bslib-color-fg)}.text-indigo{--bslib-color-fg: #6610f2;color:var(--bslib-color-fg)}.bg-purple{--bslib-color-bg: #6f42c1;--bslib-color-fg: #ffffff;background-color:var(--bslib-color-bg);color:var(--bslib-color-fg)}.text-purple{--bslib-color-fg: #6f42c1;color:var(--bslib-color-fg)}.bg-pink{--bslib-color-bg: #d63384;--bslib-color-fg: #ffffff;background-color:var(--bslib-color-bg);color:var(--bslib-color-fg)}.text-pink{--bslib-color-fg: #d63384;color:var(--bslib-color-fg)}.bg-red{--bslib-color-bg: #dc3545;--bslib-color-fg: #ffffff;background-color:var(--bslib-color-bg);color:var(--bslib-color-fg)}.text-red{--bslib-color-fg: #dc3545;color:var(--bslib-color-fg)}.bg-orange{--bslib-color-bg: #fd7e14;--bslib-color-fg: #000;background-color:var(--bslib-color-bg);color:var(--bslib-color-fg)}.text-orange{--bslib-color-fg: #fd7e14;color:var(--bslib-color-fg)}.bg-yellow{--bslib-color-bg: #ffc107;--bslib-color-fg: #000;background-color:var(--bslib-color-bg);color:var(--bslib-color-fg)}.text-yellow{--bslib-color-fg: #ffc107;color:var(--bslib-color-fg)}.bg-green{--bslib-color-bg: #198754;--bslib-color-fg: #ffffff;background-color:var(--bslib-color-bg);color:var(--bslib-color-fg)}.text-green{--bslib-color-fg: #198754;color:var(--bslib-color-fg)}.bg-teal{--bslib-color-bg: #20c997;--bslib-color-fg: #000;background-color:var(--bslib-color-bg);color:var(--bslib-color-fg)}.text-teal{--bslib-color-fg: #20c997;color:var(--bslib-color-fg)}.bg-cyan{--bslib-color-bg: #0dcaf0;--bslib-color-fg: #000;background-color:var(--bslib-color-bg);color:var(--bslib-color-fg)}.text-cyan{--bslib-color-fg: #0dcaf0;color:var(--bslib-color-fg)}.text-default{--bslib-color-fg: #dee2e6}.bg-default{--bslib-color-bg: #dee2e6;--bslib-color-fg: #000}.text-primary{--bslib-color-fg: #0d6efd}.bg-primary{--bslib-color-bg: #0d6efd;--bslib-color-fg: #ffffff}.text-secondary{--bslib-color-fg: #6c757d}.bg-secondary{--bslib-color-bg: #6c757d;--bslib-color-fg: #ffffff}.text-success{--bslib-color-fg: #198754}.bg-success{--bslib-color-bg: #198754;--bslib-color-fg: #ffffff}.text-info{--bslib-color-fg: #0dcaf0}.bg-info{--bslib-color-bg: #0dcaf0;--bslib-color-fg: #000}.text-warning{--bslib-color-fg: #ffc107}.bg-warning{--bslib-color-bg: #ffc107;--bslib-color-fg: #000}.text-danger{--bslib-color-fg: #dc3545}.bg-danger{--bslib-color-bg: #dc3545;--bslib-color-fg: #ffffff}.text-light{--bslib-color-fg: #f8f9fa}.bg-light{--bslib-color-bg: #f8f9fa;--bslib-color-fg: #000}.text-dark{--bslib-color-fg: #212529}.bg-dark{--bslib-color-bg: #212529;--bslib-color-fg: #ffffff}.bg-gradient-blue-indigo{--bslib-color-fg: #ffffff;--bslib-color-bg: #3148f9;background:linear-gradient(var(--bg-gradient-deg, 140deg), #0d6efd var(--bg-gradient-start, 36%), #6610f2 var(--bg-gradient-end, 180%)) #3148f9;color:#fff}.bg-gradient-blue-purple{--bslib-color-fg: #ffffff;--bslib-color-bg: #345ce5;background:linear-gradient(var(--bg-gradient-deg, 140deg), #0d6efd var(--bg-gradient-start, 36%), #6f42c1 var(--bg-gradient-end, 180%)) #345ce5;color:#fff}.bg-gradient-blue-pink{--bslib-color-fg: #ffffff;--bslib-color-bg: #5d56cd;background:linear-gradient(var(--bg-gradient-deg, 140deg), #0d6efd var(--bg-gradient-start, 36%), #d63384 var(--bg-gradient-end, 180%)) #5d56cd;color:#fff}.bg-gradient-blue-red{--bslib-color-fg: #ffffff;--bslib-color-bg: #6057b3;background:linear-gradient(var(--bg-gradient-deg, 140deg), #0d6efd var(--bg-gradient-start, 36%), #dc3545 var(--bg-gradient-end, 180%)) #6057b3;color:#fff}.bg-gradient-blue-orange{--bslib-color-fg: #ffffff;--bslib-color-bg: #6d74a0;background:linear-gradient(var(--bg-gradient-deg, 140deg), #0d6efd var(--bg-gradient-start, 36%), #fd7e14 var(--bg-gradient-end, 180%)) #6d74a0;color:#fff}.bg-gradient-blue-yellow{--bslib-color-fg: #000;--bslib-color-bg: #6e8f9b;background:linear-gradient(var(--bg-gradient-deg, 140deg), #0d6efd var(--bg-gradient-start, 36%), #ffc107 var(--bg-gradient-end, 180%)) #6e8f9b;color:#000}.bg-gradient-blue-green{--bslib-color-fg: #ffffff;--bslib-color-bg: #1278b9;background:linear-gradient(var(--bg-gradient-deg, 140deg), #0d6efd var(--bg-gradient-start, 36%), #198754 var(--bg-gradient-end, 180%)) #1278b9;color:#fff}.bg-gradient-blue-teal{--bslib-color-fg: #000;--bslib-color-bg: #1592d4;background:linear-gradient(var(--bg-gradient-deg, 140deg), #0d6efd var(--bg-gradient-start, 36%), #20c997 var(--bg-gradient-end, 180%)) #1592d4;color:#000}.bg-gradient-blue-cyan{--bslib-color-fg: #000;--bslib-color-bg: #0d93f8;background:linear-gradient(var(--bg-gradient-deg, 140deg), #0d6efd var(--bg-gradient-start, 36%), #0dcaf0 var(--bg-gradient-end, 180%)) #0d93f8;color:#000}.bg-gradient-indigo-blue{--bslib-color-fg: #ffffff;--bslib-color-bg: #4236f6;background:linear-gradient(var(--bg-gradient-deg, 140deg), #6610f2 var(--bg-gradient-start, 36%), #0d6efd var(--bg-gradient-end, 180%)) #4236f6;color:#fff}.bg-gradient-indigo-purple{--bslib-color-fg: #ffffff;--bslib-color-bg: #6a24de;background:linear-gradient(var(--bg-gradient-deg, 140deg), #6610f2 var(--bg-gradient-start, 36%), #6f42c1 var(--bg-gradient-end, 180%)) #6a24de;color:#fff}.bg-gradient-indigo-pink{--bslib-color-fg: #ffffff;--bslib-color-bg: #931ec6;background:linear-gradient(var(--bg-gradient-deg, 140deg), #6610f2 var(--bg-gradient-start, 36%), #d63384 var(--bg-gradient-end, 180%)) #931ec6;color:#fff}.bg-gradient-indigo-red{--bslib-color-fg: #ffffff;--bslib-color-bg: #951fad;background:linear-gradient(var(--bg-gradient-deg, 140deg), #6610f2 var(--bg-gradient-start, 36%), #dc3545 var(--bg-gradient-end, 180%)) #951fad;color:#fff}.bg-gradient-indigo-orange{--bslib-color-fg: #ffffff;--bslib-color-bg: #a23c99;background:linear-gradient(var(--bg-gradient-deg, 140deg), #6610f2 var(--bg-gradient-start, 36%), #fd7e14 var(--bg-gradient-end, 180%)) #a23c99;color:#fff}.bg-gradient-indigo-yellow{--bslib-color-fg: #ffffff;--bslib-color-bg: #a35794;background:linear-gradient(var(--bg-gradient-deg, 140deg), #6610f2 var(--bg-gradient-start, 36%), #ffc107 var(--bg-gradient-end, 180%)) #a35794;color:#fff}.bg-gradient-indigo-green{--bslib-color-fg: #ffffff;--bslib-color-bg: #4740b3;background:linear-gradient(var(--bg-gradient-deg, 140deg), #6610f2 var(--bg-gradient-start, 36%), #198754 var(--bg-gradient-end, 180%)) #4740b3;color:#fff}.bg-gradient-indigo-teal{--bslib-color-fg: #ffffff;--bslib-color-bg: #4a5ace;background:linear-gradient(var(--bg-gradient-deg, 140deg), #6610f2 var(--bg-gradient-start, 36%), #20c997 var(--bg-gradient-end, 180%)) #4a5ace;color:#fff}.bg-gradient-indigo-cyan{--bslib-color-fg: #ffffff;--bslib-color-bg: #425af1;background:linear-gradient(var(--bg-gradient-deg, 140deg), #6610f2 var(--bg-gradient-start, 36%), #0dcaf0 var(--bg-gradient-end, 180%)) #425af1;color:#fff}.bg-gradient-purple-blue{--bslib-color-fg: #ffffff;--bslib-color-bg: #4854d9;background:linear-gradient(var(--bg-gradient-deg, 140deg), #6f42c1 var(--bg-gradient-start, 36%), #0d6efd var(--bg-gradient-end, 180%)) #4854d9;color:#fff}.bg-gradient-purple-indigo{--bslib-color-fg: #ffffff;--bslib-color-bg: #6b2ed5;background:linear-gradient(var(--bg-gradient-deg, 140deg), #6f42c1 var(--bg-gradient-start, 36%), #6610f2 var(--bg-gradient-end, 180%)) #6b2ed5;color:#fff}.bg-gradient-purple-pink{--bslib-color-fg: #ffffff;--bslib-color-bg: #983ca9;background:linear-gradient(var(--bg-gradient-deg, 140deg), #6f42c1 var(--bg-gradient-start, 36%), #d63384 var(--bg-gradient-end, 180%)) #983ca9;color:#fff}.bg-gradient-purple-red{--bslib-color-fg: #ffffff;--bslib-color-bg: #9b3d8f;background:linear-gradient(var(--bg-gradient-deg, 140deg), #6f42c1 var(--bg-gradient-start, 36%), #dc3545 var(--bg-gradient-end, 180%)) #9b3d8f;color:#fff}.bg-gradient-purple-orange{--bslib-color-fg: #ffffff;--bslib-color-bg: #a85a7c;background:linear-gradient(var(--bg-gradient-deg, 140deg), #6f42c1 var(--bg-gradient-start, 36%), #fd7e14 var(--bg-gradient-end, 180%)) #a85a7c;color:#fff}.bg-gradient-purple-yellow{--bslib-color-fg: #000;--bslib-color-bg: #a97577;background:linear-gradient(var(--bg-gradient-deg, 140deg), #6f42c1 var(--bg-gradient-start, 36%), #ffc107 var(--bg-gradient-end, 180%)) #a97577;color:#000}.bg-gradient-purple-green{--bslib-color-fg: #ffffff;--bslib-color-bg: #4d5e95;background:linear-gradient(var(--bg-gradient-deg, 140deg), #6f42c1 var(--bg-gradient-start, 36%), #198754 var(--bg-gradient-end, 180%)) #4d5e95;color:#fff}.bg-gradient-purple-teal{--bslib-color-fg: #ffffff;--bslib-color-bg: #4f78b0;background:linear-gradient(var(--bg-gradient-deg, 140deg), #6f42c1 var(--bg-gradient-start, 36%), #20c997 var(--bg-gradient-end, 180%)) #4f78b0;color:#fff}.bg-gradient-purple-cyan{--bslib-color-fg: #000;--bslib-color-bg: #4878d4;background:linear-gradient(var(--bg-gradient-deg, 140deg), #6f42c1 var(--bg-gradient-start, 36%), #0dcaf0 var(--bg-gradient-end, 180%)) #4878d4;color:#000}.bg-gradient-pink-blue{--bslib-color-fg: #ffffff;--bslib-color-bg: #864bb4;background:linear-gradient(var(--bg-gradient-deg, 140deg), #d63384 var(--bg-gradient-start, 36%), #0d6efd var(--bg-gradient-end, 180%)) #864bb4;color:#fff}.bg-gradient-pink-indigo{--bslib-color-fg: #ffffff;--bslib-color-bg: #a925b0;background:linear-gradient(var(--bg-gradient-deg, 140deg), #d63384 var(--bg-gradient-start, 36%), #6610f2 var(--bg-gradient-end, 180%)) #a925b0;color:#fff}.bg-gradient-pink-purple{--bslib-color-fg: #ffffff;--bslib-color-bg: #ad399c;background:linear-gradient(var(--bg-gradient-deg, 140deg), #d63384 var(--bg-gradient-start, 36%), #6f42c1 var(--bg-gradient-end, 180%)) #ad399c;color:#fff}.bg-gradient-pink-red{--bslib-color-fg: #ffffff;--bslib-color-bg: #d8346b;background:linear-gradient(var(--bg-gradient-deg, 140deg), #d63384 var(--bg-gradient-start, 36%), #dc3545 var(--bg-gradient-end, 180%)) #d8346b;color:#fff}.bg-gradient-pink-orange{--bslib-color-fg: #000;--bslib-color-bg: #e65157;background:linear-gradient(var(--bg-gradient-deg, 140deg), #d63384 var(--bg-gradient-start, 36%), #fd7e14 var(--bg-gradient-end, 180%)) #e65157;color:#000}.bg-gradient-pink-yellow{--bslib-color-fg: #000;--bslib-color-bg: #e66c52;background:linear-gradient(var(--bg-gradient-deg, 140deg), #d63384 var(--bg-gradient-start, 36%), #ffc107 var(--bg-gradient-end, 180%)) #e66c52;color:#000}.bg-gradient-pink-green{--bslib-color-fg: #ffffff;--bslib-color-bg: #8a5571;background:linear-gradient(var(--bg-gradient-deg, 140deg), #d63384 var(--bg-gradient-start, 36%), #198754 var(--bg-gradient-end, 180%)) #8a5571;color:#fff}.bg-gradient-pink-teal{--bslib-color-fg: #000;--bslib-color-bg: #8d6f8c;background:linear-gradient(var(--bg-gradient-deg, 140deg), #d63384 var(--bg-gradient-start, 36%), #20c997 var(--bg-gradient-end, 180%)) #8d6f8c;color:#000}.bg-gradient-pink-cyan{--bslib-color-fg: #000;--bslib-color-bg: #866faf;background:linear-gradient(var(--bg-gradient-deg, 140deg), #d63384 var(--bg-gradient-start, 36%), #0dcaf0 var(--bg-gradient-end, 180%)) #866faf;color:#000}.bg-gradient-red-blue{--bslib-color-fg: #ffffff;--bslib-color-bg: #894c8f;background:linear-gradient(var(--bg-gradient-deg, 140deg), #dc3545 var(--bg-gradient-start, 36%), #0d6efd var(--bg-gradient-end, 180%)) #894c8f;color:#fff}.bg-gradient-red-indigo{--bslib-color-fg: #ffffff;--bslib-color-bg: #ad268a;background:linear-gradient(var(--bg-gradient-deg, 140deg), #dc3545 var(--bg-gradient-start, 36%), #6610f2 var(--bg-gradient-end, 180%)) #ad268a;color:#fff}.bg-gradient-red-purple{--bslib-color-fg: #ffffff;--bslib-color-bg: #b03a77;background:linear-gradient(var(--bg-gradient-deg, 140deg), #dc3545 var(--bg-gradient-start, 36%), #6f42c1 var(--bg-gradient-end, 180%)) #b03a77;color:#fff}.bg-gradient-red-pink{--bslib-color-fg: #ffffff;--bslib-color-bg: #da345e;background:linear-gradient(var(--bg-gradient-deg, 140deg), #dc3545 var(--bg-gradient-start, 36%), #d63384 var(--bg-gradient-end, 180%)) #da345e;color:#fff}.bg-gradient-red-orange{--bslib-color-fg: #000;--bslib-color-bg: #e95231;background:linear-gradient(var(--bg-gradient-deg, 140deg), #dc3545 var(--bg-gradient-start, 36%), #fd7e14 var(--bg-gradient-end, 180%)) #e95231;color:#000}.bg-gradient-red-yellow{--bslib-color-fg: #000;--bslib-color-bg: #ea6d2c;background:linear-gradient(var(--bg-gradient-deg, 140deg), #dc3545 var(--bg-gradient-start, 36%), #ffc107 var(--bg-gradient-end, 180%)) #ea6d2c;color:#000}.bg-gradient-red-green{--bslib-color-fg: #ffffff;--bslib-color-bg: #8e564b;background:linear-gradient(var(--bg-gradient-deg, 140deg), #dc3545 var(--bg-gradient-start, 36%), #198754 var(--bg-gradient-end, 180%)) #8e564b;color:#fff}.bg-gradient-red-teal{--bslib-color-fg: #000;--bslib-color-bg: #917066;background:linear-gradient(var(--bg-gradient-deg, 140deg), #dc3545 var(--bg-gradient-start, 36%), #20c997 var(--bg-gradient-end, 180%)) #917066;color:#000}.bg-gradient-red-cyan{--bslib-color-fg: #000;--bslib-color-bg: #897189;background:linear-gradient(var(--bg-gradient-deg, 140deg), #dc3545 var(--bg-gradient-start, 36%), #0dcaf0 var(--bg-gradient-end, 180%)) #897189;color:#000}.bg-gradient-orange-blue{--bslib-color-fg: #000;--bslib-color-bg: #9d7871;background:linear-gradient(var(--bg-gradient-deg, 140deg), #fd7e14 var(--bg-gradient-start, 36%), #0d6efd var(--bg-gradient-end, 180%)) #9d7871;color:#000}.bg-gradient-orange-indigo{--bslib-color-fg: #000;--bslib-color-bg: #c1526d;background:linear-gradient(var(--bg-gradient-deg, 140deg), #fd7e14 var(--bg-gradient-start, 36%), #6610f2 var(--bg-gradient-end, 180%)) #c1526d;color:#000}.bg-gradient-orange-purple{--bslib-color-fg: #000;--bslib-color-bg: #c46659;background:linear-gradient(var(--bg-gradient-deg, 140deg), #fd7e14 var(--bg-gradient-start, 36%), #6f42c1 var(--bg-gradient-end, 180%)) #c46659;color:#000}.bg-gradient-orange-pink{--bslib-color-fg: #000;--bslib-color-bg: #ed6041;background:linear-gradient(var(--bg-gradient-deg, 140deg), #fd7e14 var(--bg-gradient-start, 36%), #d63384 var(--bg-gradient-end, 180%)) #ed6041;color:#000}.bg-gradient-orange-red{--bslib-color-fg: #000;--bslib-color-bg: #f06128;background:linear-gradient(var(--bg-gradient-deg, 140deg), #fd7e14 var(--bg-gradient-start, 36%), #dc3545 var(--bg-gradient-end, 180%)) #f06128;color:#000}.bg-gradient-orange-yellow{--bslib-color-fg: #000;--bslib-color-bg: #fe990f;background:linear-gradient(var(--bg-gradient-deg, 140deg), #fd7e14 var(--bg-gradient-start, 36%), #ffc107 var(--bg-gradient-end, 180%)) #fe990f;color:#000}.bg-gradient-orange-green{--bslib-color-fg: #000;--bslib-color-bg: #a2822e;background:linear-gradient(var(--bg-gradient-deg, 140deg), #fd7e14 var(--bg-gradient-start, 36%), #198754 var(--bg-gradient-end, 180%)) #a2822e;color:#000}.bg-gradient-orange-teal{--bslib-color-fg: #000;--bslib-color-bg: #a59c48;background:linear-gradient(var(--bg-gradient-deg, 140deg), #fd7e14 var(--bg-gradient-start, 36%), #20c997 var(--bg-gradient-end, 180%)) #a59c48;color:#000}.bg-gradient-orange-cyan{--bslib-color-fg: #000;--bslib-color-bg: #9d9c6c;background:linear-gradient(var(--bg-gradient-deg, 140deg), #fd7e14 var(--bg-gradient-start, 36%), #0dcaf0 var(--bg-gradient-end, 180%)) #9d9c6c;color:#000}.bg-gradient-yellow-blue{--bslib-color-fg: #000;--bslib-color-bg: #9ea069;background:linear-gradient(var(--bg-gradient-deg, 140deg), #ffc107 var(--bg-gradient-start, 36%), #0d6efd var(--bg-gradient-end, 180%)) #9ea069;color:#000}.bg-gradient-yellow-indigo{--bslib-color-fg: #000;--bslib-color-bg: #c27a65;background:linear-gradient(var(--bg-gradient-deg, 140deg), #ffc107 var(--bg-gradient-start, 36%), #6610f2 var(--bg-gradient-end, 180%)) #c27a65;color:#000}.bg-gradient-yellow-purple{--bslib-color-fg: #000;--bslib-color-bg: #c58e51;background:linear-gradient(var(--bg-gradient-deg, 140deg), #ffc107 var(--bg-gradient-start, 36%), #6f42c1 var(--bg-gradient-end, 180%)) #c58e51;color:#000}.bg-gradient-yellow-pink{--bslib-color-fg: #000;--bslib-color-bg: #ef8839;background:linear-gradient(var(--bg-gradient-deg, 140deg), #ffc107 var(--bg-gradient-start, 36%), #d63384 var(--bg-gradient-end, 180%)) #ef8839;color:#000}.bg-gradient-yellow-red{--bslib-color-fg: #000;--bslib-color-bg: #f18920;background:linear-gradient(var(--bg-gradient-deg, 140deg), #ffc107 var(--bg-gradient-start, 36%), #dc3545 var(--bg-gradient-end, 180%)) #f18920;color:#000}.bg-gradient-yellow-orange{--bslib-color-fg: #000;--bslib-color-bg: #fea60c;background:linear-gradient(var(--bg-gradient-deg, 140deg), #ffc107 var(--bg-gradient-start, 36%), #fd7e14 var(--bg-gradient-end, 180%)) #fea60c;color:#000}.bg-gradient-yellow-green{--bslib-color-fg: #000;--bslib-color-bg: #a3aa26;background:linear-gradient(var(--bg-gradient-deg, 140deg), #ffc107 var(--bg-gradient-start, 36%), #198754 var(--bg-gradient-end, 180%)) #a3aa26;color:#000}.bg-gradient-yellow-teal{--bslib-color-fg: #000;--bslib-color-bg: #a6c441;background:linear-gradient(var(--bg-gradient-deg, 140deg), #ffc107 var(--bg-gradient-start, 36%), #20c997 var(--bg-gradient-end, 180%)) #a6c441;color:#000}.bg-gradient-yellow-cyan{--bslib-color-fg: #000;--bslib-color-bg: #9ec564;background:linear-gradient(var(--bg-gradient-deg, 140deg), #ffc107 var(--bg-gradient-start, 36%), #0dcaf0 var(--bg-gradient-end, 180%)) #9ec564;color:#000}.bg-gradient-green-blue{--bslib-color-fg: #ffffff;--bslib-color-bg: #147d98;background:linear-gradient(var(--bg-gradient-deg, 140deg), #198754 var(--bg-gradient-start, 36%), #0d6efd var(--bg-gradient-end, 180%)) #147d98;color:#fff}.bg-gradient-green-indigo{--bslib-color-fg: #ffffff;--bslib-color-bg: #385793;background:linear-gradient(var(--bg-gradient-deg, 140deg), #198754 var(--bg-gradient-start, 36%), #6610f2 var(--bg-gradient-end, 180%)) #385793;color:#fff}.bg-gradient-green-purple{--bslib-color-fg: #ffffff;--bslib-color-bg: #3b6b80;background:linear-gradient(var(--bg-gradient-deg, 140deg), #198754 var(--bg-gradient-start, 36%), #6f42c1 var(--bg-gradient-end, 180%)) #3b6b80;color:#fff}.bg-gradient-green-pink{--bslib-color-fg: #ffffff;--bslib-color-bg: #656567;background:linear-gradient(var(--bg-gradient-deg, 140deg), #198754 var(--bg-gradient-start, 36%), #d63384 var(--bg-gradient-end, 180%)) #656567;color:#fff}.bg-gradient-green-red{--bslib-color-fg: #ffffff;--bslib-color-bg: #67664e;background:linear-gradient(var(--bg-gradient-deg, 140deg), #198754 var(--bg-gradient-start, 36%), #dc3545 var(--bg-gradient-end, 180%)) #67664e;color:#fff}.bg-gradient-green-orange{--bslib-color-fg: #000;--bslib-color-bg: #74833a;background:linear-gradient(var(--bg-gradient-deg, 140deg), #198754 var(--bg-gradient-start, 36%), #fd7e14 var(--bg-gradient-end, 180%)) #74833a;color:#000}.bg-gradient-green-yellow{--bslib-color-fg: #000;--bslib-color-bg: #759e35;background:linear-gradient(var(--bg-gradient-deg, 140deg), #198754 var(--bg-gradient-start, 36%), #ffc107 var(--bg-gradient-end, 180%)) #759e35;color:#000}.bg-gradient-green-teal{--bslib-color-fg: #000;--bslib-color-bg: #1ca16f;background:linear-gradient(var(--bg-gradient-deg, 140deg), #198754 var(--bg-gradient-start, 36%), #20c997 var(--bg-gradient-end, 180%)) #1ca16f;color:#000}.bg-gradient-green-cyan{--bslib-color-fg: #000;--bslib-color-bg: #14a292;background:linear-gradient(var(--bg-gradient-deg, 140deg), #198754 var(--bg-gradient-start, 36%), #0dcaf0 var(--bg-gradient-end, 180%)) #14a292;color:#000}.bg-gradient-teal-blue{--bslib-color-fg: #000;--bslib-color-bg: #18a5c0;background:linear-gradient(var(--bg-gradient-deg, 140deg), #20c997 var(--bg-gradient-start, 36%), #0d6efd var(--bg-gradient-end, 180%)) #18a5c0;color:#000}.bg-gradient-teal-indigo{--bslib-color-fg: #000;--bslib-color-bg: #3c7fbb;background:linear-gradient(var(--bg-gradient-deg, 140deg), #20c997 var(--bg-gradient-start, 36%), #6610f2 var(--bg-gradient-end, 180%)) #3c7fbb;color:#000}.bg-gradient-teal-purple{--bslib-color-fg: #000;--bslib-color-bg: #4093a8;background:linear-gradient(var(--bg-gradient-deg, 140deg), #20c997 var(--bg-gradient-start, 36%), #6f42c1 var(--bg-gradient-end, 180%)) #4093a8;color:#000}.bg-gradient-teal-pink{--bslib-color-fg: #000;--bslib-color-bg: #698d8f;background:linear-gradient(var(--bg-gradient-deg, 140deg), #20c997 var(--bg-gradient-start, 36%), #d63384 var(--bg-gradient-end, 180%)) #698d8f;color:#000}.bg-gradient-teal-red{--bslib-color-fg: #000;--bslib-color-bg: #6b8e76;background:linear-gradient(var(--bg-gradient-deg, 140deg), #20c997 var(--bg-gradient-start, 36%), #dc3545 var(--bg-gradient-end, 180%)) #6b8e76;color:#000}.bg-gradient-teal-orange{--bslib-color-fg: #000;--bslib-color-bg: #78ab63;background:linear-gradient(var(--bg-gradient-deg, 140deg), #20c997 var(--bg-gradient-start, 36%), #fd7e14 var(--bg-gradient-end, 180%)) #78ab63;color:#000}.bg-gradient-teal-yellow{--bslib-color-fg: #000;--bslib-color-bg: #79c65d;background:linear-gradient(var(--bg-gradient-deg, 140deg), #20c997 var(--bg-gradient-start, 36%), #ffc107 var(--bg-gradient-end, 180%)) #79c65d;color:#000}.bg-gradient-teal-green{--bslib-color-fg: #000;--bslib-color-bg: #1daf7c;background:linear-gradient(var(--bg-gradient-deg, 140deg), #20c997 var(--bg-gradient-start, 36%), #198754 var(--bg-gradient-end, 180%)) #1daf7c;color:#000}.bg-gradient-teal-cyan{--bslib-color-fg: #000;--bslib-color-bg: #18c9bb;background:linear-gradient(var(--bg-gradient-deg, 140deg), #20c997 var(--bg-gradient-start, 36%), #0dcaf0 var(--bg-gradient-end, 180%)) #18c9bb;color:#000}.bg-gradient-cyan-blue{--bslib-color-fg: #000;--bslib-color-bg: #0da5f5;background:linear-gradient(var(--bg-gradient-deg, 140deg), #0dcaf0 var(--bg-gradient-start, 36%), #0d6efd var(--bg-gradient-end, 180%)) #0da5f5;color:#000}.bg-gradient-cyan-indigo{--bslib-color-fg: #000;--bslib-color-bg: #3180f1;background:linear-gradient(var(--bg-gradient-deg, 140deg), #0dcaf0 var(--bg-gradient-start, 36%), #6610f2 var(--bg-gradient-end, 180%)) #3180f1;color:#000}.bg-gradient-cyan-purple{--bslib-color-fg: #000;--bslib-color-bg: #3494dd;background:linear-gradient(var(--bg-gradient-deg, 140deg), #0dcaf0 var(--bg-gradient-start, 36%), #6f42c1 var(--bg-gradient-end, 180%)) #3494dd;color:#000}.bg-gradient-cyan-pink{--bslib-color-fg: #000;--bslib-color-bg: #5d8ec5;background:linear-gradient(var(--bg-gradient-deg, 140deg), #0dcaf0 var(--bg-gradient-start, 36%), #d63384 var(--bg-gradient-end, 180%)) #5d8ec5;color:#000}.bg-gradient-cyan-red{--bslib-color-fg: #000;--bslib-color-bg: #608eac;background:linear-gradient(var(--bg-gradient-deg, 140deg), #0dcaf0 var(--bg-gradient-start, 36%), #dc3545 var(--bg-gradient-end, 180%)) #608eac;color:#000}.bg-gradient-cyan-orange{--bslib-color-fg: #000;--bslib-color-bg: #6dac98;background:linear-gradient(var(--bg-gradient-deg, 140deg), #0dcaf0 var(--bg-gradient-start, 36%), #fd7e14 var(--bg-gradient-end, 180%)) #6dac98;color:#000}.bg-gradient-cyan-yellow{--bslib-color-fg: #000;--bslib-color-bg: #6ec693;background:linear-gradient(var(--bg-gradient-deg, 140deg), #0dcaf0 var(--bg-gradient-start, 36%), #ffc107 var(--bg-gradient-end, 180%)) #6ec693;color:#000}.bg-gradient-cyan-green{--bslib-color-fg: #000;--bslib-color-bg: #12afb2;background:linear-gradient(var(--bg-gradient-deg, 140deg), #0dcaf0 var(--bg-gradient-start, 36%), #198754 var(--bg-gradient-end, 180%)) #12afb2;color:#000}.bg-gradient-cyan-teal{--bslib-color-fg: #000;--bslib-color-bg: #15cacc;background:linear-gradient(var(--bg-gradient-deg, 140deg), #0dcaf0 var(--bg-gradient-start, 36%), #20c997 var(--bg-gradient-end, 180%)) #15cacc;color:#000}:root{--bslib-spacer: 1rem;--bslib-mb-spacer: var(--bslib-spacer, 1rem)}.bslib-mb-spacing{margin-bottom:var(--bslib-mb-spacer)}.bslib-gap-spacing{gap:var(--bslib-mb-spacer)}.bslib-gap-spacing>.bslib-mb-spacing,.bslib-gap-spacing>.form-group,.bslib-gap-spacing>p,.bslib-gap-spacing>pre{margin-bottom:0}.html-fill-container>.html-fill-item.bslib-mb-spacing{margin-bottom:0}.tab-content>.tab-pane.html-fill-container{display:none}.tab-content>.active.html-fill-container{display:flex}.tab-content.html-fill-container{padding:0}.accordion .accordion-header{font-size:calc(1.29rem + 0.48vw);margin-top:0;margin-bottom:.5rem;font-weight:500;line-height:1.2;color:var(--bs-heading-color);margin-bottom:0}@media(min-width: 1200px){.accordion .accordion-header{font-size:1.65rem}}.accordion .accordion-icon:not(:empty){margin-right:.75rem;display:flex}.accordion .accordion-button:not(.collapsed){box-shadow:none}.accordion .accordion-button:not(.collapsed):focus{box-shadow:var(--bs-accordion-btn-focus-box-shadow)}.bslib-card{overflow:auto}.bslib-card .card-body+.card-body{padding-top:0}.bslib-card .card-body{overflow:auto}.bslib-card .card-body p{margin-top:0}.bslib-card .card-body p:last-child{margin-bottom:0}.bslib-card .card-body{max-height:var(--bslib-card-body-max-height, none)}.bslib-card[data-full-screen=true]>.card-body{max-height:var(--bslib-card-body-max-height-full-screen, none)}.bslib-card .card-header .form-group{margin-bottom:0}.bslib-card .card-header .selectize-control{margin-bottom:0}.bslib-card .card-header .selectize-control .item{margin-right:1.15rem}.bslib-card .card-footer{margin-top:auto}.bslib-card .bslib-navs-card-title{display:flex;flex-wrap:wrap;justify-content:space-between;align-items:center}.bslib-card .bslib-navs-card-title .nav{margin-left:auto}.bslib-card .bslib-sidebar-layout:not([data-bslib-sidebar-border=true]){border:none}.bslib-card .bslib-sidebar-layout:not([data-bslib-sidebar-border-radius=true]){border-top-left-radius:0;border-top-right-radius:0}[data-full-screen=true]{position:fixed;inset:3.5rem 1rem 1rem;height:auto !important;max-height:none !important;width:auto !important;z-index:1070}.bslib-full-screen-enter{display:none;position:absolute;bottom:var(--bslib-full-screen-enter-bottom, 0.2rem);right:var(--bslib-full-screen-enter-right, 0);top:var(--bslib-full-screen-enter-top);left:var(--bslib-full-screen-enter-left);color:var(--bslib-color-fg, var(--bs-card-color));background-color:var(--bslib-color-bg, var(--bs-card-bg, var(--bs-body-bg)));border:var(--bs-card-border-width) solid var(--bslib-color-fg, var(--bs-card-border-color));box-shadow:0 2px 4px rgba(0,0,0,.15);margin:.2rem .4rem;padding:.55rem !important;font-size:.8rem;cursor:pointer;opacity:.7;z-index:1070}.bslib-full-screen-enter:hover{opacity:1}.card[data-full-screen=false]:hover>*>.bslib-full-screen-enter{display:block}.bslib-has-full-screen .card:hover>*>.bslib-full-screen-enter{display:none}@media(max-width: 575.98px){.bslib-full-screen-enter{display:none !important}}.bslib-full-screen-exit{position:relative;top:1.35rem;font-size:.9rem;cursor:pointer;text-decoration:none;display:flex;float:right;margin-right:2.15rem;align-items:center;color:rgba(var(--bs-body-bg-rgb), 0.8)}.bslib-full-screen-exit:hover{color:rgba(var(--bs-body-bg-rgb), 1)}.bslib-full-screen-exit svg{margin-left:.5rem;font-size:1.5rem}#bslib-full-screen-overlay{position:fixed;inset:0;background-color:rgba(var(--bs-body-color-rgb), 0.6);backdrop-filter:blur(2px);-webkit-backdrop-filter:blur(2px);z-index:1069;animation:bslib-full-screen-overlay-enter 400ms cubic-bezier(0.6, 0.02, 0.65, 1) forwards}@keyframes bslib-full-screen-overlay-enter{0%{opacity:0}100%{opacity:1}}.bslib-grid{display:grid !important;gap:var(--bslib-spacer, 1rem);height:var(--bslib-grid-height)}.bslib-grid.grid{grid-template-columns:repeat(var(--bs-columns, 12), minmax(0, 1fr));grid-template-rows:unset;grid-auto-rows:var(--bslib-grid--row-heights);--bslib-grid--row-heights--xs: unset;--bslib-grid--row-heights--sm: unset;--bslib-grid--row-heights--md: unset;--bslib-grid--row-heights--lg: unset;--bslib-grid--row-heights--xl: unset;--bslib-grid--row-heights--xxl: unset}.bslib-grid.grid.bslib-grid--row-heights--xs{--bslib-grid--row-heights: var(--bslib-grid--row-heights--xs)}@media(min-width: 576px){.bslib-grid.grid.bslib-grid--row-heights--sm{--bslib-grid--row-heights: var(--bslib-grid--row-heights--sm)}}@media(min-width: 768px){.bslib-grid.grid.bslib-grid--row-heights--md{--bslib-grid--row-heights: var(--bslib-grid--row-heights--md)}}@media(min-width: 992px){.bslib-grid.grid.bslib-grid--row-heights--lg{--bslib-grid--row-heights: var(--bslib-grid--row-heights--lg)}}@media(min-width: 1200px){.bslib-grid.grid.bslib-grid--row-heights--xl{--bslib-grid--row-heights: var(--bslib-grid--row-heights--xl)}}@media(min-width: 1400px){.bslib-grid.grid.bslib-grid--row-heights--xxl{--bslib-grid--row-heights: var(--bslib-grid--row-heights--xxl)}}.bslib-grid>*>.shiny-input-container{width:100%}.bslib-grid-item{grid-column:auto/span 1}@media(max-width: 767.98px){.bslib-grid-item{grid-column:1/-1}}@media(max-width: 575.98px){.bslib-grid{grid-template-columns:1fr !important;height:var(--bslib-grid-height-mobile)}.bslib-grid.grid{height:unset !important;grid-auto-rows:var(--bslib-grid--row-heights--xs, auto)}}@media(min-width: 576px){.nav:not(.nav-hidden){display:flex !important;display:-webkit-flex !important}.nav:not(.nav-hidden):not(.nav-stacked):not(.flex-column){float:none !important}.nav:not(.nav-hidden):not(.nav-stacked):not(.flex-column)>.bslib-nav-spacer{margin-left:auto !important}.nav:not(.nav-hidden):not(.nav-stacked):not(.flex-column)>.form-inline{margin-top:auto;margin-bottom:auto}.nav:not(.nav-hidden).nav-stacked{flex-direction:column;-webkit-flex-direction:column;height:100%}.nav:not(.nav-hidden).nav-stacked>.bslib-nav-spacer{margin-top:auto !important}}html{height:100%}.bslib-page-fill{width:100%;height:100%;margin:0;padding:var(--bslib-spacer, 1rem);gap:var(--bslib-spacer, 1rem)}@media(max-width: 575.98px){.bslib-page-fill{height:var(--bslib-page-fill-mobile-height, auto)}}.navbar+.container-fluid:has(>.tab-content>.tab-pane.active.html-fill-container),.navbar+.container-sm:has(>.tab-content>.tab-pane.active.html-fill-container),.navbar+.container-md:has(>.tab-content>.tab-pane.active.html-fill-container),.navbar+.container-lg:has(>.tab-content>.tab-pane.active.html-fill-container),.navbar+.container-xl:has(>.tab-content>.tab-pane.active.html-fill-container),.navbar+.container-xxl:has(>.tab-content>.tab-pane.active.html-fill-container){padding-left:0;padding-right:0}.navbar+.container-fluid>.tab-content>.tab-pane.active.html-fill-container,.navbar+.container-sm>.tab-content>.tab-pane.active.html-fill-container,.navbar+.container-md>.tab-content>.tab-pane.active.html-fill-container,.navbar+.container-lg>.tab-content>.tab-pane.active.html-fill-container,.navbar+.container-xl>.tab-content>.tab-pane.active.html-fill-container,.navbar+.container-xxl>.tab-content>.tab-pane.active.html-fill-container{padding:var(--bslib-spacer, 1rem);gap:var(--bslib-spacer, 1rem)}.navbar+.container-fluid>.tab-content>.tab-pane.active.html-fill-container:has(>.bslib-sidebar-layout:only-child),.navbar+.container-sm>.tab-content>.tab-pane.active.html-fill-container:has(>.bslib-sidebar-layout:only-child),.navbar+.container-md>.tab-content>.tab-pane.active.html-fill-container:has(>.bslib-sidebar-layout:only-child),.navbar+.container-lg>.tab-content>.tab-pane.active.html-fill-container:has(>.bslib-sidebar-layout:only-child),.navbar+.container-xl>.tab-content>.tab-pane.active.html-fill-container:has(>.bslib-sidebar-layout:only-child),.navbar+.container-xxl>.tab-content>.tab-pane.active.html-fill-container:has(>.bslib-sidebar-layout:only-child){padding:0}.navbar+.container-fluid>.tab-content>.tab-pane.active.html-fill-container>.bslib-sidebar-layout:only-child:not([data-bslib-sidebar-border=true]),.navbar+.container-sm>.tab-content>.tab-pane.active.html-fill-container>.bslib-sidebar-layout:only-child:not([data-bslib-sidebar-border=true]),.navbar+.container-md>.tab-content>.tab-pane.active.html-fill-container>.bslib-sidebar-layout:only-child:not([data-bslib-sidebar-border=true]),.navbar+.container-lg>.tab-content>.tab-pane.active.html-fill-container>.bslib-sidebar-layout:only-child:not([data-bslib-sidebar-border=true]),.navbar+.container-xl>.tab-content>.tab-pane.active.html-fill-container>.bslib-sidebar-layout:only-child:not([data-bslib-sidebar-border=true]),.navbar+.container-xxl>.tab-content>.tab-pane.active.html-fill-container>.bslib-sidebar-layout:only-child:not([data-bslib-sidebar-border=true]){border-left:none;border-right:none;border-bottom:none}.navbar+.container-fluid>.tab-content>.tab-pane.active.html-fill-container>.bslib-sidebar-layout:only-child:not([data-bslib-sidebar-border-radius=true]),.navbar+.container-sm>.tab-content>.tab-pane.active.html-fill-container>.bslib-sidebar-layout:only-child:not([data-bslib-sidebar-border-radius=true]),.navbar+.container-md>.tab-content>.tab-pane.active.html-fill-container>.bslib-sidebar-layout:only-child:not([data-bslib-sidebar-border-radius=true]),.navbar+.container-lg>.tab-content>.tab-pane.active.html-fill-container>.bslib-sidebar-layout:only-child:not([data-bslib-sidebar-border-radius=true]),.navbar+.container-xl>.tab-content>.tab-pane.active.html-fill-container>.bslib-sidebar-layout:only-child:not([data-bslib-sidebar-border-radius=true]),.navbar+.container-xxl>.tab-content>.tab-pane.active.html-fill-container>.bslib-sidebar-layout:only-child:not([data-bslib-sidebar-border-radius=true]){border-radius:0}.navbar+div>.bslib-sidebar-layout{border-top:var(--bslib-sidebar-border)}:root{--bslib-page-sidebar-title-bg: #517699;--bslib-page-sidebar-title-color: #ffffff}.bslib-page-title{background-color:var(--bslib-page-sidebar-title-bg);color:var(--bslib-page-sidebar-title-color);font-size:1.25rem;font-weight:300;padding:var(--bslib-spacer, 1rem);padding-left:1.5rem;margin-bottom:0;border-bottom:1px solid #dee2e6}.bslib-sidebar-layout{--bslib-sidebar-transition-duration: 500ms;--bslib-sidebar-transition-easing-x: cubic-bezier(0.8, 0.78, 0.22, 1.07);--bslib-sidebar-border: var(--bs-card-border-width, 1px) solid var(--bs-card-border-color, rgba(0, 0, 0, 0.175));--bslib-sidebar-border-radius: var(--bs-border-radius);--bslib-sidebar-vert-border: var(--bs-card-border-width, 1px) solid var(--bs-card-border-color, rgba(0, 0, 0, 0.175));--bslib-sidebar-bg: rgba(var(--bs-emphasis-color-rgb, 0, 0, 0), 0.05);--bslib-sidebar-fg: var(--bs-emphasis-color, black);--bslib-sidebar-main-fg: var(--bs-card-color, var(--bs-body-color));--bslib-sidebar-main-bg: var(--bs-card-bg, var(--bs-body-bg));--bslib-sidebar-toggle-bg: rgba(var(--bs-emphasis-color-rgb, 0, 0, 0), 0.1);--bslib-sidebar-padding: calc(var(--bslib-spacer) * 1.5);--bslib-sidebar-icon-size: var(--bslib-spacer, 1rem);--bslib-sidebar-icon-button-size: calc(var(--bslib-sidebar-icon-size, 1rem) * 2);--bslib-sidebar-padding-icon: calc(var(--bslib-sidebar-icon-button-size, 2rem) * 1.5);--bslib-collapse-toggle-border-radius: var(--bs-border-radius, 0.375rem);--bslib-collapse-toggle-transform: 0deg;--bslib-sidebar-toggle-transition-easing: cubic-bezier(1, 0, 0, 1);--bslib-collapse-toggle-right-transform: 180deg;--bslib-sidebar-column-main: minmax(0, 1fr);display:grid !important;grid-template-columns:min(100% - var(--bslib-sidebar-icon-size),var(--bslib-sidebar-width, 250px)) var(--bslib-sidebar-column-main);position:relative;transition:grid-template-columns ease-in-out var(--bslib-sidebar-transition-duration);border:var(--bslib-sidebar-border);border-radius:var(--bslib-sidebar-border-radius)}@media(prefers-reduced-motion: reduce){.bslib-sidebar-layout{transition:none}}.bslib-sidebar-layout[data-bslib-sidebar-border=false]{border:none}.bslib-sidebar-layout[data-bslib-sidebar-border-radius=false]{border-radius:initial}.bslib-sidebar-layout>.main,.bslib-sidebar-layout>.sidebar{grid-row:1/2;border-radius:inherit;overflow:auto}.bslib-sidebar-layout>.main{grid-column:2/3;border-top-left-radius:0;border-bottom-left-radius:0;padding:var(--bslib-sidebar-padding);transition:padding var(--bslib-sidebar-transition-easing-x) var(--bslib-sidebar-transition-duration);color:var(--bslib-sidebar-main-fg);background-color:var(--bslib-sidebar-main-bg)}.bslib-sidebar-layout>.sidebar{grid-column:1/2;width:100%;height:100%;border-right:var(--bslib-sidebar-vert-border);border-top-right-radius:0;border-bottom-right-radius:0;color:var(--bslib-sidebar-fg);background-color:var(--bslib-sidebar-bg);backdrop-filter:blur(5px)}.bslib-sidebar-layout>.sidebar>.sidebar-content{display:flex;flex-direction:column;gap:var(--bslib-spacer, 1rem);padding:var(--bslib-sidebar-padding);padding-top:var(--bslib-sidebar-padding-icon)}.bslib-sidebar-layout>.sidebar>.sidebar-content>:last-child:not(.sidebar-title){margin-bottom:0}.bslib-sidebar-layout>.sidebar>.sidebar-content>.accordion{margin-left:calc(-1*var(--bslib-sidebar-padding));margin-right:calc(-1*var(--bslib-sidebar-padding))}.bslib-sidebar-layout>.sidebar>.sidebar-content>.accordion:last-child{margin-bottom:calc(-1*var(--bslib-sidebar-padding))}.bslib-sidebar-layout>.sidebar>.sidebar-content>.accordion:not(:last-child){margin-bottom:1rem}.bslib-sidebar-layout>.sidebar>.sidebar-content>.accordion .accordion-body{display:flex;flex-direction:column}.bslib-sidebar-layout>.sidebar>.sidebar-content>.accordion:not(:first-child) .accordion-item:first-child{border-top:var(--bs-accordion-border-width) solid var(--bs-accordion-border-color)}.bslib-sidebar-layout>.sidebar>.sidebar-content>.accordion:not(:last-child) .accordion-item:last-child{border-bottom:var(--bs-accordion-border-width) solid var(--bs-accordion-border-color)}.bslib-sidebar-layout>.sidebar>.sidebar-content.has-accordion>.sidebar-title{border-bottom:none;padding-bottom:0}.bslib-sidebar-layout>.sidebar .shiny-input-container{width:100%}.bslib-sidebar-layout[data-bslib-sidebar-open=always]>.sidebar>.sidebar-content{padding-top:var(--bslib-sidebar-padding)}.bslib-sidebar-layout>.collapse-toggle{grid-row:1/2;grid-column:1/2;display:inline-flex;align-items:center;position:absolute;right:calc(var(--bslib-sidebar-icon-size));top:calc(var(--bslib-sidebar-icon-size, 1rem)/2);border:none;border-radius:var(--bslib-collapse-toggle-border-radius);height:var(--bslib-sidebar-icon-button-size, 2rem);width:var(--bslib-sidebar-icon-button-size, 2rem);display:flex;align-items:center;justify-content:center;padding:0;color:var(--bslib-sidebar-fg);background-color:unset;transition:color var(--bslib-sidebar-transition-easing-x) var(--bslib-sidebar-transition-duration),top var(--bslib-sidebar-transition-easing-x) var(--bslib-sidebar-transition-duration),right var(--bslib-sidebar-transition-easing-x) var(--bslib-sidebar-transition-duration),left var(--bslib-sidebar-transition-easing-x) var(--bslib-sidebar-transition-duration)}.bslib-sidebar-layout>.collapse-toggle:hover{background-color:var(--bslib-sidebar-toggle-bg)}.bslib-sidebar-layout>.collapse-toggle>.collapse-icon{opacity:.8;width:var(--bslib-sidebar-icon-size);height:var(--bslib-sidebar-icon-size);transform:rotateY(var(--bslib-collapse-toggle-transform));transition:transform var(--bslib-sidebar-toggle-transition-easing) var(--bslib-sidebar-transition-duration)}.bslib-sidebar-layout>.collapse-toggle:hover>.collapse-icon{opacity:1}.bslib-sidebar-layout .sidebar-title{font-size:1.25rem;line-height:1.25;margin-top:0;margin-bottom:1rem;padding-bottom:1rem;border-bottom:var(--bslib-sidebar-border)}.bslib-sidebar-layout.sidebar-right{grid-template-columns:var(--bslib-sidebar-column-main) min(100% - var(--bslib-sidebar-icon-size),var(--bslib-sidebar-width, 250px))}.bslib-sidebar-layout.sidebar-right>.main{grid-column:1/2;border-top-right-radius:0;border-bottom-right-radius:0;border-top-left-radius:inherit;border-bottom-left-radius:inherit}.bslib-sidebar-layout.sidebar-right>.sidebar{grid-column:2/3;border-right:none;border-left:var(--bslib-sidebar-vert-border);border-top-left-radius:0;border-bottom-left-radius:0}.bslib-sidebar-layout.sidebar-right>.collapse-toggle{grid-column:2/3;left:var(--bslib-sidebar-icon-size);right:unset;border:var(--bslib-collapse-toggle-border)}.bslib-sidebar-layout.sidebar-right>.collapse-toggle>.collapse-icon{transform:rotateY(var(--bslib-collapse-toggle-right-transform))}.bslib-sidebar-layout.sidebar-collapsed{--bslib-collapse-toggle-transform: 180deg;--bslib-collapse-toggle-right-transform: 0deg;--bslib-sidebar-vert-border: none;grid-template-columns:0 minmax(0, 1fr)}.bslib-sidebar-layout.sidebar-collapsed.sidebar-right{grid-template-columns:minmax(0, 1fr) 0}.bslib-sidebar-layout.sidebar-collapsed:not(.transitioning)>.sidebar>*{display:none}.bslib-sidebar-layout.sidebar-collapsed>.main{border-radius:inherit}.bslib-sidebar-layout.sidebar-collapsed:not(.sidebar-right)>.main{padding-left:var(--bslib-sidebar-padding-icon)}.bslib-sidebar-layout.sidebar-collapsed.sidebar-right>.main{padding-right:var(--bslib-sidebar-padding-icon)}.bslib-sidebar-layout.sidebar-collapsed>.collapse-toggle{color:var(--bslib-sidebar-main-fg);top:calc(var(--bslib-sidebar-overlap-counter, 0)*(var(--bslib-sidebar-icon-size) + var(--bslib-sidebar-padding)) + var(--bslib-sidebar-icon-size, 1rem)/2);right:calc(-2.5*var(--bslib-sidebar-icon-size) - var(--bs-card-border-width, 1px))}.bslib-sidebar-layout.sidebar-collapsed.sidebar-right>.collapse-toggle{left:calc(-2.5*var(--bslib-sidebar-icon-size) - var(--bs-card-border-width, 1px));right:unset}@media(min-width: 576px){.bslib-sidebar-layout.transitioning>.sidebar>.sidebar-content{display:none}}@media(max-width: 575.98px){.bslib-sidebar-layout[data-bslib-sidebar-open=desktop]{--bslib-sidebar-js-init-collapsed: true}.bslib-sidebar-layout>.sidebar,.bslib-sidebar-layout.sidebar-right>.sidebar{border:none}.bslib-sidebar-layout>.main,.bslib-sidebar-layout.sidebar-right>.main{grid-column:1/3}.bslib-sidebar-layout[data-bslib-sidebar-open=always]{display:block !important}.bslib-sidebar-layout[data-bslib-sidebar-open=always]>.sidebar{max-height:var(--bslib-sidebar-max-height-mobile);overflow-y:auto;border-top:var(--bslib-sidebar-vert-border)}.bslib-sidebar-layout:not([data-bslib-sidebar-open=always]){grid-template-columns:100% 0}.bslib-sidebar-layout:not([data-bslib-sidebar-open=always]):not(.sidebar-collapsed)>.sidebar{z-index:1}.bslib-sidebar-layout:not([data-bslib-sidebar-open=always]):not(.sidebar-collapsed)>.collapse-toggle{z-index:1}.bslib-sidebar-layout:not([data-bslib-sidebar-open=always]).sidebar-right{grid-template-columns:0 100%}.bslib-sidebar-layout:not([data-bslib-sidebar-open=always]).sidebar-collapsed{grid-template-columns:0 100%}.bslib-sidebar-layout:not([data-bslib-sidebar-open=always]).sidebar-collapsed.sidebar-right{grid-template-columns:100% 0}.bslib-sidebar-layout:not([data-bslib-sidebar-open=always]):not(.sidebar-right)>.main{padding-left:var(--bslib-sidebar-padding-icon)}.bslib-sidebar-layout:not([data-bslib-sidebar-open=always]).sidebar-right>.main{padding-right:var(--bslib-sidebar-padding-icon)}.bslib-sidebar-layout:not([data-bslib-sidebar-open=always])>.main{opacity:0;transition:opacity var(--bslib-sidebar-transition-easing-x) var(--bslib-sidebar-transition-duration)}.bslib-sidebar-layout:not([data-bslib-sidebar-open=always]).sidebar-collapsed>.main{opacity:1}}:root{--bslib-value-box-shadow: none;--bslib-value-box-border-width-auto-yes: var(--bslib-value-box-border-width-baseline);--bslib-value-box-border-width-auto-no: 0;--bslib-value-box-border-width-baseline: 1px}.bslib-value-box{border-width:var(--bslib-value-box-border-width-auto-no, var(--bslib-value-box-border-width-baseline));container-name:bslib-value-box;container-type:inline-size}.bslib-value-box.card{box-shadow:var(--bslib-value-box-shadow)}.bslib-value-box.border-auto{border-width:var(--bslib-value-box-border-width-auto-yes, var(--bslib-value-box-border-width-baseline))}.bslib-value-box.default{--bslib-value-box-bg-default: var(--bs-card-bg, #ffffff);--bslib-value-box-border-color-default: var(--bs-card-border-color, rgba(0, 0, 0, 0.175));color:var(--bslib-value-box-color);background-color:var(--bslib-value-box-bg, var(--bslib-value-box-bg-default));border-color:var(--bslib-value-box-border-color, var(--bslib-value-box-border-color-default))}.bslib-value-box .value-box-grid{display:grid;grid-template-areas:"left right";align-items:center;overflow:hidden}.bslib-value-box .value-box-showcase{height:100%;max-height:var(---bslib-value-box-showcase-max-h, 100%)}.bslib-value-box .value-box-showcase,.bslib-value-box .value-box-showcase>.html-fill-item{width:100%}.bslib-value-box[data-full-screen=true] .value-box-showcase{max-height:var(---bslib-value-box-showcase-max-h-fs, 100%)}@media screen and (min-width: 575.98px){@container bslib-value-box (max-width: 300px){.bslib-value-box:not(.showcase-bottom) .value-box-grid{grid-template-columns:1fr !important;grid-template-rows:auto auto;grid-template-areas:"top" "bottom"}.bslib-value-box:not(.showcase-bottom) .value-box-grid .value-box-showcase{grid-area:top !important}.bslib-value-box:not(.showcase-bottom) .value-box-grid .value-box-area{grid-area:bottom !important;justify-content:end}}}.bslib-value-box .value-box-area{justify-content:center;padding:1.5rem 1rem;font-size:.9rem;font-weight:500}.bslib-value-box .value-box-area *{margin-bottom:0;margin-top:0}.bslib-value-box .value-box-title{font-size:1rem;margin-top:0;margin-bottom:.5rem;font-weight:500;line-height:1.2}.bslib-value-box .value-box-title:empty::after{content:" "}.bslib-value-box .value-box-value{font-size:calc(1.29rem + 0.48vw);margin-top:0;margin-bottom:.5rem;font-weight:500;line-height:1.2}@media(min-width: 1200px){.bslib-value-box .value-box-value{font-size:1.65rem}}.bslib-value-box .value-box-value:empty::after{content:" "}.bslib-value-box .value-box-showcase{align-items:center;justify-content:center;margin-top:auto;margin-bottom:auto;padding:1rem}.bslib-value-box .value-box-showcase .bi,.bslib-value-box .value-box-showcase .fa,.bslib-value-box .value-box-showcase .fab,.bslib-value-box .value-box-showcase .fas,.bslib-value-box .value-box-showcase .far{opacity:.85;min-width:50px;max-width:125%}.bslib-value-box .value-box-showcase .bi,.bslib-value-box .value-box-showcase .fa,.bslib-value-box .value-box-showcase .fab,.bslib-value-box .value-box-showcase .fas,.bslib-value-box .value-box-showcase .far{font-size:4rem}.bslib-value-box.showcase-top-right .value-box-grid{grid-template-columns:1fr var(---bslib-value-box-showcase-w, 50%)}.bslib-value-box.showcase-top-right .value-box-grid .value-box-showcase{grid-area:right;margin-left:auto;align-self:start;align-items:end;padding-left:0;padding-bottom:0}.bslib-value-box.showcase-top-right .value-box-grid .value-box-area{grid-area:left;align-self:end}.bslib-value-box.showcase-top-right[data-full-screen=true] .value-box-grid{grid-template-columns:auto var(---bslib-value-box-showcase-w-fs, 1fr)}.bslib-value-box.showcase-top-right[data-full-screen=true] .value-box-grid>div{align-self:center}.bslib-value-box.showcase-top-right:not([data-full-screen=true]) .value-box-showcase{margin-top:0}@container bslib-value-box (max-width: 300px){.bslib-value-box.showcase-top-right:not([data-full-screen=true]) .value-box-grid .value-box-showcase{padding-left:1rem}}.bslib-value-box.showcase-left-center .value-box-grid{grid-template-columns:var(---bslib-value-box-showcase-w, 30%) auto}.bslib-value-box.showcase-left-center[data-full-screen=true] .value-box-grid{grid-template-columns:var(---bslib-value-box-showcase-w-fs, 1fr) auto}.bslib-value-box.showcase-left-center:not([data-fill-screen=true]) .value-box-grid .value-box-showcase{grid-area:left}.bslib-value-box.showcase-left-center:not([data-fill-screen=true]) .value-box-grid .value-box-area{grid-area:right}.bslib-value-box.showcase-bottom .value-box-grid{grid-template-columns:1fr;grid-template-rows:1fr var(---bslib-value-box-showcase-h, auto);grid-template-areas:"top" "bottom";overflow:hidden}.bslib-value-box.showcase-bottom .value-box-grid .value-box-showcase{grid-area:bottom;padding:0;margin:0}.bslib-value-box.showcase-bottom .value-box-grid .value-box-area{grid-area:top}.bslib-value-box.showcase-bottom[data-full-screen=true] .value-box-grid{grid-template-rows:1fr var(---bslib-value-box-showcase-h-fs, 2fr)}.bslib-value-box.showcase-bottom[data-full-screen=true] .value-box-grid .value-box-showcase{padding:1rem}[data-bs-theme=dark] .bslib-value-box{--bslib-value-box-shadow: 0 0.5rem 1rem rgb(0 0 0 / 50%)}.html-fill-container{display:flex;flex-direction:column;min-height:0;min-width:0}.html-fill-container>.html-fill-item{flex:1 1 auto;min-height:0;min-width:0}.html-fill-container>:not(.html-fill-item){flex:0 0 auto}.tippy-box[data-theme~=quarto]{background-color:#fff;border:solid 1px #dee2e6;border-radius:.375rem;color:#212529;font-size:.875rem}.tippy-box[data-theme~=quarto]>.tippy-backdrop{background-color:#fff}.tippy-box[data-theme~=quarto]>.tippy-arrow:after,.tippy-box[data-theme~=quarto]>.tippy-svg-arrow:after{content:"";position:absolute;z-index:-1}.tippy-box[data-theme~=quarto]>.tippy-arrow:after{border-color:rgba(0,0,0,0);border-style:solid}.tippy-box[data-placement^=top]>.tippy-arrow:before{bottom:-6px}.tippy-box[data-placement^=bottom]>.tippy-arrow:before{top:-6px}.tippy-box[data-placement^=right]>.tippy-arrow:before{left:-6px}.tippy-box[data-placement^=left]>.tippy-arrow:before{right:-6px}.tippy-box[data-theme~=quarto][data-placement^=top]>.tippy-arrow:before{border-top-color:#fff}.tippy-box[data-theme~=quarto][data-placement^=top]>.tippy-arrow:after{border-top-color:#dee2e6;border-width:7px 7px 0;top:17px;left:1px}.tippy-box[data-theme~=quarto][data-placement^=top]>.tippy-svg-arrow>svg{top:16px}.tippy-box[data-theme~=quarto][data-placement^=top]>.tippy-svg-arrow:after{top:17px}.tippy-box[data-theme~=quarto][data-placement^=bottom]>.tippy-arrow:before{border-bottom-color:#fff;bottom:16px}.tippy-box[data-theme~=quarto][data-placement^=bottom]>.tippy-arrow:after{border-bottom-color:#dee2e6;border-width:0 7px 7px;bottom:17px;left:1px}.tippy-box[data-theme~=quarto][data-placement^=bottom]>.tippy-svg-arrow>svg{bottom:15px}.tippy-box[data-theme~=quarto][data-placement^=bottom]>.tippy-svg-arrow:after{bottom:17px}.tippy-box[data-theme~=quarto][data-placement^=left]>.tippy-arrow:before{border-left-color:#fff}.tippy-box[data-theme~=quarto][data-placement^=left]>.tippy-arrow:after{border-left-color:#dee2e6;border-width:7px 0 7px 7px;left:17px;top:1px}.tippy-box[data-theme~=quarto][data-placement^=left]>.tippy-svg-arrow>svg{left:11px}.tippy-box[data-theme~=quarto][data-placement^=left]>.tippy-svg-arrow:after{left:12px}.tippy-box[data-theme~=quarto][data-placement^=right]>.tippy-arrow:before{border-right-color:#fff;right:16px}.tippy-box[data-theme~=quarto][data-placement^=right]>.tippy-arrow:after{border-width:7px 7px 7px 0;right:17px;top:1px;border-right-color:#dee2e6}.tippy-box[data-theme~=quarto][data-placement^=right]>.tippy-svg-arrow>svg{right:11px}.tippy-box[data-theme~=quarto][data-placement^=right]>.tippy-svg-arrow:after{right:12px}.tippy-box[data-theme~=quarto]>.tippy-svg-arrow{fill:#212529}.tippy-box[data-theme~=quarto]>.tippy-svg-arrow:after{background-image:url(data:image/svg+xml;base64,PHN2ZyB3aWR0aD0iMTYiIGhlaWdodD0iNiIgeG1sbnM9Imh0dHA6Ly93d3cudzMub3JnLzIwMDAvc3ZnIj48cGF0aCBkPSJNMCA2czEuNzk2LS4wMTMgNC42Ny0zLjYxNUM1Ljg1MS45IDYuOTMuMDA2IDggMGMxLjA3LS4wMDYgMi4xNDguODg3IDMuMzQzIDIuMzg1QzE0LjIzMyA2LjAwNSAxNiA2IDE2IDZIMHoiIGZpbGw9InJnYmEoMCwgOCwgMTYsIDAuMikiLz48L3N2Zz4=);background-size:16px 6px;width:16px;height:6px}.top-right{position:absolute;top:1em;right:1em}.visually-hidden{border:0;clip:rect(0 0 0 0);height:auto;margin:0;overflow:hidden;padding:0;position:absolute;width:1px;white-space:nowrap}.hidden{display:none !important}.zindex-bottom{z-index:-1 !important}figure.figure{display:block}.quarto-layout-panel{margin-bottom:1em}.quarto-layout-panel>figure{width:100%}.quarto-layout-panel>figure>figcaption,.quarto-layout-panel>.panel-caption{margin-top:10pt}.quarto-layout-panel>.table-caption{margin-top:0px}.table-caption p{margin-bottom:.5em}.quarto-layout-row{display:flex;flex-direction:row;align-items:flex-start}.quarto-layout-valign-top{align-items:flex-start}.quarto-layout-valign-bottom{align-items:flex-end}.quarto-layout-valign-center{align-items:center}.quarto-layout-cell{position:relative;margin-right:20px}.quarto-layout-cell:last-child{margin-right:0}.quarto-layout-cell figure,.quarto-layout-cell>p{margin:.2em}.quarto-layout-cell img{max-width:100%}.quarto-layout-cell .html-widget{width:100% !important}.quarto-layout-cell div figure p{margin:0}.quarto-layout-cell figure{display:block;margin-inline-start:0;margin-inline-end:0}.quarto-layout-cell table{display:inline-table}.quarto-layout-cell-subref figcaption,figure .quarto-layout-row figure figcaption{text-align:center;font-style:italic}.quarto-figure{position:relative;margin-bottom:1em}.quarto-figure>figure{width:100%;margin-bottom:0}.quarto-figure-left>figure>p,.quarto-figure-left>figure>div{text-align:left}.quarto-figure-center>figure>p,.quarto-figure-center>figure>div{text-align:center}.quarto-figure-right>figure>p,.quarto-figure-right>figure>div{text-align:right}.quarto-figure>figure>div.cell-annotation,.quarto-figure>figure>div code{text-align:left}figure>p:empty{display:none}figure>p:first-child{margin-top:0;margin-bottom:0}figure>figcaption.quarto-float-caption-bottom{margin-bottom:.5em}figure>figcaption.quarto-float-caption-top{margin-top:.5em}div[id^=tbl-]{position:relative}.quarto-figure>.anchorjs-link{position:absolute;top:.6em;right:.5em}div[id^=tbl-]>.anchorjs-link{position:absolute;top:.7em;right:.3em}.quarto-figure:hover>.anchorjs-link,div[id^=tbl-]:hover>.anchorjs-link,h2:hover>.anchorjs-link,.h2:hover>.anchorjs-link,h3:hover>.anchorjs-link,.h3:hover>.anchorjs-link,h4:hover>.anchorjs-link,.h4:hover>.anchorjs-link,h5:hover>.anchorjs-link,.h5:hover>.anchorjs-link,h6:hover>.anchorjs-link,.h6:hover>.anchorjs-link,.reveal-anchorjs-link>.anchorjs-link{opacity:1}#title-block-header{margin-block-end:1rem;position:relative;margin-top:-1px}#title-block-header .abstract{margin-block-start:1rem}#title-block-header .abstract .abstract-title{font-weight:600}#title-block-header a{text-decoration:none}#title-block-header .author,#title-block-header .date,#title-block-header .doi{margin-block-end:.2rem}#title-block-header .quarto-title-block>div{display:flex}#title-block-header .quarto-title-block>div>h1,#title-block-header .quarto-title-block>div>.h1{flex-grow:1}#title-block-header .quarto-title-block>div>button{flex-shrink:0;height:2.25rem;margin-top:0}@media(min-width: 992px){#title-block-header .quarto-title-block>div>button{margin-top:5px}}tr.header>th>p:last-of-type{margin-bottom:0px}table,table.table{margin-top:.5rem;margin-bottom:.5rem}caption,.table-caption{padding-top:.5rem;padding-bottom:.5rem;text-align:center}figure.quarto-float-tbl figcaption.quarto-float-caption-top{margin-top:.5rem;margin-bottom:.25rem;text-align:center}figure.quarto-float-tbl figcaption.quarto-float-caption-bottom{padding-top:.25rem;margin-bottom:.5rem;text-align:center}.utterances{max-width:none;margin-left:-8px}iframe{margin-bottom:1em}details{margin-bottom:1em}details[show]{margin-bottom:0}details>summary{color:rgba(33,37,41,.75)}details>summary>p:only-child{display:inline}pre.sourceCode,code.sourceCode{position:relative}p code:not(.sourceCode){white-space:pre-wrap}code{white-space:pre}@media print{code{white-space:pre-wrap}}pre>code{display:block}pre>code.sourceCode{white-space:pre}pre>code.sourceCode>span>a:first-child::before{text-decoration:none}pre.code-overflow-wrap>code.sourceCode{white-space:pre-wrap}pre.code-overflow-scroll>code.sourceCode{white-space:pre}code a:any-link{color:inherit;text-decoration:none}code a:hover{color:inherit;text-decoration:underline}ul.task-list{padding-left:1em}[data-tippy-root]{display:inline-block}.tippy-content .footnote-back{display:none}.footnote-back{margin-left:.2em}.tippy-content{overflow-x:auto}.quarto-embedded-source-code{display:none}.quarto-unresolved-ref{font-weight:600}.quarto-cover-image{max-width:35%;float:right;margin-left:30px}.cell-output-display .widget-subarea{margin-bottom:1em}.cell-output-display:not(.no-overflow-x),.knitsql-table:not(.no-overflow-x){overflow-x:auto}.panel-input{margin-bottom:1em}.panel-input>div,.panel-input>div>div{display:inline-block;vertical-align:top;padding-right:12px}.panel-input>p:last-child{margin-bottom:0}.layout-sidebar{margin-bottom:1em}.layout-sidebar .tab-content{border:none}.tab-content>.page-columns.active{display:grid}div.sourceCode>iframe{width:100%;height:300px;margin-bottom:-0.5em}a{text-underline-offset:3px}div.ansi-escaped-output{font-family:monospace;display:block}/*! +* +* ansi colors from IPython notebook's +* +* we also add `bright-[color]-` synonyms for the `-[color]-intense` classes since +* that seems to be what ansi_up emits +* +*/.ansi-black-fg{color:#3e424d}.ansi-black-bg{background-color:#3e424d}.ansi-black-intense-black,.ansi-bright-black-fg{color:#282c36}.ansi-black-intense-black,.ansi-bright-black-bg{background-color:#282c36}.ansi-red-fg{color:#e75c58}.ansi-red-bg{background-color:#e75c58}.ansi-red-intense-red,.ansi-bright-red-fg{color:#b22b31}.ansi-red-intense-red,.ansi-bright-red-bg{background-color:#b22b31}.ansi-green-fg{color:#00a250}.ansi-green-bg{background-color:#00a250}.ansi-green-intense-green,.ansi-bright-green-fg{color:#007427}.ansi-green-intense-green,.ansi-bright-green-bg{background-color:#007427}.ansi-yellow-fg{color:#ddb62b}.ansi-yellow-bg{background-color:#ddb62b}.ansi-yellow-intense-yellow,.ansi-bright-yellow-fg{color:#b27d12}.ansi-yellow-intense-yellow,.ansi-bright-yellow-bg{background-color:#b27d12}.ansi-blue-fg{color:#208ffb}.ansi-blue-bg{background-color:#208ffb}.ansi-blue-intense-blue,.ansi-bright-blue-fg{color:#0065ca}.ansi-blue-intense-blue,.ansi-bright-blue-bg{background-color:#0065ca}.ansi-magenta-fg{color:#d160c4}.ansi-magenta-bg{background-color:#d160c4}.ansi-magenta-intense-magenta,.ansi-bright-magenta-fg{color:#a03196}.ansi-magenta-intense-magenta,.ansi-bright-magenta-bg{background-color:#a03196}.ansi-cyan-fg{color:#60c6c8}.ansi-cyan-bg{background-color:#60c6c8}.ansi-cyan-intense-cyan,.ansi-bright-cyan-fg{color:#258f8f}.ansi-cyan-intense-cyan,.ansi-bright-cyan-bg{background-color:#258f8f}.ansi-white-fg{color:#c5c1b4}.ansi-white-bg{background-color:#c5c1b4}.ansi-white-intense-white,.ansi-bright-white-fg{color:#a1a6b2}.ansi-white-intense-white,.ansi-bright-white-bg{background-color:#a1a6b2}.ansi-default-inverse-fg{color:#fff}.ansi-default-inverse-bg{background-color:#000}.ansi-bold{font-weight:bold}.ansi-underline{text-decoration:underline}:root{--quarto-body-bg: #ffffff;--quarto-body-color: #212529;--quarto-text-muted: rgba(33, 37, 41, 0.75);--quarto-border-color: #dee2e6;--quarto-border-width: 1px;--quarto-border-radius: 0.375rem}table.gt_table{color:var(--quarto-body-color);font-size:1em;width:100%;background-color:rgba(0,0,0,0);border-top-width:inherit;border-bottom-width:inherit;border-color:var(--quarto-border-color)}table.gt_table th.gt_column_spanner_outer{color:var(--quarto-body-color);background-color:rgba(0,0,0,0);border-top-width:inherit;border-bottom-width:inherit;border-color:var(--quarto-border-color)}table.gt_table th.gt_col_heading{color:var(--quarto-body-color);font-weight:bold;background-color:rgba(0,0,0,0)}table.gt_table thead.gt_col_headings{border-bottom:1px solid currentColor;border-top-width:inherit;border-top-color:var(--quarto-border-color)}table.gt_table thead.gt_col_headings:not(:first-child){border-top-width:1px;border-top-color:var(--quarto-border-color)}table.gt_table td.gt_row{border-bottom-width:1px;border-bottom-color:var(--quarto-border-color);border-top-width:0px}table.gt_table tbody.gt_table_body{border-top-width:1px;border-bottom-width:1px;border-bottom-color:var(--quarto-border-color);border-top-color:currentColor}div.columns{display:initial;gap:initial}div.column{display:inline-block;overflow-x:initial;vertical-align:top;width:50%}.code-annotation-tip-content{word-wrap:break-word}.code-annotation-container-hidden{display:none !important}dl.code-annotation-container-grid{display:grid;grid-template-columns:min-content auto}dl.code-annotation-container-grid dt{grid-column:1}dl.code-annotation-container-grid dd{grid-column:2}pre.sourceCode.code-annotation-code{padding-right:0}code.sourceCode .code-annotation-anchor{z-index:100;position:relative;float:right;background-color:rgba(0,0,0,0)}input[type=checkbox]{margin-right:.5ch}:root{--mermaid-bg-color: #ffffff;--mermaid-edge-color: #6c757d;--mermaid-node-fg-color: #212529;--mermaid-fg-color: #212529;--mermaid-fg-color--lighter: #383f45;--mermaid-fg-color--lightest: #4e5862;--mermaid-font-family: system-ui, -apple-system, Segoe UI, Roboto, Helvetica Neue, Noto Sans, Liberation Sans, Arial, sans-serif, Apple Color Emoji, Segoe UI Emoji, Segoe UI Symbol, Noto Color Emoji;--mermaid-label-bg-color: #ffffff;--mermaid-label-fg-color: #0d6efd;--mermaid-node-bg-color: rgba(13, 110, 253, 0.1);--mermaid-node-fg-color: #212529}@media print{:root{font-size:11pt}#quarto-sidebar,#TOC,.nav-page{display:none}.page-columns .content{grid-column-start:page-start}.fixed-top{position:relative}.panel-caption,.figure-caption,figcaption{color:#666}}.code-copy-button{position:absolute;top:0;right:0;border:0;margin-top:5px;margin-right:5px;background-color:rgba(0,0,0,0);z-index:3}.code-copy-button:focus{outline:none}.code-copy-button-tooltip{font-size:.75em}pre.sourceCode:hover>.code-copy-button>.bi::before{display:inline-block;height:1rem;width:1rem;content:"";vertical-align:-0.125em;background-image:url('data:image/svg+xml,');background-repeat:no-repeat;background-size:1rem 1rem}pre.sourceCode:hover>.code-copy-button-checked>.bi::before{background-image:url('data:image/svg+xml,')}pre.sourceCode:hover>.code-copy-button:hover>.bi::before{background-image:url('data:image/svg+xml,')}pre.sourceCode:hover>.code-copy-button-checked:hover>.bi::before{background-image:url('data:image/svg+xml,')}main ol ol,main ul ul,main ol ul,main ul ol{margin-bottom:1em}ul>li:not(:has(>p))>ul,ol>li:not(:has(>p))>ul,ul>li:not(:has(>p))>ol,ol>li:not(:has(>p))>ol{margin-bottom:0}ul>li:not(:has(>p))>ul>li:has(>p),ol>li:not(:has(>p))>ul>li:has(>p),ul>li:not(:has(>p))>ol>li:has(>p),ol>li:not(:has(>p))>ol>li:has(>p){margin-top:1rem}body{margin:0}main.page-columns>header>h1.title,main.page-columns>header>.title.h1{margin-bottom:0}@media(min-width: 992px){body .page-columns{display:grid;gap:0;grid-template-columns:[screen-start] 1.5em [screen-start-inset] 5fr [page-start page-start-inset] 35px [body-start-outset] 35px [body-start] 1.5em [body-content-start] minmax(500px, calc(850px - 3em)) [body-content-end] 1.5em [body-end] 35px [body-end-outset] minmax(75px, 145px) [page-end-inset] 35px [page-end] 5fr [screen-end-inset] 1.5em [screen-end]}body.fullcontent:not(.floating):not(.docked) .page-columns{display:grid;gap:0;grid-template-columns:[screen-start] 1.5em [screen-start-inset] 5fr [page-start page-start-inset] 35px [body-start-outset] 35px [body-start] 1.5em [body-content-start] minmax(500px, calc(850px - 3em)) [body-content-end] 1.5em [body-end] 35px [body-end-outset] 35px [page-end-inset page-end] 5fr [screen-end-inset] 1.5em}body.slimcontent:not(.floating):not(.docked) .page-columns{display:grid;gap:0;grid-template-columns:[screen-start] 1.5em [screen-start-inset] 5fr [page-start page-start-inset] 35px [body-start-outset] 35px [body-start] 1.5em [body-content-start] minmax(500px, calc(850px - 3em)) [body-content-end] 1.5em [body-end] 50px [body-end-outset] minmax(0px, 200px) [page-end-inset] 35px [page-end] 5fr [screen-end-inset] 1.5em [screen-end]}body.listing:not(.floating):not(.docked) .page-columns{display:grid;gap:0;grid-template-columns:[screen-start] 1.5em [screen-start-inset page-start] minmax(50px, 100px) [page-start-inset] 50px [body-start-outset] 50px [body-start] 1.5em [body-content-start] minmax(500px, calc(850px - 3em)) [body-content-end] 3em [body-end] 50px [body-end-outset] minmax(0px, 250px) [page-end-inset] minmax(50px, 100px) [page-end] 1fr [screen-end-inset] 1.5em [screen-end]}body:not(.floating):not(.docked) .page-columns.toc-left{display:grid;gap:0;grid-template-columns:[screen-start] 1.5em [screen-start-inset] 5fr [page-start] 35px [page-start-inset] minmax(0px, 175px) [body-start-outset] 35px [body-start] 1.5em [body-content-start] minmax(450px, calc(800px - 3em)) [body-content-end] 1.5em [body-end] 50px [body-end-outset] minmax(0px, 200px) [page-end-inset] 50px [page-end] 5fr [screen-end-inset] 1.5em [screen-end]}body:not(.floating):not(.docked) .page-columns.toc-left .page-columns{display:grid;gap:0;grid-template-columns:[screen-start] 1.5em [screen-start-inset] 5fr [page-start] 35px [page-start-inset] minmax(0px, 175px) [body-start-outset] 35px [body-start] 1.5em [body-content-start] minmax(450px, calc(800px - 3em)) [body-content-end] 1.5em [body-end] 50px [body-end-outset] minmax(0px, 200px) [page-end-inset] 50px [page-end] 5fr [screen-end-inset] 1.5em [screen-end]}body.floating .page-columns{display:grid;gap:0;grid-template-columns:[screen-start] 1.5em [screen-start-inset] 5fr [page-start] minmax(25px, 50px) [page-start-inset] minmax(50px, 150px) [body-start-outset] minmax(25px, 50px) [body-start] 1.5em [body-content-start] minmax(500px, calc(800px - 3em)) [body-content-end] 1.5em [body-end] minmax(25px, 50px) [body-end-outset] minmax(50px, 150px) [page-end-inset] minmax(25px, 50px) [page-end] 5fr [screen-end-inset] 1.5em [screen-end]}body.docked .page-columns{display:grid;gap:0;grid-template-columns:[screen-start] 1.5em [screen-start-inset page-start] minmax(50px, 100px) [page-start-inset] 50px [body-start-outset] 50px [body-start] 1.5em [body-content-start] minmax(500px, calc(1000px - 3em)) [body-content-end] 1.5em [body-end] 50px [body-end-outset] minmax(50px, 100px) [page-end-inset] 50px [page-end] 5fr [screen-end-inset] 1.5em [screen-end]}body.docked.fullcontent .page-columns{display:grid;gap:0;grid-template-columns:[screen-start] 1.5em [screen-start-inset page-start] minmax(50px, 100px) [page-start-inset] 50px [body-start-outset] 50px [body-start] 1.5em [body-content-start] minmax(500px, calc(1000px - 3em)) [body-content-end] 1.5em [body-end body-end-outset page-end-inset page-end] 5fr [screen-end-inset] 1.5em [screen-end]}body.floating.fullcontent .page-columns{display:grid;gap:0;grid-template-columns:[screen-start] 1.5em [screen-start-inset] 5fr [page-start] 50px [page-start-inset] minmax(50px, 150px) [body-start-outset] 50px [body-start] 1.5em [body-content-start] minmax(500px, calc(800px - 3em)) [body-content-end] 1.5em [body-end body-end-outset page-end-inset page-end] 5fr [screen-end-inset] 1.5em [screen-end]}body.docked.slimcontent .page-columns{display:grid;gap:0;grid-template-columns:[screen-start] 1.5em [screen-start-inset page-start] minmax(50px, 100px) [page-start-inset] 50px [body-start-outset] 50px [body-start] 1.5em [body-content-start] minmax(450px, calc(750px - 3em)) [body-content-end] 1.5em [body-end] 50px [body-end-outset] minmax(0px, 200px) [page-end-inset] 50px [page-end] 5fr [screen-end-inset] 1.5em [screen-end]}body.docked.listing .page-columns{display:grid;gap:0;grid-template-columns:[screen-start] 1.5em [screen-start-inset page-start] minmax(50px, 100px) [page-start-inset] 50px [body-start-outset] 50px [body-start] 1.5em [body-content-start] minmax(500px, calc(1000px - 3em)) [body-content-end] 1.5em [body-end] 50px [body-end-outset] minmax(0px, 200px) [page-end-inset] 50px [page-end] 5fr [screen-end-inset] 1.5em [screen-end]}body.floating.slimcontent .page-columns{display:grid;gap:0;grid-template-columns:[screen-start] 1.5em [screen-start-inset] 5fr [page-start] 50px [page-start-inset] minmax(50px, 150px) [body-start-outset] 50px [body-start] 1.5em [body-content-start] minmax(450px, calc(750px - 3em)) [body-content-end] 1.5em [body-end] 50px [body-end-outset] minmax(50px, 150px) [page-end-inset] 50px [page-end] 5fr [screen-end-inset] 1.5em [screen-end]}body.floating.listing .page-columns{display:grid;gap:0;grid-template-columns:[screen-start] 1.5em [screen-start-inset] 5fr [page-start] minmax(25px, 50px) [page-start-inset] minmax(50px, 150px) [body-start-outset] minmax(25px, 50px) [body-start] 1.5em [body-content-start] minmax(500px, calc(800px - 3em)) [body-content-end] 1.5em [body-end] minmax(25px, 50px) [body-end-outset] minmax(50px, 150px) [page-end-inset] minmax(25px, 50px) [page-end] 5fr [screen-end-inset] 1.5em [screen-end]}}@media(max-width: 991.98px){body .page-columns{display:grid;gap:0;grid-template-columns:[screen-start] 1.5em [screen-start-inset page-start page-start-inset body-start-outset] 5fr [body-start] 1.5em [body-content-start] minmax(500px, calc(800px - 3em)) [body-content-end] 1.5em [body-end] 35px [body-end-outset] minmax(75px, 145px) [page-end-inset] 35px [page-end] 5fr [screen-end-inset] 1.5em [screen-end]}body.fullcontent:not(.floating):not(.docked) .page-columns{display:grid;gap:0;grid-template-columns:[screen-start] 1.5em [screen-start-inset page-start page-start-inset body-start-outset] 5fr [body-start] 1.5em [body-content-start] minmax(500px, calc(800px - 3em)) [body-content-end] 1.5em [body-end body-end-outset page-end-inset page-end] 5fr [screen-end-inset] 1.5em [screen-end]}body.slimcontent:not(.floating):not(.docked) .page-columns{display:grid;gap:0;grid-template-columns:[screen-start] 1.5em [screen-start-inset page-start page-start-inset body-start-outset] 5fr [body-start] 1.5em [body-content-start] minmax(500px, calc(800px - 3em)) [body-content-end] 1.5em [body-end] 35px [body-end-outset] minmax(75px, 145px) [page-end-inset] 35px [page-end] 5fr [screen-end-inset] 1.5em [screen-end]}body.listing:not(.floating):not(.docked) .page-columns{display:grid;gap:0;grid-template-columns:[screen-start] 1.5em [screen-start-inset page-start page-start-inset body-start-outset] 5fr [body-start] 1.5em [body-content-start] minmax(500px, calc(1250px - 3em)) [body-content-end body-end body-end-outset page-end-inset page-end] 5fr [screen-end-inset] 1.5em [screen-end]}body:not(.floating):not(.docked) .page-columns.toc-left{display:grid;gap:0;grid-template-columns:[screen-start] 1.5em [screen-start-inset] 5fr [page-start] 35px [page-start-inset] minmax(0px, 145px) [body-start-outset] 35px [body-start] 1.5em [body-content-start] minmax(450px, calc(800px - 3em)) [body-content-end] 1.5em [body-end body-end-outset page-end-inset page-end] 5fr [screen-end-inset] 1.5em [screen-end]}body:not(.floating):not(.docked) .page-columns.toc-left .page-columns{display:grid;gap:0;grid-template-columns:[screen-start] 1.5em [screen-start-inset] 5fr [page-start] 35px [page-start-inset] minmax(0px, 145px) [body-start-outset] 35px [body-start] 1.5em [body-content-start] minmax(450px, calc(800px - 3em)) [body-content-end] 1.5em [body-end body-end-outset page-end-inset page-end] 5fr [screen-end-inset] 1.5em [screen-end]}body.floating .page-columns{display:grid;gap:0;grid-template-columns:[screen-start] 1.5em [screen-start-inset] 5fr [page-start page-start-inset body-start-outset body-start] 1.5em [body-content-start] minmax(500px, calc(750px - 3em)) [body-content-end] 1.5em [body-end] 50px [body-end-outset] minmax(75px, 150px) [page-end-inset] 25px [page-end] 5fr [screen-end-inset] 1.5em [screen-end]}body.docked .page-columns{display:grid;gap:0;grid-template-columns:[screen-start] 1.5em [screen-start-inset page-start page-start-inset body-start-outset body-start body-content-start] minmax(500px, calc(750px - 3em)) [body-content-end] 1.5em [body-end] 50px [body-end-outset] minmax(25px, 50px) [page-end-inset] 50px [page-end] 5fr [screen-end-inset] 1.5em [screen-end]}body.docked.fullcontent .page-columns{display:grid;gap:0;grid-template-columns:[screen-start] 1.5em [screen-start-inset page-start page-start-inset body-start-outset body-start body-content-start] minmax(500px, calc(1000px - 3em)) [body-content-end] 1.5em [body-end body-end-outset page-end-inset page-end] 5fr [screen-end-inset] 1.5em [screen-end]}body.floating.fullcontent .page-columns{display:grid;gap:0;grid-template-columns:[screen-start] 1.5em [screen-start-inset] 5fr [page-start page-start-inset body-start-outset body-start] 1em [body-content-start] minmax(500px, calc(800px - 3em)) [body-content-end] 1.5em [body-end body-end-outset page-end-inset page-end] 4fr [screen-end-inset] 1.5em [screen-end]}body.docked.slimcontent .page-columns{display:grid;gap:0;grid-template-columns:[screen-start] 1.5em [screen-start-inset page-start page-start-inset body-start-outset body-start body-content-start] minmax(500px, calc(750px - 3em)) [body-content-end] 1.5em [body-end] 50px [body-end-outset] minmax(25px, 50px) [page-end-inset] 50px [page-end] 5fr [screen-end-inset] 1.5em [screen-end]}body.docked.listing .page-columns{display:grid;gap:0;grid-template-columns:[screen-start] 1.5em [screen-start-inset page-start page-start-inset body-start-outset body-start body-content-start] minmax(500px, calc(750px - 3em)) [body-content-end] 1.5em [body-end] 50px [body-end-outset] minmax(25px, 50px) [page-end-inset] 50px [page-end] 5fr [screen-end-inset] 1.5em [screen-end]}body.floating.slimcontent .page-columns{display:grid;gap:0;grid-template-columns:[screen-start] 1.5em [screen-start-inset] 5fr [page-start page-start-inset body-start-outset body-start] 1em [body-content-start] minmax(500px, calc(750px - 3em)) [body-content-end] 1.5em [body-end] 35px [body-end-outset] minmax(75px, 145px) [page-end-inset] 35px [page-end] 4fr [screen-end-inset] 1.5em [screen-end]}body.floating.listing .page-columns{display:grid;gap:0;grid-template-columns:[screen-start] 1.5em [screen-start-inset] 5fr [page-start page-start-inset body-start-outset body-start] 1em [body-content-start] minmax(500px, calc(750px - 3em)) [body-content-end] 1.5em [body-end] 50px [body-end-outset] minmax(75px, 150px) [page-end-inset] 25px [page-end] 4fr [screen-end-inset] 1.5em [screen-end]}}@media(max-width: 767.98px){body .page-columns,body.fullcontent:not(.floating):not(.docked) .page-columns,body.slimcontent:not(.floating):not(.docked) .page-columns,body.docked .page-columns,body.docked.slimcontent .page-columns,body.docked.fullcontent .page-columns,body.floating .page-columns,body.floating.slimcontent .page-columns,body.floating.fullcontent .page-columns{display:grid;gap:0;grid-template-columns:[screen-start] 1.5em [screen-start-inset page-start page-start-inset body-start-outset body-start body-content-start] minmax(0px, 1fr) [body-content-end body-end body-end-outset page-end-inset page-end screen-end-inset] 1.5em [screen-end]}body:not(.floating):not(.docked) .page-columns.toc-left{display:grid;gap:0;grid-template-columns:[screen-start] 1.5em [screen-start-inset page-start page-start-inset body-start-outset body-start body-content-start] minmax(0px, 1fr) [body-content-end body-end body-end-outset page-end-inset page-end screen-end-inset] 1.5em [screen-end]}body:not(.floating):not(.docked) .page-columns.toc-left .page-columns{display:grid;gap:0;grid-template-columns:[screen-start] 1.5em [screen-start-inset page-start page-start-inset body-start-outset body-start body-content-start] minmax(0px, 1fr) [body-content-end body-end body-end-outset page-end-inset page-end screen-end-inset] 1.5em [screen-end]}nav[role=doc-toc]{display:none}}body,.page-row-navigation{grid-template-rows:[page-top] max-content [contents-top] max-content [contents-bottom] max-content [page-bottom]}.page-rows-contents{grid-template-rows:[content-top] minmax(max-content, 1fr) [content-bottom] minmax(60px, max-content) [page-bottom]}.page-full{grid-column:screen-start/screen-end !important}.page-columns>*{grid-column:body-content-start/body-content-end}.page-columns.column-page>*{grid-column:page-start/page-end}.page-columns.column-page-left .page-columns.page-full>*,.page-columns.column-page-left>*{grid-column:page-start/body-content-end}.page-columns.column-page-right .page-columns.page-full>*,.page-columns.column-page-right>*{grid-column:body-content-start/page-end}.page-rows{grid-auto-rows:auto}.header{grid-column:screen-start/screen-end;grid-row:page-top/contents-top}#quarto-content{padding:0;grid-column:screen-start/screen-end;grid-row:contents-top/contents-bottom}body.floating .sidebar.sidebar-navigation{grid-column:page-start/body-start;grid-row:content-top/page-bottom}body.docked .sidebar.sidebar-navigation{grid-column:screen-start/body-start;grid-row:content-top/page-bottom}.sidebar.toc-left{grid-column:page-start/body-start;grid-row:content-top/page-bottom}.sidebar.margin-sidebar{grid-column:body-end/page-end;grid-row:content-top/page-bottom}.page-columns .content{grid-column:body-content-start/body-content-end;grid-row:content-top/content-bottom;align-content:flex-start}.page-columns .page-navigation{grid-column:body-content-start/body-content-end;grid-row:content-bottom/page-bottom}.page-columns .footer{grid-column:screen-start/screen-end;grid-row:contents-bottom/page-bottom}.page-columns .column-body{grid-column:body-content-start/body-content-end}.page-columns .column-body-fullbleed{grid-column:body-start/body-end}.page-columns .column-body-outset{grid-column:body-start-outset/body-end-outset;z-index:998;opacity:.999}.page-columns .column-body-outset table{background:#fff}.page-columns .column-body-outset-left{grid-column:body-start-outset/body-content-end;z-index:998;opacity:.999}.page-columns .column-body-outset-left table{background:#fff}.page-columns .column-body-outset-right{grid-column:body-content-start/body-end-outset;z-index:998;opacity:.999}.page-columns .column-body-outset-right table{background:#fff}.page-columns .column-page{grid-column:page-start/page-end;z-index:998;opacity:.999}.page-columns .column-page table{background:#fff}.page-columns .column-page-inset{grid-column:page-start-inset/page-end-inset;z-index:998;opacity:.999}.page-columns .column-page-inset table{background:#fff}.page-columns .column-page-inset-left{grid-column:page-start-inset/body-content-end;z-index:998;opacity:.999}.page-columns .column-page-inset-left table{background:#fff}.page-columns .column-page-inset-right{grid-column:body-content-start/page-end-inset;z-index:998;opacity:.999}.page-columns .column-page-inset-right figcaption table{background:#fff}.page-columns .column-page-left{grid-column:page-start/body-content-end;z-index:998;opacity:.999}.page-columns .column-page-left table{background:#fff}.page-columns .column-page-right{grid-column:body-content-start/page-end;z-index:998;opacity:.999}.page-columns .column-page-right figcaption table{background:#fff}#quarto-content.page-columns #quarto-margin-sidebar,#quarto-content.page-columns #quarto-sidebar{z-index:1}@media(max-width: 991.98px){#quarto-content.page-columns #quarto-margin-sidebar.collapse,#quarto-content.page-columns #quarto-sidebar.collapse,#quarto-content.page-columns #quarto-margin-sidebar.collapsing,#quarto-content.page-columns #quarto-sidebar.collapsing{z-index:1055}}#quarto-content.page-columns main.column-page,#quarto-content.page-columns main.column-page-right,#quarto-content.page-columns main.column-page-left{z-index:0}.page-columns .column-screen-inset{grid-column:screen-start-inset/screen-end-inset;z-index:998;opacity:.999}.page-columns .column-screen-inset table{background:#fff}.page-columns .column-screen-inset-left{grid-column:screen-start-inset/body-content-end;z-index:998;opacity:.999}.page-columns .column-screen-inset-left table{background:#fff}.page-columns .column-screen-inset-right{grid-column:body-content-start/screen-end-inset;z-index:998;opacity:.999}.page-columns .column-screen-inset-right table{background:#fff}.page-columns .column-screen{grid-column:screen-start/screen-end;z-index:998;opacity:.999}.page-columns .column-screen table{background:#fff}.page-columns .column-screen-left{grid-column:screen-start/body-content-end;z-index:998;opacity:.999}.page-columns .column-screen-left table{background:#fff}.page-columns .column-screen-right{grid-column:body-content-start/screen-end;z-index:998;opacity:.999}.page-columns .column-screen-right table{background:#fff}.page-columns .column-screen-inset-shaded{grid-column:screen-start/screen-end;padding:1em;background:#f8f9fa;z-index:998;opacity:.999;margin-bottom:1em}.zindex-content{z-index:998;opacity:.999}.zindex-modal{z-index:1055;opacity:.999}.zindex-over-content{z-index:999;opacity:.999}img.img-fluid.column-screen,img.img-fluid.column-screen-inset-shaded,img.img-fluid.column-screen-inset,img.img-fluid.column-screen-inset-left,img.img-fluid.column-screen-inset-right,img.img-fluid.column-screen-left,img.img-fluid.column-screen-right{width:100%}@media(min-width: 992px){.margin-caption,div.aside,aside:not(.footnotes):not(.sidebar),.column-margin{grid-column:body-end/page-end !important;z-index:998}.column-sidebar{grid-column:page-start/body-start !important;z-index:998}.column-leftmargin{grid-column:screen-start-inset/body-start !important;z-index:998}.no-row-height{height:1em;overflow:visible}}@media(max-width: 991.98px){.margin-caption,div.aside,aside:not(.footnotes):not(.sidebar),.column-margin{grid-column:body-end/page-end !important;z-index:998}.no-row-height{height:1em;overflow:visible}.page-columns.page-full{overflow:visible}.page-columns.toc-left .margin-caption,.page-columns.toc-left div.aside,.page-columns.toc-left aside:not(.footnotes):not(.sidebar),.page-columns.toc-left .column-margin{grid-column:body-content-start/body-content-end !important;z-index:998;opacity:.999}.page-columns.toc-left .no-row-height{height:initial;overflow:initial}}@media(max-width: 767.98px){.margin-caption,div.aside,aside:not(.footnotes):not(.sidebar),.column-margin{grid-column:body-content-start/body-content-end !important;z-index:998;opacity:.999}.no-row-height{height:initial;overflow:initial}#quarto-margin-sidebar{display:none}#quarto-sidebar-toc-left{display:none}.hidden-sm{display:none}}.panel-grid{display:grid;grid-template-rows:repeat(1, 1fr);grid-template-columns:repeat(24, 1fr);gap:1em}.panel-grid .g-col-1{grid-column:auto/span 1}.panel-grid .g-col-2{grid-column:auto/span 2}.panel-grid .g-col-3{grid-column:auto/span 3}.panel-grid .g-col-4{grid-column:auto/span 4}.panel-grid .g-col-5{grid-column:auto/span 5}.panel-grid .g-col-6{grid-column:auto/span 6}.panel-grid .g-col-7{grid-column:auto/span 7}.panel-grid .g-col-8{grid-column:auto/span 8}.panel-grid .g-col-9{grid-column:auto/span 9}.panel-grid .g-col-10{grid-column:auto/span 10}.panel-grid .g-col-11{grid-column:auto/span 11}.panel-grid .g-col-12{grid-column:auto/span 12}.panel-grid .g-col-13{grid-column:auto/span 13}.panel-grid .g-col-14{grid-column:auto/span 14}.panel-grid .g-col-15{grid-column:auto/span 15}.panel-grid .g-col-16{grid-column:auto/span 16}.panel-grid .g-col-17{grid-column:auto/span 17}.panel-grid .g-col-18{grid-column:auto/span 18}.panel-grid .g-col-19{grid-column:auto/span 19}.panel-grid .g-col-20{grid-column:auto/span 20}.panel-grid .g-col-21{grid-column:auto/span 21}.panel-grid .g-col-22{grid-column:auto/span 22}.panel-grid .g-col-23{grid-column:auto/span 23}.panel-grid .g-col-24{grid-column:auto/span 24}.panel-grid .g-start-1{grid-column-start:1}.panel-grid .g-start-2{grid-column-start:2}.panel-grid .g-start-3{grid-column-start:3}.panel-grid .g-start-4{grid-column-start:4}.panel-grid .g-start-5{grid-column-start:5}.panel-grid .g-start-6{grid-column-start:6}.panel-grid .g-start-7{grid-column-start:7}.panel-grid .g-start-8{grid-column-start:8}.panel-grid .g-start-9{grid-column-start:9}.panel-grid .g-start-10{grid-column-start:10}.panel-grid .g-start-11{grid-column-start:11}.panel-grid .g-start-12{grid-column-start:12}.panel-grid .g-start-13{grid-column-start:13}.panel-grid .g-start-14{grid-column-start:14}.panel-grid .g-start-15{grid-column-start:15}.panel-grid .g-start-16{grid-column-start:16}.panel-grid .g-start-17{grid-column-start:17}.panel-grid .g-start-18{grid-column-start:18}.panel-grid .g-start-19{grid-column-start:19}.panel-grid .g-start-20{grid-column-start:20}.panel-grid .g-start-21{grid-column-start:21}.panel-grid .g-start-22{grid-column-start:22}.panel-grid .g-start-23{grid-column-start:23}@media(min-width: 576px){.panel-grid .g-col-sm-1{grid-column:auto/span 1}.panel-grid .g-col-sm-2{grid-column:auto/span 2}.panel-grid .g-col-sm-3{grid-column:auto/span 3}.panel-grid .g-col-sm-4{grid-column:auto/span 4}.panel-grid .g-col-sm-5{grid-column:auto/span 5}.panel-grid .g-col-sm-6{grid-column:auto/span 6}.panel-grid .g-col-sm-7{grid-column:auto/span 7}.panel-grid .g-col-sm-8{grid-column:auto/span 8}.panel-grid .g-col-sm-9{grid-column:auto/span 9}.panel-grid .g-col-sm-10{grid-column:auto/span 10}.panel-grid .g-col-sm-11{grid-column:auto/span 11}.panel-grid .g-col-sm-12{grid-column:auto/span 12}.panel-grid .g-col-sm-13{grid-column:auto/span 13}.panel-grid .g-col-sm-14{grid-column:auto/span 14}.panel-grid .g-col-sm-15{grid-column:auto/span 15}.panel-grid .g-col-sm-16{grid-column:auto/span 16}.panel-grid .g-col-sm-17{grid-column:auto/span 17}.panel-grid .g-col-sm-18{grid-column:auto/span 18}.panel-grid .g-col-sm-19{grid-column:auto/span 19}.panel-grid .g-col-sm-20{grid-column:auto/span 20}.panel-grid .g-col-sm-21{grid-column:auto/span 21}.panel-grid .g-col-sm-22{grid-column:auto/span 22}.panel-grid .g-col-sm-23{grid-column:auto/span 23}.panel-grid .g-col-sm-24{grid-column:auto/span 24}.panel-grid .g-start-sm-1{grid-column-start:1}.panel-grid .g-start-sm-2{grid-column-start:2}.panel-grid .g-start-sm-3{grid-column-start:3}.panel-grid .g-start-sm-4{grid-column-start:4}.panel-grid .g-start-sm-5{grid-column-start:5}.panel-grid .g-start-sm-6{grid-column-start:6}.panel-grid .g-start-sm-7{grid-column-start:7}.panel-grid .g-start-sm-8{grid-column-start:8}.panel-grid .g-start-sm-9{grid-column-start:9}.panel-grid .g-start-sm-10{grid-column-start:10}.panel-grid .g-start-sm-11{grid-column-start:11}.panel-grid .g-start-sm-12{grid-column-start:12}.panel-grid .g-start-sm-13{grid-column-start:13}.panel-grid .g-start-sm-14{grid-column-start:14}.panel-grid .g-start-sm-15{grid-column-start:15}.panel-grid .g-start-sm-16{grid-column-start:16}.panel-grid .g-start-sm-17{grid-column-start:17}.panel-grid .g-start-sm-18{grid-column-start:18}.panel-grid .g-start-sm-19{grid-column-start:19}.panel-grid .g-start-sm-20{grid-column-start:20}.panel-grid .g-start-sm-21{grid-column-start:21}.panel-grid .g-start-sm-22{grid-column-start:22}.panel-grid .g-start-sm-23{grid-column-start:23}}@media(min-width: 768px){.panel-grid .g-col-md-1{grid-column:auto/span 1}.panel-grid .g-col-md-2{grid-column:auto/span 2}.panel-grid .g-col-md-3{grid-column:auto/span 3}.panel-grid .g-col-md-4{grid-column:auto/span 4}.panel-grid .g-col-md-5{grid-column:auto/span 5}.panel-grid .g-col-md-6{grid-column:auto/span 6}.panel-grid .g-col-md-7{grid-column:auto/span 7}.panel-grid .g-col-md-8{grid-column:auto/span 8}.panel-grid .g-col-md-9{grid-column:auto/span 9}.panel-grid .g-col-md-10{grid-column:auto/span 10}.panel-grid .g-col-md-11{grid-column:auto/span 11}.panel-grid .g-col-md-12{grid-column:auto/span 12}.panel-grid .g-col-md-13{grid-column:auto/span 13}.panel-grid .g-col-md-14{grid-column:auto/span 14}.panel-grid .g-col-md-15{grid-column:auto/span 15}.panel-grid .g-col-md-16{grid-column:auto/span 16}.panel-grid .g-col-md-17{grid-column:auto/span 17}.panel-grid .g-col-md-18{grid-column:auto/span 18}.panel-grid .g-col-md-19{grid-column:auto/span 19}.panel-grid .g-col-md-20{grid-column:auto/span 20}.panel-grid .g-col-md-21{grid-column:auto/span 21}.panel-grid .g-col-md-22{grid-column:auto/span 22}.panel-grid .g-col-md-23{grid-column:auto/span 23}.panel-grid .g-col-md-24{grid-column:auto/span 24}.panel-grid .g-start-md-1{grid-column-start:1}.panel-grid .g-start-md-2{grid-column-start:2}.panel-grid .g-start-md-3{grid-column-start:3}.panel-grid .g-start-md-4{grid-column-start:4}.panel-grid .g-start-md-5{grid-column-start:5}.panel-grid .g-start-md-6{grid-column-start:6}.panel-grid .g-start-md-7{grid-column-start:7}.panel-grid .g-start-md-8{grid-column-start:8}.panel-grid .g-start-md-9{grid-column-start:9}.panel-grid .g-start-md-10{grid-column-start:10}.panel-grid .g-start-md-11{grid-column-start:11}.panel-grid .g-start-md-12{grid-column-start:12}.panel-grid .g-start-md-13{grid-column-start:13}.panel-grid .g-start-md-14{grid-column-start:14}.panel-grid .g-start-md-15{grid-column-start:15}.panel-grid .g-start-md-16{grid-column-start:16}.panel-grid .g-start-md-17{grid-column-start:17}.panel-grid .g-start-md-18{grid-column-start:18}.panel-grid .g-start-md-19{grid-column-start:19}.panel-grid .g-start-md-20{grid-column-start:20}.panel-grid .g-start-md-21{grid-column-start:21}.panel-grid .g-start-md-22{grid-column-start:22}.panel-grid .g-start-md-23{grid-column-start:23}}@media(min-width: 992px){.panel-grid .g-col-lg-1{grid-column:auto/span 1}.panel-grid .g-col-lg-2{grid-column:auto/span 2}.panel-grid .g-col-lg-3{grid-column:auto/span 3}.panel-grid .g-col-lg-4{grid-column:auto/span 4}.panel-grid .g-col-lg-5{grid-column:auto/span 5}.panel-grid .g-col-lg-6{grid-column:auto/span 6}.panel-grid .g-col-lg-7{grid-column:auto/span 7}.panel-grid .g-col-lg-8{grid-column:auto/span 8}.panel-grid .g-col-lg-9{grid-column:auto/span 9}.panel-grid .g-col-lg-10{grid-column:auto/span 10}.panel-grid .g-col-lg-11{grid-column:auto/span 11}.panel-grid .g-col-lg-12{grid-column:auto/span 12}.panel-grid .g-col-lg-13{grid-column:auto/span 13}.panel-grid .g-col-lg-14{grid-column:auto/span 14}.panel-grid .g-col-lg-15{grid-column:auto/span 15}.panel-grid .g-col-lg-16{grid-column:auto/span 16}.panel-grid .g-col-lg-17{grid-column:auto/span 17}.panel-grid .g-col-lg-18{grid-column:auto/span 18}.panel-grid .g-col-lg-19{grid-column:auto/span 19}.panel-grid .g-col-lg-20{grid-column:auto/span 20}.panel-grid .g-col-lg-21{grid-column:auto/span 21}.panel-grid .g-col-lg-22{grid-column:auto/span 22}.panel-grid .g-col-lg-23{grid-column:auto/span 23}.panel-grid .g-col-lg-24{grid-column:auto/span 24}.panel-grid .g-start-lg-1{grid-column-start:1}.panel-grid .g-start-lg-2{grid-column-start:2}.panel-grid .g-start-lg-3{grid-column-start:3}.panel-grid .g-start-lg-4{grid-column-start:4}.panel-grid .g-start-lg-5{grid-column-start:5}.panel-grid .g-start-lg-6{grid-column-start:6}.panel-grid .g-start-lg-7{grid-column-start:7}.panel-grid .g-start-lg-8{grid-column-start:8}.panel-grid .g-start-lg-9{grid-column-start:9}.panel-grid .g-start-lg-10{grid-column-start:10}.panel-grid .g-start-lg-11{grid-column-start:11}.panel-grid .g-start-lg-12{grid-column-start:12}.panel-grid .g-start-lg-13{grid-column-start:13}.panel-grid .g-start-lg-14{grid-column-start:14}.panel-grid .g-start-lg-15{grid-column-start:15}.panel-grid .g-start-lg-16{grid-column-start:16}.panel-grid .g-start-lg-17{grid-column-start:17}.panel-grid .g-start-lg-18{grid-column-start:18}.panel-grid .g-start-lg-19{grid-column-start:19}.panel-grid .g-start-lg-20{grid-column-start:20}.panel-grid .g-start-lg-21{grid-column-start:21}.panel-grid .g-start-lg-22{grid-column-start:22}.panel-grid .g-start-lg-23{grid-column-start:23}}@media(min-width: 1200px){.panel-grid .g-col-xl-1{grid-column:auto/span 1}.panel-grid .g-col-xl-2{grid-column:auto/span 2}.panel-grid .g-col-xl-3{grid-column:auto/span 3}.panel-grid .g-col-xl-4{grid-column:auto/span 4}.panel-grid .g-col-xl-5{grid-column:auto/span 5}.panel-grid .g-col-xl-6{grid-column:auto/span 6}.panel-grid .g-col-xl-7{grid-column:auto/span 7}.panel-grid .g-col-xl-8{grid-column:auto/span 8}.panel-grid .g-col-xl-9{grid-column:auto/span 9}.panel-grid .g-col-xl-10{grid-column:auto/span 10}.panel-grid .g-col-xl-11{grid-column:auto/span 11}.panel-grid .g-col-xl-12{grid-column:auto/span 12}.panel-grid .g-col-xl-13{grid-column:auto/span 13}.panel-grid .g-col-xl-14{grid-column:auto/span 14}.panel-grid .g-col-xl-15{grid-column:auto/span 15}.panel-grid .g-col-xl-16{grid-column:auto/span 16}.panel-grid .g-col-xl-17{grid-column:auto/span 17}.panel-grid .g-col-xl-18{grid-column:auto/span 18}.panel-grid .g-col-xl-19{grid-column:auto/span 19}.panel-grid .g-col-xl-20{grid-column:auto/span 20}.panel-grid .g-col-xl-21{grid-column:auto/span 21}.panel-grid .g-col-xl-22{grid-column:auto/span 22}.panel-grid .g-col-xl-23{grid-column:auto/span 23}.panel-grid .g-col-xl-24{grid-column:auto/span 24}.panel-grid .g-start-xl-1{grid-column-start:1}.panel-grid .g-start-xl-2{grid-column-start:2}.panel-grid .g-start-xl-3{grid-column-start:3}.panel-grid .g-start-xl-4{grid-column-start:4}.panel-grid .g-start-xl-5{grid-column-start:5}.panel-grid .g-start-xl-6{grid-column-start:6}.panel-grid .g-start-xl-7{grid-column-start:7}.panel-grid .g-start-xl-8{grid-column-start:8}.panel-grid .g-start-xl-9{grid-column-start:9}.panel-grid .g-start-xl-10{grid-column-start:10}.panel-grid .g-start-xl-11{grid-column-start:11}.panel-grid .g-start-xl-12{grid-column-start:12}.panel-grid .g-start-xl-13{grid-column-start:13}.panel-grid .g-start-xl-14{grid-column-start:14}.panel-grid .g-start-xl-15{grid-column-start:15}.panel-grid .g-start-xl-16{grid-column-start:16}.panel-grid .g-start-xl-17{grid-column-start:17}.panel-grid .g-start-xl-18{grid-column-start:18}.panel-grid .g-start-xl-19{grid-column-start:19}.panel-grid .g-start-xl-20{grid-column-start:20}.panel-grid .g-start-xl-21{grid-column-start:21}.panel-grid .g-start-xl-22{grid-column-start:22}.panel-grid .g-start-xl-23{grid-column-start:23}}@media(min-width: 1400px){.panel-grid .g-col-xxl-1{grid-column:auto/span 1}.panel-grid .g-col-xxl-2{grid-column:auto/span 2}.panel-grid .g-col-xxl-3{grid-column:auto/span 3}.panel-grid .g-col-xxl-4{grid-column:auto/span 4}.panel-grid .g-col-xxl-5{grid-column:auto/span 5}.panel-grid .g-col-xxl-6{grid-column:auto/span 6}.panel-grid .g-col-xxl-7{grid-column:auto/span 7}.panel-grid .g-col-xxl-8{grid-column:auto/span 8}.panel-grid .g-col-xxl-9{grid-column:auto/span 9}.panel-grid .g-col-xxl-10{grid-column:auto/span 10}.panel-grid .g-col-xxl-11{grid-column:auto/span 11}.panel-grid .g-col-xxl-12{grid-column:auto/span 12}.panel-grid .g-col-xxl-13{grid-column:auto/span 13}.panel-grid .g-col-xxl-14{grid-column:auto/span 14}.panel-grid .g-col-xxl-15{grid-column:auto/span 15}.panel-grid .g-col-xxl-16{grid-column:auto/span 16}.panel-grid .g-col-xxl-17{grid-column:auto/span 17}.panel-grid .g-col-xxl-18{grid-column:auto/span 18}.panel-grid .g-col-xxl-19{grid-column:auto/span 19}.panel-grid .g-col-xxl-20{grid-column:auto/span 20}.panel-grid .g-col-xxl-21{grid-column:auto/span 21}.panel-grid .g-col-xxl-22{grid-column:auto/span 22}.panel-grid .g-col-xxl-23{grid-column:auto/span 23}.panel-grid .g-col-xxl-24{grid-column:auto/span 24}.panel-grid .g-start-xxl-1{grid-column-start:1}.panel-grid .g-start-xxl-2{grid-column-start:2}.panel-grid .g-start-xxl-3{grid-column-start:3}.panel-grid .g-start-xxl-4{grid-column-start:4}.panel-grid .g-start-xxl-5{grid-column-start:5}.panel-grid .g-start-xxl-6{grid-column-start:6}.panel-grid .g-start-xxl-7{grid-column-start:7}.panel-grid .g-start-xxl-8{grid-column-start:8}.panel-grid .g-start-xxl-9{grid-column-start:9}.panel-grid .g-start-xxl-10{grid-column-start:10}.panel-grid .g-start-xxl-11{grid-column-start:11}.panel-grid .g-start-xxl-12{grid-column-start:12}.panel-grid .g-start-xxl-13{grid-column-start:13}.panel-grid .g-start-xxl-14{grid-column-start:14}.panel-grid .g-start-xxl-15{grid-column-start:15}.panel-grid .g-start-xxl-16{grid-column-start:16}.panel-grid .g-start-xxl-17{grid-column-start:17}.panel-grid .g-start-xxl-18{grid-column-start:18}.panel-grid .g-start-xxl-19{grid-column-start:19}.panel-grid .g-start-xxl-20{grid-column-start:20}.panel-grid .g-start-xxl-21{grid-column-start:21}.panel-grid .g-start-xxl-22{grid-column-start:22}.panel-grid .g-start-xxl-23{grid-column-start:23}}main{margin-top:1em;margin-bottom:1em}h1,.h1,h2,.h2{color:inherit;margin-top:2rem;margin-bottom:1rem;font-weight:600}h1.title,.title.h1{margin-top:0}main.content>section:first-of-type>h2:first-child,main.content>section:first-of-type>.h2:first-child{margin-top:0}h2,.h2{border-bottom:1px solid #dee2e6;padding-bottom:.5rem}h3,.h3{font-weight:600}h3,.h3,h4,.h4{opacity:.9;margin-top:1.5rem}h5,.h5,h6,.h6{opacity:.9}.header-section-number{color:#5a6570}.nav-link.active .header-section-number{color:inherit}mark,.mark{padding:0em}.panel-caption,.figure-caption,.subfigure-caption,.table-caption,figcaption,caption{font-size:.9rem;color:#5a6570}.quarto-layout-cell[data-ref-parent] caption{color:#5a6570}.column-margin figcaption,.margin-caption,div.aside,aside,.column-margin{color:#5a6570;font-size:.825rem}.panel-caption.margin-caption{text-align:inherit}.column-margin.column-container p{margin-bottom:0}.column-margin.column-container>*:not(.collapse):first-child{padding-bottom:.5em;display:block}.column-margin.column-container>*:not(.collapse):not(:first-child){padding-top:.5em;padding-bottom:.5em;display:block}.column-margin.column-container>*.collapse:not(.show){display:none}@media(min-width: 768px){.column-margin.column-container .callout-margin-content:first-child{margin-top:4.5em}.column-margin.column-container .callout-margin-content-simple:first-child{margin-top:3.5em}}.margin-caption>*{padding-top:.5em;padding-bottom:.5em}@media(max-width: 767.98px){.quarto-layout-row{flex-direction:column}}.nav-tabs .nav-item{margin-top:1px;cursor:pointer}.tab-content{margin-top:0px;border-left:#dee2e6 1px solid;border-right:#dee2e6 1px solid;border-bottom:#dee2e6 1px solid;margin-left:0;padding:1em;margin-bottom:1em}@media(max-width: 767.98px){.layout-sidebar{margin-left:0;margin-right:0}}.panel-sidebar,.panel-sidebar .form-control,.panel-input,.panel-input .form-control,.selectize-dropdown{font-size:.9rem}.panel-sidebar .form-control,.panel-input .form-control{padding-top:.1rem}.tab-pane div.sourceCode{margin-top:0px}.tab-pane>p{padding-top:0}.tab-pane>p:nth-child(1){padding-top:0}.tab-pane>p:last-child{margin-bottom:0}.tab-pane>pre:last-child{margin-bottom:0}.tab-content>.tab-pane:not(.active){display:none !important}div.sourceCode{background-color:rgba(233,236,239,.65);border:1px solid rgba(233,236,239,.65);border-radius:.375rem}pre.sourceCode{background-color:rgba(0,0,0,0)}pre.sourceCode{border:none;font-size:.875em;overflow:visible !important;padding:.4em}.callout pre.sourceCode{padding-left:0}div.sourceCode{overflow-y:hidden}.callout div.sourceCode{margin-left:initial}.blockquote{font-size:inherit;padding-left:1rem;padding-right:1.5rem;color:#5a6570}.blockquote h1:first-child,.blockquote .h1:first-child,.blockquote h2:first-child,.blockquote .h2:first-child,.blockquote h3:first-child,.blockquote .h3:first-child,.blockquote h4:first-child,.blockquote .h4:first-child,.blockquote h5:first-child,.blockquote .h5:first-child{margin-top:0}pre{background-color:initial;padding:initial;border:initial}p pre code:not(.sourceCode),li pre code:not(.sourceCode),pre code:not(.sourceCode){background-color:initial}p code:not(.sourceCode),li code:not(.sourceCode),td code:not(.sourceCode){background-color:#f8f9fa;padding:.2em}nav p code:not(.sourceCode),nav li code:not(.sourceCode),nav td code:not(.sourceCode){background-color:rgba(0,0,0,0);padding:0}td code:not(.sourceCode){white-space:pre-wrap}#quarto-embedded-source-code-modal>.modal-dialog{max-width:1000px;padding-left:1.75rem;padding-right:1.75rem}#quarto-embedded-source-code-modal>.modal-dialog>.modal-content>.modal-body{padding:0}#quarto-embedded-source-code-modal>.modal-dialog>.modal-content>.modal-body div.sourceCode{margin:0;padding:.2rem .2rem;border-radius:0px;border:none}#quarto-embedded-source-code-modal>.modal-dialog>.modal-content>.modal-header{padding:.7rem}.code-tools-button{font-size:1rem;padding:.15rem .15rem;margin-left:5px;color:rgba(33,37,41,.75);background-color:rgba(0,0,0,0);transition:initial;cursor:pointer}.code-tools-button>.bi::before{display:inline-block;height:1rem;width:1rem;content:"";vertical-align:-0.125em;background-image:url('data:image/svg+xml,');background-repeat:no-repeat;background-size:1rem 1rem}.code-tools-button:hover>.bi::before{background-image:url('data:image/svg+xml,')}#quarto-embedded-source-code-modal .code-copy-button>.bi::before{background-image:url('data:image/svg+xml,')}#quarto-embedded-source-code-modal .code-copy-button-checked>.bi::before{background-image:url('data:image/svg+xml,')}.sidebar{will-change:top;transition:top 200ms linear;position:sticky;overflow-y:auto;padding-top:1.2em;max-height:100vh}.sidebar.toc-left,.sidebar.margin-sidebar{top:0px;padding-top:1em}.sidebar.quarto-banner-title-block-sidebar>*{padding-top:1.65em}figure .quarto-notebook-link{margin-top:.5em}.quarto-notebook-link{font-size:.75em;color:rgba(33,37,41,.75);margin-bottom:1em;text-decoration:none;display:block}.quarto-notebook-link:hover{text-decoration:underline;color:#0d6efd}.quarto-notebook-link::before{display:inline-block;height:.75rem;width:.75rem;margin-bottom:0em;margin-right:.25em;content:"";vertical-align:-0.125em;background-image:url('data:image/svg+xml,');background-repeat:no-repeat;background-size:.75rem .75rem}.toc-actions i.bi,.quarto-code-links i.bi,.quarto-other-links i.bi,.quarto-alternate-notebooks i.bi,.quarto-alternate-formats i.bi{margin-right:.4em;font-size:.8rem}.quarto-other-links-text-target .quarto-code-links i.bi,.quarto-other-links-text-target .quarto-other-links i.bi{margin-right:.2em}.quarto-other-formats-text-target .quarto-alternate-formats i.bi{margin-right:.1em}.toc-actions i.bi.empty,.quarto-code-links i.bi.empty,.quarto-other-links i.bi.empty,.quarto-alternate-notebooks i.bi.empty,.quarto-alternate-formats i.bi.empty{padding-left:1em}.quarto-notebook h2,.quarto-notebook .h2{border-bottom:none}.quarto-notebook .cell-container{display:flex}.quarto-notebook .cell-container .cell{flex-grow:4}.quarto-notebook .cell-container .cell-decorator{padding-top:1.5em;padding-right:1em;text-align:right}.quarto-notebook .cell-container.code-fold .cell-decorator{padding-top:3em}.quarto-notebook .cell-code code{white-space:pre-wrap}.quarto-notebook .cell .cell-output-stderr pre code,.quarto-notebook .cell .cell-output-stdout pre code{white-space:pre-wrap;overflow-wrap:anywhere}.toc-actions,.quarto-alternate-formats,.quarto-other-links,.quarto-code-links,.quarto-alternate-notebooks{padding-left:0em}.sidebar .toc-actions a,.sidebar .quarto-alternate-formats a,.sidebar .quarto-other-links a,.sidebar .quarto-code-links a,.sidebar .quarto-alternate-notebooks a,.sidebar nav[role=doc-toc] a{text-decoration:none}.sidebar .toc-actions a:hover,.sidebar .quarto-other-links a:hover,.sidebar .quarto-code-links a:hover,.sidebar .quarto-alternate-formats a:hover,.sidebar .quarto-alternate-notebooks a:hover{color:#0d6efd}.sidebar .toc-actions h2,.sidebar .toc-actions .h2,.sidebar .quarto-code-links h2,.sidebar .quarto-code-links .h2,.sidebar .quarto-other-links h2,.sidebar .quarto-other-links .h2,.sidebar .quarto-alternate-notebooks h2,.sidebar .quarto-alternate-notebooks .h2,.sidebar .quarto-alternate-formats h2,.sidebar .quarto-alternate-formats .h2,.sidebar nav[role=doc-toc]>h2,.sidebar nav[role=doc-toc]>.h2{font-weight:500;margin-bottom:.2rem;margin-top:.3rem;font-family:inherit;border-bottom:0;padding-bottom:0;padding-top:0px}.sidebar .toc-actions>h2,.sidebar .toc-actions>.h2,.sidebar .quarto-code-links>h2,.sidebar .quarto-code-links>.h2,.sidebar .quarto-other-links>h2,.sidebar .quarto-other-links>.h2,.sidebar .quarto-alternate-notebooks>h2,.sidebar .quarto-alternate-notebooks>.h2,.sidebar .quarto-alternate-formats>h2,.sidebar .quarto-alternate-formats>.h2{font-size:.8rem}.sidebar nav[role=doc-toc]>h2,.sidebar nav[role=doc-toc]>.h2{font-size:.875rem}.sidebar nav[role=doc-toc]>ul a{border-left:1px solid #e9ecef;padding-left:.6rem}.sidebar .toc-actions h2>ul a,.sidebar .toc-actions .h2>ul a,.sidebar .quarto-code-links h2>ul a,.sidebar .quarto-code-links .h2>ul a,.sidebar .quarto-other-links h2>ul a,.sidebar .quarto-other-links .h2>ul a,.sidebar .quarto-alternate-notebooks h2>ul a,.sidebar .quarto-alternate-notebooks .h2>ul a,.sidebar .quarto-alternate-formats h2>ul a,.sidebar .quarto-alternate-formats .h2>ul a{border-left:none;padding-left:.6rem}.sidebar .toc-actions ul a:empty,.sidebar .quarto-code-links ul a:empty,.sidebar .quarto-other-links ul a:empty,.sidebar .quarto-alternate-notebooks ul a:empty,.sidebar .quarto-alternate-formats ul a:empty,.sidebar nav[role=doc-toc]>ul a:empty{display:none}.sidebar .toc-actions ul,.sidebar .quarto-code-links ul,.sidebar .quarto-other-links ul,.sidebar .quarto-alternate-notebooks ul,.sidebar .quarto-alternate-formats ul{padding-left:0;list-style:none}.sidebar nav[role=doc-toc] ul{list-style:none;padding-left:0;list-style:none}.sidebar nav[role=doc-toc]>ul{margin-left:.45em}.quarto-margin-sidebar nav[role=doc-toc]{padding-left:.5em}.sidebar .toc-actions>ul,.sidebar .quarto-code-links>ul,.sidebar .quarto-other-links>ul,.sidebar .quarto-alternate-notebooks>ul,.sidebar .quarto-alternate-formats>ul{font-size:.8rem}.sidebar nav[role=doc-toc]>ul{font-size:.875rem}.sidebar .toc-actions ul li a,.sidebar .quarto-code-links ul li a,.sidebar .quarto-other-links ul li a,.sidebar .quarto-alternate-notebooks ul li a,.sidebar .quarto-alternate-formats ul li a,.sidebar nav[role=doc-toc]>ul li a{line-height:1.1rem;padding-bottom:.2rem;padding-top:.2rem;color:inherit}.sidebar nav[role=doc-toc] ul>li>ul>li>a{padding-left:1.2em}.sidebar nav[role=doc-toc] ul>li>ul>li>ul>li>a{padding-left:2.4em}.sidebar nav[role=doc-toc] ul>li>ul>li>ul>li>ul>li>a{padding-left:3.6em}.sidebar nav[role=doc-toc] ul>li>ul>li>ul>li>ul>li>ul>li>a{padding-left:4.8em}.sidebar nav[role=doc-toc] ul>li>ul>li>ul>li>ul>li>ul>li>ul>li>a{padding-left:6em}.sidebar nav[role=doc-toc] ul>li>a.active,.sidebar nav[role=doc-toc] ul>li>ul>li>a.active{border-left:1px solid #0d6efd;color:#0d6efd !important}.sidebar nav[role=doc-toc] ul>li>a:hover,.sidebar nav[role=doc-toc] ul>li>ul>li>a:hover{color:#0d6efd !important}kbd,.kbd{color:#212529;background-color:#f8f9fa;border:1px solid;border-radius:5px;border-color:#dee2e6}.quarto-appendix-contents div.hanging-indent{margin-left:0em}.quarto-appendix-contents div.hanging-indent div.csl-entry{margin-left:1em;text-indent:-1em}.citation a,.footnote-ref{text-decoration:none}.footnotes ol{padding-left:1em}.tippy-content>*{margin-bottom:.7em}.tippy-content>*:last-child{margin-bottom:0}.callout{margin-top:1.25rem;margin-bottom:1.25rem;border-radius:.375rem;overflow-wrap:break-word}.callout .callout-title-container{overflow-wrap:anywhere}.callout.callout-style-simple{padding:.4em .7em;border-left:5px solid;border-right:1px solid #dee2e6;border-top:1px solid #dee2e6;border-bottom:1px solid #dee2e6}.callout.callout-style-default{border-left:5px solid;border-right:1px solid #dee2e6;border-top:1px solid #dee2e6;border-bottom:1px solid #dee2e6}.callout .callout-body-container{flex-grow:1}.callout.callout-style-simple .callout-body{font-size:.9rem;font-weight:400}.callout.callout-style-default .callout-body{font-size:.9rem;font-weight:400}.callout:not(.no-icon).callout-titled.callout-style-simple .callout-body{padding-left:1.6em}.callout.callout-titled>.callout-header{padding-top:.2em;margin-bottom:-0.2em}.callout.callout-style-simple>div.callout-header{border-bottom:none;font-size:.9rem;font-weight:600;opacity:75%}.callout.callout-style-default>div.callout-header{border-bottom:none;font-weight:600;opacity:85%;font-size:.9rem;padding-left:.5em;padding-right:.5em}.callout.callout-style-default .callout-body{padding-left:.5em;padding-right:.5em}.callout.callout-style-default .callout-body>:first-child{padding-top:.5rem;margin-top:0}.callout>div.callout-header[data-bs-toggle=collapse]{cursor:pointer}.callout.callout-style-default .callout-header[aria-expanded=false],.callout.callout-style-default .callout-header[aria-expanded=true]{padding-top:0px;margin-bottom:0px;align-items:center}.callout.callout-titled .callout-body>:last-child:not(.sourceCode),.callout.callout-titled .callout-body>div>:last-child:not(.sourceCode){padding-bottom:.5rem;margin-bottom:0}.callout:not(.callout-titled) .callout-body>:first-child,.callout:not(.callout-titled) .callout-body>div>:first-child{margin-top:.25rem}.callout:not(.callout-titled) .callout-body>:last-child,.callout:not(.callout-titled) .callout-body>div>:last-child{margin-bottom:.2rem}.callout.callout-style-simple .callout-icon::before,.callout.callout-style-simple .callout-toggle::before{height:1rem;width:1rem;display:inline-block;content:"";background-repeat:no-repeat;background-size:1rem 1rem}.callout.callout-style-default .callout-icon::before,.callout.callout-style-default .callout-toggle::before{height:.9rem;width:.9rem;display:inline-block;content:"";background-repeat:no-repeat;background-size:.9rem .9rem}.callout.callout-style-default .callout-toggle::before{margin-top:5px}.callout .callout-btn-toggle .callout-toggle::before{transition:transform .2s linear}.callout .callout-header[aria-expanded=false] .callout-toggle::before{transform:rotate(-90deg)}.callout .callout-header[aria-expanded=true] .callout-toggle::before{transform:none}.callout.callout-style-simple:not(.no-icon) div.callout-icon-container{padding-top:.2em;padding-right:.55em}.callout.callout-style-default:not(.no-icon) div.callout-icon-container{padding-top:.1em;padding-right:.35em}.callout.callout-style-default:not(.no-icon) div.callout-title-container{margin-top:-1px}.callout.callout-style-default.callout-caution:not(.no-icon) div.callout-icon-container{padding-top:.3em;padding-right:.35em}.callout>.callout-body>.callout-icon-container>.no-icon,.callout>.callout-header>.callout-icon-container>.no-icon{display:none}div.callout.callout{border-left-color:rgba(33,37,41,.75)}div.callout.callout-style-default>.callout-header{background-color:rgba(33,37,41,.75)}div.callout-note.callout{border-left-color:#0d6efd}div.callout-note.callout-style-default>.callout-header{background-color:#e7f1ff}div.callout-note:not(.callout-titled) .callout-icon::before{background-image:url('data:image/svg+xml,');}div.callout-note.callout-titled .callout-icon::before{background-image:url('data:image/svg+xml,');}div.callout-note .callout-toggle::before{background-image:url('data:image/svg+xml,')}div.callout-tip.callout{border-left-color:#198754}div.callout-tip.callout-style-default>.callout-header{background-color:#e8f3ee}div.callout-tip:not(.callout-titled) .callout-icon::before{background-image:url('data:image/svg+xml,');}div.callout-tip.callout-titled .callout-icon::before{background-image:url('data:image/svg+xml,');}div.callout-tip .callout-toggle::before{background-image:url('data:image/svg+xml,')}div.callout-warning.callout{border-left-color:#ffc107}div.callout-warning.callout-style-default>.callout-header{background-color:#fff9e6}div.callout-warning:not(.callout-titled) .callout-icon::before{background-image:url('data:image/svg+xml,');}div.callout-warning.callout-titled .callout-icon::before{background-image:url('data:image/svg+xml,');}div.callout-warning .callout-toggle::before{background-image:url('data:image/svg+xml,')}div.callout-caution.callout{border-left-color:#fd7e14}div.callout-caution.callout-style-default>.callout-header{background-color:#fff2e8}div.callout-caution:not(.callout-titled) .callout-icon::before{background-image:url('data:image/svg+xml,');}div.callout-caution.callout-titled .callout-icon::before{background-image:url('data:image/svg+xml,');}div.callout-caution .callout-toggle::before{background-image:url('data:image/svg+xml,')}div.callout-important.callout{border-left-color:#dc3545}div.callout-important.callout-style-default>.callout-header{background-color:#fcebec}div.callout-important:not(.callout-titled) .callout-icon::before{background-image:url('data:image/svg+xml,');}div.callout-important.callout-titled .callout-icon::before{background-image:url('data:image/svg+xml,');}div.callout-important .callout-toggle::before{background-image:url('data:image/svg+xml,')}.quarto-toggle-container{display:flex;align-items:center}.quarto-reader-toggle .bi::before,.quarto-color-scheme-toggle .bi::before{display:inline-block;height:1rem;width:1rem;content:"";background-repeat:no-repeat;background-size:1rem 1rem}.sidebar-navigation{padding-left:20px}.navbar{background-color:#517699;color:#fdfefe}.navbar .quarto-color-scheme-toggle:not(.alternate) .bi::before{background-image:url('data:image/svg+xml,')}.navbar .quarto-color-scheme-toggle.alternate .bi::before{background-image:url('data:image/svg+xml,')}.sidebar-navigation .quarto-color-scheme-toggle:not(.alternate) .bi::before{background-image:url('data:image/svg+xml,')}.sidebar-navigation .quarto-color-scheme-toggle.alternate .bi::before{background-image:url('data:image/svg+xml,')}.quarto-sidebar-toggle{border-color:#dee2e6;border-bottom-left-radius:.375rem;border-bottom-right-radius:.375rem;border-style:solid;border-width:1px;overflow:hidden;border-top-width:0px;padding-top:0px !important}.quarto-sidebar-toggle-title{cursor:pointer;padding-bottom:2px;margin-left:.25em;text-align:center;font-weight:400;font-size:.775em}#quarto-content .quarto-sidebar-toggle{background:#fafafa}#quarto-content .quarto-sidebar-toggle-title{color:#212529}.quarto-sidebar-toggle-icon{color:#dee2e6;margin-right:.5em;float:right;transition:transform .2s ease}.quarto-sidebar-toggle-icon::before{padding-top:5px}.quarto-sidebar-toggle.expanded .quarto-sidebar-toggle-icon{transform:rotate(-180deg)}.quarto-sidebar-toggle.expanded .quarto-sidebar-toggle-title{border-bottom:solid #dee2e6 1px}.quarto-sidebar-toggle-contents{background-color:#fff;padding-right:10px;padding-left:10px;margin-top:0px !important;transition:max-height .5s ease}.quarto-sidebar-toggle.expanded .quarto-sidebar-toggle-contents{padding-top:1em;padding-bottom:10px}@media(max-width: 767.98px){.sidebar-menu-container{padding-bottom:5em}}.quarto-sidebar-toggle:not(.expanded) .quarto-sidebar-toggle-contents{padding-top:0px !important;padding-bottom:0px}nav[role=doc-toc]{z-index:1020}#quarto-sidebar>*,nav[role=doc-toc]>*{transition:opacity .1s ease,border .1s ease}#quarto-sidebar.slow>*,nav[role=doc-toc].slow>*{transition:opacity .4s ease,border .4s ease}.quarto-color-scheme-toggle:not(.alternate).top-right .bi::before{background-image:url('data:image/svg+xml,')}.quarto-color-scheme-toggle.alternate.top-right .bi::before{background-image:url('data:image/svg+xml,')}#quarto-appendix.default{border-top:1px solid #dee2e6}#quarto-appendix.default{background-color:#fff;padding-top:1.5em;margin-top:2em;z-index:998}#quarto-appendix.default .quarto-appendix-heading{margin-top:0;line-height:1.4em;font-weight:600;opacity:.9;border-bottom:none;margin-bottom:0}#quarto-appendix.default .footnotes ol,#quarto-appendix.default .footnotes ol li>p:last-of-type,#quarto-appendix.default .quarto-appendix-contents>p:last-of-type{margin-bottom:0}#quarto-appendix.default .footnotes ol{margin-left:.5em}#quarto-appendix.default .quarto-appendix-secondary-label{margin-bottom:.4em}#quarto-appendix.default .quarto-appendix-bibtex{font-size:.7em;padding:1em;border:solid 1px #dee2e6;margin-bottom:1em}#quarto-appendix.default .quarto-appendix-bibtex code.sourceCode{white-space:pre-wrap}#quarto-appendix.default .quarto-appendix-citeas{font-size:.9em;padding:1em;border:solid 1px #dee2e6;margin-bottom:1em}#quarto-appendix.default .quarto-appendix-heading{font-size:1em !important}#quarto-appendix.default *[role=doc-endnotes]>ol,#quarto-appendix.default .quarto-appendix-contents>*:not(h2):not(.h2){font-size:.9em}#quarto-appendix.default section{padding-bottom:1.5em}#quarto-appendix.default section *[role=doc-endnotes],#quarto-appendix.default section>*:not(a){opacity:.9;word-wrap:break-word}.btn.btn-quarto,div.cell-output-display .btn-quarto{--bs-btn-color: #fefefe;--bs-btn-bg: #6c757d;--bs-btn-border-color: #6c757d;--bs-btn-hover-color: #fefefe;--bs-btn-hover-bg: #828a91;--bs-btn-hover-border-color: #7b838a;--bs-btn-focus-shadow-rgb: 130, 138, 144;--bs-btn-active-color: #000;--bs-btn-active-bg: #899197;--bs-btn-active-border-color: #7b838a;--bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color: #ffffff;--bs-btn-disabled-bg: #6c757d;--bs-btn-disabled-border-color: #6c757d}nav.quarto-secondary-nav.color-navbar{background-color:#517699;color:#fdfefe}nav.quarto-secondary-nav.color-navbar h1,nav.quarto-secondary-nav.color-navbar .h1,nav.quarto-secondary-nav.color-navbar .quarto-btn-toggle{color:#fdfefe}@media(max-width: 991.98px){body.nav-sidebar .quarto-title-banner{margin-bottom:0;padding-bottom:1em}body.nav-sidebar #title-block-header{margin-block-end:0}}p.subtitle{margin-top:.25em;margin-bottom:.5em}code a:any-link{color:inherit;text-decoration-color:#6c757d}/*! light */div.observablehq table thead tr th{background-color:var(--bs-body-bg)}input,button,select,optgroup,textarea{background-color:var(--bs-body-bg)}.code-annotated .code-copy-button{margin-right:1.25em;margin-top:0;padding-bottom:0;padding-top:3px}.code-annotation-gutter-bg{background-color:#fff}.code-annotation-gutter{background-color:rgba(233,236,239,.65)}.code-annotation-gutter,.code-annotation-gutter-bg{height:100%;width:calc(20px + .5em);position:absolute;top:0;right:0}dl.code-annotation-container-grid dt{margin-right:1em;margin-top:.25rem}dl.code-annotation-container-grid dt{font-family:SFMono-Regular,Menlo,Monaco,Consolas,"Liberation Mono","Courier New",monospace;color:#383f45;border:solid #383f45 1px;border-radius:50%;height:22px;width:22px;line-height:22px;font-size:11px;text-align:center;vertical-align:middle;text-decoration:none}dl.code-annotation-container-grid dt[data-target-cell]{cursor:pointer}dl.code-annotation-container-grid dt[data-target-cell].code-annotation-active{color:#fff;border:solid #aaa 1px;background-color:#aaa}pre.code-annotation-code{padding-top:0;padding-bottom:0}pre.code-annotation-code code{z-index:3}#code-annotation-line-highlight-gutter{width:100%;border-top:solid rgba(170,170,170,.2666666667) 1px;border-bottom:solid rgba(170,170,170,.2666666667) 1px;z-index:2;background-color:rgba(170,170,170,.1333333333)}#code-annotation-line-highlight{margin-left:-4em;width:calc(100% + 4em);border-top:solid rgba(170,170,170,.2666666667) 1px;border-bottom:solid rgba(170,170,170,.2666666667) 1px;z-index:2;background-color:rgba(170,170,170,.1333333333)}code.sourceCode .code-annotation-anchor.code-annotation-active{background-color:var(--quarto-hl-normal-color, #aaaaaa);border:solid var(--quarto-hl-normal-color, #aaaaaa) 1px;color:#e9ecef;font-weight:bolder}code.sourceCode .code-annotation-anchor{font-family:SFMono-Regular,Menlo,Monaco,Consolas,"Liberation Mono","Courier New",monospace;color:var(--quarto-hl-co-color);border:solid var(--quarto-hl-co-color) 1px;border-radius:50%;height:18px;width:18px;font-size:9px;margin-top:2px}code.sourceCode button.code-annotation-anchor{padding:2px;user-select:none;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;-o-user-select:none}code.sourceCode a.code-annotation-anchor{line-height:18px;text-align:center;vertical-align:middle;cursor:default;text-decoration:none}@media print{.page-columns .column-screen-inset{grid-column:page-start-inset/page-end-inset;z-index:998;opacity:.999}.page-columns .column-screen-inset table{background:#fff}.page-columns .column-screen-inset-left{grid-column:page-start-inset/body-content-end;z-index:998;opacity:.999}.page-columns .column-screen-inset-left table{background:#fff}.page-columns .column-screen-inset-right{grid-column:body-content-start/page-end-inset;z-index:998;opacity:.999}.page-columns .column-screen-inset-right table{background:#fff}.page-columns .column-screen{grid-column:page-start/page-end;z-index:998;opacity:.999}.page-columns .column-screen table{background:#fff}.page-columns .column-screen-left{grid-column:page-start/body-content-end;z-index:998;opacity:.999}.page-columns .column-screen-left table{background:#fff}.page-columns .column-screen-right{grid-column:body-content-start/page-end;z-index:998;opacity:.999}.page-columns .column-screen-right table{background:#fff}.page-columns .column-screen-inset-shaded{grid-column:page-start-inset/page-end-inset;padding:1em;background:#f8f9fa;z-index:998;opacity:.999;margin-bottom:1em}}.quarto-video{margin-bottom:1em}.table{border-top:1px solid #d3d8dc;border-bottom:1px solid #d3d8dc}.table>thead{border-top-width:0;border-bottom:1px solid #9ba5ae}.table a{word-break:break-word}.table>:not(caption)>*>*{background-color:unset;color:unset}#quarto-document-content .crosstalk-input .checkbox input[type=checkbox],#quarto-document-content .crosstalk-input .checkbox-inline input[type=checkbox]{position:unset;margin-top:unset;margin-left:unset}#quarto-document-content .row{margin-left:unset;margin-right:unset}.quarto-xref{white-space:nowrap}a.external:after{content:"";background-image:url('data:image/svg+xml,');background-size:contain;background-repeat:no-repeat;background-position:center center;margin-left:.2em;padding-right:.75em}div.sourceCode code a.external:after{content:none}a.external:after:hover{cursor:pointer}.quarto-ext-icon{display:inline-block;font-size:.75em;padding-left:.3em}.code-with-filename .code-with-filename-file{margin-bottom:0;padding-bottom:2px;padding-top:2px;padding-left:.7em;border:var(--quarto-border-width) solid var(--quarto-border-color);border-radius:var(--quarto-border-radius);border-bottom:0;border-bottom-left-radius:0%;border-bottom-right-radius:0%}.code-with-filename div.sourceCode,.reveal .code-with-filename div.sourceCode{margin-top:0;border-top-left-radius:0%;border-top-right-radius:0%}.code-with-filename .code-with-filename-file pre{margin-bottom:0}.code-with-filename .code-with-filename-file{background-color:rgba(219,219,219,.8)}.quarto-dark .code-with-filename .code-with-filename-file{background-color:#555}.code-with-filename .code-with-filename-file strong{font-weight:400}.quarto-title-banner{margin-bottom:1em;color:#fdfefe;background:#517699}.quarto-title-banner a{color:#fdfefe}.quarto-title-banner h1,.quarto-title-banner .h1,.quarto-title-banner h2,.quarto-title-banner .h2{color:#fdfefe}.quarto-title-banner .code-tools-button{color:#b9dcdc}.quarto-title-banner .code-tools-button:hover{color:#fdfefe}.quarto-title-banner .code-tools-button>.bi::before{background-image:url('data:image/svg+xml,')}.quarto-title-banner .code-tools-button:hover>.bi::before{background-image:url('data:image/svg+xml,')}.quarto-title-banner .quarto-title .title{font-weight:600}.quarto-title-banner .quarto-categories{margin-top:.75em}@media(min-width: 992px){.quarto-title-banner{padding-top:2.5em;padding-bottom:2.5em}}@media(max-width: 991.98px){.quarto-title-banner{padding-top:1em;padding-bottom:1em}}@media(max-width: 767.98px){body.hypothesis-enabled #title-block-header>*{padding-right:20px}}main.quarto-banner-title-block>section:first-child>h2,main.quarto-banner-title-block>section:first-child>.h2,main.quarto-banner-title-block>section:first-child>h3,main.quarto-banner-title-block>section:first-child>.h3,main.quarto-banner-title-block>section:first-child>h4,main.quarto-banner-title-block>section:first-child>.h4{margin-top:0}.quarto-title .quarto-categories{display:flex;flex-wrap:wrap;row-gap:.5em;column-gap:.4em;padding-bottom:.5em;margin-top:.75em}.quarto-title .quarto-categories .quarto-category{padding:.25em .75em;font-size:.65em;text-transform:uppercase;border:solid 1px;border-radius:.375rem;opacity:.6}.quarto-title .quarto-categories .quarto-category a{color:inherit}.quarto-title-meta-container{display:grid;grid-template-columns:1fr auto}.quarto-title-meta-column-end{display:flex;flex-direction:column;padding-left:1em}.quarto-title-meta-column-end a .bi{margin-right:.3em}#title-block-header.quarto-title-block.default .quarto-title-meta{display:grid;grid-template-columns:minmax(max-content, 1fr) 1fr;grid-column-gap:1em}#title-block-header.quarto-title-block.default .quarto-title .title{margin-bottom:0}#title-block-header.quarto-title-block.default .quarto-title-author-orcid img{margin-top:-0.2em;height:.8em;width:.8em}#title-block-header.quarto-title-block.default .quarto-title-author-email{opacity:.7}#title-block-header.quarto-title-block.default .quarto-description p:last-of-type{margin-bottom:0}#title-block-header.quarto-title-block.default .quarto-title-meta-contents p,#title-block-header.quarto-title-block.default .quarto-title-authors p,#title-block-header.quarto-title-block.default .quarto-title-affiliations p{margin-bottom:.1em}#title-block-header.quarto-title-block.default .quarto-title-meta-heading{text-transform:uppercase;margin-top:1em;font-size:.8em;opacity:.8;font-weight:400}#title-block-header.quarto-title-block.default .quarto-title-meta-contents{font-size:.9em}#title-block-header.quarto-title-block.default .quarto-title-meta-contents p.affiliation:last-of-type{margin-bottom:.1em}#title-block-header.quarto-title-block.default p.affiliation{margin-bottom:.1em}#title-block-header.quarto-title-block.default .keywords,#title-block-header.quarto-title-block.default .description,#title-block-header.quarto-title-block.default .abstract{margin-top:0}#title-block-header.quarto-title-block.default .keywords>p,#title-block-header.quarto-title-block.default .description>p,#title-block-header.quarto-title-block.default .abstract>p{font-size:.9em}#title-block-header.quarto-title-block.default .keywords>p:last-of-type,#title-block-header.quarto-title-block.default .description>p:last-of-type,#title-block-header.quarto-title-block.default .abstract>p:last-of-type{margin-bottom:0}#title-block-header.quarto-title-block.default .keywords .block-title,#title-block-header.quarto-title-block.default .description .block-title,#title-block-header.quarto-title-block.default .abstract .block-title{margin-top:1em;text-transform:uppercase;font-size:.8em;opacity:.8;font-weight:400}#title-block-header.quarto-title-block.default .quarto-title-meta-author{display:grid;grid-template-columns:minmax(max-content, 1fr) 1fr;grid-column-gap:1em}.quarto-title-tools-only{display:flex;justify-content:right} diff --git a/docs/otb_subbasin_loads_files/libs/bootstrap/bootstrap.min.js b/docs/otb_subbasin_loads_files/libs/bootstrap/bootstrap.min.js new file mode 100644 index 0000000..e8f21f7 --- /dev/null +++ b/docs/otb_subbasin_loads_files/libs/bootstrap/bootstrap.min.js @@ -0,0 +1,7 @@ +/*! + * Bootstrap v5.3.1 (https://getbootstrap.com/) + * Copyright 2011-2023 The Bootstrap Authors (https://github.com/twbs/bootstrap/graphs/contributors) + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE) + */ +!function(t,e){"object"==typeof exports&&"undefined"!=typeof module?module.exports=e():"function"==typeof define&&define.amd?define(e):(t="undefined"!=typeof globalThis?globalThis:t||self).bootstrap=e()}(this,(function(){"use strict";const t=new Map,e={set(e,i,n){t.has(e)||t.set(e,new Map);const s=t.get(e);s.has(i)||0===s.size?s.set(i,n):console.error(`Bootstrap doesn't allow more than one instance per element. Bound instance: ${Array.from(s.keys())[0]}.`)},get:(e,i)=>t.has(e)&&t.get(e).get(i)||null,remove(e,i){if(!t.has(e))return;const n=t.get(e);n.delete(i),0===n.size&&t.delete(e)}},i="transitionend",n=t=>(t&&window.CSS&&window.CSS.escape&&(t=t.replace(/#([^\s"#']+)/g,((t,e)=>`#${CSS.escape(e)}`))),t),s=t=>{t.dispatchEvent(new Event(i))},o=t=>!(!t||"object"!=typeof t)&&(void 0!==t.jquery&&(t=t[0]),void 0!==t.nodeType),r=t=>o(t)?t.jquery?t[0]:t:"string"==typeof t&&t.length>0?document.querySelector(n(t)):null,a=t=>{if(!o(t)||0===t.getClientRects().length)return!1;const e="visible"===getComputedStyle(t).getPropertyValue("visibility"),i=t.closest("details:not([open])");if(!i)return e;if(i!==t){const e=t.closest("summary");if(e&&e.parentNode!==i)return!1;if(null===e)return!1}return e},l=t=>!t||t.nodeType!==Node.ELEMENT_NODE||!!t.classList.contains("disabled")||(void 0!==t.disabled?t.disabled:t.hasAttribute("disabled")&&"false"!==t.getAttribute("disabled")),c=t=>{if(!document.documentElement.attachShadow)return null;if("function"==typeof t.getRootNode){const e=t.getRootNode();return e instanceof ShadowRoot?e:null}return t instanceof ShadowRoot?t:t.parentNode?c(t.parentNode):null},h=()=>{},d=t=>{t.offsetHeight},u=()=>window.jQuery&&!document.body.hasAttribute("data-bs-no-jquery")?window.jQuery:null,f=[],p=()=>"rtl"===document.documentElement.dir,m=t=>{var e;e=()=>{const e=u();if(e){const i=t.NAME,n=e.fn[i];e.fn[i]=t.jQueryInterface,e.fn[i].Constructor=t,e.fn[i].noConflict=()=>(e.fn[i]=n,t.jQueryInterface)}},"loading"===document.readyState?(f.length||document.addEventListener("DOMContentLoaded",(()=>{for(const t of f)t()})),f.push(e)):e()},g=(t,e=[],i=t)=>"function"==typeof t?t(...e):i,_=(t,e,n=!0)=>{if(!n)return void g(t);const o=(t=>{if(!t)return 0;let{transitionDuration:e,transitionDelay:i}=window.getComputedStyle(t);const n=Number.parseFloat(e),s=Number.parseFloat(i);return n||s?(e=e.split(",")[0],i=i.split(",")[0],1e3*(Number.parseFloat(e)+Number.parseFloat(i))):0})(e)+5;let r=!1;const a=({target:n})=>{n===e&&(r=!0,e.removeEventListener(i,a),g(t))};e.addEventListener(i,a),setTimeout((()=>{r||s(e)}),o)},b=(t,e,i,n)=>{const s=t.length;let o=t.indexOf(e);return-1===o?!i&&n?t[s-1]:t[0]:(o+=i?1:-1,n&&(o=(o+s)%s),t[Math.max(0,Math.min(o,s-1))])},v=/[^.]*(?=\..*)\.|.*/,y=/\..*/,w=/::\d+$/,A={};let E=1;const T={mouseenter:"mouseover",mouseleave:"mouseout"},C=new Set(["click","dblclick","mouseup","mousedown","contextmenu","mousewheel","DOMMouseScroll","mouseover","mouseout","mousemove","selectstart","selectend","keydown","keypress","keyup","orientationchange","touchstart","touchmove","touchend","touchcancel","pointerdown","pointermove","pointerup","pointerleave","pointercancel","gesturestart","gesturechange","gestureend","focus","blur","change","reset","select","submit","focusin","focusout","load","unload","beforeunload","resize","move","DOMContentLoaded","readystatechange","error","abort","scroll"]);function O(t,e){return e&&`${e}::${E++}`||t.uidEvent||E++}function x(t){const e=O(t);return t.uidEvent=e,A[e]=A[e]||{},A[e]}function k(t,e,i=null){return Object.values(t).find((t=>t.callable===e&&t.delegationSelector===i))}function L(t,e,i){const n="string"==typeof e,s=n?i:e||i;let o=I(t);return C.has(o)||(o=t),[n,s,o]}function S(t,e,i,n,s){if("string"!=typeof e||!t)return;let[o,r,a]=L(e,i,n);if(e in T){const t=t=>function(e){if(!e.relatedTarget||e.relatedTarget!==e.delegateTarget&&!e.delegateTarget.contains(e.relatedTarget))return t.call(this,e)};r=t(r)}const l=x(t),c=l[a]||(l[a]={}),h=k(c,r,o?i:null);if(h)return void(h.oneOff=h.oneOff&&s);const d=O(r,e.replace(v,"")),u=o?function(t,e,i){return function n(s){const o=t.querySelectorAll(e);for(let{target:r}=s;r&&r!==this;r=r.parentNode)for(const a of o)if(a===r)return P(s,{delegateTarget:r}),n.oneOff&&N.off(t,s.type,e,i),i.apply(r,[s])}}(t,i,r):function(t,e){return function i(n){return P(n,{delegateTarget:t}),i.oneOff&&N.off(t,n.type,e),e.apply(t,[n])}}(t,r);u.delegationSelector=o?i:null,u.callable=r,u.oneOff=s,u.uidEvent=d,c[d]=u,t.addEventListener(a,u,o)}function D(t,e,i,n,s){const o=k(e[i],n,s);o&&(t.removeEventListener(i,o,Boolean(s)),delete e[i][o.uidEvent])}function $(t,e,i,n){const s=e[i]||{};for(const[o,r]of Object.entries(s))o.includes(n)&&D(t,e,i,r.callable,r.delegationSelector)}function I(t){return t=t.replace(y,""),T[t]||t}const N={on(t,e,i,n){S(t,e,i,n,!1)},one(t,e,i,n){S(t,e,i,n,!0)},off(t,e,i,n){if("string"!=typeof e||!t)return;const[s,o,r]=L(e,i,n),a=r!==e,l=x(t),c=l[r]||{},h=e.startsWith(".");if(void 0===o){if(h)for(const i of Object.keys(l))$(t,l,i,e.slice(1));for(const[i,n]of Object.entries(c)){const s=i.replace(w,"");a&&!e.includes(s)||D(t,l,r,n.callable,n.delegationSelector)}}else{if(!Object.keys(c).length)return;D(t,l,r,o,s?i:null)}},trigger(t,e,i){if("string"!=typeof e||!t)return null;const n=u();let s=null,o=!0,r=!0,a=!1;e!==I(e)&&n&&(s=n.Event(e,i),n(t).trigger(s),o=!s.isPropagationStopped(),r=!s.isImmediatePropagationStopped(),a=s.isDefaultPrevented());const l=P(new Event(e,{bubbles:o,cancelable:!0}),i);return a&&l.preventDefault(),r&&t.dispatchEvent(l),l.defaultPrevented&&s&&s.preventDefault(),l}};function P(t,e={}){for(const[i,n]of Object.entries(e))try{t[i]=n}catch(e){Object.defineProperty(t,i,{configurable:!0,get:()=>n})}return t}function M(t){if("true"===t)return!0;if("false"===t)return!1;if(t===Number(t).toString())return Number(t);if(""===t||"null"===t)return null;if("string"!=typeof t)return t;try{return JSON.parse(decodeURIComponent(t))}catch(e){return t}}function j(t){return t.replace(/[A-Z]/g,(t=>`-${t.toLowerCase()}`))}const F={setDataAttribute(t,e,i){t.setAttribute(`data-bs-${j(e)}`,i)},removeDataAttribute(t,e){t.removeAttribute(`data-bs-${j(e)}`)},getDataAttributes(t){if(!t)return{};const e={},i=Object.keys(t.dataset).filter((t=>t.startsWith("bs")&&!t.startsWith("bsConfig")));for(const n of i){let i=n.replace(/^bs/,"");i=i.charAt(0).toLowerCase()+i.slice(1,i.length),e[i]=M(t.dataset[n])}return e},getDataAttribute:(t,e)=>M(t.getAttribute(`data-bs-${j(e)}`))};class H{static get Default(){return{}}static get DefaultType(){return{}}static get NAME(){throw new Error('You have to implement the static method "NAME", for each component!')}_getConfig(t){return t=this._mergeConfigObj(t),t=this._configAfterMerge(t),this._typeCheckConfig(t),t}_configAfterMerge(t){return t}_mergeConfigObj(t,e){const i=o(e)?F.getDataAttribute(e,"config"):{};return{...this.constructor.Default,..."object"==typeof i?i:{},...o(e)?F.getDataAttributes(e):{},..."object"==typeof t?t:{}}}_typeCheckConfig(t,e=this.constructor.DefaultType){for(const[n,s]of Object.entries(e)){const e=t[n],r=o(e)?"element":null==(i=e)?`${i}`:Object.prototype.toString.call(i).match(/\s([a-z]+)/i)[1].toLowerCase();if(!new RegExp(s).test(r))throw new TypeError(`${this.constructor.NAME.toUpperCase()}: Option "${n}" provided type "${r}" but expected type "${s}".`)}var i}}class W extends H{constructor(t,i){super(),(t=r(t))&&(this._element=t,this._config=this._getConfig(i),e.set(this._element,this.constructor.DATA_KEY,this))}dispose(){e.remove(this._element,this.constructor.DATA_KEY),N.off(this._element,this.constructor.EVENT_KEY);for(const t of Object.getOwnPropertyNames(this))this[t]=null}_queueCallback(t,e,i=!0){_(t,e,i)}_getConfig(t){return t=this._mergeConfigObj(t,this._element),t=this._configAfterMerge(t),this._typeCheckConfig(t),t}static getInstance(t){return e.get(r(t),this.DATA_KEY)}static getOrCreateInstance(t,e={}){return this.getInstance(t)||new this(t,"object"==typeof e?e:null)}static get VERSION(){return"5.3.1"}static get DATA_KEY(){return`bs.${this.NAME}`}static get EVENT_KEY(){return`.${this.DATA_KEY}`}static eventName(t){return`${t}${this.EVENT_KEY}`}}const B=t=>{let e=t.getAttribute("data-bs-target");if(!e||"#"===e){let i=t.getAttribute("href");if(!i||!i.includes("#")&&!i.startsWith("."))return null;i.includes("#")&&!i.startsWith("#")&&(i=`#${i.split("#")[1]}`),e=i&&"#"!==i?i.trim():null}return n(e)},z={find:(t,e=document.documentElement)=>[].concat(...Element.prototype.querySelectorAll.call(e,t)),findOne:(t,e=document.documentElement)=>Element.prototype.querySelector.call(e,t),children:(t,e)=>[].concat(...t.children).filter((t=>t.matches(e))),parents(t,e){const i=[];let n=t.parentNode.closest(e);for(;n;)i.push(n),n=n.parentNode.closest(e);return i},prev(t,e){let i=t.previousElementSibling;for(;i;){if(i.matches(e))return[i];i=i.previousElementSibling}return[]},next(t,e){let i=t.nextElementSibling;for(;i;){if(i.matches(e))return[i];i=i.nextElementSibling}return[]},focusableChildren(t){const e=["a","button","input","textarea","select","details","[tabindex]",'[contenteditable="true"]'].map((t=>`${t}:not([tabindex^="-"])`)).join(",");return this.find(e,t).filter((t=>!l(t)&&a(t)))},getSelectorFromElement(t){const e=B(t);return e&&z.findOne(e)?e:null},getElementFromSelector(t){const e=B(t);return e?z.findOne(e):null},getMultipleElementsFromSelector(t){const e=B(t);return e?z.find(e):[]}},R=(t,e="hide")=>{const i=`click.dismiss${t.EVENT_KEY}`,n=t.NAME;N.on(document,i,`[data-bs-dismiss="${n}"]`,(function(i){if(["A","AREA"].includes(this.tagName)&&i.preventDefault(),l(this))return;const s=z.getElementFromSelector(this)||this.closest(`.${n}`);t.getOrCreateInstance(s)[e]()}))},q=".bs.alert",V=`close${q}`,K=`closed${q}`;class Q extends W{static get NAME(){return"alert"}close(){if(N.trigger(this._element,V).defaultPrevented)return;this._element.classList.remove("show");const t=this._element.classList.contains("fade");this._queueCallback((()=>this._destroyElement()),this._element,t)}_destroyElement(){this._element.remove(),N.trigger(this._element,K),this.dispose()}static jQueryInterface(t){return this.each((function(){const e=Q.getOrCreateInstance(this);if("string"==typeof t){if(void 0===e[t]||t.startsWith("_")||"constructor"===t)throw new TypeError(`No method named "${t}"`);e[t](this)}}))}}R(Q,"close"),m(Q);const X='[data-bs-toggle="button"]';class Y extends W{static get NAME(){return"button"}toggle(){this._element.setAttribute("aria-pressed",this._element.classList.toggle("active"))}static jQueryInterface(t){return this.each((function(){const e=Y.getOrCreateInstance(this);"toggle"===t&&e[t]()}))}}N.on(document,"click.bs.button.data-api",X,(t=>{t.preventDefault();const e=t.target.closest(X);Y.getOrCreateInstance(e).toggle()})),m(Y);const U=".bs.swipe",G=`touchstart${U}`,J=`touchmove${U}`,Z=`touchend${U}`,tt=`pointerdown${U}`,et=`pointerup${U}`,it={endCallback:null,leftCallback:null,rightCallback:null},nt={endCallback:"(function|null)",leftCallback:"(function|null)",rightCallback:"(function|null)"};class st extends H{constructor(t,e){super(),this._element=t,t&&st.isSupported()&&(this._config=this._getConfig(e),this._deltaX=0,this._supportPointerEvents=Boolean(window.PointerEvent),this._initEvents())}static get Default(){return it}static get DefaultType(){return nt}static get NAME(){return"swipe"}dispose(){N.off(this._element,U)}_start(t){this._supportPointerEvents?this._eventIsPointerPenTouch(t)&&(this._deltaX=t.clientX):this._deltaX=t.touches[0].clientX}_end(t){this._eventIsPointerPenTouch(t)&&(this._deltaX=t.clientX-this._deltaX),this._handleSwipe(),g(this._config.endCallback)}_move(t){this._deltaX=t.touches&&t.touches.length>1?0:t.touches[0].clientX-this._deltaX}_handleSwipe(){const t=Math.abs(this._deltaX);if(t<=40)return;const e=t/this._deltaX;this._deltaX=0,e&&g(e>0?this._config.rightCallback:this._config.leftCallback)}_initEvents(){this._supportPointerEvents?(N.on(this._element,tt,(t=>this._start(t))),N.on(this._element,et,(t=>this._end(t))),this._element.classList.add("pointer-event")):(N.on(this._element,G,(t=>this._start(t))),N.on(this._element,J,(t=>this._move(t))),N.on(this._element,Z,(t=>this._end(t))))}_eventIsPointerPenTouch(t){return this._supportPointerEvents&&("pen"===t.pointerType||"touch"===t.pointerType)}static isSupported(){return"ontouchstart"in document.documentElement||navigator.maxTouchPoints>0}}const ot=".bs.carousel",rt=".data-api",at="next",lt="prev",ct="left",ht="right",dt=`slide${ot}`,ut=`slid${ot}`,ft=`keydown${ot}`,pt=`mouseenter${ot}`,mt=`mouseleave${ot}`,gt=`dragstart${ot}`,_t=`load${ot}${rt}`,bt=`click${ot}${rt}`,vt="carousel",yt="active",wt=".active",At=".carousel-item",Et=wt+At,Tt={ArrowLeft:ht,ArrowRight:ct},Ct={interval:5e3,keyboard:!0,pause:"hover",ride:!1,touch:!0,wrap:!0},Ot={interval:"(number|boolean)",keyboard:"boolean",pause:"(string|boolean)",ride:"(boolean|string)",touch:"boolean",wrap:"boolean"};class xt extends W{constructor(t,e){super(t,e),this._interval=null,this._activeElement=null,this._isSliding=!1,this.touchTimeout=null,this._swipeHelper=null,this._indicatorsElement=z.findOne(".carousel-indicators",this._element),this._addEventListeners(),this._config.ride===vt&&this.cycle()}static get Default(){return Ct}static get DefaultType(){return Ot}static get NAME(){return"carousel"}next(){this._slide(at)}nextWhenVisible(){!document.hidden&&a(this._element)&&this.next()}prev(){this._slide(lt)}pause(){this._isSliding&&s(this._element),this._clearInterval()}cycle(){this._clearInterval(),this._updateInterval(),this._interval=setInterval((()=>this.nextWhenVisible()),this._config.interval)}_maybeEnableCycle(){this._config.ride&&(this._isSliding?N.one(this._element,ut,(()=>this.cycle())):this.cycle())}to(t){const e=this._getItems();if(t>e.length-1||t<0)return;if(this._isSliding)return void N.one(this._element,ut,(()=>this.to(t)));const i=this._getItemIndex(this._getActive());if(i===t)return;const n=t>i?at:lt;this._slide(n,e[t])}dispose(){this._swipeHelper&&this._swipeHelper.dispose(),super.dispose()}_configAfterMerge(t){return t.defaultInterval=t.interval,t}_addEventListeners(){this._config.keyboard&&N.on(this._element,ft,(t=>this._keydown(t))),"hover"===this._config.pause&&(N.on(this._element,pt,(()=>this.pause())),N.on(this._element,mt,(()=>this._maybeEnableCycle()))),this._config.touch&&st.isSupported()&&this._addTouchEventListeners()}_addTouchEventListeners(){for(const t of z.find(".carousel-item img",this._element))N.on(t,gt,(t=>t.preventDefault()));const t={leftCallback:()=>this._slide(this._directionToOrder(ct)),rightCallback:()=>this._slide(this._directionToOrder(ht)),endCallback:()=>{"hover"===this._config.pause&&(this.pause(),this.touchTimeout&&clearTimeout(this.touchTimeout),this.touchTimeout=setTimeout((()=>this._maybeEnableCycle()),500+this._config.interval))}};this._swipeHelper=new st(this._element,t)}_keydown(t){if(/input|textarea/i.test(t.target.tagName))return;const e=Tt[t.key];e&&(t.preventDefault(),this._slide(this._directionToOrder(e)))}_getItemIndex(t){return this._getItems().indexOf(t)}_setActiveIndicatorElement(t){if(!this._indicatorsElement)return;const e=z.findOne(wt,this._indicatorsElement);e.classList.remove(yt),e.removeAttribute("aria-current");const i=z.findOne(`[data-bs-slide-to="${t}"]`,this._indicatorsElement);i&&(i.classList.add(yt),i.setAttribute("aria-current","true"))}_updateInterval(){const t=this._activeElement||this._getActive();if(!t)return;const e=Number.parseInt(t.getAttribute("data-bs-interval"),10);this._config.interval=e||this._config.defaultInterval}_slide(t,e=null){if(this._isSliding)return;const i=this._getActive(),n=t===at,s=e||b(this._getItems(),i,n,this._config.wrap);if(s===i)return;const o=this._getItemIndex(s),r=e=>N.trigger(this._element,e,{relatedTarget:s,direction:this._orderToDirection(t),from:this._getItemIndex(i),to:o});if(r(dt).defaultPrevented)return;if(!i||!s)return;const a=Boolean(this._interval);this.pause(),this._isSliding=!0,this._setActiveIndicatorElement(o),this._activeElement=s;const l=n?"carousel-item-start":"carousel-item-end",c=n?"carousel-item-next":"carousel-item-prev";s.classList.add(c),d(s),i.classList.add(l),s.classList.add(l),this._queueCallback((()=>{s.classList.remove(l,c),s.classList.add(yt),i.classList.remove(yt,c,l),this._isSliding=!1,r(ut)}),i,this._isAnimated()),a&&this.cycle()}_isAnimated(){return this._element.classList.contains("slide")}_getActive(){return z.findOne(Et,this._element)}_getItems(){return z.find(At,this._element)}_clearInterval(){this._interval&&(clearInterval(this._interval),this._interval=null)}_directionToOrder(t){return p()?t===ct?lt:at:t===ct?at:lt}_orderToDirection(t){return p()?t===lt?ct:ht:t===lt?ht:ct}static jQueryInterface(t){return this.each((function(){const e=xt.getOrCreateInstance(this,t);if("number"!=typeof t){if("string"==typeof t){if(void 0===e[t]||t.startsWith("_")||"constructor"===t)throw new TypeError(`No method named "${t}"`);e[t]()}}else e.to(t)}))}}N.on(document,bt,"[data-bs-slide], [data-bs-slide-to]",(function(t){const e=z.getElementFromSelector(this);if(!e||!e.classList.contains(vt))return;t.preventDefault();const i=xt.getOrCreateInstance(e),n=this.getAttribute("data-bs-slide-to");return n?(i.to(n),void i._maybeEnableCycle()):"next"===F.getDataAttribute(this,"slide")?(i.next(),void i._maybeEnableCycle()):(i.prev(),void i._maybeEnableCycle())})),N.on(window,_t,(()=>{const t=z.find('[data-bs-ride="carousel"]');for(const e of t)xt.getOrCreateInstance(e)})),m(xt);const kt=".bs.collapse",Lt=`show${kt}`,St=`shown${kt}`,Dt=`hide${kt}`,$t=`hidden${kt}`,It=`click${kt}.data-api`,Nt="show",Pt="collapse",Mt="collapsing",jt=`:scope .${Pt} .${Pt}`,Ft='[data-bs-toggle="collapse"]',Ht={parent:null,toggle:!0},Wt={parent:"(null|element)",toggle:"boolean"};class Bt extends W{constructor(t,e){super(t,e),this._isTransitioning=!1,this._triggerArray=[];const i=z.find(Ft);for(const t of i){const e=z.getSelectorFromElement(t),i=z.find(e).filter((t=>t===this._element));null!==e&&i.length&&this._triggerArray.push(t)}this._initializeChildren(),this._config.parent||this._addAriaAndCollapsedClass(this._triggerArray,this._isShown()),this._config.toggle&&this.toggle()}static get Default(){return Ht}static get DefaultType(){return Wt}static get NAME(){return"collapse"}toggle(){this._isShown()?this.hide():this.show()}show(){if(this._isTransitioning||this._isShown())return;let t=[];if(this._config.parent&&(t=this._getFirstLevelChildren(".collapse.show, .collapse.collapsing").filter((t=>t!==this._element)).map((t=>Bt.getOrCreateInstance(t,{toggle:!1})))),t.length&&t[0]._isTransitioning)return;if(N.trigger(this._element,Lt).defaultPrevented)return;for(const e of t)e.hide();const e=this._getDimension();this._element.classList.remove(Pt),this._element.classList.add(Mt),this._element.style[e]=0,this._addAriaAndCollapsedClass(this._triggerArray,!0),this._isTransitioning=!0;const i=`scroll${e[0].toUpperCase()+e.slice(1)}`;this._queueCallback((()=>{this._isTransitioning=!1,this._element.classList.remove(Mt),this._element.classList.add(Pt,Nt),this._element.style[e]="",N.trigger(this._element,St)}),this._element,!0),this._element.style[e]=`${this._element[i]}px`}hide(){if(this._isTransitioning||!this._isShown())return;if(N.trigger(this._element,Dt).defaultPrevented)return;const t=this._getDimension();this._element.style[t]=`${this._element.getBoundingClientRect()[t]}px`,d(this._element),this._element.classList.add(Mt),this._element.classList.remove(Pt,Nt);for(const t of this._triggerArray){const e=z.getElementFromSelector(t);e&&!this._isShown(e)&&this._addAriaAndCollapsedClass([t],!1)}this._isTransitioning=!0,this._element.style[t]="",this._queueCallback((()=>{this._isTransitioning=!1,this._element.classList.remove(Mt),this._element.classList.add(Pt),N.trigger(this._element,$t)}),this._element,!0)}_isShown(t=this._element){return t.classList.contains(Nt)}_configAfterMerge(t){return t.toggle=Boolean(t.toggle),t.parent=r(t.parent),t}_getDimension(){return this._element.classList.contains("collapse-horizontal")?"width":"height"}_initializeChildren(){if(!this._config.parent)return;const t=this._getFirstLevelChildren(Ft);for(const e of t){const t=z.getElementFromSelector(e);t&&this._addAriaAndCollapsedClass([e],this._isShown(t))}}_getFirstLevelChildren(t){const e=z.find(jt,this._config.parent);return z.find(t,this._config.parent).filter((t=>!e.includes(t)))}_addAriaAndCollapsedClass(t,e){if(t.length)for(const i of t)i.classList.toggle("collapsed",!e),i.setAttribute("aria-expanded",e)}static jQueryInterface(t){const e={};return"string"==typeof t&&/show|hide/.test(t)&&(e.toggle=!1),this.each((function(){const i=Bt.getOrCreateInstance(this,e);if("string"==typeof t){if(void 0===i[t])throw new TypeError(`No method named "${t}"`);i[t]()}}))}}N.on(document,It,Ft,(function(t){("A"===t.target.tagName||t.delegateTarget&&"A"===t.delegateTarget.tagName)&&t.preventDefault();for(const t of z.getMultipleElementsFromSelector(this))Bt.getOrCreateInstance(t,{toggle:!1}).toggle()})),m(Bt);var zt="top",Rt="bottom",qt="right",Vt="left",Kt="auto",Qt=[zt,Rt,qt,Vt],Xt="start",Yt="end",Ut="clippingParents",Gt="viewport",Jt="popper",Zt="reference",te=Qt.reduce((function(t,e){return t.concat([e+"-"+Xt,e+"-"+Yt])}),[]),ee=[].concat(Qt,[Kt]).reduce((function(t,e){return t.concat([e,e+"-"+Xt,e+"-"+Yt])}),[]),ie="beforeRead",ne="read",se="afterRead",oe="beforeMain",re="main",ae="afterMain",le="beforeWrite",ce="write",he="afterWrite",de=[ie,ne,se,oe,re,ae,le,ce,he];function ue(t){return t?(t.nodeName||"").toLowerCase():null}function fe(t){if(null==t)return window;if("[object Window]"!==t.toString()){var e=t.ownerDocument;return e&&e.defaultView||window}return t}function pe(t){return t instanceof fe(t).Element||t instanceof Element}function me(t){return t instanceof fe(t).HTMLElement||t instanceof HTMLElement}function ge(t){return"undefined"!=typeof ShadowRoot&&(t instanceof fe(t).ShadowRoot||t instanceof ShadowRoot)}const _e={name:"applyStyles",enabled:!0,phase:"write",fn:function(t){var e=t.state;Object.keys(e.elements).forEach((function(t){var i=e.styles[t]||{},n=e.attributes[t]||{},s=e.elements[t];me(s)&&ue(s)&&(Object.assign(s.style,i),Object.keys(n).forEach((function(t){var e=n[t];!1===e?s.removeAttribute(t):s.setAttribute(t,!0===e?"":e)})))}))},effect:function(t){var e=t.state,i={popper:{position:e.options.strategy,left:"0",top:"0",margin:"0"},arrow:{position:"absolute"},reference:{}};return Object.assign(e.elements.popper.style,i.popper),e.styles=i,e.elements.arrow&&Object.assign(e.elements.arrow.style,i.arrow),function(){Object.keys(e.elements).forEach((function(t){var n=e.elements[t],s=e.attributes[t]||{},o=Object.keys(e.styles.hasOwnProperty(t)?e.styles[t]:i[t]).reduce((function(t,e){return t[e]="",t}),{});me(n)&&ue(n)&&(Object.assign(n.style,o),Object.keys(s).forEach((function(t){n.removeAttribute(t)})))}))}},requires:["computeStyles"]};function be(t){return t.split("-")[0]}var ve=Math.max,ye=Math.min,we=Math.round;function Ae(){var t=navigator.userAgentData;return null!=t&&t.brands&&Array.isArray(t.brands)?t.brands.map((function(t){return t.brand+"/"+t.version})).join(" "):navigator.userAgent}function Ee(){return!/^((?!chrome|android).)*safari/i.test(Ae())}function Te(t,e,i){void 0===e&&(e=!1),void 0===i&&(i=!1);var n=t.getBoundingClientRect(),s=1,o=1;e&&me(t)&&(s=t.offsetWidth>0&&we(n.width)/t.offsetWidth||1,o=t.offsetHeight>0&&we(n.height)/t.offsetHeight||1);var r=(pe(t)?fe(t):window).visualViewport,a=!Ee()&&i,l=(n.left+(a&&r?r.offsetLeft:0))/s,c=(n.top+(a&&r?r.offsetTop:0))/o,h=n.width/s,d=n.height/o;return{width:h,height:d,top:c,right:l+h,bottom:c+d,left:l,x:l,y:c}}function Ce(t){var e=Te(t),i=t.offsetWidth,n=t.offsetHeight;return Math.abs(e.width-i)<=1&&(i=e.width),Math.abs(e.height-n)<=1&&(n=e.height),{x:t.offsetLeft,y:t.offsetTop,width:i,height:n}}function Oe(t,e){var i=e.getRootNode&&e.getRootNode();if(t.contains(e))return!0;if(i&&ge(i)){var n=e;do{if(n&&t.isSameNode(n))return!0;n=n.parentNode||n.host}while(n)}return!1}function xe(t){return fe(t).getComputedStyle(t)}function ke(t){return["table","td","th"].indexOf(ue(t))>=0}function Le(t){return((pe(t)?t.ownerDocument:t.document)||window.document).documentElement}function Se(t){return"html"===ue(t)?t:t.assignedSlot||t.parentNode||(ge(t)?t.host:null)||Le(t)}function De(t){return me(t)&&"fixed"!==xe(t).position?t.offsetParent:null}function $e(t){for(var e=fe(t),i=De(t);i&&ke(i)&&"static"===xe(i).position;)i=De(i);return i&&("html"===ue(i)||"body"===ue(i)&&"static"===xe(i).position)?e:i||function(t){var e=/firefox/i.test(Ae());if(/Trident/i.test(Ae())&&me(t)&&"fixed"===xe(t).position)return null;var i=Se(t);for(ge(i)&&(i=i.host);me(i)&&["html","body"].indexOf(ue(i))<0;){var n=xe(i);if("none"!==n.transform||"none"!==n.perspective||"paint"===n.contain||-1!==["transform","perspective"].indexOf(n.willChange)||e&&"filter"===n.willChange||e&&n.filter&&"none"!==n.filter)return i;i=i.parentNode}return null}(t)||e}function Ie(t){return["top","bottom"].indexOf(t)>=0?"x":"y"}function Ne(t,e,i){return ve(t,ye(e,i))}function Pe(t){return Object.assign({},{top:0,right:0,bottom:0,left:0},t)}function Me(t,e){return e.reduce((function(e,i){return e[i]=t,e}),{})}const je={name:"arrow",enabled:!0,phase:"main",fn:function(t){var e,i=t.state,n=t.name,s=t.options,o=i.elements.arrow,r=i.modifiersData.popperOffsets,a=be(i.placement),l=Ie(a),c=[Vt,qt].indexOf(a)>=0?"height":"width";if(o&&r){var h=function(t,e){return Pe("number"!=typeof(t="function"==typeof t?t(Object.assign({},e.rects,{placement:e.placement})):t)?t:Me(t,Qt))}(s.padding,i),d=Ce(o),u="y"===l?zt:Vt,f="y"===l?Rt:qt,p=i.rects.reference[c]+i.rects.reference[l]-r[l]-i.rects.popper[c],m=r[l]-i.rects.reference[l],g=$e(o),_=g?"y"===l?g.clientHeight||0:g.clientWidth||0:0,b=p/2-m/2,v=h[u],y=_-d[c]-h[f],w=_/2-d[c]/2+b,A=Ne(v,w,y),E=l;i.modifiersData[n]=((e={})[E]=A,e.centerOffset=A-w,e)}},effect:function(t){var e=t.state,i=t.options.element,n=void 0===i?"[data-popper-arrow]":i;null!=n&&("string"!=typeof n||(n=e.elements.popper.querySelector(n)))&&Oe(e.elements.popper,n)&&(e.elements.arrow=n)},requires:["popperOffsets"],requiresIfExists:["preventOverflow"]};function Fe(t){return t.split("-")[1]}var He={top:"auto",right:"auto",bottom:"auto",left:"auto"};function We(t){var e,i=t.popper,n=t.popperRect,s=t.placement,o=t.variation,r=t.offsets,a=t.position,l=t.gpuAcceleration,c=t.adaptive,h=t.roundOffsets,d=t.isFixed,u=r.x,f=void 0===u?0:u,p=r.y,m=void 0===p?0:p,g="function"==typeof h?h({x:f,y:m}):{x:f,y:m};f=g.x,m=g.y;var _=r.hasOwnProperty("x"),b=r.hasOwnProperty("y"),v=Vt,y=zt,w=window;if(c){var A=$e(i),E="clientHeight",T="clientWidth";A===fe(i)&&"static"!==xe(A=Le(i)).position&&"absolute"===a&&(E="scrollHeight",T="scrollWidth"),(s===zt||(s===Vt||s===qt)&&o===Yt)&&(y=Rt,m-=(d&&A===w&&w.visualViewport?w.visualViewport.height:A[E])-n.height,m*=l?1:-1),s!==Vt&&(s!==zt&&s!==Rt||o!==Yt)||(v=qt,f-=(d&&A===w&&w.visualViewport?w.visualViewport.width:A[T])-n.width,f*=l?1:-1)}var C,O=Object.assign({position:a},c&&He),x=!0===h?function(t,e){var i=t.x,n=t.y,s=e.devicePixelRatio||1;return{x:we(i*s)/s||0,y:we(n*s)/s||0}}({x:f,y:m},fe(i)):{x:f,y:m};return f=x.x,m=x.y,l?Object.assign({},O,((C={})[y]=b?"0":"",C[v]=_?"0":"",C.transform=(w.devicePixelRatio||1)<=1?"translate("+f+"px, "+m+"px)":"translate3d("+f+"px, "+m+"px, 0)",C)):Object.assign({},O,((e={})[y]=b?m+"px":"",e[v]=_?f+"px":"",e.transform="",e))}const Be={name:"computeStyles",enabled:!0,phase:"beforeWrite",fn:function(t){var e=t.state,i=t.options,n=i.gpuAcceleration,s=void 0===n||n,o=i.adaptive,r=void 0===o||o,a=i.roundOffsets,l=void 0===a||a,c={placement:be(e.placement),variation:Fe(e.placement),popper:e.elements.popper,popperRect:e.rects.popper,gpuAcceleration:s,isFixed:"fixed"===e.options.strategy};null!=e.modifiersData.popperOffsets&&(e.styles.popper=Object.assign({},e.styles.popper,We(Object.assign({},c,{offsets:e.modifiersData.popperOffsets,position:e.options.strategy,adaptive:r,roundOffsets:l})))),null!=e.modifiersData.arrow&&(e.styles.arrow=Object.assign({},e.styles.arrow,We(Object.assign({},c,{offsets:e.modifiersData.arrow,position:"absolute",adaptive:!1,roundOffsets:l})))),e.attributes.popper=Object.assign({},e.attributes.popper,{"data-popper-placement":e.placement})},data:{}};var ze={passive:!0};const Re={name:"eventListeners",enabled:!0,phase:"write",fn:function(){},effect:function(t){var e=t.state,i=t.instance,n=t.options,s=n.scroll,o=void 0===s||s,r=n.resize,a=void 0===r||r,l=fe(e.elements.popper),c=[].concat(e.scrollParents.reference,e.scrollParents.popper);return o&&c.forEach((function(t){t.addEventListener("scroll",i.update,ze)})),a&&l.addEventListener("resize",i.update,ze),function(){o&&c.forEach((function(t){t.removeEventListener("scroll",i.update,ze)})),a&&l.removeEventListener("resize",i.update,ze)}},data:{}};var qe={left:"right",right:"left",bottom:"top",top:"bottom"};function Ve(t){return t.replace(/left|right|bottom|top/g,(function(t){return qe[t]}))}var Ke={start:"end",end:"start"};function Qe(t){return t.replace(/start|end/g,(function(t){return Ke[t]}))}function Xe(t){var e=fe(t);return{scrollLeft:e.pageXOffset,scrollTop:e.pageYOffset}}function Ye(t){return Te(Le(t)).left+Xe(t).scrollLeft}function Ue(t){var e=xe(t),i=e.overflow,n=e.overflowX,s=e.overflowY;return/auto|scroll|overlay|hidden/.test(i+s+n)}function Ge(t){return["html","body","#document"].indexOf(ue(t))>=0?t.ownerDocument.body:me(t)&&Ue(t)?t:Ge(Se(t))}function Je(t,e){var i;void 0===e&&(e=[]);var n=Ge(t),s=n===(null==(i=t.ownerDocument)?void 0:i.body),o=fe(n),r=s?[o].concat(o.visualViewport||[],Ue(n)?n:[]):n,a=e.concat(r);return s?a:a.concat(Je(Se(r)))}function Ze(t){return Object.assign({},t,{left:t.x,top:t.y,right:t.x+t.width,bottom:t.y+t.height})}function ti(t,e,i){return e===Gt?Ze(function(t,e){var i=fe(t),n=Le(t),s=i.visualViewport,o=n.clientWidth,r=n.clientHeight,a=0,l=0;if(s){o=s.width,r=s.height;var c=Ee();(c||!c&&"fixed"===e)&&(a=s.offsetLeft,l=s.offsetTop)}return{width:o,height:r,x:a+Ye(t),y:l}}(t,i)):pe(e)?function(t,e){var i=Te(t,!1,"fixed"===e);return i.top=i.top+t.clientTop,i.left=i.left+t.clientLeft,i.bottom=i.top+t.clientHeight,i.right=i.left+t.clientWidth,i.width=t.clientWidth,i.height=t.clientHeight,i.x=i.left,i.y=i.top,i}(e,i):Ze(function(t){var e,i=Le(t),n=Xe(t),s=null==(e=t.ownerDocument)?void 0:e.body,o=ve(i.scrollWidth,i.clientWidth,s?s.scrollWidth:0,s?s.clientWidth:0),r=ve(i.scrollHeight,i.clientHeight,s?s.scrollHeight:0,s?s.clientHeight:0),a=-n.scrollLeft+Ye(t),l=-n.scrollTop;return"rtl"===xe(s||i).direction&&(a+=ve(i.clientWidth,s?s.clientWidth:0)-o),{width:o,height:r,x:a,y:l}}(Le(t)))}function ei(t){var e,i=t.reference,n=t.element,s=t.placement,o=s?be(s):null,r=s?Fe(s):null,a=i.x+i.width/2-n.width/2,l=i.y+i.height/2-n.height/2;switch(o){case zt:e={x:a,y:i.y-n.height};break;case Rt:e={x:a,y:i.y+i.height};break;case qt:e={x:i.x+i.width,y:l};break;case Vt:e={x:i.x-n.width,y:l};break;default:e={x:i.x,y:i.y}}var c=o?Ie(o):null;if(null!=c){var h="y"===c?"height":"width";switch(r){case Xt:e[c]=e[c]-(i[h]/2-n[h]/2);break;case Yt:e[c]=e[c]+(i[h]/2-n[h]/2)}}return e}function ii(t,e){void 0===e&&(e={});var i=e,n=i.placement,s=void 0===n?t.placement:n,o=i.strategy,r=void 0===o?t.strategy:o,a=i.boundary,l=void 0===a?Ut:a,c=i.rootBoundary,h=void 0===c?Gt:c,d=i.elementContext,u=void 0===d?Jt:d,f=i.altBoundary,p=void 0!==f&&f,m=i.padding,g=void 0===m?0:m,_=Pe("number"!=typeof g?g:Me(g,Qt)),b=u===Jt?Zt:Jt,v=t.rects.popper,y=t.elements[p?b:u],w=function(t,e,i,n){var s="clippingParents"===e?function(t){var e=Je(Se(t)),i=["absolute","fixed"].indexOf(xe(t).position)>=0&&me(t)?$e(t):t;return pe(i)?e.filter((function(t){return pe(t)&&Oe(t,i)&&"body"!==ue(t)})):[]}(t):[].concat(e),o=[].concat(s,[i]),r=o[0],a=o.reduce((function(e,i){var s=ti(t,i,n);return e.top=ve(s.top,e.top),e.right=ye(s.right,e.right),e.bottom=ye(s.bottom,e.bottom),e.left=ve(s.left,e.left),e}),ti(t,r,n));return a.width=a.right-a.left,a.height=a.bottom-a.top,a.x=a.left,a.y=a.top,a}(pe(y)?y:y.contextElement||Le(t.elements.popper),l,h,r),A=Te(t.elements.reference),E=ei({reference:A,element:v,strategy:"absolute",placement:s}),T=Ze(Object.assign({},v,E)),C=u===Jt?T:A,O={top:w.top-C.top+_.top,bottom:C.bottom-w.bottom+_.bottom,left:w.left-C.left+_.left,right:C.right-w.right+_.right},x=t.modifiersData.offset;if(u===Jt&&x){var k=x[s];Object.keys(O).forEach((function(t){var e=[qt,Rt].indexOf(t)>=0?1:-1,i=[zt,Rt].indexOf(t)>=0?"y":"x";O[t]+=k[i]*e}))}return O}function ni(t,e){void 0===e&&(e={});var i=e,n=i.placement,s=i.boundary,o=i.rootBoundary,r=i.padding,a=i.flipVariations,l=i.allowedAutoPlacements,c=void 0===l?ee:l,h=Fe(n),d=h?a?te:te.filter((function(t){return Fe(t)===h})):Qt,u=d.filter((function(t){return c.indexOf(t)>=0}));0===u.length&&(u=d);var f=u.reduce((function(e,i){return e[i]=ii(t,{placement:i,boundary:s,rootBoundary:o,padding:r})[be(i)],e}),{});return Object.keys(f).sort((function(t,e){return f[t]-f[e]}))}const si={name:"flip",enabled:!0,phase:"main",fn:function(t){var e=t.state,i=t.options,n=t.name;if(!e.modifiersData[n]._skip){for(var s=i.mainAxis,o=void 0===s||s,r=i.altAxis,a=void 0===r||r,l=i.fallbackPlacements,c=i.padding,h=i.boundary,d=i.rootBoundary,u=i.altBoundary,f=i.flipVariations,p=void 0===f||f,m=i.allowedAutoPlacements,g=e.options.placement,_=be(g),b=l||(_!==g&&p?function(t){if(be(t)===Kt)return[];var e=Ve(t);return[Qe(t),e,Qe(e)]}(g):[Ve(g)]),v=[g].concat(b).reduce((function(t,i){return t.concat(be(i)===Kt?ni(e,{placement:i,boundary:h,rootBoundary:d,padding:c,flipVariations:p,allowedAutoPlacements:m}):i)}),[]),y=e.rects.reference,w=e.rects.popper,A=new Map,E=!0,T=v[0],C=0;C=0,S=L?"width":"height",D=ii(e,{placement:O,boundary:h,rootBoundary:d,altBoundary:u,padding:c}),$=L?k?qt:Vt:k?Rt:zt;y[S]>w[S]&&($=Ve($));var I=Ve($),N=[];if(o&&N.push(D[x]<=0),a&&N.push(D[$]<=0,D[I]<=0),N.every((function(t){return t}))){T=O,E=!1;break}A.set(O,N)}if(E)for(var P=function(t){var e=v.find((function(e){var i=A.get(e);if(i)return i.slice(0,t).every((function(t){return t}))}));if(e)return T=e,"break"},M=p?3:1;M>0&&"break"!==P(M);M--);e.placement!==T&&(e.modifiersData[n]._skip=!0,e.placement=T,e.reset=!0)}},requiresIfExists:["offset"],data:{_skip:!1}};function oi(t,e,i){return void 0===i&&(i={x:0,y:0}),{top:t.top-e.height-i.y,right:t.right-e.width+i.x,bottom:t.bottom-e.height+i.y,left:t.left-e.width-i.x}}function ri(t){return[zt,qt,Rt,Vt].some((function(e){return t[e]>=0}))}const ai={name:"hide",enabled:!0,phase:"main",requiresIfExists:["preventOverflow"],fn:function(t){var e=t.state,i=t.name,n=e.rects.reference,s=e.rects.popper,o=e.modifiersData.preventOverflow,r=ii(e,{elementContext:"reference"}),a=ii(e,{altBoundary:!0}),l=oi(r,n),c=oi(a,s,o),h=ri(l),d=ri(c);e.modifiersData[i]={referenceClippingOffsets:l,popperEscapeOffsets:c,isReferenceHidden:h,hasPopperEscaped:d},e.attributes.popper=Object.assign({},e.attributes.popper,{"data-popper-reference-hidden":h,"data-popper-escaped":d})}},li={name:"offset",enabled:!0,phase:"main",requires:["popperOffsets"],fn:function(t){var e=t.state,i=t.options,n=t.name,s=i.offset,o=void 0===s?[0,0]:s,r=ee.reduce((function(t,i){return t[i]=function(t,e,i){var n=be(t),s=[Vt,zt].indexOf(n)>=0?-1:1,o="function"==typeof i?i(Object.assign({},e,{placement:t})):i,r=o[0],a=o[1];return r=r||0,a=(a||0)*s,[Vt,qt].indexOf(n)>=0?{x:a,y:r}:{x:r,y:a}}(i,e.rects,o),t}),{}),a=r[e.placement],l=a.x,c=a.y;null!=e.modifiersData.popperOffsets&&(e.modifiersData.popperOffsets.x+=l,e.modifiersData.popperOffsets.y+=c),e.modifiersData[n]=r}},ci={name:"popperOffsets",enabled:!0,phase:"read",fn:function(t){var e=t.state,i=t.name;e.modifiersData[i]=ei({reference:e.rects.reference,element:e.rects.popper,strategy:"absolute",placement:e.placement})},data:{}},hi={name:"preventOverflow",enabled:!0,phase:"main",fn:function(t){var e=t.state,i=t.options,n=t.name,s=i.mainAxis,o=void 0===s||s,r=i.altAxis,a=void 0!==r&&r,l=i.boundary,c=i.rootBoundary,h=i.altBoundary,d=i.padding,u=i.tether,f=void 0===u||u,p=i.tetherOffset,m=void 0===p?0:p,g=ii(e,{boundary:l,rootBoundary:c,padding:d,altBoundary:h}),_=be(e.placement),b=Fe(e.placement),v=!b,y=Ie(_),w="x"===y?"y":"x",A=e.modifiersData.popperOffsets,E=e.rects.reference,T=e.rects.popper,C="function"==typeof m?m(Object.assign({},e.rects,{placement:e.placement})):m,O="number"==typeof C?{mainAxis:C,altAxis:C}:Object.assign({mainAxis:0,altAxis:0},C),x=e.modifiersData.offset?e.modifiersData.offset[e.placement]:null,k={x:0,y:0};if(A){if(o){var L,S="y"===y?zt:Vt,D="y"===y?Rt:qt,$="y"===y?"height":"width",I=A[y],N=I+g[S],P=I-g[D],M=f?-T[$]/2:0,j=b===Xt?E[$]:T[$],F=b===Xt?-T[$]:-E[$],H=e.elements.arrow,W=f&&H?Ce(H):{width:0,height:0},B=e.modifiersData["arrow#persistent"]?e.modifiersData["arrow#persistent"].padding:{top:0,right:0,bottom:0,left:0},z=B[S],R=B[D],q=Ne(0,E[$],W[$]),V=v?E[$]/2-M-q-z-O.mainAxis:j-q-z-O.mainAxis,K=v?-E[$]/2+M+q+R+O.mainAxis:F+q+R+O.mainAxis,Q=e.elements.arrow&&$e(e.elements.arrow),X=Q?"y"===y?Q.clientTop||0:Q.clientLeft||0:0,Y=null!=(L=null==x?void 0:x[y])?L:0,U=I+K-Y,G=Ne(f?ye(N,I+V-Y-X):N,I,f?ve(P,U):P);A[y]=G,k[y]=G-I}if(a){var J,Z="x"===y?zt:Vt,tt="x"===y?Rt:qt,et=A[w],it="y"===w?"height":"width",nt=et+g[Z],st=et-g[tt],ot=-1!==[zt,Vt].indexOf(_),rt=null!=(J=null==x?void 0:x[w])?J:0,at=ot?nt:et-E[it]-T[it]-rt+O.altAxis,lt=ot?et+E[it]+T[it]-rt-O.altAxis:st,ct=f&&ot?function(t,e,i){var n=Ne(t,e,i);return n>i?i:n}(at,et,lt):Ne(f?at:nt,et,f?lt:st);A[w]=ct,k[w]=ct-et}e.modifiersData[n]=k}},requiresIfExists:["offset"]};function di(t,e,i){void 0===i&&(i=!1);var n,s,o=me(e),r=me(e)&&function(t){var e=t.getBoundingClientRect(),i=we(e.width)/t.offsetWidth||1,n=we(e.height)/t.offsetHeight||1;return 1!==i||1!==n}(e),a=Le(e),l=Te(t,r,i),c={scrollLeft:0,scrollTop:0},h={x:0,y:0};return(o||!o&&!i)&&(("body"!==ue(e)||Ue(a))&&(c=(n=e)!==fe(n)&&me(n)?{scrollLeft:(s=n).scrollLeft,scrollTop:s.scrollTop}:Xe(n)),me(e)?((h=Te(e,!0)).x+=e.clientLeft,h.y+=e.clientTop):a&&(h.x=Ye(a))),{x:l.left+c.scrollLeft-h.x,y:l.top+c.scrollTop-h.y,width:l.width,height:l.height}}function ui(t){var e=new Map,i=new Set,n=[];function s(t){i.add(t.name),[].concat(t.requires||[],t.requiresIfExists||[]).forEach((function(t){if(!i.has(t)){var n=e.get(t);n&&s(n)}})),n.push(t)}return t.forEach((function(t){e.set(t.name,t)})),t.forEach((function(t){i.has(t.name)||s(t)})),n}var fi={placement:"bottom",modifiers:[],strategy:"absolute"};function pi(){for(var t=arguments.length,e=new Array(t),i=0;iNumber.parseInt(t,10))):"function"==typeof t?e=>t(e,this._element):t}_getPopperConfig(){const t={placement:this._getPlacement(),modifiers:[{name:"preventOverflow",options:{boundary:this._config.boundary}},{name:"offset",options:{offset:this._getOffset()}}]};return(this._inNavbar||"static"===this._config.display)&&(F.setDataAttribute(this._menu,"popper","static"),t.modifiers=[{name:"applyStyles",enabled:!1}]),{...t,...g(this._config.popperConfig,[t])}}_selectMenuItem({key:t,target:e}){const i=z.find(".dropdown-menu .dropdown-item:not(.disabled):not(:disabled)",this._menu).filter((t=>a(t)));i.length&&b(i,e,t===Ti,!i.includes(e)).focus()}static jQueryInterface(t){return this.each((function(){const e=qi.getOrCreateInstance(this,t);if("string"==typeof t){if(void 0===e[t])throw new TypeError(`No method named "${t}"`);e[t]()}}))}static clearMenus(t){if(2===t.button||"keyup"===t.type&&"Tab"!==t.key)return;const e=z.find(Ni);for(const i of e){const e=qi.getInstance(i);if(!e||!1===e._config.autoClose)continue;const n=t.composedPath(),s=n.includes(e._menu);if(n.includes(e._element)||"inside"===e._config.autoClose&&!s||"outside"===e._config.autoClose&&s)continue;if(e._menu.contains(t.target)&&("keyup"===t.type&&"Tab"===t.key||/input|select|option|textarea|form/i.test(t.target.tagName)))continue;const o={relatedTarget:e._element};"click"===t.type&&(o.clickEvent=t),e._completeHide(o)}}static dataApiKeydownHandler(t){const e=/input|textarea/i.test(t.target.tagName),i="Escape"===t.key,n=[Ei,Ti].includes(t.key);if(!n&&!i)return;if(e&&!i)return;t.preventDefault();const s=this.matches(Ii)?this:z.prev(this,Ii)[0]||z.next(this,Ii)[0]||z.findOne(Ii,t.delegateTarget.parentNode),o=qi.getOrCreateInstance(s);if(n)return t.stopPropagation(),o.show(),void o._selectMenuItem(t);o._isShown()&&(t.stopPropagation(),o.hide(),s.focus())}}N.on(document,Si,Ii,qi.dataApiKeydownHandler),N.on(document,Si,Pi,qi.dataApiKeydownHandler),N.on(document,Li,qi.clearMenus),N.on(document,Di,qi.clearMenus),N.on(document,Li,Ii,(function(t){t.preventDefault(),qi.getOrCreateInstance(this).toggle()})),m(qi);const Vi="backdrop",Ki="show",Qi=`mousedown.bs.${Vi}`,Xi={className:"modal-backdrop",clickCallback:null,isAnimated:!1,isVisible:!0,rootElement:"body"},Yi={className:"string",clickCallback:"(function|null)",isAnimated:"boolean",isVisible:"boolean",rootElement:"(element|string)"};class Ui extends H{constructor(t){super(),this._config=this._getConfig(t),this._isAppended=!1,this._element=null}static get Default(){return Xi}static get DefaultType(){return Yi}static get NAME(){return Vi}show(t){if(!this._config.isVisible)return void g(t);this._append();const e=this._getElement();this._config.isAnimated&&d(e),e.classList.add(Ki),this._emulateAnimation((()=>{g(t)}))}hide(t){this._config.isVisible?(this._getElement().classList.remove(Ki),this._emulateAnimation((()=>{this.dispose(),g(t)}))):g(t)}dispose(){this._isAppended&&(N.off(this._element,Qi),this._element.remove(),this._isAppended=!1)}_getElement(){if(!this._element){const t=document.createElement("div");t.className=this._config.className,this._config.isAnimated&&t.classList.add("fade"),this._element=t}return this._element}_configAfterMerge(t){return t.rootElement=r(t.rootElement),t}_append(){if(this._isAppended)return;const t=this._getElement();this._config.rootElement.append(t),N.on(t,Qi,(()=>{g(this._config.clickCallback)})),this._isAppended=!0}_emulateAnimation(t){_(t,this._getElement(),this._config.isAnimated)}}const Gi=".bs.focustrap",Ji=`focusin${Gi}`,Zi=`keydown.tab${Gi}`,tn="backward",en={autofocus:!0,trapElement:null},nn={autofocus:"boolean",trapElement:"element"};class sn extends H{constructor(t){super(),this._config=this._getConfig(t),this._isActive=!1,this._lastTabNavDirection=null}static get Default(){return en}static get DefaultType(){return nn}static get NAME(){return"focustrap"}activate(){this._isActive||(this._config.autofocus&&this._config.trapElement.focus(),N.off(document,Gi),N.on(document,Ji,(t=>this._handleFocusin(t))),N.on(document,Zi,(t=>this._handleKeydown(t))),this._isActive=!0)}deactivate(){this._isActive&&(this._isActive=!1,N.off(document,Gi))}_handleFocusin(t){const{trapElement:e}=this._config;if(t.target===document||t.target===e||e.contains(t.target))return;const i=z.focusableChildren(e);0===i.length?e.focus():this._lastTabNavDirection===tn?i[i.length-1].focus():i[0].focus()}_handleKeydown(t){"Tab"===t.key&&(this._lastTabNavDirection=t.shiftKey?tn:"forward")}}const on=".fixed-top, .fixed-bottom, .is-fixed, .sticky-top",rn=".sticky-top",an="padding-right",ln="margin-right";class cn{constructor(){this._element=document.body}getWidth(){const t=document.documentElement.clientWidth;return Math.abs(window.innerWidth-t)}hide(){const t=this.getWidth();this._disableOverFlow(),this._setElementAttributes(this._element,an,(e=>e+t)),this._setElementAttributes(on,an,(e=>e+t)),this._setElementAttributes(rn,ln,(e=>e-t))}reset(){this._resetElementAttributes(this._element,"overflow"),this._resetElementAttributes(this._element,an),this._resetElementAttributes(on,an),this._resetElementAttributes(rn,ln)}isOverflowing(){return this.getWidth()>0}_disableOverFlow(){this._saveInitialAttribute(this._element,"overflow"),this._element.style.overflow="hidden"}_setElementAttributes(t,e,i){const n=this.getWidth();this._applyManipulationCallback(t,(t=>{if(t!==this._element&&window.innerWidth>t.clientWidth+n)return;this._saveInitialAttribute(t,e);const s=window.getComputedStyle(t).getPropertyValue(e);t.style.setProperty(e,`${i(Number.parseFloat(s))}px`)}))}_saveInitialAttribute(t,e){const i=t.style.getPropertyValue(e);i&&F.setDataAttribute(t,e,i)}_resetElementAttributes(t,e){this._applyManipulationCallback(t,(t=>{const i=F.getDataAttribute(t,e);null!==i?(F.removeDataAttribute(t,e),t.style.setProperty(e,i)):t.style.removeProperty(e)}))}_applyManipulationCallback(t,e){if(o(t))e(t);else for(const i of z.find(t,this._element))e(i)}}const hn=".bs.modal",dn=`hide${hn}`,un=`hidePrevented${hn}`,fn=`hidden${hn}`,pn=`show${hn}`,mn=`shown${hn}`,gn=`resize${hn}`,_n=`click.dismiss${hn}`,bn=`mousedown.dismiss${hn}`,vn=`keydown.dismiss${hn}`,yn=`click${hn}.data-api`,wn="modal-open",An="show",En="modal-static",Tn={backdrop:!0,focus:!0,keyboard:!0},Cn={backdrop:"(boolean|string)",focus:"boolean",keyboard:"boolean"};class On extends W{constructor(t,e){super(t,e),this._dialog=z.findOne(".modal-dialog",this._element),this._backdrop=this._initializeBackDrop(),this._focustrap=this._initializeFocusTrap(),this._isShown=!1,this._isTransitioning=!1,this._scrollBar=new cn,this._addEventListeners()}static get Default(){return Tn}static get DefaultType(){return Cn}static get NAME(){return"modal"}toggle(t){return this._isShown?this.hide():this.show(t)}show(t){this._isShown||this._isTransitioning||N.trigger(this._element,pn,{relatedTarget:t}).defaultPrevented||(this._isShown=!0,this._isTransitioning=!0,this._scrollBar.hide(),document.body.classList.add(wn),this._adjustDialog(),this._backdrop.show((()=>this._showElement(t))))}hide(){this._isShown&&!this._isTransitioning&&(N.trigger(this._element,dn).defaultPrevented||(this._isShown=!1,this._isTransitioning=!0,this._focustrap.deactivate(),this._element.classList.remove(An),this._queueCallback((()=>this._hideModal()),this._element,this._isAnimated())))}dispose(){N.off(window,hn),N.off(this._dialog,hn),this._backdrop.dispose(),this._focustrap.deactivate(),super.dispose()}handleUpdate(){this._adjustDialog()}_initializeBackDrop(){return new Ui({isVisible:Boolean(this._config.backdrop),isAnimated:this._isAnimated()})}_initializeFocusTrap(){return new sn({trapElement:this._element})}_showElement(t){document.body.contains(this._element)||document.body.append(this._element),this._element.style.display="block",this._element.removeAttribute("aria-hidden"),this._element.setAttribute("aria-modal",!0),this._element.setAttribute("role","dialog"),this._element.scrollTop=0;const e=z.findOne(".modal-body",this._dialog);e&&(e.scrollTop=0),d(this._element),this._element.classList.add(An),this._queueCallback((()=>{this._config.focus&&this._focustrap.activate(),this._isTransitioning=!1,N.trigger(this._element,mn,{relatedTarget:t})}),this._dialog,this._isAnimated())}_addEventListeners(){N.on(this._element,vn,(t=>{"Escape"===t.key&&(this._config.keyboard?this.hide():this._triggerBackdropTransition())})),N.on(window,gn,(()=>{this._isShown&&!this._isTransitioning&&this._adjustDialog()})),N.on(this._element,bn,(t=>{N.one(this._element,_n,(e=>{this._element===t.target&&this._element===e.target&&("static"!==this._config.backdrop?this._config.backdrop&&this.hide():this._triggerBackdropTransition())}))}))}_hideModal(){this._element.style.display="none",this._element.setAttribute("aria-hidden",!0),this._element.removeAttribute("aria-modal"),this._element.removeAttribute("role"),this._isTransitioning=!1,this._backdrop.hide((()=>{document.body.classList.remove(wn),this._resetAdjustments(),this._scrollBar.reset(),N.trigger(this._element,fn)}))}_isAnimated(){return this._element.classList.contains("fade")}_triggerBackdropTransition(){if(N.trigger(this._element,un).defaultPrevented)return;const t=this._element.scrollHeight>document.documentElement.clientHeight,e=this._element.style.overflowY;"hidden"===e||this._element.classList.contains(En)||(t||(this._element.style.overflowY="hidden"),this._element.classList.add(En),this._queueCallback((()=>{this._element.classList.remove(En),this._queueCallback((()=>{this._element.style.overflowY=e}),this._dialog)}),this._dialog),this._element.focus())}_adjustDialog(){const t=this._element.scrollHeight>document.documentElement.clientHeight,e=this._scrollBar.getWidth(),i=e>0;if(i&&!t){const t=p()?"paddingLeft":"paddingRight";this._element.style[t]=`${e}px`}if(!i&&t){const t=p()?"paddingRight":"paddingLeft";this._element.style[t]=`${e}px`}}_resetAdjustments(){this._element.style.paddingLeft="",this._element.style.paddingRight=""}static jQueryInterface(t,e){return this.each((function(){const i=On.getOrCreateInstance(this,t);if("string"==typeof t){if(void 0===i[t])throw new TypeError(`No method named "${t}"`);i[t](e)}}))}}N.on(document,yn,'[data-bs-toggle="modal"]',(function(t){const e=z.getElementFromSelector(this);["A","AREA"].includes(this.tagName)&&t.preventDefault(),N.one(e,pn,(t=>{t.defaultPrevented||N.one(e,fn,(()=>{a(this)&&this.focus()}))}));const i=z.findOne(".modal.show");i&&On.getInstance(i).hide(),On.getOrCreateInstance(e).toggle(this)})),R(On),m(On);const xn=".bs.offcanvas",kn=".data-api",Ln=`load${xn}${kn}`,Sn="show",Dn="showing",$n="hiding",In=".offcanvas.show",Nn=`show${xn}`,Pn=`shown${xn}`,Mn=`hide${xn}`,jn=`hidePrevented${xn}`,Fn=`hidden${xn}`,Hn=`resize${xn}`,Wn=`click${xn}${kn}`,Bn=`keydown.dismiss${xn}`,zn={backdrop:!0,keyboard:!0,scroll:!1},Rn={backdrop:"(boolean|string)",keyboard:"boolean",scroll:"boolean"};class qn extends W{constructor(t,e){super(t,e),this._isShown=!1,this._backdrop=this._initializeBackDrop(),this._focustrap=this._initializeFocusTrap(),this._addEventListeners()}static get Default(){return zn}static get DefaultType(){return Rn}static get NAME(){return"offcanvas"}toggle(t){return this._isShown?this.hide():this.show(t)}show(t){this._isShown||N.trigger(this._element,Nn,{relatedTarget:t}).defaultPrevented||(this._isShown=!0,this._backdrop.show(),this._config.scroll||(new cn).hide(),this._element.setAttribute("aria-modal",!0),this._element.setAttribute("role","dialog"),this._element.classList.add(Dn),this._queueCallback((()=>{this._config.scroll&&!this._config.backdrop||this._focustrap.activate(),this._element.classList.add(Sn),this._element.classList.remove(Dn),N.trigger(this._element,Pn,{relatedTarget:t})}),this._element,!0))}hide(){this._isShown&&(N.trigger(this._element,Mn).defaultPrevented||(this._focustrap.deactivate(),this._element.blur(),this._isShown=!1,this._element.classList.add($n),this._backdrop.hide(),this._queueCallback((()=>{this._element.classList.remove(Sn,$n),this._element.removeAttribute("aria-modal"),this._element.removeAttribute("role"),this._config.scroll||(new cn).reset(),N.trigger(this._element,Fn)}),this._element,!0)))}dispose(){this._backdrop.dispose(),this._focustrap.deactivate(),super.dispose()}_initializeBackDrop(){const t=Boolean(this._config.backdrop);return new Ui({className:"offcanvas-backdrop",isVisible:t,isAnimated:!0,rootElement:this._element.parentNode,clickCallback:t?()=>{"static"!==this._config.backdrop?this.hide():N.trigger(this._element,jn)}:null})}_initializeFocusTrap(){return new sn({trapElement:this._element})}_addEventListeners(){N.on(this._element,Bn,(t=>{"Escape"===t.key&&(this._config.keyboard?this.hide():N.trigger(this._element,jn))}))}static jQueryInterface(t){return this.each((function(){const e=qn.getOrCreateInstance(this,t);if("string"==typeof t){if(void 0===e[t]||t.startsWith("_")||"constructor"===t)throw new TypeError(`No method named "${t}"`);e[t](this)}}))}}N.on(document,Wn,'[data-bs-toggle="offcanvas"]',(function(t){const e=z.getElementFromSelector(this);if(["A","AREA"].includes(this.tagName)&&t.preventDefault(),l(this))return;N.one(e,Fn,(()=>{a(this)&&this.focus()}));const i=z.findOne(In);i&&i!==e&&qn.getInstance(i).hide(),qn.getOrCreateInstance(e).toggle(this)})),N.on(window,Ln,(()=>{for(const t of z.find(In))qn.getOrCreateInstance(t).show()})),N.on(window,Hn,(()=>{for(const t of z.find("[aria-modal][class*=show][class*=offcanvas-]"))"fixed"!==getComputedStyle(t).position&&qn.getOrCreateInstance(t).hide()})),R(qn),m(qn);const Vn={"*":["class","dir","id","lang","role",/^aria-[\w-]*$/i],a:["target","href","title","rel"],area:[],b:[],br:[],col:[],code:[],div:[],em:[],hr:[],h1:[],h2:[],h3:[],h4:[],h5:[],h6:[],i:[],img:["src","srcset","alt","title","width","height"],li:[],ol:[],p:[],pre:[],s:[],small:[],span:[],sub:[],sup:[],strong:[],u:[],ul:[]},Kn=new Set(["background","cite","href","itemtype","longdesc","poster","src","xlink:href"]),Qn=/^(?!javascript:)(?:[a-z0-9+.-]+:|[^&:/?#]*(?:[/?#]|$))/i,Xn=(t,e)=>{const i=t.nodeName.toLowerCase();return e.includes(i)?!Kn.has(i)||Boolean(Qn.test(t.nodeValue)):e.filter((t=>t instanceof RegExp)).some((t=>t.test(i)))},Yn={allowList:Vn,content:{},extraClass:"",html:!1,sanitize:!0,sanitizeFn:null,template:"
"},Un={allowList:"object",content:"object",extraClass:"(string|function)",html:"boolean",sanitize:"boolean",sanitizeFn:"(null|function)",template:"string"},Gn={entry:"(string|element|function|null)",selector:"(string|element)"};class Jn extends H{constructor(t){super(),this._config=this._getConfig(t)}static get Default(){return Yn}static get DefaultType(){return Un}static get NAME(){return"TemplateFactory"}getContent(){return Object.values(this._config.content).map((t=>this._resolvePossibleFunction(t))).filter(Boolean)}hasContent(){return this.getContent().length>0}changeContent(t){return this._checkContent(t),this._config.content={...this._config.content,...t},this}toHtml(){const t=document.createElement("div");t.innerHTML=this._maybeSanitize(this._config.template);for(const[e,i]of Object.entries(this._config.content))this._setContent(t,i,e);const e=t.children[0],i=this._resolvePossibleFunction(this._config.extraClass);return i&&e.classList.add(...i.split(" ")),e}_typeCheckConfig(t){super._typeCheckConfig(t),this._checkContent(t.content)}_checkContent(t){for(const[e,i]of Object.entries(t))super._typeCheckConfig({selector:e,entry:i},Gn)}_setContent(t,e,i){const n=z.findOne(i,t);n&&((e=this._resolvePossibleFunction(e))?o(e)?this._putElementInTemplate(r(e),n):this._config.html?n.innerHTML=this._maybeSanitize(e):n.textContent=e:n.remove())}_maybeSanitize(t){return this._config.sanitize?function(t,e,i){if(!t.length)return t;if(i&&"function"==typeof i)return i(t);const n=(new window.DOMParser).parseFromString(t,"text/html"),s=[].concat(...n.body.querySelectorAll("*"));for(const t of s){const i=t.nodeName.toLowerCase();if(!Object.keys(e).includes(i)){t.remove();continue}const n=[].concat(...t.attributes),s=[].concat(e["*"]||[],e[i]||[]);for(const e of n)Xn(e,s)||t.removeAttribute(e.nodeName)}return n.body.innerHTML}(t,this._config.allowList,this._config.sanitizeFn):t}_resolvePossibleFunction(t){return g(t,[this])}_putElementInTemplate(t,e){if(this._config.html)return e.innerHTML="",void e.append(t);e.textContent=t.textContent}}const Zn=new Set(["sanitize","allowList","sanitizeFn"]),ts="fade",es="show",is=".modal",ns="hide.bs.modal",ss="hover",os="focus",rs={AUTO:"auto",TOP:"top",RIGHT:p()?"left":"right",BOTTOM:"bottom",LEFT:p()?"right":"left"},as={allowList:Vn,animation:!0,boundary:"clippingParents",container:!1,customClass:"",delay:0,fallbackPlacements:["top","right","bottom","left"],html:!1,offset:[0,6],placement:"top",popperConfig:null,sanitize:!0,sanitizeFn:null,selector:!1,template:'',title:"",trigger:"hover focus"},ls={allowList:"object",animation:"boolean",boundary:"(string|element)",container:"(string|element|boolean)",customClass:"(string|function)",delay:"(number|object)",fallbackPlacements:"array",html:"boolean",offset:"(array|string|function)",placement:"(string|function)",popperConfig:"(null|object|function)",sanitize:"boolean",sanitizeFn:"(null|function)",selector:"(string|boolean)",template:"string",title:"(string|element|function)",trigger:"string"};class cs extends W{constructor(t,e){if(void 0===vi)throw new TypeError("Bootstrap's tooltips require Popper (https://popper.js.org)");super(t,e),this._isEnabled=!0,this._timeout=0,this._isHovered=null,this._activeTrigger={},this._popper=null,this._templateFactory=null,this._newContent=null,this.tip=null,this._setListeners(),this._config.selector||this._fixTitle()}static get Default(){return as}static get DefaultType(){return ls}static get NAME(){return"tooltip"}enable(){this._isEnabled=!0}disable(){this._isEnabled=!1}toggleEnabled(){this._isEnabled=!this._isEnabled}toggle(){this._isEnabled&&(this._activeTrigger.click=!this._activeTrigger.click,this._isShown()?this._leave():this._enter())}dispose(){clearTimeout(this._timeout),N.off(this._element.closest(is),ns,this._hideModalHandler),this._element.getAttribute("data-bs-original-title")&&this._element.setAttribute("title",this._element.getAttribute("data-bs-original-title")),this._disposePopper(),super.dispose()}show(){if("none"===this._element.style.display)throw new Error("Please use show on visible elements");if(!this._isWithContent()||!this._isEnabled)return;const t=N.trigger(this._element,this.constructor.eventName("show")),e=(c(this._element)||this._element.ownerDocument.documentElement).contains(this._element);if(t.defaultPrevented||!e)return;this._disposePopper();const i=this._getTipElement();this._element.setAttribute("aria-describedby",i.getAttribute("id"));const{container:n}=this._config;if(this._element.ownerDocument.documentElement.contains(this.tip)||(n.append(i),N.trigger(this._element,this.constructor.eventName("inserted"))),this._popper=this._createPopper(i),i.classList.add(es),"ontouchstart"in document.documentElement)for(const t of[].concat(...document.body.children))N.on(t,"mouseover",h);this._queueCallback((()=>{N.trigger(this._element,this.constructor.eventName("shown")),!1===this._isHovered&&this._leave(),this._isHovered=!1}),this.tip,this._isAnimated())}hide(){if(this._isShown()&&!N.trigger(this._element,this.constructor.eventName("hide")).defaultPrevented){if(this._getTipElement().classList.remove(es),"ontouchstart"in document.documentElement)for(const t of[].concat(...document.body.children))N.off(t,"mouseover",h);this._activeTrigger.click=!1,this._activeTrigger[os]=!1,this._activeTrigger[ss]=!1,this._isHovered=null,this._queueCallback((()=>{this._isWithActiveTrigger()||(this._isHovered||this._disposePopper(),this._element.removeAttribute("aria-describedby"),N.trigger(this._element,this.constructor.eventName("hidden")))}),this.tip,this._isAnimated())}}update(){this._popper&&this._popper.update()}_isWithContent(){return Boolean(this._getTitle())}_getTipElement(){return this.tip||(this.tip=this._createTipElement(this._newContent||this._getContentForTemplate())),this.tip}_createTipElement(t){const e=this._getTemplateFactory(t).toHtml();if(!e)return null;e.classList.remove(ts,es),e.classList.add(`bs-${this.constructor.NAME}-auto`);const i=(t=>{do{t+=Math.floor(1e6*Math.random())}while(document.getElementById(t));return t})(this.constructor.NAME).toString();return e.setAttribute("id",i),this._isAnimated()&&e.classList.add(ts),e}setContent(t){this._newContent=t,this._isShown()&&(this._disposePopper(),this.show())}_getTemplateFactory(t){return this._templateFactory?this._templateFactory.changeContent(t):this._templateFactory=new Jn({...this._config,content:t,extraClass:this._resolvePossibleFunction(this._config.customClass)}),this._templateFactory}_getContentForTemplate(){return{".tooltip-inner":this._getTitle()}}_getTitle(){return this._resolvePossibleFunction(this._config.title)||this._element.getAttribute("data-bs-original-title")}_initializeOnDelegatedTarget(t){return this.constructor.getOrCreateInstance(t.delegateTarget,this._getDelegateConfig())}_isAnimated(){return this._config.animation||this.tip&&this.tip.classList.contains(ts)}_isShown(){return this.tip&&this.tip.classList.contains(es)}_createPopper(t){const e=g(this._config.placement,[this,t,this._element]),i=rs[e.toUpperCase()];return bi(this._element,t,this._getPopperConfig(i))}_getOffset(){const{offset:t}=this._config;return"string"==typeof t?t.split(",").map((t=>Number.parseInt(t,10))):"function"==typeof t?e=>t(e,this._element):t}_resolvePossibleFunction(t){return g(t,[this._element])}_getPopperConfig(t){const e={placement:t,modifiers:[{name:"flip",options:{fallbackPlacements:this._config.fallbackPlacements}},{name:"offset",options:{offset:this._getOffset()}},{name:"preventOverflow",options:{boundary:this._config.boundary}},{name:"arrow",options:{element:`.${this.constructor.NAME}-arrow`}},{name:"preSetPlacement",enabled:!0,phase:"beforeMain",fn:t=>{this._getTipElement().setAttribute("data-popper-placement",t.state.placement)}}]};return{...e,...g(this._config.popperConfig,[e])}}_setListeners(){const t=this._config.trigger.split(" ");for(const e of t)if("click"===e)N.on(this._element,this.constructor.eventName("click"),this._config.selector,(t=>{this._initializeOnDelegatedTarget(t).toggle()}));else if("manual"!==e){const t=e===ss?this.constructor.eventName("mouseenter"):this.constructor.eventName("focusin"),i=e===ss?this.constructor.eventName("mouseleave"):this.constructor.eventName("focusout");N.on(this._element,t,this._config.selector,(t=>{const e=this._initializeOnDelegatedTarget(t);e._activeTrigger["focusin"===t.type?os:ss]=!0,e._enter()})),N.on(this._element,i,this._config.selector,(t=>{const e=this._initializeOnDelegatedTarget(t);e._activeTrigger["focusout"===t.type?os:ss]=e._element.contains(t.relatedTarget),e._leave()}))}this._hideModalHandler=()=>{this._element&&this.hide()},N.on(this._element.closest(is),ns,this._hideModalHandler)}_fixTitle(){const t=this._element.getAttribute("title");t&&(this._element.getAttribute("aria-label")||this._element.textContent.trim()||this._element.setAttribute("aria-label",t),this._element.setAttribute("data-bs-original-title",t),this._element.removeAttribute("title"))}_enter(){this._isShown()||this._isHovered?this._isHovered=!0:(this._isHovered=!0,this._setTimeout((()=>{this._isHovered&&this.show()}),this._config.delay.show))}_leave(){this._isWithActiveTrigger()||(this._isHovered=!1,this._setTimeout((()=>{this._isHovered||this.hide()}),this._config.delay.hide))}_setTimeout(t,e){clearTimeout(this._timeout),this._timeout=setTimeout(t,e)}_isWithActiveTrigger(){return Object.values(this._activeTrigger).includes(!0)}_getConfig(t){const e=F.getDataAttributes(this._element);for(const t of Object.keys(e))Zn.has(t)&&delete e[t];return t={...e,..."object"==typeof t&&t?t:{}},t=this._mergeConfigObj(t),t=this._configAfterMerge(t),this._typeCheckConfig(t),t}_configAfterMerge(t){return t.container=!1===t.container?document.body:r(t.container),"number"==typeof t.delay&&(t.delay={show:t.delay,hide:t.delay}),"number"==typeof t.title&&(t.title=t.title.toString()),"number"==typeof t.content&&(t.content=t.content.toString()),t}_getDelegateConfig(){const t={};for(const[e,i]of Object.entries(this._config))this.constructor.Default[e]!==i&&(t[e]=i);return t.selector=!1,t.trigger="manual",t}_disposePopper(){this._popper&&(this._popper.destroy(),this._popper=null),this.tip&&(this.tip.remove(),this.tip=null)}static jQueryInterface(t){return this.each((function(){const e=cs.getOrCreateInstance(this,t);if("string"==typeof t){if(void 0===e[t])throw new TypeError(`No method named "${t}"`);e[t]()}}))}}m(cs);const hs={...cs.Default,content:"",offset:[0,8],placement:"right",template:'',trigger:"click"},ds={...cs.DefaultType,content:"(null|string|element|function)"};class us extends cs{static get Default(){return hs}static get DefaultType(){return ds}static get NAME(){return"popover"}_isWithContent(){return this._getTitle()||this._getContent()}_getContentForTemplate(){return{".popover-header":this._getTitle(),".popover-body":this._getContent()}}_getContent(){return this._resolvePossibleFunction(this._config.content)}static jQueryInterface(t){return this.each((function(){const e=us.getOrCreateInstance(this,t);if("string"==typeof t){if(void 0===e[t])throw new TypeError(`No method named "${t}"`);e[t]()}}))}}m(us);const fs=".bs.scrollspy",ps=`activate${fs}`,ms=`click${fs}`,gs=`load${fs}.data-api`,_s="active",bs="[href]",vs=".nav-link",ys=`${vs}, .nav-item > ${vs}, .list-group-item`,ws={offset:null,rootMargin:"0px 0px -25%",smoothScroll:!1,target:null,threshold:[.1,.5,1]},As={offset:"(number|null)",rootMargin:"string",smoothScroll:"boolean",target:"element",threshold:"array"};class Es extends W{constructor(t,e){super(t,e),this._targetLinks=new Map,this._observableSections=new Map,this._rootElement="visible"===getComputedStyle(this._element).overflowY?null:this._element,this._activeTarget=null,this._observer=null,this._previousScrollData={visibleEntryTop:0,parentScrollTop:0},this.refresh()}static get Default(){return ws}static get DefaultType(){return As}static get NAME(){return"scrollspy"}refresh(){this._initializeTargetsAndObservables(),this._maybeEnableSmoothScroll(),this._observer?this._observer.disconnect():this._observer=this._getNewObserver();for(const t of this._observableSections.values())this._observer.observe(t)}dispose(){this._observer.disconnect(),super.dispose()}_configAfterMerge(t){return t.target=r(t.target)||document.body,t.rootMargin=t.offset?`${t.offset}px 0px -30%`:t.rootMargin,"string"==typeof t.threshold&&(t.threshold=t.threshold.split(",").map((t=>Number.parseFloat(t)))),t}_maybeEnableSmoothScroll(){this._config.smoothScroll&&(N.off(this._config.target,ms),N.on(this._config.target,ms,bs,(t=>{const e=this._observableSections.get(t.target.hash);if(e){t.preventDefault();const i=this._rootElement||window,n=e.offsetTop-this._element.offsetTop;if(i.scrollTo)return void i.scrollTo({top:n,behavior:"smooth"});i.scrollTop=n}})))}_getNewObserver(){const t={root:this._rootElement,threshold:this._config.threshold,rootMargin:this._config.rootMargin};return new IntersectionObserver((t=>this._observerCallback(t)),t)}_observerCallback(t){const e=t=>this._targetLinks.get(`#${t.target.id}`),i=t=>{this._previousScrollData.visibleEntryTop=t.target.offsetTop,this._process(e(t))},n=(this._rootElement||document.documentElement).scrollTop,s=n>=this._previousScrollData.parentScrollTop;this._previousScrollData.parentScrollTop=n;for(const o of t){if(!o.isIntersecting){this._activeTarget=null,this._clearActiveClass(e(o));continue}const t=o.target.offsetTop>=this._previousScrollData.visibleEntryTop;if(s&&t){if(i(o),!n)return}else s||t||i(o)}}_initializeTargetsAndObservables(){this._targetLinks=new Map,this._observableSections=new Map;const t=z.find(bs,this._config.target);for(const e of t){if(!e.hash||l(e))continue;const t=z.findOne(decodeURI(e.hash),this._element);a(t)&&(this._targetLinks.set(decodeURI(e.hash),e),this._observableSections.set(e.hash,t))}}_process(t){this._activeTarget!==t&&(this._clearActiveClass(this._config.target),this._activeTarget=t,t.classList.add(_s),this._activateParents(t),N.trigger(this._element,ps,{relatedTarget:t}))}_activateParents(t){if(t.classList.contains("dropdown-item"))z.findOne(".dropdown-toggle",t.closest(".dropdown")).classList.add(_s);else for(const e of z.parents(t,".nav, .list-group"))for(const t of z.prev(e,ys))t.classList.add(_s)}_clearActiveClass(t){t.classList.remove(_s);const e=z.find(`${bs}.${_s}`,t);for(const t of e)t.classList.remove(_s)}static jQueryInterface(t){return this.each((function(){const e=Es.getOrCreateInstance(this,t);if("string"==typeof t){if(void 0===e[t]||t.startsWith("_")||"constructor"===t)throw new TypeError(`No method named "${t}"`);e[t]()}}))}}N.on(window,gs,(()=>{for(const t of z.find('[data-bs-spy="scroll"]'))Es.getOrCreateInstance(t)})),m(Es);const Ts=".bs.tab",Cs=`hide${Ts}`,Os=`hidden${Ts}`,xs=`show${Ts}`,ks=`shown${Ts}`,Ls=`click${Ts}`,Ss=`keydown${Ts}`,Ds=`load${Ts}`,$s="ArrowLeft",Is="ArrowRight",Ns="ArrowUp",Ps="ArrowDown",Ms="Home",js="End",Fs="active",Hs="fade",Ws="show",Bs=":not(.dropdown-toggle)",zs='[data-bs-toggle="tab"], [data-bs-toggle="pill"], [data-bs-toggle="list"]',Rs=`.nav-link${Bs}, .list-group-item${Bs}, [role="tab"]${Bs}, ${zs}`,qs=`.${Fs}[data-bs-toggle="tab"], .${Fs}[data-bs-toggle="pill"], .${Fs}[data-bs-toggle="list"]`;class Vs extends W{constructor(t){super(t),this._parent=this._element.closest('.list-group, .nav, [role="tablist"]'),this._parent&&(this._setInitialAttributes(this._parent,this._getChildren()),N.on(this._element,Ss,(t=>this._keydown(t))))}static get NAME(){return"tab"}show(){const t=this._element;if(this._elemIsActive(t))return;const e=this._getActiveElem(),i=e?N.trigger(e,Cs,{relatedTarget:t}):null;N.trigger(t,xs,{relatedTarget:e}).defaultPrevented||i&&i.defaultPrevented||(this._deactivate(e,t),this._activate(t,e))}_activate(t,e){t&&(t.classList.add(Fs),this._activate(z.getElementFromSelector(t)),this._queueCallback((()=>{"tab"===t.getAttribute("role")?(t.removeAttribute("tabindex"),t.setAttribute("aria-selected",!0),this._toggleDropDown(t,!0),N.trigger(t,ks,{relatedTarget:e})):t.classList.add(Ws)}),t,t.classList.contains(Hs)))}_deactivate(t,e){t&&(t.classList.remove(Fs),t.blur(),this._deactivate(z.getElementFromSelector(t)),this._queueCallback((()=>{"tab"===t.getAttribute("role")?(t.setAttribute("aria-selected",!1),t.setAttribute("tabindex","-1"),this._toggleDropDown(t,!1),N.trigger(t,Os,{relatedTarget:e})):t.classList.remove(Ws)}),t,t.classList.contains(Hs)))}_keydown(t){if(![$s,Is,Ns,Ps,Ms,js].includes(t.key))return;t.stopPropagation(),t.preventDefault();const e=this._getChildren().filter((t=>!l(t)));let i;if([Ms,js].includes(t.key))i=e[t.key===Ms?0:e.length-1];else{const n=[Is,Ps].includes(t.key);i=b(e,t.target,n,!0)}i&&(i.focus({preventScroll:!0}),Vs.getOrCreateInstance(i).show())}_getChildren(){return z.find(Rs,this._parent)}_getActiveElem(){return this._getChildren().find((t=>this._elemIsActive(t)))||null}_setInitialAttributes(t,e){this._setAttributeIfNotExists(t,"role","tablist");for(const t of e)this._setInitialAttributesOnChild(t)}_setInitialAttributesOnChild(t){t=this._getInnerElement(t);const e=this._elemIsActive(t),i=this._getOuterElement(t);t.setAttribute("aria-selected",e),i!==t&&this._setAttributeIfNotExists(i,"role","presentation"),e||t.setAttribute("tabindex","-1"),this._setAttributeIfNotExists(t,"role","tab"),this._setInitialAttributesOnTargetPanel(t)}_setInitialAttributesOnTargetPanel(t){const e=z.getElementFromSelector(t);e&&(this._setAttributeIfNotExists(e,"role","tabpanel"),t.id&&this._setAttributeIfNotExists(e,"aria-labelledby",`${t.id}`))}_toggleDropDown(t,e){const i=this._getOuterElement(t);if(!i.classList.contains("dropdown"))return;const n=(t,n)=>{const s=z.findOne(t,i);s&&s.classList.toggle(n,e)};n(".dropdown-toggle",Fs),n(".dropdown-menu",Ws),i.setAttribute("aria-expanded",e)}_setAttributeIfNotExists(t,e,i){t.hasAttribute(e)||t.setAttribute(e,i)}_elemIsActive(t){return t.classList.contains(Fs)}_getInnerElement(t){return t.matches(Rs)?t:z.findOne(Rs,t)}_getOuterElement(t){return t.closest(".nav-item, .list-group-item")||t}static jQueryInterface(t){return this.each((function(){const e=Vs.getOrCreateInstance(this);if("string"==typeof t){if(void 0===e[t]||t.startsWith("_")||"constructor"===t)throw new TypeError(`No method named "${t}"`);e[t]()}}))}}N.on(document,Ls,zs,(function(t){["A","AREA"].includes(this.tagName)&&t.preventDefault(),l(this)||Vs.getOrCreateInstance(this).show()})),N.on(window,Ds,(()=>{for(const t of z.find(qs))Vs.getOrCreateInstance(t)})),m(Vs);const Ks=".bs.toast",Qs=`mouseover${Ks}`,Xs=`mouseout${Ks}`,Ys=`focusin${Ks}`,Us=`focusout${Ks}`,Gs=`hide${Ks}`,Js=`hidden${Ks}`,Zs=`show${Ks}`,to=`shown${Ks}`,eo="hide",io="show",no="showing",so={animation:"boolean",autohide:"boolean",delay:"number"},oo={animation:!0,autohide:!0,delay:5e3};class ro extends W{constructor(t,e){super(t,e),this._timeout=null,this._hasMouseInteraction=!1,this._hasKeyboardInteraction=!1,this._setListeners()}static get Default(){return oo}static get DefaultType(){return so}static get NAME(){return"toast"}show(){N.trigger(this._element,Zs).defaultPrevented||(this._clearTimeout(),this._config.animation&&this._element.classList.add("fade"),this._element.classList.remove(eo),d(this._element),this._element.classList.add(io,no),this._queueCallback((()=>{this._element.classList.remove(no),N.trigger(this._element,to),this._maybeScheduleHide()}),this._element,this._config.animation))}hide(){this.isShown()&&(N.trigger(this._element,Gs).defaultPrevented||(this._element.classList.add(no),this._queueCallback((()=>{this._element.classList.add(eo),this._element.classList.remove(no,io),N.trigger(this._element,Js)}),this._element,this._config.animation)))}dispose(){this._clearTimeout(),this.isShown()&&this._element.classList.remove(io),super.dispose()}isShown(){return this._element.classList.contains(io)}_maybeScheduleHide(){this._config.autohide&&(this._hasMouseInteraction||this._hasKeyboardInteraction||(this._timeout=setTimeout((()=>{this.hide()}),this._config.delay)))}_onInteraction(t,e){switch(t.type){case"mouseover":case"mouseout":this._hasMouseInteraction=e;break;case"focusin":case"focusout":this._hasKeyboardInteraction=e}if(e)return void this._clearTimeout();const i=t.relatedTarget;this._element===i||this._element.contains(i)||this._maybeScheduleHide()}_setListeners(){N.on(this._element,Qs,(t=>this._onInteraction(t,!0))),N.on(this._element,Xs,(t=>this._onInteraction(t,!1))),N.on(this._element,Ys,(t=>this._onInteraction(t,!0))),N.on(this._element,Us,(t=>this._onInteraction(t,!1)))}_clearTimeout(){clearTimeout(this._timeout),this._timeout=null}static jQueryInterface(t){return this.each((function(){const e=ro.getOrCreateInstance(this,t);if("string"==typeof t){if(void 0===e[t])throw new TypeError(`No method named "${t}"`);e[t](this)}}))}}return R(ro),m(ro),{Alert:Q,Button:Y,Carousel:xt,Collapse:Bt,Dropdown:qi,Modal:On,Offcanvas:qn,Popover:us,ScrollSpy:Es,Tab:Vs,Toast:ro,Tooltip:cs}})); +//# sourceMappingURL=bootstrap.bundle.min.js.map \ No newline at end of file diff --git a/docs/otb_subbasin_loads_files/libs/clipboard/clipboard.min.js b/docs/otb_subbasin_loads_files/libs/clipboard/clipboard.min.js new file mode 100644 index 0000000..1103f81 --- /dev/null +++ b/docs/otb_subbasin_loads_files/libs/clipboard/clipboard.min.js @@ -0,0 +1,7 @@ +/*! + * clipboard.js v2.0.11 + * https://clipboardjs.com/ + * + * Licensed MIT © Zeno Rocha + */ +!function(t,e){"object"==typeof exports&&"object"==typeof module?module.exports=e():"function"==typeof define&&define.amd?define([],e):"object"==typeof exports?exports.ClipboardJS=e():t.ClipboardJS=e()}(this,function(){return n={686:function(t,e,n){"use strict";n.d(e,{default:function(){return b}});var e=n(279),i=n.n(e),e=n(370),u=n.n(e),e=n(817),r=n.n(e);function c(t){try{return document.execCommand(t)}catch(t){return}}var a=function(t){t=r()(t);return c("cut"),t};function o(t,e){var n,o,t=(n=t,o="rtl"===document.documentElement.getAttribute("dir"),(t=document.createElement("textarea")).style.fontSize="12pt",t.style.border="0",t.style.padding="0",t.style.margin="0",t.style.position="absolute",t.style[o?"right":"left"]="-9999px",o=window.pageYOffset||document.documentElement.scrollTop,t.style.top="".concat(o,"px"),t.setAttribute("readonly",""),t.value=n,t);return e.container.appendChild(t),e=r()(t),c("copy"),t.remove(),e}var f=function(t){var e=1 .html-fill-item { + /* Fill items can grow and shrink freely within + available vertical space in fillable container */ + flex: 1 1 auto; + min-height: 0; + min-width: 0; + } + .html-fill-container > :not(.html-fill-item) { + /* Prevent shrinking or growing of non-fill items */ + flex: 0 0 auto; + } +} diff --git a/docs/otb_subbasin_loads_files/libs/htmlwidgets-1.6.4/htmlwidgets.js b/docs/otb_subbasin_loads_files/libs/htmlwidgets-1.6.4/htmlwidgets.js new file mode 100644 index 0000000..1067d02 --- /dev/null +++ b/docs/otb_subbasin_loads_files/libs/htmlwidgets-1.6.4/htmlwidgets.js @@ -0,0 +1,901 @@ +(function() { + // If window.HTMLWidgets is already defined, then use it; otherwise create a + // new object. This allows preceding code to set options that affect the + // initialization process (though none currently exist). + window.HTMLWidgets = window.HTMLWidgets || {}; + + // See if we're running in a viewer pane. If not, we're in a web browser. + var viewerMode = window.HTMLWidgets.viewerMode = + /\bviewer_pane=1\b/.test(window.location); + + // See if we're running in Shiny mode. If not, it's a static document. + // Note that static widgets can appear in both Shiny and static modes, but + // obviously, Shiny widgets can only appear in Shiny apps/documents. + var shinyMode = window.HTMLWidgets.shinyMode = + typeof(window.Shiny) !== "undefined" && !!window.Shiny.outputBindings; + + // We can't count on jQuery being available, so we implement our own + // version if necessary. + function querySelectorAll(scope, selector) { + if (typeof(jQuery) !== "undefined" && scope instanceof jQuery) { + return scope.find(selector); + } + if (scope.querySelectorAll) { + return scope.querySelectorAll(selector); + } + } + + function asArray(value) { + if (value === null) + return []; + if ($.isArray(value)) + return value; + return [value]; + } + + // Implement jQuery's extend + function extend(target /*, ... */) { + if (arguments.length == 1) { + return target; + } + for (var i = 1; i < arguments.length; i++) { + var source = arguments[i]; + for (var prop in source) { + if (source.hasOwnProperty(prop)) { + target[prop] = source[prop]; + } + } + } + return target; + } + + // IE8 doesn't support Array.forEach. + function forEach(values, callback, thisArg) { + if (values.forEach) { + values.forEach(callback, thisArg); + } else { + for (var i = 0; i < values.length; i++) { + callback.call(thisArg, values[i], i, values); + } + } + } + + // Replaces the specified method with the return value of funcSource. + // + // Note that funcSource should not BE the new method, it should be a function + // that RETURNS the new method. funcSource receives a single argument that is + // the overridden method, it can be called from the new method. The overridden + // method can be called like a regular function, it has the target permanently + // bound to it so "this" will work correctly. + function overrideMethod(target, methodName, funcSource) { + var superFunc = target[methodName] || function() {}; + var superFuncBound = function() { + return superFunc.apply(target, arguments); + }; + target[methodName] = funcSource(superFuncBound); + } + + // Add a method to delegator that, when invoked, calls + // delegatee.methodName. If there is no such method on + // the delegatee, but there was one on delegator before + // delegateMethod was called, then the original version + // is invoked instead. + // For example: + // + // var a = { + // method1: function() { console.log('a1'); } + // method2: function() { console.log('a2'); } + // }; + // var b = { + // method1: function() { console.log('b1'); } + // }; + // delegateMethod(a, b, "method1"); + // delegateMethod(a, b, "method2"); + // a.method1(); + // a.method2(); + // + // The output would be "b1", "a2". + function delegateMethod(delegator, delegatee, methodName) { + var inherited = delegator[methodName]; + delegator[methodName] = function() { + var target = delegatee; + var method = delegatee[methodName]; + + // The method doesn't exist on the delegatee. Instead, + // call the method on the delegator, if it exists. + if (!method) { + target = delegator; + method = inherited; + } + + if (method) { + return method.apply(target, arguments); + } + }; + } + + // Implement a vague facsimilie of jQuery's data method + function elementData(el, name, value) { + if (arguments.length == 2) { + return el["htmlwidget_data_" + name]; + } else if (arguments.length == 3) { + el["htmlwidget_data_" + name] = value; + return el; + } else { + throw new Error("Wrong number of arguments for elementData: " + + arguments.length); + } + } + + // http://stackoverflow.com/questions/3446170/escape-string-for-use-in-javascript-regex + function escapeRegExp(str) { + return str.replace(/[\-\[\]\/\{\}\(\)\*\+\?\.\\\^\$\|]/g, "\\$&"); + } + + function hasClass(el, className) { + var re = new RegExp("\\b" + escapeRegExp(className) + "\\b"); + return re.test(el.className); + } + + // elements - array (or array-like object) of HTML elements + // className - class name to test for + // include - if true, only return elements with given className; + // if false, only return elements *without* given className + function filterByClass(elements, className, include) { + var results = []; + for (var i = 0; i < elements.length; i++) { + if (hasClass(elements[i], className) == include) + results.push(elements[i]); + } + return results; + } + + function on(obj, eventName, func) { + if (obj.addEventListener) { + obj.addEventListener(eventName, func, false); + } else if (obj.attachEvent) { + obj.attachEvent(eventName, func); + } + } + + function off(obj, eventName, func) { + if (obj.removeEventListener) + obj.removeEventListener(eventName, func, false); + else if (obj.detachEvent) { + obj.detachEvent(eventName, func); + } + } + + // Translate array of values to top/right/bottom/left, as usual with + // the "padding" CSS property + // https://developer.mozilla.org/en-US/docs/Web/CSS/padding + function unpackPadding(value) { + if (typeof(value) === "number") + value = [value]; + if (value.length === 1) { + return {top: value[0], right: value[0], bottom: value[0], left: value[0]}; + } + if (value.length === 2) { + return {top: value[0], right: value[1], bottom: value[0], left: value[1]}; + } + if (value.length === 3) { + return {top: value[0], right: value[1], bottom: value[2], left: value[1]}; + } + if (value.length === 4) { + return {top: value[0], right: value[1], bottom: value[2], left: value[3]}; + } + } + + // Convert an unpacked padding object to a CSS value + function paddingToCss(paddingObj) { + return paddingObj.top + "px " + paddingObj.right + "px " + paddingObj.bottom + "px " + paddingObj.left + "px"; + } + + // Makes a number suitable for CSS + function px(x) { + if (typeof(x) === "number") + return x + "px"; + else + return x; + } + + // Retrieves runtime widget sizing information for an element. + // The return value is either null, or an object with fill, padding, + // defaultWidth, defaultHeight fields. + function sizingPolicy(el) { + var sizingEl = document.querySelector("script[data-for='" + el.id + "'][type='application/htmlwidget-sizing']"); + if (!sizingEl) + return null; + var sp = JSON.parse(sizingEl.textContent || sizingEl.text || "{}"); + if (viewerMode) { + return sp.viewer; + } else { + return sp.browser; + } + } + + // @param tasks Array of strings (or falsy value, in which case no-op). + // Each element must be a valid JavaScript expression that yields a + // function. Or, can be an array of objects with "code" and "data" + // properties; in this case, the "code" property should be a string + // of JS that's an expr that yields a function, and "data" should be + // an object that will be added as an additional argument when that + // function is called. + // @param target The object that will be "this" for each function + // execution. + // @param args Array of arguments to be passed to the functions. (The + // same arguments will be passed to all functions.) + function evalAndRun(tasks, target, args) { + if (tasks) { + forEach(tasks, function(task) { + var theseArgs = args; + if (typeof(task) === "object") { + theseArgs = theseArgs.concat([task.data]); + task = task.code; + } + var taskFunc = tryEval(task); + if (typeof(taskFunc) !== "function") { + throw new Error("Task must be a function! Source:\n" + task); + } + taskFunc.apply(target, theseArgs); + }); + } + } + + // Attempt eval() both with and without enclosing in parentheses. + // Note that enclosing coerces a function declaration into + // an expression that eval() can parse + // (otherwise, a SyntaxError is thrown) + function tryEval(code) { + var result = null; + try { + result = eval("(" + code + ")"); + } catch(error) { + if (!(error instanceof SyntaxError)) { + throw error; + } + try { + result = eval(code); + } catch(e) { + if (e instanceof SyntaxError) { + throw error; + } else { + throw e; + } + } + } + return result; + } + + function initSizing(el) { + var sizing = sizingPolicy(el); + if (!sizing) + return; + + var cel = document.getElementById("htmlwidget_container"); + if (!cel) + return; + + if (typeof(sizing.padding) !== "undefined") { + document.body.style.margin = "0"; + document.body.style.padding = paddingToCss(unpackPadding(sizing.padding)); + } + + if (sizing.fill) { + document.body.style.overflow = "hidden"; + document.body.style.width = "100%"; + document.body.style.height = "100%"; + document.documentElement.style.width = "100%"; + document.documentElement.style.height = "100%"; + cel.style.position = "absolute"; + var pad = unpackPadding(sizing.padding); + cel.style.top = pad.top + "px"; + cel.style.right = pad.right + "px"; + cel.style.bottom = pad.bottom + "px"; + cel.style.left = pad.left + "px"; + el.style.width = "100%"; + el.style.height = "100%"; + + return { + getWidth: function() { return cel.getBoundingClientRect().width; }, + getHeight: function() { return cel.getBoundingClientRect().height; } + }; + + } else { + el.style.width = px(sizing.width); + el.style.height = px(sizing.height); + + return { + getWidth: function() { return cel.getBoundingClientRect().width; }, + getHeight: function() { return cel.getBoundingClientRect().height; } + }; + } + } + + // Default implementations for methods + var defaults = { + find: function(scope) { + return querySelectorAll(scope, "." + this.name); + }, + renderError: function(el, err) { + var $el = $(el); + + this.clearError(el); + + // Add all these error classes, as Shiny does + var errClass = "shiny-output-error"; + if (err.type !== null) { + // use the classes of the error condition as CSS class names + errClass = errClass + " " + $.map(asArray(err.type), function(type) { + return errClass + "-" + type; + }).join(" "); + } + errClass = errClass + " htmlwidgets-error"; + + // Is el inline or block? If inline or inline-block, just display:none it + // and add an inline error. + var display = $el.css("display"); + $el.data("restore-display-mode", display); + + if (display === "inline" || display === "inline-block") { + $el.hide(); + if (err.message !== "") { + var errorSpan = $("").addClass(errClass); + errorSpan.text(err.message); + $el.after(errorSpan); + } + } else if (display === "block") { + // If block, add an error just after the el, set visibility:none on the + // el, and position the error to be on top of the el. + // Mark it with a unique ID and CSS class so we can remove it later. + $el.css("visibility", "hidden"); + if (err.message !== "") { + var errorDiv = $("
").addClass(errClass).css("position", "absolute") + .css("top", el.offsetTop) + .css("left", el.offsetLeft) + // setting width can push out the page size, forcing otherwise + // unnecessary scrollbars to appear and making it impossible for + // the element to shrink; so use max-width instead + .css("maxWidth", el.offsetWidth) + .css("height", el.offsetHeight); + errorDiv.text(err.message); + $el.after(errorDiv); + + // Really dumb way to keep the size/position of the error in sync with + // the parent element as the window is resized or whatever. + var intId = setInterval(function() { + if (!errorDiv[0].parentElement) { + clearInterval(intId); + return; + } + errorDiv + .css("top", el.offsetTop) + .css("left", el.offsetLeft) + .css("maxWidth", el.offsetWidth) + .css("height", el.offsetHeight); + }, 500); + } + } + }, + clearError: function(el) { + var $el = $(el); + var display = $el.data("restore-display-mode"); + $el.data("restore-display-mode", null); + + if (display === "inline" || display === "inline-block") { + if (display) + $el.css("display", display); + $(el.nextSibling).filter(".htmlwidgets-error").remove(); + } else if (display === "block"){ + $el.css("visibility", "inherit"); + $(el.nextSibling).filter(".htmlwidgets-error").remove(); + } + }, + sizing: {} + }; + + // Called by widget bindings to register a new type of widget. The definition + // object can contain the following properties: + // - name (required) - A string indicating the binding name, which will be + // used by default as the CSS classname to look for. + // - initialize (optional) - A function(el) that will be called once per + // widget element; if a value is returned, it will be passed as the third + // value to renderValue. + // - renderValue (required) - A function(el, data, initValue) that will be + // called with data. Static contexts will cause this to be called once per + // element; Shiny apps will cause this to be called multiple times per + // element, as the data changes. + window.HTMLWidgets.widget = function(definition) { + if (!definition.name) { + throw new Error("Widget must have a name"); + } + if (!definition.type) { + throw new Error("Widget must have a type"); + } + // Currently we only support output widgets + if (definition.type !== "output") { + throw new Error("Unrecognized widget type '" + definition.type + "'"); + } + // TODO: Verify that .name is a valid CSS classname + + // Support new-style instance-bound definitions. Old-style class-bound + // definitions have one widget "object" per widget per type/class of + // widget; the renderValue and resize methods on such widget objects + // take el and instance arguments, because the widget object can't + // store them. New-style instance-bound definitions have one widget + // object per widget instance; the definition that's passed in doesn't + // provide renderValue or resize methods at all, just the single method + // factory(el, width, height) + // which returns an object that has renderValue(x) and resize(w, h). + // This enables a far more natural programming style for the widget + // author, who can store per-instance state using either OO-style + // instance fields or functional-style closure variables (I guess this + // is in contrast to what can only be called C-style pseudo-OO which is + // what we required before). + if (definition.factory) { + definition = createLegacyDefinitionAdapter(definition); + } + + if (!definition.renderValue) { + throw new Error("Widget must have a renderValue function"); + } + + // For static rendering (non-Shiny), use a simple widget registration + // scheme. We also use this scheme for Shiny apps/documents that also + // contain static widgets. + window.HTMLWidgets.widgets = window.HTMLWidgets.widgets || []; + // Merge defaults into the definition; don't mutate the original definition. + var staticBinding = extend({}, defaults, definition); + overrideMethod(staticBinding, "find", function(superfunc) { + return function(scope) { + var results = superfunc(scope); + // Filter out Shiny outputs, we only want the static kind + return filterByClass(results, "html-widget-output", false); + }; + }); + window.HTMLWidgets.widgets.push(staticBinding); + + if (shinyMode) { + // Shiny is running. Register the definition with an output binding. + // The definition itself will not be the output binding, instead + // we will make an output binding object that delegates to the + // definition. This is because we foolishly used the same method + // name (renderValue) for htmlwidgets definition and Shiny bindings + // but they actually have quite different semantics (the Shiny + // bindings receive data that includes lots of metadata that it + // strips off before calling htmlwidgets renderValue). We can't + // just ignore the difference because in some widgets it's helpful + // to call this.renderValue() from inside of resize(), and if + // we're not delegating, then that call will go to the Shiny + // version instead of the htmlwidgets version. + + // Merge defaults with definition, without mutating either. + var bindingDef = extend({}, defaults, definition); + + // This object will be our actual Shiny binding. + var shinyBinding = new Shiny.OutputBinding(); + + // With a few exceptions, we'll want to simply use the bindingDef's + // version of methods if they are available, otherwise fall back to + // Shiny's defaults. NOTE: If Shiny's output bindings gain additional + // methods in the future, and we want them to be overrideable by + // HTMLWidget binding definitions, then we'll need to add them to this + // list. + delegateMethod(shinyBinding, bindingDef, "getId"); + delegateMethod(shinyBinding, bindingDef, "onValueChange"); + delegateMethod(shinyBinding, bindingDef, "onValueError"); + delegateMethod(shinyBinding, bindingDef, "renderError"); + delegateMethod(shinyBinding, bindingDef, "clearError"); + delegateMethod(shinyBinding, bindingDef, "showProgress"); + + // The find, renderValue, and resize are handled differently, because we + // want to actually decorate the behavior of the bindingDef methods. + + shinyBinding.find = function(scope) { + var results = bindingDef.find(scope); + + // Only return elements that are Shiny outputs, not static ones + var dynamicResults = results.filter(".html-widget-output"); + + // It's possible that whatever caused Shiny to think there might be + // new dynamic outputs, also caused there to be new static outputs. + // Since there might be lots of different htmlwidgets bindings, we + // schedule execution for later--no need to staticRender multiple + // times. + if (results.length !== dynamicResults.length) + scheduleStaticRender(); + + return dynamicResults; + }; + + // Wrap renderValue to handle initialization, which unfortunately isn't + // supported natively by Shiny at the time of this writing. + + shinyBinding.renderValue = function(el, data) { + Shiny.renderDependencies(data.deps); + // Resolve strings marked as javascript literals to objects + if (!(data.evals instanceof Array)) data.evals = [data.evals]; + for (var i = 0; data.evals && i < data.evals.length; i++) { + window.HTMLWidgets.evaluateStringMember(data.x, data.evals[i]); + } + if (!bindingDef.renderOnNullValue) { + if (data.x === null) { + el.style.visibility = "hidden"; + return; + } else { + el.style.visibility = "inherit"; + } + } + if (!elementData(el, "initialized")) { + initSizing(el); + + elementData(el, "initialized", true); + if (bindingDef.initialize) { + var rect = el.getBoundingClientRect(); + var result = bindingDef.initialize(el, rect.width, rect.height); + elementData(el, "init_result", result); + } + } + bindingDef.renderValue(el, data.x, elementData(el, "init_result")); + evalAndRun(data.jsHooks.render, elementData(el, "init_result"), [el, data.x]); + }; + + // Only override resize if bindingDef implements it + if (bindingDef.resize) { + shinyBinding.resize = function(el, width, height) { + // Shiny can call resize before initialize/renderValue have been + // called, which doesn't make sense for widgets. + if (elementData(el, "initialized")) { + bindingDef.resize(el, width, height, elementData(el, "init_result")); + } + }; + } + + Shiny.outputBindings.register(shinyBinding, bindingDef.name); + } + }; + + var scheduleStaticRenderTimerId = null; + function scheduleStaticRender() { + if (!scheduleStaticRenderTimerId) { + scheduleStaticRenderTimerId = setTimeout(function() { + scheduleStaticRenderTimerId = null; + window.HTMLWidgets.staticRender(); + }, 1); + } + } + + // Render static widgets after the document finishes loading + // Statically render all elements that are of this widget's class + window.HTMLWidgets.staticRender = function() { + var bindings = window.HTMLWidgets.widgets || []; + forEach(bindings, function(binding) { + var matches = binding.find(document.documentElement); + forEach(matches, function(el) { + var sizeObj = initSizing(el, binding); + + var getSize = function(el) { + if (sizeObj) { + return {w: sizeObj.getWidth(), h: sizeObj.getHeight()} + } else { + var rect = el.getBoundingClientRect(); + return {w: rect.width, h: rect.height} + } + }; + + if (hasClass(el, "html-widget-static-bound")) + return; + el.className = el.className + " html-widget-static-bound"; + + var initResult; + if (binding.initialize) { + var size = getSize(el); + initResult = binding.initialize(el, size.w, size.h); + elementData(el, "init_result", initResult); + } + + if (binding.resize) { + var lastSize = getSize(el); + var resizeHandler = function(e) { + var size = getSize(el); + if (size.w === 0 && size.h === 0) + return; + if (size.w === lastSize.w && size.h === lastSize.h) + return; + lastSize = size; + binding.resize(el, size.w, size.h, initResult); + }; + + on(window, "resize", resizeHandler); + + // This is needed for cases where we're running in a Shiny + // app, but the widget itself is not a Shiny output, but + // rather a simple static widget. One example of this is + // an rmarkdown document that has runtime:shiny and widget + // that isn't in a render function. Shiny only knows to + // call resize handlers for Shiny outputs, not for static + // widgets, so we do it ourselves. + if (window.jQuery) { + window.jQuery(document).on( + "shown.htmlwidgets shown.bs.tab.htmlwidgets shown.bs.collapse.htmlwidgets", + resizeHandler + ); + window.jQuery(document).on( + "hidden.htmlwidgets hidden.bs.tab.htmlwidgets hidden.bs.collapse.htmlwidgets", + resizeHandler + ); + } + + // This is needed for the specific case of ioslides, which + // flips slides between display:none and display:block. + // Ideally we would not have to have ioslide-specific code + // here, but rather have ioslides raise a generic event, + // but the rmarkdown package just went to CRAN so the + // window to getting that fixed may be long. + if (window.addEventListener) { + // It's OK to limit this to window.addEventListener + // browsers because ioslides itself only supports + // such browsers. + on(document, "slideenter", resizeHandler); + on(document, "slideleave", resizeHandler); + } + } + + var scriptData = document.querySelector("script[data-for='" + el.id + "'][type='application/json']"); + if (scriptData) { + var data = JSON.parse(scriptData.textContent || scriptData.text); + // Resolve strings marked as javascript literals to objects + if (!(data.evals instanceof Array)) data.evals = [data.evals]; + for (var k = 0; data.evals && k < data.evals.length; k++) { + window.HTMLWidgets.evaluateStringMember(data.x, data.evals[k]); + } + binding.renderValue(el, data.x, initResult); + evalAndRun(data.jsHooks.render, initResult, [el, data.x]); + } + }); + }); + + invokePostRenderHandlers(); + } + + + function has_jQuery3() { + if (!window.jQuery) { + return false; + } + var $version = window.jQuery.fn.jquery; + var $major_version = parseInt($version.split(".")[0]); + return $major_version >= 3; + } + + /* + / Shiny 1.4 bumped jQuery from 1.x to 3.x which means jQuery's + / on-ready handler (i.e., $(fn)) is now asyncronous (i.e., it now + / really means $(setTimeout(fn)). + / https://jquery.com/upgrade-guide/3.0/#breaking-change-document-ready-handlers-are-now-asynchronous + / + / Since Shiny uses $() to schedule initShiny, shiny>=1.4 calls initShiny + / one tick later than it did before, which means staticRender() is + / called renderValue() earlier than (advanced) widget authors might be expecting. + / https://github.com/rstudio/shiny/issues/2630 + / + / For a concrete example, leaflet has some methods (e.g., updateBounds) + / which reference Shiny methods registered in initShiny (e.g., setInputValue). + / Since leaflet is privy to this life-cycle, it knows to use setTimeout() to + / delay execution of those methods (until Shiny methods are ready) + / https://github.com/rstudio/leaflet/blob/18ec981/javascript/src/index.js#L266-L268 + / + / Ideally widget authors wouldn't need to use this setTimeout() hack that + / leaflet uses to call Shiny methods on a staticRender(). In the long run, + / the logic initShiny should be broken up so that method registration happens + / right away, but binding happens later. + */ + function maybeStaticRenderLater() { + if (shinyMode && has_jQuery3()) { + window.jQuery(window.HTMLWidgets.staticRender); + } else { + window.HTMLWidgets.staticRender(); + } + } + + if (document.addEventListener) { + document.addEventListener("DOMContentLoaded", function() { + document.removeEventListener("DOMContentLoaded", arguments.callee, false); + maybeStaticRenderLater(); + }, false); + } else if (document.attachEvent) { + document.attachEvent("onreadystatechange", function() { + if (document.readyState === "complete") { + document.detachEvent("onreadystatechange", arguments.callee); + maybeStaticRenderLater(); + } + }); + } + + + window.HTMLWidgets.getAttachmentUrl = function(depname, key) { + // If no key, default to the first item + if (typeof(key) === "undefined") + key = 1; + + var link = document.getElementById(depname + "-" + key + "-attachment"); + if (!link) { + throw new Error("Attachment " + depname + "/" + key + " not found in document"); + } + return link.getAttribute("href"); + }; + + window.HTMLWidgets.dataframeToD3 = function(df) { + var names = []; + var length; + for (var name in df) { + if (df.hasOwnProperty(name)) + names.push(name); + if (typeof(df[name]) !== "object" || typeof(df[name].length) === "undefined") { + throw new Error("All fields must be arrays"); + } else if (typeof(length) !== "undefined" && length !== df[name].length) { + throw new Error("All fields must be arrays of the same length"); + } + length = df[name].length; + } + var results = []; + var item; + for (var row = 0; row < length; row++) { + item = {}; + for (var col = 0; col < names.length; col++) { + item[names[col]] = df[names[col]][row]; + } + results.push(item); + } + return results; + }; + + window.HTMLWidgets.transposeArray2D = function(array) { + if (array.length === 0) return array; + var newArray = array[0].map(function(col, i) { + return array.map(function(row) { + return row[i] + }) + }); + return newArray; + }; + // Split value at splitChar, but allow splitChar to be escaped + // using escapeChar. Any other characters escaped by escapeChar + // will be included as usual (including escapeChar itself). + function splitWithEscape(value, splitChar, escapeChar) { + var results = []; + var escapeMode = false; + var currentResult = ""; + for (var pos = 0; pos < value.length; pos++) { + if (!escapeMode) { + if (value[pos] === splitChar) { + results.push(currentResult); + currentResult = ""; + } else if (value[pos] === escapeChar) { + escapeMode = true; + } else { + currentResult += value[pos]; + } + } else { + currentResult += value[pos]; + escapeMode = false; + } + } + if (currentResult !== "") { + results.push(currentResult); + } + return results; + } + // Function authored by Yihui/JJ Allaire + window.HTMLWidgets.evaluateStringMember = function(o, member) { + var parts = splitWithEscape(member, '.', '\\'); + for (var i = 0, l = parts.length; i < l; i++) { + var part = parts[i]; + // part may be a character or 'numeric' member name + if (o !== null && typeof o === "object" && part in o) { + if (i == (l - 1)) { // if we are at the end of the line then evalulate + if (typeof o[part] === "string") + o[part] = tryEval(o[part]); + } else { // otherwise continue to next embedded object + o = o[part]; + } + } + } + }; + + // Retrieve the HTMLWidget instance (i.e. the return value of an + // HTMLWidget binding's initialize() or factory() function) + // associated with an element, or null if none. + window.HTMLWidgets.getInstance = function(el) { + return elementData(el, "init_result"); + }; + + // Finds the first element in the scope that matches the selector, + // and returns the HTMLWidget instance (i.e. the return value of + // an HTMLWidget binding's initialize() or factory() function) + // associated with that element, if any. If no element matches the + // selector, or the first matching element has no HTMLWidget + // instance associated with it, then null is returned. + // + // The scope argument is optional, and defaults to window.document. + window.HTMLWidgets.find = function(scope, selector) { + if (arguments.length == 1) { + selector = scope; + scope = document; + } + + var el = scope.querySelector(selector); + if (el === null) { + return null; + } else { + return window.HTMLWidgets.getInstance(el); + } + }; + + // Finds all elements in the scope that match the selector, and + // returns the HTMLWidget instances (i.e. the return values of + // an HTMLWidget binding's initialize() or factory() function) + // associated with the elements, in an array. If elements that + // match the selector don't have an associated HTMLWidget + // instance, the returned array will contain nulls. + // + // The scope argument is optional, and defaults to window.document. + window.HTMLWidgets.findAll = function(scope, selector) { + if (arguments.length == 1) { + selector = scope; + scope = document; + } + + var nodes = scope.querySelectorAll(selector); + var results = []; + for (var i = 0; i < nodes.length; i++) { + results.push(window.HTMLWidgets.getInstance(nodes[i])); + } + return results; + }; + + var postRenderHandlers = []; + function invokePostRenderHandlers() { + while (postRenderHandlers.length) { + var handler = postRenderHandlers.shift(); + if (handler) { + handler(); + } + } + } + + // Register the given callback function to be invoked after the + // next time static widgets are rendered. + window.HTMLWidgets.addPostRenderHandler = function(callback) { + postRenderHandlers.push(callback); + }; + + // Takes a new-style instance-bound definition, and returns an + // old-style class-bound definition. This saves us from having + // to rewrite all the logic in this file to accomodate both + // types of definitions. + function createLegacyDefinitionAdapter(defn) { + var result = { + name: defn.name, + type: defn.type, + initialize: function(el, width, height) { + return defn.factory(el, width, height); + }, + renderValue: function(el, x, instance) { + return instance.renderValue(x); + }, + resize: function(el, width, height, instance) { + return instance.resize(width, height); + } + }; + + if (defn.find) + result.find = defn.find; + if (defn.renderError) + result.renderError = defn.renderError; + if (defn.clearError) + result.clearError = defn.clearError; + + return result; + } +})(); diff --git a/docs/otb_subbasin_loads_files/libs/jquery-3.6.0/jquery-3.6.0.js b/docs/otb_subbasin_loads_files/libs/jquery-3.6.0/jquery-3.6.0.js new file mode 100644 index 0000000..fc6c299 --- /dev/null +++ b/docs/otb_subbasin_loads_files/libs/jquery-3.6.0/jquery-3.6.0.js @@ -0,0 +1,10881 @@ +/*! + * jQuery JavaScript Library v3.6.0 + * https://jquery.com/ + * + * Includes Sizzle.js + * https://sizzlejs.com/ + * + * Copyright OpenJS Foundation and other contributors + * Released under the MIT license + * https://jquery.org/license + * + * Date: 2021-03-02T17:08Z + */ +( function( global, factory ) { + + "use strict"; + + if ( typeof module === "object" && typeof module.exports === "object" ) { + + // For CommonJS and CommonJS-like environments where a proper `window` + // is present, execute the factory and get jQuery. + // For environments that do not have a `window` with a `document` + // (such as Node.js), expose a factory as module.exports. + // This accentuates the need for the creation of a real `window`. + // e.g. var jQuery = require("jquery")(window); + // See ticket #14549 for more info. + module.exports = global.document ? + factory( global, true ) : + function( w ) { + if ( !w.document ) { + throw new Error( "jQuery requires a window with a document" ); + } + return factory( w ); + }; + } else { + factory( global ); + } + +// Pass this if window is not defined yet +} )( typeof window !== "undefined" ? window : this, function( window, noGlobal ) { + +// Edge <= 12 - 13+, Firefox <=18 - 45+, IE 10 - 11, Safari 5.1 - 9+, iOS 6 - 9.1 +// throw exceptions when non-strict code (e.g., ASP.NET 4.5) accesses strict mode +// arguments.callee.caller (trac-13335). But as of jQuery 3.0 (2016), strict mode should be common +// enough that all such attempts are guarded in a try block. +"use strict"; + +var arr = []; + +var getProto = Object.getPrototypeOf; + +var slice = arr.slice; + +var flat = arr.flat ? function( array ) { + return arr.flat.call( array ); +} : function( array ) { + return arr.concat.apply( [], array ); +}; + + +var push = arr.push; + +var indexOf = arr.indexOf; + +var class2type = {}; + +var toString = class2type.toString; + +var hasOwn = class2type.hasOwnProperty; + +var fnToString = hasOwn.toString; + +var ObjectFunctionString = fnToString.call( Object ); + +var support = {}; + +var isFunction = function isFunction( obj ) { + + // Support: Chrome <=57, Firefox <=52 + // In some browsers, typeof returns "function" for HTML elements + // (i.e., `typeof document.createElement( "object" ) === "function"`). + // We don't want to classify *any* DOM node as a function. + // Support: QtWeb <=3.8.5, WebKit <=534.34, wkhtmltopdf tool <=0.12.5 + // Plus for old WebKit, typeof returns "function" for HTML collections + // (e.g., `typeof document.getElementsByTagName("div") === "function"`). (gh-4756) + return typeof obj === "function" && typeof obj.nodeType !== "number" && + typeof obj.item !== "function"; + }; + + +var isWindow = function isWindow( obj ) { + return obj != null && obj === obj.window; + }; + + +var document = window.document; + + + + var preservedScriptAttributes = { + type: true, + src: true, + nonce: true, + noModule: true + }; + + function DOMEval( code, node, doc ) { + doc = doc || document; + + var i, val, + script = doc.createElement( "script" ); + + script.text = code; + if ( node ) { + for ( i in preservedScriptAttributes ) { + + // Support: Firefox 64+, Edge 18+ + // Some browsers don't support the "nonce" property on scripts. + // On the other hand, just using `getAttribute` is not enough as + // the `nonce` attribute is reset to an empty string whenever it + // becomes browsing-context connected. + // See https://github.com/whatwg/html/issues/2369 + // See https://html.spec.whatwg.org/#nonce-attributes + // The `node.getAttribute` check was added for the sake of + // `jQuery.globalEval` so that it can fake a nonce-containing node + // via an object. + val = node[ i ] || node.getAttribute && node.getAttribute( i ); + if ( val ) { + script.setAttribute( i, val ); + } + } + } + doc.head.appendChild( script ).parentNode.removeChild( script ); + } + + +function toType( obj ) { + if ( obj == null ) { + return obj + ""; + } + + // Support: Android <=2.3 only (functionish RegExp) + return typeof obj === "object" || typeof obj === "function" ? + class2type[ toString.call( obj ) ] || "object" : + typeof obj; +} +/* global Symbol */ +// Defining this global in .eslintrc.json would create a danger of using the global +// unguarded in another place, it seems safer to define global only for this module + + + +var + version = "3.6.0", + + // Define a local copy of jQuery + jQuery = function( selector, context ) { + + // The jQuery object is actually just the init constructor 'enhanced' + // Need init if jQuery is called (just allow error to be thrown if not included) + return new jQuery.fn.init( selector, context ); + }; + +jQuery.fn = jQuery.prototype = { + + // The current version of jQuery being used + jquery: version, + + constructor: jQuery, + + // The default length of a jQuery object is 0 + length: 0, + + toArray: function() { + return slice.call( this ); + }, + + // Get the Nth element in the matched element set OR + // Get the whole matched element set as a clean array + get: function( num ) { + + // Return all the elements in a clean array + if ( num == null ) { + return slice.call( this ); + } + + // Return just the one element from the set + return num < 0 ? this[ num + this.length ] : this[ num ]; + }, + + // Take an array of elements and push it onto the stack + // (returning the new matched element set) + pushStack: function( elems ) { + + // Build a new jQuery matched element set + var ret = jQuery.merge( this.constructor(), elems ); + + // Add the old object onto the stack (as a reference) + ret.prevObject = this; + + // Return the newly-formed element set + return ret; + }, + + // Execute a callback for every element in the matched set. + each: function( callback ) { + return jQuery.each( this, callback ); + }, + + map: function( callback ) { + return this.pushStack( jQuery.map( this, function( elem, i ) { + return callback.call( elem, i, elem ); + } ) ); + }, + + slice: function() { + return this.pushStack( slice.apply( this, arguments ) ); + }, + + first: function() { + return this.eq( 0 ); + }, + + last: function() { + return this.eq( -1 ); + }, + + even: function() { + return this.pushStack( jQuery.grep( this, function( _elem, i ) { + return ( i + 1 ) % 2; + } ) ); + }, + + odd: function() { + return this.pushStack( jQuery.grep( this, function( _elem, i ) { + return i % 2; + } ) ); + }, + + eq: function( i ) { + var len = this.length, + j = +i + ( i < 0 ? len : 0 ); + return this.pushStack( j >= 0 && j < len ? [ this[ j ] ] : [] ); + }, + + end: function() { + return this.prevObject || this.constructor(); + }, + + // For internal use only. + // Behaves like an Array's method, not like a jQuery method. + push: push, + sort: arr.sort, + splice: arr.splice +}; + +jQuery.extend = jQuery.fn.extend = function() { + var options, name, src, copy, copyIsArray, clone, + target = arguments[ 0 ] || {}, + i = 1, + length = arguments.length, + deep = false; + + // Handle a deep copy situation + if ( typeof target === "boolean" ) { + deep = target; + + // Skip the boolean and the target + target = arguments[ i ] || {}; + i++; + } + + // Handle case when target is a string or something (possible in deep copy) + if ( typeof target !== "object" && !isFunction( target ) ) { + target = {}; + } + + // Extend jQuery itself if only one argument is passed + if ( i === length ) { + target = this; + i--; + } + + for ( ; i < length; i++ ) { + + // Only deal with non-null/undefined values + if ( ( options = arguments[ i ] ) != null ) { + + // Extend the base object + for ( name in options ) { + copy = options[ name ]; + + // Prevent Object.prototype pollution + // Prevent never-ending loop + if ( name === "__proto__" || target === copy ) { + continue; + } + + // Recurse if we're merging plain objects or arrays + if ( deep && copy && ( jQuery.isPlainObject( copy ) || + ( copyIsArray = Array.isArray( copy ) ) ) ) { + src = target[ name ]; + + // Ensure proper type for the source value + if ( copyIsArray && !Array.isArray( src ) ) { + clone = []; + } else if ( !copyIsArray && !jQuery.isPlainObject( src ) ) { + clone = {}; + } else { + clone = src; + } + copyIsArray = false; + + // Never move original objects, clone them + target[ name ] = jQuery.extend( deep, clone, copy ); + + // Don't bring in undefined values + } else if ( copy !== undefined ) { + target[ name ] = copy; + } + } + } + } + + // Return the modified object + return target; +}; + +jQuery.extend( { + + // Unique for each copy of jQuery on the page + expando: "jQuery" + ( version + Math.random() ).replace( /\D/g, "" ), + + // Assume jQuery is ready without the ready module + isReady: true, + + error: function( msg ) { + throw new Error( msg ); + }, + + noop: function() {}, + + isPlainObject: function( obj ) { + var proto, Ctor; + + // Detect obvious negatives + // Use toString instead of jQuery.type to catch host objects + if ( !obj || toString.call( obj ) !== "[object Object]" ) { + return false; + } + + proto = getProto( obj ); + + // Objects with no prototype (e.g., `Object.create( null )`) are plain + if ( !proto ) { + return true; + } + + // Objects with prototype are plain iff they were constructed by a global Object function + Ctor = hasOwn.call( proto, "constructor" ) && proto.constructor; + return typeof Ctor === "function" && fnToString.call( Ctor ) === ObjectFunctionString; + }, + + isEmptyObject: function( obj ) { + var name; + + for ( name in obj ) { + return false; + } + return true; + }, + + // Evaluates a script in a provided context; falls back to the global one + // if not specified. + globalEval: function( code, options, doc ) { + DOMEval( code, { nonce: options && options.nonce }, doc ); + }, + + each: function( obj, callback ) { + var length, i = 0; + + if ( isArrayLike( obj ) ) { + length = obj.length; + for ( ; i < length; i++ ) { + if ( callback.call( obj[ i ], i, obj[ i ] ) === false ) { + break; + } + } + } else { + for ( i in obj ) { + if ( callback.call( obj[ i ], i, obj[ i ] ) === false ) { + break; + } + } + } + + return obj; + }, + + // results is for internal usage only + makeArray: function( arr, results ) { + var ret = results || []; + + if ( arr != null ) { + if ( isArrayLike( Object( arr ) ) ) { + jQuery.merge( ret, + typeof arr === "string" ? + [ arr ] : arr + ); + } else { + push.call( ret, arr ); + } + } + + return ret; + }, + + inArray: function( elem, arr, i ) { + return arr == null ? -1 : indexOf.call( arr, elem, i ); + }, + + // Support: Android <=4.0 only, PhantomJS 1 only + // push.apply(_, arraylike) throws on ancient WebKit + merge: function( first, second ) { + var len = +second.length, + j = 0, + i = first.length; + + for ( ; j < len; j++ ) { + first[ i++ ] = second[ j ]; + } + + first.length = i; + + return first; + }, + + grep: function( elems, callback, invert ) { + var callbackInverse, + matches = [], + i = 0, + length = elems.length, + callbackExpect = !invert; + + // Go through the array, only saving the items + // that pass the validator function + for ( ; i < length; i++ ) { + callbackInverse = !callback( elems[ i ], i ); + if ( callbackInverse !== callbackExpect ) { + matches.push( elems[ i ] ); + } + } + + return matches; + }, + + // arg is for internal usage only + map: function( elems, callback, arg ) { + var length, value, + i = 0, + ret = []; + + // Go through the array, translating each of the items to their new values + if ( isArrayLike( elems ) ) { + length = elems.length; + for ( ; i < length; i++ ) { + value = callback( elems[ i ], i, arg ); + + if ( value != null ) { + ret.push( value ); + } + } + + // Go through every key on the object, + } else { + for ( i in elems ) { + value = callback( elems[ i ], i, arg ); + + if ( value != null ) { + ret.push( value ); + } + } + } + + // Flatten any nested arrays + return flat( ret ); + }, + + // A global GUID counter for objects + guid: 1, + + // jQuery.support is not used in Core but other projects attach their + // properties to it so it needs to exist. + support: support +} ); + +if ( typeof Symbol === "function" ) { + jQuery.fn[ Symbol.iterator ] = arr[ Symbol.iterator ]; +} + +// Populate the class2type map +jQuery.each( "Boolean Number String Function Array Date RegExp Object Error Symbol".split( " " ), + function( _i, name ) { + class2type[ "[object " + name + "]" ] = name.toLowerCase(); + } ); + +function isArrayLike( obj ) { + + // Support: real iOS 8.2 only (not reproducible in simulator) + // `in` check used to prevent JIT error (gh-2145) + // hasOwn isn't used here due to false negatives + // regarding Nodelist length in IE + var length = !!obj && "length" in obj && obj.length, + type = toType( obj ); + + if ( isFunction( obj ) || isWindow( obj ) ) { + return false; + } + + return type === "array" || length === 0 || + typeof length === "number" && length > 0 && ( length - 1 ) in obj; +} +var Sizzle = +/*! + * Sizzle CSS Selector Engine v2.3.6 + * https://sizzlejs.com/ + * + * Copyright JS Foundation and other contributors + * Released under the MIT license + * https://js.foundation/ + * + * Date: 2021-02-16 + */ +( function( window ) { +var i, + support, + Expr, + getText, + isXML, + tokenize, + compile, + select, + outermostContext, + sortInput, + hasDuplicate, + + // Local document vars + setDocument, + document, + docElem, + documentIsHTML, + rbuggyQSA, + rbuggyMatches, + matches, + contains, + + // Instance-specific data + expando = "sizzle" + 1 * new Date(), + preferredDoc = window.document, + dirruns = 0, + done = 0, + classCache = createCache(), + tokenCache = createCache(), + compilerCache = createCache(), + nonnativeSelectorCache = createCache(), + sortOrder = function( a, b ) { + if ( a === b ) { + hasDuplicate = true; + } + return 0; + }, + + // Instance methods + hasOwn = ( {} ).hasOwnProperty, + arr = [], + pop = arr.pop, + pushNative = arr.push, + push = arr.push, + slice = arr.slice, + + // Use a stripped-down indexOf as it's faster than native + // https://jsperf.com/thor-indexof-vs-for/5 + indexOf = function( list, elem ) { + var i = 0, + len = list.length; + for ( ; i < len; i++ ) { + if ( list[ i ] === elem ) { + return i; + } + } + return -1; + }, + + booleans = "checked|selected|async|autofocus|autoplay|controls|defer|disabled|hidden|" + + "ismap|loop|multiple|open|readonly|required|scoped", + + // Regular expressions + + // http://www.w3.org/TR/css3-selectors/#whitespace + whitespace = "[\\x20\\t\\r\\n\\f]", + + // https://www.w3.org/TR/css-syntax-3/#ident-token-diagram + identifier = "(?:\\\\[\\da-fA-F]{1,6}" + whitespace + + "?|\\\\[^\\r\\n\\f]|[\\w-]|[^\0-\\x7f])+", + + // Attribute selectors: http://www.w3.org/TR/selectors/#attribute-selectors + attributes = "\\[" + whitespace + "*(" + identifier + ")(?:" + whitespace + + + // Operator (capture 2) + "*([*^$|!~]?=)" + whitespace + + + // "Attribute values must be CSS identifiers [capture 5] + // or strings [capture 3 or capture 4]" + "*(?:'((?:\\\\.|[^\\\\'])*)'|\"((?:\\\\.|[^\\\\\"])*)\"|(" + identifier + "))|)" + + whitespace + "*\\]", + + pseudos = ":(" + identifier + ")(?:\\((" + + + // To reduce the number of selectors needing tokenize in the preFilter, prefer arguments: + // 1. quoted (capture 3; capture 4 or capture 5) + "('((?:\\\\.|[^\\\\'])*)'|\"((?:\\\\.|[^\\\\\"])*)\")|" + + + // 2. simple (capture 6) + "((?:\\\\.|[^\\\\()[\\]]|" + attributes + ")*)|" + + + // 3. anything else (capture 2) + ".*" + + ")\\)|)", + + // Leading and non-escaped trailing whitespace, capturing some non-whitespace characters preceding the latter + rwhitespace = new RegExp( whitespace + "+", "g" ), + rtrim = new RegExp( "^" + whitespace + "+|((?:^|[^\\\\])(?:\\\\.)*)" + + whitespace + "+$", "g" ), + + rcomma = new RegExp( "^" + whitespace + "*," + whitespace + "*" ), + rcombinators = new RegExp( "^" + whitespace + "*([>+~]|" + whitespace + ")" + whitespace + + "*" ), + rdescend = new RegExp( whitespace + "|>" ), + + rpseudo = new RegExp( pseudos ), + ridentifier = new RegExp( "^" + identifier + "$" ), + + matchExpr = { + "ID": new RegExp( "^#(" + identifier + ")" ), + "CLASS": new RegExp( "^\\.(" + identifier + ")" ), + "TAG": new RegExp( "^(" + identifier + "|[*])" ), + "ATTR": new RegExp( "^" + attributes ), + "PSEUDO": new RegExp( "^" + pseudos ), + "CHILD": new RegExp( "^:(only|first|last|nth|nth-last)-(child|of-type)(?:\\(" + + whitespace + "*(even|odd|(([+-]|)(\\d*)n|)" + whitespace + "*(?:([+-]|)" + + whitespace + "*(\\d+)|))" + whitespace + "*\\)|)", "i" ), + "bool": new RegExp( "^(?:" + booleans + ")$", "i" ), + + // For use in libraries implementing .is() + // We use this for POS matching in `select` + "needsContext": new RegExp( "^" + whitespace + + "*[>+~]|:(even|odd|eq|gt|lt|nth|first|last)(?:\\(" + whitespace + + "*((?:-\\d)?\\d*)" + whitespace + "*\\)|)(?=[^-]|$)", "i" ) + }, + + rhtml = /HTML$/i, + rinputs = /^(?:input|select|textarea|button)$/i, + rheader = /^h\d$/i, + + rnative = /^[^{]+\{\s*\[native \w/, + + // Easily-parseable/retrievable ID or TAG or CLASS selectors + rquickExpr = /^(?:#([\w-]+)|(\w+)|\.([\w-]+))$/, + + rsibling = /[+~]/, + + // CSS escapes + // http://www.w3.org/TR/CSS21/syndata.html#escaped-characters + runescape = new RegExp( "\\\\[\\da-fA-F]{1,6}" + whitespace + "?|\\\\([^\\r\\n\\f])", "g" ), + funescape = function( escape, nonHex ) { + var high = "0x" + escape.slice( 1 ) - 0x10000; + + return nonHex ? + + // Strip the backslash prefix from a non-hex escape sequence + nonHex : + + // Replace a hexadecimal escape sequence with the encoded Unicode code point + // Support: IE <=11+ + // For values outside the Basic Multilingual Plane (BMP), manually construct a + // surrogate pair + high < 0 ? + String.fromCharCode( high + 0x10000 ) : + String.fromCharCode( high >> 10 | 0xD800, high & 0x3FF | 0xDC00 ); + }, + + // CSS string/identifier serialization + // https://drafts.csswg.org/cssom/#common-serializing-idioms + rcssescape = /([\0-\x1f\x7f]|^-?\d)|^-$|[^\0-\x1f\x7f-\uFFFF\w-]/g, + fcssescape = function( ch, asCodePoint ) { + if ( asCodePoint ) { + + // U+0000 NULL becomes U+FFFD REPLACEMENT CHARACTER + if ( ch === "\0" ) { + return "\uFFFD"; + } + + // Control characters and (dependent upon position) numbers get escaped as code points + return ch.slice( 0, -1 ) + "\\" + + ch.charCodeAt( ch.length - 1 ).toString( 16 ) + " "; + } + + // Other potentially-special ASCII characters get backslash-escaped + return "\\" + ch; + }, + + // Used for iframes + // See setDocument() + // Removing the function wrapper causes a "Permission Denied" + // error in IE + unloadHandler = function() { + setDocument(); + }, + + inDisabledFieldset = addCombinator( + function( elem ) { + return elem.disabled === true && elem.nodeName.toLowerCase() === "fieldset"; + }, + { dir: "parentNode", next: "legend" } + ); + +// Optimize for push.apply( _, NodeList ) +try { + push.apply( + ( arr = slice.call( preferredDoc.childNodes ) ), + preferredDoc.childNodes + ); + + // Support: Android<4.0 + // Detect silently failing push.apply + // eslint-disable-next-line no-unused-expressions + arr[ preferredDoc.childNodes.length ].nodeType; +} catch ( e ) { + push = { apply: arr.length ? + + // Leverage slice if possible + function( target, els ) { + pushNative.apply( target, slice.call( els ) ); + } : + + // Support: IE<9 + // Otherwise append directly + function( target, els ) { + var j = target.length, + i = 0; + + // Can't trust NodeList.length + while ( ( target[ j++ ] = els[ i++ ] ) ) {} + target.length = j - 1; + } + }; +} + +function Sizzle( selector, context, results, seed ) { + var m, i, elem, nid, match, groups, newSelector, + newContext = context && context.ownerDocument, + + // nodeType defaults to 9, since context defaults to document + nodeType = context ? context.nodeType : 9; + + results = results || []; + + // Return early from calls with invalid selector or context + if ( typeof selector !== "string" || !selector || + nodeType !== 1 && nodeType !== 9 && nodeType !== 11 ) { + + return results; + } + + // Try to shortcut find operations (as opposed to filters) in HTML documents + if ( !seed ) { + setDocument( context ); + context = context || document; + + if ( documentIsHTML ) { + + // If the selector is sufficiently simple, try using a "get*By*" DOM method + // (excepting DocumentFragment context, where the methods don't exist) + if ( nodeType !== 11 && ( match = rquickExpr.exec( selector ) ) ) { + + // ID selector + if ( ( m = match[ 1 ] ) ) { + + // Document context + if ( nodeType === 9 ) { + if ( ( elem = context.getElementById( m ) ) ) { + + // Support: IE, Opera, Webkit + // TODO: identify versions + // getElementById can match elements by name instead of ID + if ( elem.id === m ) { + results.push( elem ); + return results; + } + } else { + return results; + } + + // Element context + } else { + + // Support: IE, Opera, Webkit + // TODO: identify versions + // getElementById can match elements by name instead of ID + if ( newContext && ( elem = newContext.getElementById( m ) ) && + contains( context, elem ) && + elem.id === m ) { + + results.push( elem ); + return results; + } + } + + // Type selector + } else if ( match[ 2 ] ) { + push.apply( results, context.getElementsByTagName( selector ) ); + return results; + + // Class selector + } else if ( ( m = match[ 3 ] ) && support.getElementsByClassName && + context.getElementsByClassName ) { + + push.apply( results, context.getElementsByClassName( m ) ); + return results; + } + } + + // Take advantage of querySelectorAll + if ( support.qsa && + !nonnativeSelectorCache[ selector + " " ] && + ( !rbuggyQSA || !rbuggyQSA.test( selector ) ) && + + // Support: IE 8 only + // Exclude object elements + ( nodeType !== 1 || context.nodeName.toLowerCase() !== "object" ) ) { + + newSelector = selector; + newContext = context; + + // qSA considers elements outside a scoping root when evaluating child or + // descendant combinators, which is not what we want. + // In such cases, we work around the behavior by prefixing every selector in the + // list with an ID selector referencing the scope context. + // The technique has to be used as well when a leading combinator is used + // as such selectors are not recognized by querySelectorAll. + // Thanks to Andrew Dupont for this technique. + if ( nodeType === 1 && + ( rdescend.test( selector ) || rcombinators.test( selector ) ) ) { + + // Expand context for sibling selectors + newContext = rsibling.test( selector ) && testContext( context.parentNode ) || + context; + + // We can use :scope instead of the ID hack if the browser + // supports it & if we're not changing the context. + if ( newContext !== context || !support.scope ) { + + // Capture the context ID, setting it first if necessary + if ( ( nid = context.getAttribute( "id" ) ) ) { + nid = nid.replace( rcssescape, fcssescape ); + } else { + context.setAttribute( "id", ( nid = expando ) ); + } + } + + // Prefix every selector in the list + groups = tokenize( selector ); + i = groups.length; + while ( i-- ) { + groups[ i ] = ( nid ? "#" + nid : ":scope" ) + " " + + toSelector( groups[ i ] ); + } + newSelector = groups.join( "," ); + } + + try { + push.apply( results, + newContext.querySelectorAll( newSelector ) + ); + return results; + } catch ( qsaError ) { + nonnativeSelectorCache( selector, true ); + } finally { + if ( nid === expando ) { + context.removeAttribute( "id" ); + } + } + } + } + } + + // All others + return select( selector.replace( rtrim, "$1" ), context, results, seed ); +} + +/** + * Create key-value caches of limited size + * @returns {function(string, object)} Returns the Object data after storing it on itself with + * property name the (space-suffixed) string and (if the cache is larger than Expr.cacheLength) + * deleting the oldest entry + */ +function createCache() { + var keys = []; + + function cache( key, value ) { + + // Use (key + " ") to avoid collision with native prototype properties (see Issue #157) + if ( keys.push( key + " " ) > Expr.cacheLength ) { + + // Only keep the most recent entries + delete cache[ keys.shift() ]; + } + return ( cache[ key + " " ] = value ); + } + return cache; +} + +/** + * Mark a function for special use by Sizzle + * @param {Function} fn The function to mark + */ +function markFunction( fn ) { + fn[ expando ] = true; + return fn; +} + +/** + * Support testing using an element + * @param {Function} fn Passed the created element and returns a boolean result + */ +function assert( fn ) { + var el = document.createElement( "fieldset" ); + + try { + return !!fn( el ); + } catch ( e ) { + return false; + } finally { + + // Remove from its parent by default + if ( el.parentNode ) { + el.parentNode.removeChild( el ); + } + + // release memory in IE + el = null; + } +} + +/** + * Adds the same handler for all of the specified attrs + * @param {String} attrs Pipe-separated list of attributes + * @param {Function} handler The method that will be applied + */ +function addHandle( attrs, handler ) { + var arr = attrs.split( "|" ), + i = arr.length; + + while ( i-- ) { + Expr.attrHandle[ arr[ i ] ] = handler; + } +} + +/** + * Checks document order of two siblings + * @param {Element} a + * @param {Element} b + * @returns {Number} Returns less than 0 if a precedes b, greater than 0 if a follows b + */ +function siblingCheck( a, b ) { + var cur = b && a, + diff = cur && a.nodeType === 1 && b.nodeType === 1 && + a.sourceIndex - b.sourceIndex; + + // Use IE sourceIndex if available on both nodes + if ( diff ) { + return diff; + } + + // Check if b follows a + if ( cur ) { + while ( ( cur = cur.nextSibling ) ) { + if ( cur === b ) { + return -1; + } + } + } + + return a ? 1 : -1; +} + +/** + * Returns a function to use in pseudos for input types + * @param {String} type + */ +function createInputPseudo( type ) { + return function( elem ) { + var name = elem.nodeName.toLowerCase(); + return name === "input" && elem.type === type; + }; +} + +/** + * Returns a function to use in pseudos for buttons + * @param {String} type + */ +function createButtonPseudo( type ) { + return function( elem ) { + var name = elem.nodeName.toLowerCase(); + return ( name === "input" || name === "button" ) && elem.type === type; + }; +} + +/** + * Returns a function to use in pseudos for :enabled/:disabled + * @param {Boolean} disabled true for :disabled; false for :enabled + */ +function createDisabledPseudo( disabled ) { + + // Known :disabled false positives: fieldset[disabled] > legend:nth-of-type(n+2) :can-disable + return function( elem ) { + + // Only certain elements can match :enabled or :disabled + // https://html.spec.whatwg.org/multipage/scripting.html#selector-enabled + // https://html.spec.whatwg.org/multipage/scripting.html#selector-disabled + if ( "form" in elem ) { + + // Check for inherited disabledness on relevant non-disabled elements: + // * listed form-associated elements in a disabled fieldset + // https://html.spec.whatwg.org/multipage/forms.html#category-listed + // https://html.spec.whatwg.org/multipage/forms.html#concept-fe-disabled + // * option elements in a disabled optgroup + // https://html.spec.whatwg.org/multipage/forms.html#concept-option-disabled + // All such elements have a "form" property. + if ( elem.parentNode && elem.disabled === false ) { + + // Option elements defer to a parent optgroup if present + if ( "label" in elem ) { + if ( "label" in elem.parentNode ) { + return elem.parentNode.disabled === disabled; + } else { + return elem.disabled === disabled; + } + } + + // Support: IE 6 - 11 + // Use the isDisabled shortcut property to check for disabled fieldset ancestors + return elem.isDisabled === disabled || + + // Where there is no isDisabled, check manually + /* jshint -W018 */ + elem.isDisabled !== !disabled && + inDisabledFieldset( elem ) === disabled; + } + + return elem.disabled === disabled; + + // Try to winnow out elements that can't be disabled before trusting the disabled property. + // Some victims get caught in our net (label, legend, menu, track), but it shouldn't + // even exist on them, let alone have a boolean value. + } else if ( "label" in elem ) { + return elem.disabled === disabled; + } + + // Remaining elements are neither :enabled nor :disabled + return false; + }; +} + +/** + * Returns a function to use in pseudos for positionals + * @param {Function} fn + */ +function createPositionalPseudo( fn ) { + return markFunction( function( argument ) { + argument = +argument; + return markFunction( function( seed, matches ) { + var j, + matchIndexes = fn( [], seed.length, argument ), + i = matchIndexes.length; + + // Match elements found at the specified indexes + while ( i-- ) { + if ( seed[ ( j = matchIndexes[ i ] ) ] ) { + seed[ j ] = !( matches[ j ] = seed[ j ] ); + } + } + } ); + } ); +} + +/** + * Checks a node for validity as a Sizzle context + * @param {Element|Object=} context + * @returns {Element|Object|Boolean} The input node if acceptable, otherwise a falsy value + */ +function testContext( context ) { + return context && typeof context.getElementsByTagName !== "undefined" && context; +} + +// Expose support vars for convenience +support = Sizzle.support = {}; + +/** + * Detects XML nodes + * @param {Element|Object} elem An element or a document + * @returns {Boolean} True iff elem is a non-HTML XML node + */ +isXML = Sizzle.isXML = function( elem ) { + var namespace = elem && elem.namespaceURI, + docElem = elem && ( elem.ownerDocument || elem ).documentElement; + + // Support: IE <=8 + // Assume HTML when documentElement doesn't yet exist, such as inside loading iframes + // https://bugs.jquery.com/ticket/4833 + return !rhtml.test( namespace || docElem && docElem.nodeName || "HTML" ); +}; + +/** + * Sets document-related variables once based on the current document + * @param {Element|Object} [doc] An element or document object to use to set the document + * @returns {Object} Returns the current document + */ +setDocument = Sizzle.setDocument = function( node ) { + var hasCompare, subWindow, + doc = node ? node.ownerDocument || node : preferredDoc; + + // Return early if doc is invalid or already selected + // Support: IE 11+, Edge 17 - 18+ + // IE/Edge sometimes throw a "Permission denied" error when strict-comparing + // two documents; shallow comparisons work. + // eslint-disable-next-line eqeqeq + if ( doc == document || doc.nodeType !== 9 || !doc.documentElement ) { + return document; + } + + // Update global variables + document = doc; + docElem = document.documentElement; + documentIsHTML = !isXML( document ); + + // Support: IE 9 - 11+, Edge 12 - 18+ + // Accessing iframe documents after unload throws "permission denied" errors (jQuery #13936) + // Support: IE 11+, Edge 17 - 18+ + // IE/Edge sometimes throw a "Permission denied" error when strict-comparing + // two documents; shallow comparisons work. + // eslint-disable-next-line eqeqeq + if ( preferredDoc != document && + ( subWindow = document.defaultView ) && subWindow.top !== subWindow ) { + + // Support: IE 11, Edge + if ( subWindow.addEventListener ) { + subWindow.addEventListener( "unload", unloadHandler, false ); + + // Support: IE 9 - 10 only + } else if ( subWindow.attachEvent ) { + subWindow.attachEvent( "onunload", unloadHandler ); + } + } + + // Support: IE 8 - 11+, Edge 12 - 18+, Chrome <=16 - 25 only, Firefox <=3.6 - 31 only, + // Safari 4 - 5 only, Opera <=11.6 - 12.x only + // IE/Edge & older browsers don't support the :scope pseudo-class. + // Support: Safari 6.0 only + // Safari 6.0 supports :scope but it's an alias of :root there. + support.scope = assert( function( el ) { + docElem.appendChild( el ).appendChild( document.createElement( "div" ) ); + return typeof el.querySelectorAll !== "undefined" && + !el.querySelectorAll( ":scope fieldset div" ).length; + } ); + + /* Attributes + ---------------------------------------------------------------------- */ + + // Support: IE<8 + // Verify that getAttribute really returns attributes and not properties + // (excepting IE8 booleans) + support.attributes = assert( function( el ) { + el.className = "i"; + return !el.getAttribute( "className" ); + } ); + + /* getElement(s)By* + ---------------------------------------------------------------------- */ + + // Check if getElementsByTagName("*") returns only elements + support.getElementsByTagName = assert( function( el ) { + el.appendChild( document.createComment( "" ) ); + return !el.getElementsByTagName( "*" ).length; + } ); + + // Support: IE<9 + support.getElementsByClassName = rnative.test( document.getElementsByClassName ); + + // Support: IE<10 + // Check if getElementById returns elements by name + // The broken getElementById methods don't pick up programmatically-set names, + // so use a roundabout getElementsByName test + support.getById = assert( function( el ) { + docElem.appendChild( el ).id = expando; + return !document.getElementsByName || !document.getElementsByName( expando ).length; + } ); + + // ID filter and find + if ( support.getById ) { + Expr.filter[ "ID" ] = function( id ) { + var attrId = id.replace( runescape, funescape ); + return function( elem ) { + return elem.getAttribute( "id" ) === attrId; + }; + }; + Expr.find[ "ID" ] = function( id, context ) { + if ( typeof context.getElementById !== "undefined" && documentIsHTML ) { + var elem = context.getElementById( id ); + return elem ? [ elem ] : []; + } + }; + } else { + Expr.filter[ "ID" ] = function( id ) { + var attrId = id.replace( runescape, funescape ); + return function( elem ) { + var node = typeof elem.getAttributeNode !== "undefined" && + elem.getAttributeNode( "id" ); + return node && node.value === attrId; + }; + }; + + // Support: IE 6 - 7 only + // getElementById is not reliable as a find shortcut + Expr.find[ "ID" ] = function( id, context ) { + if ( typeof context.getElementById !== "undefined" && documentIsHTML ) { + var node, i, elems, + elem = context.getElementById( id ); + + if ( elem ) { + + // Verify the id attribute + node = elem.getAttributeNode( "id" ); + if ( node && node.value === id ) { + return [ elem ]; + } + + // Fall back on getElementsByName + elems = context.getElementsByName( id ); + i = 0; + while ( ( elem = elems[ i++ ] ) ) { + node = elem.getAttributeNode( "id" ); + if ( node && node.value === id ) { + return [ elem ]; + } + } + } + + return []; + } + }; + } + + // Tag + Expr.find[ "TAG" ] = support.getElementsByTagName ? + function( tag, context ) { + if ( typeof context.getElementsByTagName !== "undefined" ) { + return context.getElementsByTagName( tag ); + + // DocumentFragment nodes don't have gEBTN + } else if ( support.qsa ) { + return context.querySelectorAll( tag ); + } + } : + + function( tag, context ) { + var elem, + tmp = [], + i = 0, + + // By happy coincidence, a (broken) gEBTN appears on DocumentFragment nodes too + results = context.getElementsByTagName( tag ); + + // Filter out possible comments + if ( tag === "*" ) { + while ( ( elem = results[ i++ ] ) ) { + if ( elem.nodeType === 1 ) { + tmp.push( elem ); + } + } + + return tmp; + } + return results; + }; + + // Class + Expr.find[ "CLASS" ] = support.getElementsByClassName && function( className, context ) { + if ( typeof context.getElementsByClassName !== "undefined" && documentIsHTML ) { + return context.getElementsByClassName( className ); + } + }; + + /* QSA/matchesSelector + ---------------------------------------------------------------------- */ + + // QSA and matchesSelector support + + // matchesSelector(:active) reports false when true (IE9/Opera 11.5) + rbuggyMatches = []; + + // qSa(:focus) reports false when true (Chrome 21) + // We allow this because of a bug in IE8/9 that throws an error + // whenever `document.activeElement` is accessed on an iframe + // So, we allow :focus to pass through QSA all the time to avoid the IE error + // See https://bugs.jquery.com/ticket/13378 + rbuggyQSA = []; + + if ( ( support.qsa = rnative.test( document.querySelectorAll ) ) ) { + + // Build QSA regex + // Regex strategy adopted from Diego Perini + assert( function( el ) { + + var input; + + // Select is set to empty string on purpose + // This is to test IE's treatment of not explicitly + // setting a boolean content attribute, + // since its presence should be enough + // https://bugs.jquery.com/ticket/12359 + docElem.appendChild( el ).innerHTML = "" + + ""; + + // Support: IE8, Opera 11-12.16 + // Nothing should be selected when empty strings follow ^= or $= or *= + // The test attribute must be unknown in Opera but "safe" for WinRT + // https://msdn.microsoft.com/en-us/library/ie/hh465388.aspx#attribute_section + if ( el.querySelectorAll( "[msallowcapture^='']" ).length ) { + rbuggyQSA.push( "[*^$]=" + whitespace + "*(?:''|\"\")" ); + } + + // Support: IE8 + // Boolean attributes and "value" are not treated correctly + if ( !el.querySelectorAll( "[selected]" ).length ) { + rbuggyQSA.push( "\\[" + whitespace + "*(?:value|" + booleans + ")" ); + } + + // Support: Chrome<29, Android<4.4, Safari<7.0+, iOS<7.0+, PhantomJS<1.9.8+ + if ( !el.querySelectorAll( "[id~=" + expando + "-]" ).length ) { + rbuggyQSA.push( "~=" ); + } + + // Support: IE 11+, Edge 15 - 18+ + // IE 11/Edge don't find elements on a `[name='']` query in some cases. + // Adding a temporary attribute to the document before the selection works + // around the issue. + // Interestingly, IE 10 & older don't seem to have the issue. + input = document.createElement( "input" ); + input.setAttribute( "name", "" ); + el.appendChild( input ); + if ( !el.querySelectorAll( "[name='']" ).length ) { + rbuggyQSA.push( "\\[" + whitespace + "*name" + whitespace + "*=" + + whitespace + "*(?:''|\"\")" ); + } + + // Webkit/Opera - :checked should return selected option elements + // http://www.w3.org/TR/2011/REC-css3-selectors-20110929/#checked + // IE8 throws error here and will not see later tests + if ( !el.querySelectorAll( ":checked" ).length ) { + rbuggyQSA.push( ":checked" ); + } + + // Support: Safari 8+, iOS 8+ + // https://bugs.webkit.org/show_bug.cgi?id=136851 + // In-page `selector#id sibling-combinator selector` fails + if ( !el.querySelectorAll( "a#" + expando + "+*" ).length ) { + rbuggyQSA.push( ".#.+[+~]" ); + } + + // Support: Firefox <=3.6 - 5 only + // Old Firefox doesn't throw on a badly-escaped identifier. + el.querySelectorAll( "\\\f" ); + rbuggyQSA.push( "[\\r\\n\\f]" ); + } ); + + assert( function( el ) { + el.innerHTML = "" + + ""; + + // Support: Windows 8 Native Apps + // The type and name attributes are restricted during .innerHTML assignment + var input = document.createElement( "input" ); + input.setAttribute( "type", "hidden" ); + el.appendChild( input ).setAttribute( "name", "D" ); + + // Support: IE8 + // Enforce case-sensitivity of name attribute + if ( el.querySelectorAll( "[name=d]" ).length ) { + rbuggyQSA.push( "name" + whitespace + "*[*^$|!~]?=" ); + } + + // FF 3.5 - :enabled/:disabled and hidden elements (hidden elements are still enabled) + // IE8 throws error here and will not see later tests + if ( el.querySelectorAll( ":enabled" ).length !== 2 ) { + rbuggyQSA.push( ":enabled", ":disabled" ); + } + + // Support: IE9-11+ + // IE's :disabled selector does not pick up the children of disabled fieldsets + docElem.appendChild( el ).disabled = true; + if ( el.querySelectorAll( ":disabled" ).length !== 2 ) { + rbuggyQSA.push( ":enabled", ":disabled" ); + } + + // Support: Opera 10 - 11 only + // Opera 10-11 does not throw on post-comma invalid pseudos + el.querySelectorAll( "*,:x" ); + rbuggyQSA.push( ",.*:" ); + } ); + } + + if ( ( support.matchesSelector = rnative.test( ( matches = docElem.matches || + docElem.webkitMatchesSelector || + docElem.mozMatchesSelector || + docElem.oMatchesSelector || + docElem.msMatchesSelector ) ) ) ) { + + assert( function( el ) { + + // Check to see if it's possible to do matchesSelector + // on a disconnected node (IE 9) + support.disconnectedMatch = matches.call( el, "*" ); + + // This should fail with an exception + // Gecko does not error, returns false instead + matches.call( el, "[s!='']:x" ); + rbuggyMatches.push( "!=", pseudos ); + } ); + } + + rbuggyQSA = rbuggyQSA.length && new RegExp( rbuggyQSA.join( "|" ) ); + rbuggyMatches = rbuggyMatches.length && new RegExp( rbuggyMatches.join( "|" ) ); + + /* Contains + ---------------------------------------------------------------------- */ + hasCompare = rnative.test( docElem.compareDocumentPosition ); + + // Element contains another + // Purposefully self-exclusive + // As in, an element does not contain itself + contains = hasCompare || rnative.test( docElem.contains ) ? + function( a, b ) { + var adown = a.nodeType === 9 ? a.documentElement : a, + bup = b && b.parentNode; + return a === bup || !!( bup && bup.nodeType === 1 && ( + adown.contains ? + adown.contains( bup ) : + a.compareDocumentPosition && a.compareDocumentPosition( bup ) & 16 + ) ); + } : + function( a, b ) { + if ( b ) { + while ( ( b = b.parentNode ) ) { + if ( b === a ) { + return true; + } + } + } + return false; + }; + + /* Sorting + ---------------------------------------------------------------------- */ + + // Document order sorting + sortOrder = hasCompare ? + function( a, b ) { + + // Flag for duplicate removal + if ( a === b ) { + hasDuplicate = true; + return 0; + } + + // Sort on method existence if only one input has compareDocumentPosition + var compare = !a.compareDocumentPosition - !b.compareDocumentPosition; + if ( compare ) { + return compare; + } + + // Calculate position if both inputs belong to the same document + // Support: IE 11+, Edge 17 - 18+ + // IE/Edge sometimes throw a "Permission denied" error when strict-comparing + // two documents; shallow comparisons work. + // eslint-disable-next-line eqeqeq + compare = ( a.ownerDocument || a ) == ( b.ownerDocument || b ) ? + a.compareDocumentPosition( b ) : + + // Otherwise we know they are disconnected + 1; + + // Disconnected nodes + if ( compare & 1 || + ( !support.sortDetached && b.compareDocumentPosition( a ) === compare ) ) { + + // Choose the first element that is related to our preferred document + // Support: IE 11+, Edge 17 - 18+ + // IE/Edge sometimes throw a "Permission denied" error when strict-comparing + // two documents; shallow comparisons work. + // eslint-disable-next-line eqeqeq + if ( a == document || a.ownerDocument == preferredDoc && + contains( preferredDoc, a ) ) { + return -1; + } + + // Support: IE 11+, Edge 17 - 18+ + // IE/Edge sometimes throw a "Permission denied" error when strict-comparing + // two documents; shallow comparisons work. + // eslint-disable-next-line eqeqeq + if ( b == document || b.ownerDocument == preferredDoc && + contains( preferredDoc, b ) ) { + return 1; + } + + // Maintain original order + return sortInput ? + ( indexOf( sortInput, a ) - indexOf( sortInput, b ) ) : + 0; + } + + return compare & 4 ? -1 : 1; + } : + function( a, b ) { + + // Exit early if the nodes are identical + if ( a === b ) { + hasDuplicate = true; + return 0; + } + + var cur, + i = 0, + aup = a.parentNode, + bup = b.parentNode, + ap = [ a ], + bp = [ b ]; + + // Parentless nodes are either documents or disconnected + if ( !aup || !bup ) { + + // Support: IE 11+, Edge 17 - 18+ + // IE/Edge sometimes throw a "Permission denied" error when strict-comparing + // two documents; shallow comparisons work. + /* eslint-disable eqeqeq */ + return a == document ? -1 : + b == document ? 1 : + /* eslint-enable eqeqeq */ + aup ? -1 : + bup ? 1 : + sortInput ? + ( indexOf( sortInput, a ) - indexOf( sortInput, b ) ) : + 0; + + // If the nodes are siblings, we can do a quick check + } else if ( aup === bup ) { + return siblingCheck( a, b ); + } + + // Otherwise we need full lists of their ancestors for comparison + cur = a; + while ( ( cur = cur.parentNode ) ) { + ap.unshift( cur ); + } + cur = b; + while ( ( cur = cur.parentNode ) ) { + bp.unshift( cur ); + } + + // Walk down the tree looking for a discrepancy + while ( ap[ i ] === bp[ i ] ) { + i++; + } + + return i ? + + // Do a sibling check if the nodes have a common ancestor + siblingCheck( ap[ i ], bp[ i ] ) : + + // Otherwise nodes in our document sort first + // Support: IE 11+, Edge 17 - 18+ + // IE/Edge sometimes throw a "Permission denied" error when strict-comparing + // two documents; shallow comparisons work. + /* eslint-disable eqeqeq */ + ap[ i ] == preferredDoc ? -1 : + bp[ i ] == preferredDoc ? 1 : + /* eslint-enable eqeqeq */ + 0; + }; + + return document; +}; + +Sizzle.matches = function( expr, elements ) { + return Sizzle( expr, null, null, elements ); +}; + +Sizzle.matchesSelector = function( elem, expr ) { + setDocument( elem ); + + if ( support.matchesSelector && documentIsHTML && + !nonnativeSelectorCache[ expr + " " ] && + ( !rbuggyMatches || !rbuggyMatches.test( expr ) ) && + ( !rbuggyQSA || !rbuggyQSA.test( expr ) ) ) { + + try { + var ret = matches.call( elem, expr ); + + // IE 9's matchesSelector returns false on disconnected nodes + if ( ret || support.disconnectedMatch || + + // As well, disconnected nodes are said to be in a document + // fragment in IE 9 + elem.document && elem.document.nodeType !== 11 ) { + return ret; + } + } catch ( e ) { + nonnativeSelectorCache( expr, true ); + } + } + + return Sizzle( expr, document, null, [ elem ] ).length > 0; +}; + +Sizzle.contains = function( context, elem ) { + + // Set document vars if needed + // Support: IE 11+, Edge 17 - 18+ + // IE/Edge sometimes throw a "Permission denied" error when strict-comparing + // two documents; shallow comparisons work. + // eslint-disable-next-line eqeqeq + if ( ( context.ownerDocument || context ) != document ) { + setDocument( context ); + } + return contains( context, elem ); +}; + +Sizzle.attr = function( elem, name ) { + + // Set document vars if needed + // Support: IE 11+, Edge 17 - 18+ + // IE/Edge sometimes throw a "Permission denied" error when strict-comparing + // two documents; shallow comparisons work. + // eslint-disable-next-line eqeqeq + if ( ( elem.ownerDocument || elem ) != document ) { + setDocument( elem ); + } + + var fn = Expr.attrHandle[ name.toLowerCase() ], + + // Don't get fooled by Object.prototype properties (jQuery #13807) + val = fn && hasOwn.call( Expr.attrHandle, name.toLowerCase() ) ? + fn( elem, name, !documentIsHTML ) : + undefined; + + return val !== undefined ? + val : + support.attributes || !documentIsHTML ? + elem.getAttribute( name ) : + ( val = elem.getAttributeNode( name ) ) && val.specified ? + val.value : + null; +}; + +Sizzle.escape = function( sel ) { + return ( sel + "" ).replace( rcssescape, fcssescape ); +}; + +Sizzle.error = function( msg ) { + throw new Error( "Syntax error, unrecognized expression: " + msg ); +}; + +/** + * Document sorting and removing duplicates + * @param {ArrayLike} results + */ +Sizzle.uniqueSort = function( results ) { + var elem, + duplicates = [], + j = 0, + i = 0; + + // Unless we *know* we can detect duplicates, assume their presence + hasDuplicate = !support.detectDuplicates; + sortInput = !support.sortStable && results.slice( 0 ); + results.sort( sortOrder ); + + if ( hasDuplicate ) { + while ( ( elem = results[ i++ ] ) ) { + if ( elem === results[ i ] ) { + j = duplicates.push( i ); + } + } + while ( j-- ) { + results.splice( duplicates[ j ], 1 ); + } + } + + // Clear input after sorting to release objects + // See https://github.com/jquery/sizzle/pull/225 + sortInput = null; + + return results; +}; + +/** + * Utility function for retrieving the text value of an array of DOM nodes + * @param {Array|Element} elem + */ +getText = Sizzle.getText = function( elem ) { + var node, + ret = "", + i = 0, + nodeType = elem.nodeType; + + if ( !nodeType ) { + + // If no nodeType, this is expected to be an array + while ( ( node = elem[ i++ ] ) ) { + + // Do not traverse comment nodes + ret += getText( node ); + } + } else if ( nodeType === 1 || nodeType === 9 || nodeType === 11 ) { + + // Use textContent for elements + // innerText usage removed for consistency of new lines (jQuery #11153) + if ( typeof elem.textContent === "string" ) { + return elem.textContent; + } else { + + // Traverse its children + for ( elem = elem.firstChild; elem; elem = elem.nextSibling ) { + ret += getText( elem ); + } + } + } else if ( nodeType === 3 || nodeType === 4 ) { + return elem.nodeValue; + } + + // Do not include comment or processing instruction nodes + + return ret; +}; + +Expr = Sizzle.selectors = { + + // Can be adjusted by the user + cacheLength: 50, + + createPseudo: markFunction, + + match: matchExpr, + + attrHandle: {}, + + find: {}, + + relative: { + ">": { dir: "parentNode", first: true }, + " ": { dir: "parentNode" }, + "+": { dir: "previousSibling", first: true }, + "~": { dir: "previousSibling" } + }, + + preFilter: { + "ATTR": function( match ) { + match[ 1 ] = match[ 1 ].replace( runescape, funescape ); + + // Move the given value to match[3] whether quoted or unquoted + match[ 3 ] = ( match[ 3 ] || match[ 4 ] || + match[ 5 ] || "" ).replace( runescape, funescape ); + + if ( match[ 2 ] === "~=" ) { + match[ 3 ] = " " + match[ 3 ] + " "; + } + + return match.slice( 0, 4 ); + }, + + "CHILD": function( match ) { + + /* matches from matchExpr["CHILD"] + 1 type (only|nth|...) + 2 what (child|of-type) + 3 argument (even|odd|\d*|\d*n([+-]\d+)?|...) + 4 xn-component of xn+y argument ([+-]?\d*n|) + 5 sign of xn-component + 6 x of xn-component + 7 sign of y-component + 8 y of y-component + */ + match[ 1 ] = match[ 1 ].toLowerCase(); + + if ( match[ 1 ].slice( 0, 3 ) === "nth" ) { + + // nth-* requires argument + if ( !match[ 3 ] ) { + Sizzle.error( match[ 0 ] ); + } + + // numeric x and y parameters for Expr.filter.CHILD + // remember that false/true cast respectively to 0/1 + match[ 4 ] = +( match[ 4 ] ? + match[ 5 ] + ( match[ 6 ] || 1 ) : + 2 * ( match[ 3 ] === "even" || match[ 3 ] === "odd" ) ); + match[ 5 ] = +( ( match[ 7 ] + match[ 8 ] ) || match[ 3 ] === "odd" ); + + // other types prohibit arguments + } else if ( match[ 3 ] ) { + Sizzle.error( match[ 0 ] ); + } + + return match; + }, + + "PSEUDO": function( match ) { + var excess, + unquoted = !match[ 6 ] && match[ 2 ]; + + if ( matchExpr[ "CHILD" ].test( match[ 0 ] ) ) { + return null; + } + + // Accept quoted arguments as-is + if ( match[ 3 ] ) { + match[ 2 ] = match[ 4 ] || match[ 5 ] || ""; + + // Strip excess characters from unquoted arguments + } else if ( unquoted && rpseudo.test( unquoted ) && + + // Get excess from tokenize (recursively) + ( excess = tokenize( unquoted, true ) ) && + + // advance to the next closing parenthesis + ( excess = unquoted.indexOf( ")", unquoted.length - excess ) - unquoted.length ) ) { + + // excess is a negative index + match[ 0 ] = match[ 0 ].slice( 0, excess ); + match[ 2 ] = unquoted.slice( 0, excess ); + } + + // Return only captures needed by the pseudo filter method (type and argument) + return match.slice( 0, 3 ); + } + }, + + filter: { + + "TAG": function( nodeNameSelector ) { + var nodeName = nodeNameSelector.replace( runescape, funescape ).toLowerCase(); + return nodeNameSelector === "*" ? + function() { + return true; + } : + function( elem ) { + return elem.nodeName && elem.nodeName.toLowerCase() === nodeName; + }; + }, + + "CLASS": function( className ) { + var pattern = classCache[ className + " " ]; + + return pattern || + ( pattern = new RegExp( "(^|" + whitespace + + ")" + className + "(" + whitespace + "|$)" ) ) && classCache( + className, function( elem ) { + return pattern.test( + typeof elem.className === "string" && elem.className || + typeof elem.getAttribute !== "undefined" && + elem.getAttribute( "class" ) || + "" + ); + } ); + }, + + "ATTR": function( name, operator, check ) { + return function( elem ) { + var result = Sizzle.attr( elem, name ); + + if ( result == null ) { + return operator === "!="; + } + if ( !operator ) { + return true; + } + + result += ""; + + /* eslint-disable max-len */ + + return operator === "=" ? result === check : + operator === "!=" ? result !== check : + operator === "^=" ? check && result.indexOf( check ) === 0 : + operator === "*=" ? check && result.indexOf( check ) > -1 : + operator === "$=" ? check && result.slice( -check.length ) === check : + operator === "~=" ? ( " " + result.replace( rwhitespace, " " ) + " " ).indexOf( check ) > -1 : + operator === "|=" ? result === check || result.slice( 0, check.length + 1 ) === check + "-" : + false; + /* eslint-enable max-len */ + + }; + }, + + "CHILD": function( type, what, _argument, first, last ) { + var simple = type.slice( 0, 3 ) !== "nth", + forward = type.slice( -4 ) !== "last", + ofType = what === "of-type"; + + return first === 1 && last === 0 ? + + // Shortcut for :nth-*(n) + function( elem ) { + return !!elem.parentNode; + } : + + function( elem, _context, xml ) { + var cache, uniqueCache, outerCache, node, nodeIndex, start, + dir = simple !== forward ? "nextSibling" : "previousSibling", + parent = elem.parentNode, + name = ofType && elem.nodeName.toLowerCase(), + useCache = !xml && !ofType, + diff = false; + + if ( parent ) { + + // :(first|last|only)-(child|of-type) + if ( simple ) { + while ( dir ) { + node = elem; + while ( ( node = node[ dir ] ) ) { + if ( ofType ? + node.nodeName.toLowerCase() === name : + node.nodeType === 1 ) { + + return false; + } + } + + // Reverse direction for :only-* (if we haven't yet done so) + start = dir = type === "only" && !start && "nextSibling"; + } + return true; + } + + start = [ forward ? parent.firstChild : parent.lastChild ]; + + // non-xml :nth-child(...) stores cache data on `parent` + if ( forward && useCache ) { + + // Seek `elem` from a previously-cached index + + // ...in a gzip-friendly way + node = parent; + outerCache = node[ expando ] || ( node[ expando ] = {} ); + + // Support: IE <9 only + // Defend against cloned attroperties (jQuery gh-1709) + uniqueCache = outerCache[ node.uniqueID ] || + ( outerCache[ node.uniqueID ] = {} ); + + cache = uniqueCache[ type ] || []; + nodeIndex = cache[ 0 ] === dirruns && cache[ 1 ]; + diff = nodeIndex && cache[ 2 ]; + node = nodeIndex && parent.childNodes[ nodeIndex ]; + + while ( ( node = ++nodeIndex && node && node[ dir ] || + + // Fallback to seeking `elem` from the start + ( diff = nodeIndex = 0 ) || start.pop() ) ) { + + // When found, cache indexes on `parent` and break + if ( node.nodeType === 1 && ++diff && node === elem ) { + uniqueCache[ type ] = [ dirruns, nodeIndex, diff ]; + break; + } + } + + } else { + + // Use previously-cached element index if available + if ( useCache ) { + + // ...in a gzip-friendly way + node = elem; + outerCache = node[ expando ] || ( node[ expando ] = {} ); + + // Support: IE <9 only + // Defend against cloned attroperties (jQuery gh-1709) + uniqueCache = outerCache[ node.uniqueID ] || + ( outerCache[ node.uniqueID ] = {} ); + + cache = uniqueCache[ type ] || []; + nodeIndex = cache[ 0 ] === dirruns && cache[ 1 ]; + diff = nodeIndex; + } + + // xml :nth-child(...) + // or :nth-last-child(...) or :nth(-last)?-of-type(...) + if ( diff === false ) { + + // Use the same loop as above to seek `elem` from the start + while ( ( node = ++nodeIndex && node && node[ dir ] || + ( diff = nodeIndex = 0 ) || start.pop() ) ) { + + if ( ( ofType ? + node.nodeName.toLowerCase() === name : + node.nodeType === 1 ) && + ++diff ) { + + // Cache the index of each encountered element + if ( useCache ) { + outerCache = node[ expando ] || + ( node[ expando ] = {} ); + + // Support: IE <9 only + // Defend against cloned attroperties (jQuery gh-1709) + uniqueCache = outerCache[ node.uniqueID ] || + ( outerCache[ node.uniqueID ] = {} ); + + uniqueCache[ type ] = [ dirruns, diff ]; + } + + if ( node === elem ) { + break; + } + } + } + } + } + + // Incorporate the offset, then check against cycle size + diff -= last; + return diff === first || ( diff % first === 0 && diff / first >= 0 ); + } + }; + }, + + "PSEUDO": function( pseudo, argument ) { + + // pseudo-class names are case-insensitive + // http://www.w3.org/TR/selectors/#pseudo-classes + // Prioritize by case sensitivity in case custom pseudos are added with uppercase letters + // Remember that setFilters inherits from pseudos + var args, + fn = Expr.pseudos[ pseudo ] || Expr.setFilters[ pseudo.toLowerCase() ] || + Sizzle.error( "unsupported pseudo: " + pseudo ); + + // The user may use createPseudo to indicate that + // arguments are needed to create the filter function + // just as Sizzle does + if ( fn[ expando ] ) { + return fn( argument ); + } + + // But maintain support for old signatures + if ( fn.length > 1 ) { + args = [ pseudo, pseudo, "", argument ]; + return Expr.setFilters.hasOwnProperty( pseudo.toLowerCase() ) ? + markFunction( function( seed, matches ) { + var idx, + matched = fn( seed, argument ), + i = matched.length; + while ( i-- ) { + idx = indexOf( seed, matched[ i ] ); + seed[ idx ] = !( matches[ idx ] = matched[ i ] ); + } + } ) : + function( elem ) { + return fn( elem, 0, args ); + }; + } + + return fn; + } + }, + + pseudos: { + + // Potentially complex pseudos + "not": markFunction( function( selector ) { + + // Trim the selector passed to compile + // to avoid treating leading and trailing + // spaces as combinators + var input = [], + results = [], + matcher = compile( selector.replace( rtrim, "$1" ) ); + + return matcher[ expando ] ? + markFunction( function( seed, matches, _context, xml ) { + var elem, + unmatched = matcher( seed, null, xml, [] ), + i = seed.length; + + // Match elements unmatched by `matcher` + while ( i-- ) { + if ( ( elem = unmatched[ i ] ) ) { + seed[ i ] = !( matches[ i ] = elem ); + } + } + } ) : + function( elem, _context, xml ) { + input[ 0 ] = elem; + matcher( input, null, xml, results ); + + // Don't keep the element (issue #299) + input[ 0 ] = null; + return !results.pop(); + }; + } ), + + "has": markFunction( function( selector ) { + return function( elem ) { + return Sizzle( selector, elem ).length > 0; + }; + } ), + + "contains": markFunction( function( text ) { + text = text.replace( runescape, funescape ); + return function( elem ) { + return ( elem.textContent || getText( elem ) ).indexOf( text ) > -1; + }; + } ), + + // "Whether an element is represented by a :lang() selector + // is based solely on the element's language value + // being equal to the identifier C, + // or beginning with the identifier C immediately followed by "-". + // The matching of C against the element's language value is performed case-insensitively. + // The identifier C does not have to be a valid language name." + // http://www.w3.org/TR/selectors/#lang-pseudo + "lang": markFunction( function( lang ) { + + // lang value must be a valid identifier + if ( !ridentifier.test( lang || "" ) ) { + Sizzle.error( "unsupported lang: " + lang ); + } + lang = lang.replace( runescape, funescape ).toLowerCase(); + return function( elem ) { + var elemLang; + do { + if ( ( elemLang = documentIsHTML ? + elem.lang : + elem.getAttribute( "xml:lang" ) || elem.getAttribute( "lang" ) ) ) { + + elemLang = elemLang.toLowerCase(); + return elemLang === lang || elemLang.indexOf( lang + "-" ) === 0; + } + } while ( ( elem = elem.parentNode ) && elem.nodeType === 1 ); + return false; + }; + } ), + + // Miscellaneous + "target": function( elem ) { + var hash = window.location && window.location.hash; + return hash && hash.slice( 1 ) === elem.id; + }, + + "root": function( elem ) { + return elem === docElem; + }, + + "focus": function( elem ) { + return elem === document.activeElement && + ( !document.hasFocus || document.hasFocus() ) && + !!( elem.type || elem.href || ~elem.tabIndex ); + }, + + // Boolean properties + "enabled": createDisabledPseudo( false ), + "disabled": createDisabledPseudo( true ), + + "checked": function( elem ) { + + // In CSS3, :checked should return both checked and selected elements + // http://www.w3.org/TR/2011/REC-css3-selectors-20110929/#checked + var nodeName = elem.nodeName.toLowerCase(); + return ( nodeName === "input" && !!elem.checked ) || + ( nodeName === "option" && !!elem.selected ); + }, + + "selected": function( elem ) { + + // Accessing this property makes selected-by-default + // options in Safari work properly + if ( elem.parentNode ) { + // eslint-disable-next-line no-unused-expressions + elem.parentNode.selectedIndex; + } + + return elem.selected === true; + }, + + // Contents + "empty": function( elem ) { + + // http://www.w3.org/TR/selectors/#empty-pseudo + // :empty is negated by element (1) or content nodes (text: 3; cdata: 4; entity ref: 5), + // but not by others (comment: 8; processing instruction: 7; etc.) + // nodeType < 6 works because attributes (2) do not appear as children + for ( elem = elem.firstChild; elem; elem = elem.nextSibling ) { + if ( elem.nodeType < 6 ) { + return false; + } + } + return true; + }, + + "parent": function( elem ) { + return !Expr.pseudos[ "empty" ]( elem ); + }, + + // Element/input types + "header": function( elem ) { + return rheader.test( elem.nodeName ); + }, + + "input": function( elem ) { + return rinputs.test( elem.nodeName ); + }, + + "button": function( elem ) { + var name = elem.nodeName.toLowerCase(); + return name === "input" && elem.type === "button" || name === "button"; + }, + + "text": function( elem ) { + var attr; + return elem.nodeName.toLowerCase() === "input" && + elem.type === "text" && + + // Support: IE<8 + // New HTML5 attribute values (e.g., "search") appear with elem.type === "text" + ( ( attr = elem.getAttribute( "type" ) ) == null || + attr.toLowerCase() === "text" ); + }, + + // Position-in-collection + "first": createPositionalPseudo( function() { + return [ 0 ]; + } ), + + "last": createPositionalPseudo( function( _matchIndexes, length ) { + return [ length - 1 ]; + } ), + + "eq": createPositionalPseudo( function( _matchIndexes, length, argument ) { + return [ argument < 0 ? argument + length : argument ]; + } ), + + "even": createPositionalPseudo( function( matchIndexes, length ) { + var i = 0; + for ( ; i < length; i += 2 ) { + matchIndexes.push( i ); + } + return matchIndexes; + } ), + + "odd": createPositionalPseudo( function( matchIndexes, length ) { + var i = 1; + for ( ; i < length; i += 2 ) { + matchIndexes.push( i ); + } + return matchIndexes; + } ), + + "lt": createPositionalPseudo( function( matchIndexes, length, argument ) { + var i = argument < 0 ? + argument + length : + argument > length ? + length : + argument; + for ( ; --i >= 0; ) { + matchIndexes.push( i ); + } + return matchIndexes; + } ), + + "gt": createPositionalPseudo( function( matchIndexes, length, argument ) { + var i = argument < 0 ? argument + length : argument; + for ( ; ++i < length; ) { + matchIndexes.push( i ); + } + return matchIndexes; + } ) + } +}; + +Expr.pseudos[ "nth" ] = Expr.pseudos[ "eq" ]; + +// Add button/input type pseudos +for ( i in { radio: true, checkbox: true, file: true, password: true, image: true } ) { + Expr.pseudos[ i ] = createInputPseudo( i ); +} +for ( i in { submit: true, reset: true } ) { + Expr.pseudos[ i ] = createButtonPseudo( i ); +} + +// Easy API for creating new setFilters +function setFilters() {} +setFilters.prototype = Expr.filters = Expr.pseudos; +Expr.setFilters = new setFilters(); + +tokenize = Sizzle.tokenize = function( selector, parseOnly ) { + var matched, match, tokens, type, + soFar, groups, preFilters, + cached = tokenCache[ selector + " " ]; + + if ( cached ) { + return parseOnly ? 0 : cached.slice( 0 ); + } + + soFar = selector; + groups = []; + preFilters = Expr.preFilter; + + while ( soFar ) { + + // Comma and first run + if ( !matched || ( match = rcomma.exec( soFar ) ) ) { + if ( match ) { + + // Don't consume trailing commas as valid + soFar = soFar.slice( match[ 0 ].length ) || soFar; + } + groups.push( ( tokens = [] ) ); + } + + matched = false; + + // Combinators + if ( ( match = rcombinators.exec( soFar ) ) ) { + matched = match.shift(); + tokens.push( { + value: matched, + + // Cast descendant combinators to space + type: match[ 0 ].replace( rtrim, " " ) + } ); + soFar = soFar.slice( matched.length ); + } + + // Filters + for ( type in Expr.filter ) { + if ( ( match = matchExpr[ type ].exec( soFar ) ) && ( !preFilters[ type ] || + ( match = preFilters[ type ]( match ) ) ) ) { + matched = match.shift(); + tokens.push( { + value: matched, + type: type, + matches: match + } ); + soFar = soFar.slice( matched.length ); + } + } + + if ( !matched ) { + break; + } + } + + // Return the length of the invalid excess + // if we're just parsing + // Otherwise, throw an error or return tokens + return parseOnly ? + soFar.length : + soFar ? + Sizzle.error( selector ) : + + // Cache the tokens + tokenCache( selector, groups ).slice( 0 ); +}; + +function toSelector( tokens ) { + var i = 0, + len = tokens.length, + selector = ""; + for ( ; i < len; i++ ) { + selector += tokens[ i ].value; + } + return selector; +} + +function addCombinator( matcher, combinator, base ) { + var dir = combinator.dir, + skip = combinator.next, + key = skip || dir, + checkNonElements = base && key === "parentNode", + doneName = done++; + + return combinator.first ? + + // Check against closest ancestor/preceding element + function( elem, context, xml ) { + while ( ( elem = elem[ dir ] ) ) { + if ( elem.nodeType === 1 || checkNonElements ) { + return matcher( elem, context, xml ); + } + } + return false; + } : + + // Check against all ancestor/preceding elements + function( elem, context, xml ) { + var oldCache, uniqueCache, outerCache, + newCache = [ dirruns, doneName ]; + + // We can't set arbitrary data on XML nodes, so they don't benefit from combinator caching + if ( xml ) { + while ( ( elem = elem[ dir ] ) ) { + if ( elem.nodeType === 1 || checkNonElements ) { + if ( matcher( elem, context, xml ) ) { + return true; + } + } + } + } else { + while ( ( elem = elem[ dir ] ) ) { + if ( elem.nodeType === 1 || checkNonElements ) { + outerCache = elem[ expando ] || ( elem[ expando ] = {} ); + + // Support: IE <9 only + // Defend against cloned attroperties (jQuery gh-1709) + uniqueCache = outerCache[ elem.uniqueID ] || + ( outerCache[ elem.uniqueID ] = {} ); + + if ( skip && skip === elem.nodeName.toLowerCase() ) { + elem = elem[ dir ] || elem; + } else if ( ( oldCache = uniqueCache[ key ] ) && + oldCache[ 0 ] === dirruns && oldCache[ 1 ] === doneName ) { + + // Assign to newCache so results back-propagate to previous elements + return ( newCache[ 2 ] = oldCache[ 2 ] ); + } else { + + // Reuse newcache so results back-propagate to previous elements + uniqueCache[ key ] = newCache; + + // A match means we're done; a fail means we have to keep checking + if ( ( newCache[ 2 ] = matcher( elem, context, xml ) ) ) { + return true; + } + } + } + } + } + return false; + }; +} + +function elementMatcher( matchers ) { + return matchers.length > 1 ? + function( elem, context, xml ) { + var i = matchers.length; + while ( i-- ) { + if ( !matchers[ i ]( elem, context, xml ) ) { + return false; + } + } + return true; + } : + matchers[ 0 ]; +} + +function multipleContexts( selector, contexts, results ) { + var i = 0, + len = contexts.length; + for ( ; i < len; i++ ) { + Sizzle( selector, contexts[ i ], results ); + } + return results; +} + +function condense( unmatched, map, filter, context, xml ) { + var elem, + newUnmatched = [], + i = 0, + len = unmatched.length, + mapped = map != null; + + for ( ; i < len; i++ ) { + if ( ( elem = unmatched[ i ] ) ) { + if ( !filter || filter( elem, context, xml ) ) { + newUnmatched.push( elem ); + if ( mapped ) { + map.push( i ); + } + } + } + } + + return newUnmatched; +} + +function setMatcher( preFilter, selector, matcher, postFilter, postFinder, postSelector ) { + if ( postFilter && !postFilter[ expando ] ) { + postFilter = setMatcher( postFilter ); + } + if ( postFinder && !postFinder[ expando ] ) { + postFinder = setMatcher( postFinder, postSelector ); + } + return markFunction( function( seed, results, context, xml ) { + var temp, i, elem, + preMap = [], + postMap = [], + preexisting = results.length, + + // Get initial elements from seed or context + elems = seed || multipleContexts( + selector || "*", + context.nodeType ? [ context ] : context, + [] + ), + + // Prefilter to get matcher input, preserving a map for seed-results synchronization + matcherIn = preFilter && ( seed || !selector ) ? + condense( elems, preMap, preFilter, context, xml ) : + elems, + + matcherOut = matcher ? + + // If we have a postFinder, or filtered seed, or non-seed postFilter or preexisting results, + postFinder || ( seed ? preFilter : preexisting || postFilter ) ? + + // ...intermediate processing is necessary + [] : + + // ...otherwise use results directly + results : + matcherIn; + + // Find primary matches + if ( matcher ) { + matcher( matcherIn, matcherOut, context, xml ); + } + + // Apply postFilter + if ( postFilter ) { + temp = condense( matcherOut, postMap ); + postFilter( temp, [], context, xml ); + + // Un-match failing elements by moving them back to matcherIn + i = temp.length; + while ( i-- ) { + if ( ( elem = temp[ i ] ) ) { + matcherOut[ postMap[ i ] ] = !( matcherIn[ postMap[ i ] ] = elem ); + } + } + } + + if ( seed ) { + if ( postFinder || preFilter ) { + if ( postFinder ) { + + // Get the final matcherOut by condensing this intermediate into postFinder contexts + temp = []; + i = matcherOut.length; + while ( i-- ) { + if ( ( elem = matcherOut[ i ] ) ) { + + // Restore matcherIn since elem is not yet a final match + temp.push( ( matcherIn[ i ] = elem ) ); + } + } + postFinder( null, ( matcherOut = [] ), temp, xml ); + } + + // Move matched elements from seed to results to keep them synchronized + i = matcherOut.length; + while ( i-- ) { + if ( ( elem = matcherOut[ i ] ) && + ( temp = postFinder ? indexOf( seed, elem ) : preMap[ i ] ) > -1 ) { + + seed[ temp ] = !( results[ temp ] = elem ); + } + } + } + + // Add elements to results, through postFinder if defined + } else { + matcherOut = condense( + matcherOut === results ? + matcherOut.splice( preexisting, matcherOut.length ) : + matcherOut + ); + if ( postFinder ) { + postFinder( null, results, matcherOut, xml ); + } else { + push.apply( results, matcherOut ); + } + } + } ); +} + +function matcherFromTokens( tokens ) { + var checkContext, matcher, j, + len = tokens.length, + leadingRelative = Expr.relative[ tokens[ 0 ].type ], + implicitRelative = leadingRelative || Expr.relative[ " " ], + i = leadingRelative ? 1 : 0, + + // The foundational matcher ensures that elements are reachable from top-level context(s) + matchContext = addCombinator( function( elem ) { + return elem === checkContext; + }, implicitRelative, true ), + matchAnyContext = addCombinator( function( elem ) { + return indexOf( checkContext, elem ) > -1; + }, implicitRelative, true ), + matchers = [ function( elem, context, xml ) { + var ret = ( !leadingRelative && ( xml || context !== outermostContext ) ) || ( + ( checkContext = context ).nodeType ? + matchContext( elem, context, xml ) : + matchAnyContext( elem, context, xml ) ); + + // Avoid hanging onto element (issue #299) + checkContext = null; + return ret; + } ]; + + for ( ; i < len; i++ ) { + if ( ( matcher = Expr.relative[ tokens[ i ].type ] ) ) { + matchers = [ addCombinator( elementMatcher( matchers ), matcher ) ]; + } else { + matcher = Expr.filter[ tokens[ i ].type ].apply( null, tokens[ i ].matches ); + + // Return special upon seeing a positional matcher + if ( matcher[ expando ] ) { + + // Find the next relative operator (if any) for proper handling + j = ++i; + for ( ; j < len; j++ ) { + if ( Expr.relative[ tokens[ j ].type ] ) { + break; + } + } + return setMatcher( + i > 1 && elementMatcher( matchers ), + i > 1 && toSelector( + + // If the preceding token was a descendant combinator, insert an implicit any-element `*` + tokens + .slice( 0, i - 1 ) + .concat( { value: tokens[ i - 2 ].type === " " ? "*" : "" } ) + ).replace( rtrim, "$1" ), + matcher, + i < j && matcherFromTokens( tokens.slice( i, j ) ), + j < len && matcherFromTokens( ( tokens = tokens.slice( j ) ) ), + j < len && toSelector( tokens ) + ); + } + matchers.push( matcher ); + } + } + + return elementMatcher( matchers ); +} + +function matcherFromGroupMatchers( elementMatchers, setMatchers ) { + var bySet = setMatchers.length > 0, + byElement = elementMatchers.length > 0, + superMatcher = function( seed, context, xml, results, outermost ) { + var elem, j, matcher, + matchedCount = 0, + i = "0", + unmatched = seed && [], + setMatched = [], + contextBackup = outermostContext, + + // We must always have either seed elements or outermost context + elems = seed || byElement && Expr.find[ "TAG" ]( "*", outermost ), + + // Use integer dirruns iff this is the outermost matcher + dirrunsUnique = ( dirruns += contextBackup == null ? 1 : Math.random() || 0.1 ), + len = elems.length; + + if ( outermost ) { + + // Support: IE 11+, Edge 17 - 18+ + // IE/Edge sometimes throw a "Permission denied" error when strict-comparing + // two documents; shallow comparisons work. + // eslint-disable-next-line eqeqeq + outermostContext = context == document || context || outermost; + } + + // Add elements passing elementMatchers directly to results + // Support: IE<9, Safari + // Tolerate NodeList properties (IE: "length"; Safari: ) matching elements by id + for ( ; i !== len && ( elem = elems[ i ] ) != null; i++ ) { + if ( byElement && elem ) { + j = 0; + + // Support: IE 11+, Edge 17 - 18+ + // IE/Edge sometimes throw a "Permission denied" error when strict-comparing + // two documents; shallow comparisons work. + // eslint-disable-next-line eqeqeq + if ( !context && elem.ownerDocument != document ) { + setDocument( elem ); + xml = !documentIsHTML; + } + while ( ( matcher = elementMatchers[ j++ ] ) ) { + if ( matcher( elem, context || document, xml ) ) { + results.push( elem ); + break; + } + } + if ( outermost ) { + dirruns = dirrunsUnique; + } + } + + // Track unmatched elements for set filters + if ( bySet ) { + + // They will have gone through all possible matchers + if ( ( elem = !matcher && elem ) ) { + matchedCount--; + } + + // Lengthen the array for every element, matched or not + if ( seed ) { + unmatched.push( elem ); + } + } + } + + // `i` is now the count of elements visited above, and adding it to `matchedCount` + // makes the latter nonnegative. + matchedCount += i; + + // Apply set filters to unmatched elements + // NOTE: This can be skipped if there are no unmatched elements (i.e., `matchedCount` + // equals `i`), unless we didn't visit _any_ elements in the above loop because we have + // no element matchers and no seed. + // Incrementing an initially-string "0" `i` allows `i` to remain a string only in that + // case, which will result in a "00" `matchedCount` that differs from `i` but is also + // numerically zero. + if ( bySet && i !== matchedCount ) { + j = 0; + while ( ( matcher = setMatchers[ j++ ] ) ) { + matcher( unmatched, setMatched, context, xml ); + } + + if ( seed ) { + + // Reintegrate element matches to eliminate the need for sorting + if ( matchedCount > 0 ) { + while ( i-- ) { + if ( !( unmatched[ i ] || setMatched[ i ] ) ) { + setMatched[ i ] = pop.call( results ); + } + } + } + + // Discard index placeholder values to get only actual matches + setMatched = condense( setMatched ); + } + + // Add matches to results + push.apply( results, setMatched ); + + // Seedless set matches succeeding multiple successful matchers stipulate sorting + if ( outermost && !seed && setMatched.length > 0 && + ( matchedCount + setMatchers.length ) > 1 ) { + + Sizzle.uniqueSort( results ); + } + } + + // Override manipulation of globals by nested matchers + if ( outermost ) { + dirruns = dirrunsUnique; + outermostContext = contextBackup; + } + + return unmatched; + }; + + return bySet ? + markFunction( superMatcher ) : + superMatcher; +} + +compile = Sizzle.compile = function( selector, match /* Internal Use Only */ ) { + var i, + setMatchers = [], + elementMatchers = [], + cached = compilerCache[ selector + " " ]; + + if ( !cached ) { + + // Generate a function of recursive functions that can be used to check each element + if ( !match ) { + match = tokenize( selector ); + } + i = match.length; + while ( i-- ) { + cached = matcherFromTokens( match[ i ] ); + if ( cached[ expando ] ) { + setMatchers.push( cached ); + } else { + elementMatchers.push( cached ); + } + } + + // Cache the compiled function + cached = compilerCache( + selector, + matcherFromGroupMatchers( elementMatchers, setMatchers ) + ); + + // Save selector and tokenization + cached.selector = selector; + } + return cached; +}; + +/** + * A low-level selection function that works with Sizzle's compiled + * selector functions + * @param {String|Function} selector A selector or a pre-compiled + * selector function built with Sizzle.compile + * @param {Element} context + * @param {Array} [results] + * @param {Array} [seed] A set of elements to match against + */ +select = Sizzle.select = function( selector, context, results, seed ) { + var i, tokens, token, type, find, + compiled = typeof selector === "function" && selector, + match = !seed && tokenize( ( selector = compiled.selector || selector ) ); + + results = results || []; + + // Try to minimize operations if there is only one selector in the list and no seed + // (the latter of which guarantees us context) + if ( match.length === 1 ) { + + // Reduce context if the leading compound selector is an ID + tokens = match[ 0 ] = match[ 0 ].slice( 0 ); + if ( tokens.length > 2 && ( token = tokens[ 0 ] ).type === "ID" && + context.nodeType === 9 && documentIsHTML && Expr.relative[ tokens[ 1 ].type ] ) { + + context = ( Expr.find[ "ID" ]( token.matches[ 0 ] + .replace( runescape, funescape ), context ) || [] )[ 0 ]; + if ( !context ) { + return results; + + // Precompiled matchers will still verify ancestry, so step up a level + } else if ( compiled ) { + context = context.parentNode; + } + + selector = selector.slice( tokens.shift().value.length ); + } + + // Fetch a seed set for right-to-left matching + i = matchExpr[ "needsContext" ].test( selector ) ? 0 : tokens.length; + while ( i-- ) { + token = tokens[ i ]; + + // Abort if we hit a combinator + if ( Expr.relative[ ( type = token.type ) ] ) { + break; + } + if ( ( find = Expr.find[ type ] ) ) { + + // Search, expanding context for leading sibling combinators + if ( ( seed = find( + token.matches[ 0 ].replace( runescape, funescape ), + rsibling.test( tokens[ 0 ].type ) && testContext( context.parentNode ) || + context + ) ) ) { + + // If seed is empty or no tokens remain, we can return early + tokens.splice( i, 1 ); + selector = seed.length && toSelector( tokens ); + if ( !selector ) { + push.apply( results, seed ); + return results; + } + + break; + } + } + } + } + + // Compile and execute a filtering function if one is not provided + // Provide `match` to avoid retokenization if we modified the selector above + ( compiled || compile( selector, match ) )( + seed, + context, + !documentIsHTML, + results, + !context || rsibling.test( selector ) && testContext( context.parentNode ) || context + ); + return results; +}; + +// One-time assignments + +// Sort stability +support.sortStable = expando.split( "" ).sort( sortOrder ).join( "" ) === expando; + +// Support: Chrome 14-35+ +// Always assume duplicates if they aren't passed to the comparison function +support.detectDuplicates = !!hasDuplicate; + +// Initialize against the default document +setDocument(); + +// Support: Webkit<537.32 - Safari 6.0.3/Chrome 25 (fixed in Chrome 27) +// Detached nodes confoundingly follow *each other* +support.sortDetached = assert( function( el ) { + + // Should return 1, but returns 4 (following) + return el.compareDocumentPosition( document.createElement( "fieldset" ) ) & 1; +} ); + +// Support: IE<8 +// Prevent attribute/property "interpolation" +// https://msdn.microsoft.com/en-us/library/ms536429%28VS.85%29.aspx +if ( !assert( function( el ) { + el.innerHTML = ""; + return el.firstChild.getAttribute( "href" ) === "#"; +} ) ) { + addHandle( "type|href|height|width", function( elem, name, isXML ) { + if ( !isXML ) { + return elem.getAttribute( name, name.toLowerCase() === "type" ? 1 : 2 ); + } + } ); +} + +// Support: IE<9 +// Use defaultValue in place of getAttribute("value") +if ( !support.attributes || !assert( function( el ) { + el.innerHTML = ""; + el.firstChild.setAttribute( "value", "" ); + return el.firstChild.getAttribute( "value" ) === ""; +} ) ) { + addHandle( "value", function( elem, _name, isXML ) { + if ( !isXML && elem.nodeName.toLowerCase() === "input" ) { + return elem.defaultValue; + } + } ); +} + +// Support: IE<9 +// Use getAttributeNode to fetch booleans when getAttribute lies +if ( !assert( function( el ) { + return el.getAttribute( "disabled" ) == null; +} ) ) { + addHandle( booleans, function( elem, name, isXML ) { + var val; + if ( !isXML ) { + return elem[ name ] === true ? name.toLowerCase() : + ( val = elem.getAttributeNode( name ) ) && val.specified ? + val.value : + null; + } + } ); +} + +return Sizzle; + +} )( window ); + + + +jQuery.find = Sizzle; +jQuery.expr = Sizzle.selectors; + +// Deprecated +jQuery.expr[ ":" ] = jQuery.expr.pseudos; +jQuery.uniqueSort = jQuery.unique = Sizzle.uniqueSort; +jQuery.text = Sizzle.getText; +jQuery.isXMLDoc = Sizzle.isXML; +jQuery.contains = Sizzle.contains; +jQuery.escapeSelector = Sizzle.escape; + + + + +var dir = function( elem, dir, until ) { + var matched = [], + truncate = until !== undefined; + + while ( ( elem = elem[ dir ] ) && elem.nodeType !== 9 ) { + if ( elem.nodeType === 1 ) { + if ( truncate && jQuery( elem ).is( until ) ) { + break; + } + matched.push( elem ); + } + } + return matched; +}; + + +var siblings = function( n, elem ) { + var matched = []; + + for ( ; n; n = n.nextSibling ) { + if ( n.nodeType === 1 && n !== elem ) { + matched.push( n ); + } + } + + return matched; +}; + + +var rneedsContext = jQuery.expr.match.needsContext; + + + +function nodeName( elem, name ) { + + return elem.nodeName && elem.nodeName.toLowerCase() === name.toLowerCase(); + +} +var rsingleTag = ( /^<([a-z][^\/\0>:\x20\t\r\n\f]*)[\x20\t\r\n\f]*\/?>(?:<\/\1>|)$/i ); + + + +// Implement the identical functionality for filter and not +function winnow( elements, qualifier, not ) { + if ( isFunction( qualifier ) ) { + return jQuery.grep( elements, function( elem, i ) { + return !!qualifier.call( elem, i, elem ) !== not; + } ); + } + + // Single element + if ( qualifier.nodeType ) { + return jQuery.grep( elements, function( elem ) { + return ( elem === qualifier ) !== not; + } ); + } + + // Arraylike of elements (jQuery, arguments, Array) + if ( typeof qualifier !== "string" ) { + return jQuery.grep( elements, function( elem ) { + return ( indexOf.call( qualifier, elem ) > -1 ) !== not; + } ); + } + + // Filtered directly for both simple and complex selectors + return jQuery.filter( qualifier, elements, not ); +} + +jQuery.filter = function( expr, elems, not ) { + var elem = elems[ 0 ]; + + if ( not ) { + expr = ":not(" + expr + ")"; + } + + if ( elems.length === 1 && elem.nodeType === 1 ) { + return jQuery.find.matchesSelector( elem, expr ) ? [ elem ] : []; + } + + return jQuery.find.matches( expr, jQuery.grep( elems, function( elem ) { + return elem.nodeType === 1; + } ) ); +}; + +jQuery.fn.extend( { + find: function( selector ) { + var i, ret, + len = this.length, + self = this; + + if ( typeof selector !== "string" ) { + return this.pushStack( jQuery( selector ).filter( function() { + for ( i = 0; i < len; i++ ) { + if ( jQuery.contains( self[ i ], this ) ) { + return true; + } + } + } ) ); + } + + ret = this.pushStack( [] ); + + for ( i = 0; i < len; i++ ) { + jQuery.find( selector, self[ i ], ret ); + } + + return len > 1 ? jQuery.uniqueSort( ret ) : ret; + }, + filter: function( selector ) { + return this.pushStack( winnow( this, selector || [], false ) ); + }, + not: function( selector ) { + return this.pushStack( winnow( this, selector || [], true ) ); + }, + is: function( selector ) { + return !!winnow( + this, + + // If this is a positional/relative selector, check membership in the returned set + // so $("p:first").is("p:last") won't return true for a doc with two "p". + typeof selector === "string" && rneedsContext.test( selector ) ? + jQuery( selector ) : + selector || [], + false + ).length; + } +} ); + + +// Initialize a jQuery object + + +// A central reference to the root jQuery(document) +var rootjQuery, + + // A simple way to check for HTML strings + // Prioritize #id over to avoid XSS via location.hash (#9521) + // Strict HTML recognition (#11290: must start with <) + // Shortcut simple #id case for speed + rquickExpr = /^(?:\s*(<[\w\W]+>)[^>]*|#([\w-]+))$/, + + init = jQuery.fn.init = function( selector, context, root ) { + var match, elem; + + // HANDLE: $(""), $(null), $(undefined), $(false) + if ( !selector ) { + return this; + } + + // Method init() accepts an alternate rootjQuery + // so migrate can support jQuery.sub (gh-2101) + root = root || rootjQuery; + + // Handle HTML strings + if ( typeof selector === "string" ) { + if ( selector[ 0 ] === "<" && + selector[ selector.length - 1 ] === ">" && + selector.length >= 3 ) { + + // Assume that strings that start and end with <> are HTML and skip the regex check + match = [ null, selector, null ]; + + } else { + match = rquickExpr.exec( selector ); + } + + // Match html or make sure no context is specified for #id + if ( match && ( match[ 1 ] || !context ) ) { + + // HANDLE: $(html) -> $(array) + if ( match[ 1 ] ) { + context = context instanceof jQuery ? context[ 0 ] : context; + + // Option to run scripts is true for back-compat + // Intentionally let the error be thrown if parseHTML is not present + jQuery.merge( this, jQuery.parseHTML( + match[ 1 ], + context && context.nodeType ? context.ownerDocument || context : document, + true + ) ); + + // HANDLE: $(html, props) + if ( rsingleTag.test( match[ 1 ] ) && jQuery.isPlainObject( context ) ) { + for ( match in context ) { + + // Properties of context are called as methods if possible + if ( isFunction( this[ match ] ) ) { + this[ match ]( context[ match ] ); + + // ...and otherwise set as attributes + } else { + this.attr( match, context[ match ] ); + } + } + } + + return this; + + // HANDLE: $(#id) + } else { + elem = document.getElementById( match[ 2 ] ); + + if ( elem ) { + + // Inject the element directly into the jQuery object + this[ 0 ] = elem; + this.length = 1; + } + return this; + } + + // HANDLE: $(expr, $(...)) + } else if ( !context || context.jquery ) { + return ( context || root ).find( selector ); + + // HANDLE: $(expr, context) + // (which is just equivalent to: $(context).find(expr) + } else { + return this.constructor( context ).find( selector ); + } + + // HANDLE: $(DOMElement) + } else if ( selector.nodeType ) { + this[ 0 ] = selector; + this.length = 1; + return this; + + // HANDLE: $(function) + // Shortcut for document ready + } else if ( isFunction( selector ) ) { + return root.ready !== undefined ? + root.ready( selector ) : + + // Execute immediately if ready is not present + selector( jQuery ); + } + + return jQuery.makeArray( selector, this ); + }; + +// Give the init function the jQuery prototype for later instantiation +init.prototype = jQuery.fn; + +// Initialize central reference +rootjQuery = jQuery( document ); + + +var rparentsprev = /^(?:parents|prev(?:Until|All))/, + + // Methods guaranteed to produce a unique set when starting from a unique set + guaranteedUnique = { + children: true, + contents: true, + next: true, + prev: true + }; + +jQuery.fn.extend( { + has: function( target ) { + var targets = jQuery( target, this ), + l = targets.length; + + return this.filter( function() { + var i = 0; + for ( ; i < l; i++ ) { + if ( jQuery.contains( this, targets[ i ] ) ) { + return true; + } + } + } ); + }, + + closest: function( selectors, context ) { + var cur, + i = 0, + l = this.length, + matched = [], + targets = typeof selectors !== "string" && jQuery( selectors ); + + // Positional selectors never match, since there's no _selection_ context + if ( !rneedsContext.test( selectors ) ) { + for ( ; i < l; i++ ) { + for ( cur = this[ i ]; cur && cur !== context; cur = cur.parentNode ) { + + // Always skip document fragments + if ( cur.nodeType < 11 && ( targets ? + targets.index( cur ) > -1 : + + // Don't pass non-elements to Sizzle + cur.nodeType === 1 && + jQuery.find.matchesSelector( cur, selectors ) ) ) { + + matched.push( cur ); + break; + } + } + } + } + + return this.pushStack( matched.length > 1 ? jQuery.uniqueSort( matched ) : matched ); + }, + + // Determine the position of an element within the set + index: function( elem ) { + + // No argument, return index in parent + if ( !elem ) { + return ( this[ 0 ] && this[ 0 ].parentNode ) ? this.first().prevAll().length : -1; + } + + // Index in selector + if ( typeof elem === "string" ) { + return indexOf.call( jQuery( elem ), this[ 0 ] ); + } + + // Locate the position of the desired element + return indexOf.call( this, + + // If it receives a jQuery object, the first element is used + elem.jquery ? elem[ 0 ] : elem + ); + }, + + add: function( selector, context ) { + return this.pushStack( + jQuery.uniqueSort( + jQuery.merge( this.get(), jQuery( selector, context ) ) + ) + ); + }, + + addBack: function( selector ) { + return this.add( selector == null ? + this.prevObject : this.prevObject.filter( selector ) + ); + } +} ); + +function sibling( cur, dir ) { + while ( ( cur = cur[ dir ] ) && cur.nodeType !== 1 ) {} + return cur; +} + +jQuery.each( { + parent: function( elem ) { + var parent = elem.parentNode; + return parent && parent.nodeType !== 11 ? parent : null; + }, + parents: function( elem ) { + return dir( elem, "parentNode" ); + }, + parentsUntil: function( elem, _i, until ) { + return dir( elem, "parentNode", until ); + }, + next: function( elem ) { + return sibling( elem, "nextSibling" ); + }, + prev: function( elem ) { + return sibling( elem, "previousSibling" ); + }, + nextAll: function( elem ) { + return dir( elem, "nextSibling" ); + }, + prevAll: function( elem ) { + return dir( elem, "previousSibling" ); + }, + nextUntil: function( elem, _i, until ) { + return dir( elem, "nextSibling", until ); + }, + prevUntil: function( elem, _i, until ) { + return dir( elem, "previousSibling", until ); + }, + siblings: function( elem ) { + return siblings( ( elem.parentNode || {} ).firstChild, elem ); + }, + children: function( elem ) { + return siblings( elem.firstChild ); + }, + contents: function( elem ) { + if ( elem.contentDocument != null && + + // Support: IE 11+ + // elements with no `data` attribute has an object + // `contentDocument` with a `null` prototype. + getProto( elem.contentDocument ) ) { + + return elem.contentDocument; + } + + // Support: IE 9 - 11 only, iOS 7 only, Android Browser <=4.3 only + // Treat the template element as a regular one in browsers that + // don't support it. + if ( nodeName( elem, "template" ) ) { + elem = elem.content || elem; + } + + return jQuery.merge( [], elem.childNodes ); + } +}, function( name, fn ) { + jQuery.fn[ name ] = function( until, selector ) { + var matched = jQuery.map( this, fn, until ); + + if ( name.slice( -5 ) !== "Until" ) { + selector = until; + } + + if ( selector && typeof selector === "string" ) { + matched = jQuery.filter( selector, matched ); + } + + if ( this.length > 1 ) { + + // Remove duplicates + if ( !guaranteedUnique[ name ] ) { + jQuery.uniqueSort( matched ); + } + + // Reverse order for parents* and prev-derivatives + if ( rparentsprev.test( name ) ) { + matched.reverse(); + } + } + + return this.pushStack( matched ); + }; +} ); +var rnothtmlwhite = ( /[^\x20\t\r\n\f]+/g ); + + + +// Convert String-formatted options into Object-formatted ones +function createOptions( options ) { + var object = {}; + jQuery.each( options.match( rnothtmlwhite ) || [], function( _, flag ) { + object[ flag ] = true; + } ); + return object; +} + +/* + * Create a callback list using the following parameters: + * + * options: an optional list of space-separated options that will change how + * the callback list behaves or a more traditional option object + * + * By default a callback list will act like an event callback list and can be + * "fired" multiple times. + * + * Possible options: + * + * once: will ensure the callback list can only be fired once (like a Deferred) + * + * memory: will keep track of previous values and will call any callback added + * after the list has been fired right away with the latest "memorized" + * values (like a Deferred) + * + * unique: will ensure a callback can only be added once (no duplicate in the list) + * + * stopOnFalse: interrupt callings when a callback returns false + * + */ +jQuery.Callbacks = function( options ) { + + // Convert options from String-formatted to Object-formatted if needed + // (we check in cache first) + options = typeof options === "string" ? + createOptions( options ) : + jQuery.extend( {}, options ); + + var // Flag to know if list is currently firing + firing, + + // Last fire value for non-forgettable lists + memory, + + // Flag to know if list was already fired + fired, + + // Flag to prevent firing + locked, + + // Actual callback list + list = [], + + // Queue of execution data for repeatable lists + queue = [], + + // Index of currently firing callback (modified by add/remove as needed) + firingIndex = -1, + + // Fire callbacks + fire = function() { + + // Enforce single-firing + locked = locked || options.once; + + // Execute callbacks for all pending executions, + // respecting firingIndex overrides and runtime changes + fired = firing = true; + for ( ; queue.length; firingIndex = -1 ) { + memory = queue.shift(); + while ( ++firingIndex < list.length ) { + + // Run callback and check for early termination + if ( list[ firingIndex ].apply( memory[ 0 ], memory[ 1 ] ) === false && + options.stopOnFalse ) { + + // Jump to end and forget the data so .add doesn't re-fire + firingIndex = list.length; + memory = false; + } + } + } + + // Forget the data if we're done with it + if ( !options.memory ) { + memory = false; + } + + firing = false; + + // Clean up if we're done firing for good + if ( locked ) { + + // Keep an empty list if we have data for future add calls + if ( memory ) { + list = []; + + // Otherwise, this object is spent + } else { + list = ""; + } + } + }, + + // Actual Callbacks object + self = { + + // Add a callback or a collection of callbacks to the list + add: function() { + if ( list ) { + + // If we have memory from a past run, we should fire after adding + if ( memory && !firing ) { + firingIndex = list.length - 1; + queue.push( memory ); + } + + ( function add( args ) { + jQuery.each( args, function( _, arg ) { + if ( isFunction( arg ) ) { + if ( !options.unique || !self.has( arg ) ) { + list.push( arg ); + } + } else if ( arg && arg.length && toType( arg ) !== "string" ) { + + // Inspect recursively + add( arg ); + } + } ); + } )( arguments ); + + if ( memory && !firing ) { + fire(); + } + } + return this; + }, + + // Remove a callback from the list + remove: function() { + jQuery.each( arguments, function( _, arg ) { + var index; + while ( ( index = jQuery.inArray( arg, list, index ) ) > -1 ) { + list.splice( index, 1 ); + + // Handle firing indexes + if ( index <= firingIndex ) { + firingIndex--; + } + } + } ); + return this; + }, + + // Check if a given callback is in the list. + // If no argument is given, return whether or not list has callbacks attached. + has: function( fn ) { + return fn ? + jQuery.inArray( fn, list ) > -1 : + list.length > 0; + }, + + // Remove all callbacks from the list + empty: function() { + if ( list ) { + list = []; + } + return this; + }, + + // Disable .fire and .add + // Abort any current/pending executions + // Clear all callbacks and values + disable: function() { + locked = queue = []; + list = memory = ""; + return this; + }, + disabled: function() { + return !list; + }, + + // Disable .fire + // Also disable .add unless we have memory (since it would have no effect) + // Abort any pending executions + lock: function() { + locked = queue = []; + if ( !memory && !firing ) { + list = memory = ""; + } + return this; + }, + locked: function() { + return !!locked; + }, + + // Call all callbacks with the given context and arguments + fireWith: function( context, args ) { + if ( !locked ) { + args = args || []; + args = [ context, args.slice ? args.slice() : args ]; + queue.push( args ); + if ( !firing ) { + fire(); + } + } + return this; + }, + + // Call all the callbacks with the given arguments + fire: function() { + self.fireWith( this, arguments ); + return this; + }, + + // To know if the callbacks have already been called at least once + fired: function() { + return !!fired; + } + }; + + return self; +}; + + +function Identity( v ) { + return v; +} +function Thrower( ex ) { + throw ex; +} + +function adoptValue( value, resolve, reject, noValue ) { + var method; + + try { + + // Check for promise aspect first to privilege synchronous behavior + if ( value && isFunction( ( method = value.promise ) ) ) { + method.call( value ).done( resolve ).fail( reject ); + + // Other thenables + } else if ( value && isFunction( ( method = value.then ) ) ) { + method.call( value, resolve, reject ); + + // Other non-thenables + } else { + + // Control `resolve` arguments by letting Array#slice cast boolean `noValue` to integer: + // * false: [ value ].slice( 0 ) => resolve( value ) + // * true: [ value ].slice( 1 ) => resolve() + resolve.apply( undefined, [ value ].slice( noValue ) ); + } + + // For Promises/A+, convert exceptions into rejections + // Since jQuery.when doesn't unwrap thenables, we can skip the extra checks appearing in + // Deferred#then to conditionally suppress rejection. + } catch ( value ) { + + // Support: Android 4.0 only + // Strict mode functions invoked without .call/.apply get global-object context + reject.apply( undefined, [ value ] ); + } +} + +jQuery.extend( { + + Deferred: function( func ) { + var tuples = [ + + // action, add listener, callbacks, + // ... .then handlers, argument index, [final state] + [ "notify", "progress", jQuery.Callbacks( "memory" ), + jQuery.Callbacks( "memory" ), 2 ], + [ "resolve", "done", jQuery.Callbacks( "once memory" ), + jQuery.Callbacks( "once memory" ), 0, "resolved" ], + [ "reject", "fail", jQuery.Callbacks( "once memory" ), + jQuery.Callbacks( "once memory" ), 1, "rejected" ] + ], + state = "pending", + promise = { + state: function() { + return state; + }, + always: function() { + deferred.done( arguments ).fail( arguments ); + return this; + }, + "catch": function( fn ) { + return promise.then( null, fn ); + }, + + // Keep pipe for back-compat + pipe: function( /* fnDone, fnFail, fnProgress */ ) { + var fns = arguments; + + return jQuery.Deferred( function( newDefer ) { + jQuery.each( tuples, function( _i, tuple ) { + + // Map tuples (progress, done, fail) to arguments (done, fail, progress) + var fn = isFunction( fns[ tuple[ 4 ] ] ) && fns[ tuple[ 4 ] ]; + + // deferred.progress(function() { bind to newDefer or newDefer.notify }) + // deferred.done(function() { bind to newDefer or newDefer.resolve }) + // deferred.fail(function() { bind to newDefer or newDefer.reject }) + deferred[ tuple[ 1 ] ]( function() { + var returned = fn && fn.apply( this, arguments ); + if ( returned && isFunction( returned.promise ) ) { + returned.promise() + .progress( newDefer.notify ) + .done( newDefer.resolve ) + .fail( newDefer.reject ); + } else { + newDefer[ tuple[ 0 ] + "With" ]( + this, + fn ? [ returned ] : arguments + ); + } + } ); + } ); + fns = null; + } ).promise(); + }, + then: function( onFulfilled, onRejected, onProgress ) { + var maxDepth = 0; + function resolve( depth, deferred, handler, special ) { + return function() { + var that = this, + args = arguments, + mightThrow = function() { + var returned, then; + + // Support: Promises/A+ section 2.3.3.3.3 + // https://promisesaplus.com/#point-59 + // Ignore double-resolution attempts + if ( depth < maxDepth ) { + return; + } + + returned = handler.apply( that, args ); + + // Support: Promises/A+ section 2.3.1 + // https://promisesaplus.com/#point-48 + if ( returned === deferred.promise() ) { + throw new TypeError( "Thenable self-resolution" ); + } + + // Support: Promises/A+ sections 2.3.3.1, 3.5 + // https://promisesaplus.com/#point-54 + // https://promisesaplus.com/#point-75 + // Retrieve `then` only once + then = returned && + + // Support: Promises/A+ section 2.3.4 + // https://promisesaplus.com/#point-64 + // Only check objects and functions for thenability + ( typeof returned === "object" || + typeof returned === "function" ) && + returned.then; + + // Handle a returned thenable + if ( isFunction( then ) ) { + + // Special processors (notify) just wait for resolution + if ( special ) { + then.call( + returned, + resolve( maxDepth, deferred, Identity, special ), + resolve( maxDepth, deferred, Thrower, special ) + ); + + // Normal processors (resolve) also hook into progress + } else { + + // ...and disregard older resolution values + maxDepth++; + + then.call( + returned, + resolve( maxDepth, deferred, Identity, special ), + resolve( maxDepth, deferred, Thrower, special ), + resolve( maxDepth, deferred, Identity, + deferred.notifyWith ) + ); + } + + // Handle all other returned values + } else { + + // Only substitute handlers pass on context + // and multiple values (non-spec behavior) + if ( handler !== Identity ) { + that = undefined; + args = [ returned ]; + } + + // Process the value(s) + // Default process is resolve + ( special || deferred.resolveWith )( that, args ); + } + }, + + // Only normal processors (resolve) catch and reject exceptions + process = special ? + mightThrow : + function() { + try { + mightThrow(); + } catch ( e ) { + + if ( jQuery.Deferred.exceptionHook ) { + jQuery.Deferred.exceptionHook( e, + process.stackTrace ); + } + + // Support: Promises/A+ section 2.3.3.3.4.1 + // https://promisesaplus.com/#point-61 + // Ignore post-resolution exceptions + if ( depth + 1 >= maxDepth ) { + + // Only substitute handlers pass on context + // and multiple values (non-spec behavior) + if ( handler !== Thrower ) { + that = undefined; + args = [ e ]; + } + + deferred.rejectWith( that, args ); + } + } + }; + + // Support: Promises/A+ section 2.3.3.3.1 + // https://promisesaplus.com/#point-57 + // Re-resolve promises immediately to dodge false rejection from + // subsequent errors + if ( depth ) { + process(); + } else { + + // Call an optional hook to record the stack, in case of exception + // since it's otherwise lost when execution goes async + if ( jQuery.Deferred.getStackHook ) { + process.stackTrace = jQuery.Deferred.getStackHook(); + } + window.setTimeout( process ); + } + }; + } + + return jQuery.Deferred( function( newDefer ) { + + // progress_handlers.add( ... ) + tuples[ 0 ][ 3 ].add( + resolve( + 0, + newDefer, + isFunction( onProgress ) ? + onProgress : + Identity, + newDefer.notifyWith + ) + ); + + // fulfilled_handlers.add( ... ) + tuples[ 1 ][ 3 ].add( + resolve( + 0, + newDefer, + isFunction( onFulfilled ) ? + onFulfilled : + Identity + ) + ); + + // rejected_handlers.add( ... ) + tuples[ 2 ][ 3 ].add( + resolve( + 0, + newDefer, + isFunction( onRejected ) ? + onRejected : + Thrower + ) + ); + } ).promise(); + }, + + // Get a promise for this deferred + // If obj is provided, the promise aspect is added to the object + promise: function( obj ) { + return obj != null ? jQuery.extend( obj, promise ) : promise; + } + }, + deferred = {}; + + // Add list-specific methods + jQuery.each( tuples, function( i, tuple ) { + var list = tuple[ 2 ], + stateString = tuple[ 5 ]; + + // promise.progress = list.add + // promise.done = list.add + // promise.fail = list.add + promise[ tuple[ 1 ] ] = list.add; + + // Handle state + if ( stateString ) { + list.add( + function() { + + // state = "resolved" (i.e., fulfilled) + // state = "rejected" + state = stateString; + }, + + // rejected_callbacks.disable + // fulfilled_callbacks.disable + tuples[ 3 - i ][ 2 ].disable, + + // rejected_handlers.disable + // fulfilled_handlers.disable + tuples[ 3 - i ][ 3 ].disable, + + // progress_callbacks.lock + tuples[ 0 ][ 2 ].lock, + + // progress_handlers.lock + tuples[ 0 ][ 3 ].lock + ); + } + + // progress_handlers.fire + // fulfilled_handlers.fire + // rejected_handlers.fire + list.add( tuple[ 3 ].fire ); + + // deferred.notify = function() { deferred.notifyWith(...) } + // deferred.resolve = function() { deferred.resolveWith(...) } + // deferred.reject = function() { deferred.rejectWith(...) } + deferred[ tuple[ 0 ] ] = function() { + deferred[ tuple[ 0 ] + "With" ]( this === deferred ? undefined : this, arguments ); + return this; + }; + + // deferred.notifyWith = list.fireWith + // deferred.resolveWith = list.fireWith + // deferred.rejectWith = list.fireWith + deferred[ tuple[ 0 ] + "With" ] = list.fireWith; + } ); + + // Make the deferred a promise + promise.promise( deferred ); + + // Call given func if any + if ( func ) { + func.call( deferred, deferred ); + } + + // All done! + return deferred; + }, + + // Deferred helper + when: function( singleValue ) { + var + + // count of uncompleted subordinates + remaining = arguments.length, + + // count of unprocessed arguments + i = remaining, + + // subordinate fulfillment data + resolveContexts = Array( i ), + resolveValues = slice.call( arguments ), + + // the primary Deferred + primary = jQuery.Deferred(), + + // subordinate callback factory + updateFunc = function( i ) { + return function( value ) { + resolveContexts[ i ] = this; + resolveValues[ i ] = arguments.length > 1 ? slice.call( arguments ) : value; + if ( !( --remaining ) ) { + primary.resolveWith( resolveContexts, resolveValues ); + } + }; + }; + + // Single- and empty arguments are adopted like Promise.resolve + if ( remaining <= 1 ) { + adoptValue( singleValue, primary.done( updateFunc( i ) ).resolve, primary.reject, + !remaining ); + + // Use .then() to unwrap secondary thenables (cf. gh-3000) + if ( primary.state() === "pending" || + isFunction( resolveValues[ i ] && resolveValues[ i ].then ) ) { + + return primary.then(); + } + } + + // Multiple arguments are aggregated like Promise.all array elements + while ( i-- ) { + adoptValue( resolveValues[ i ], updateFunc( i ), primary.reject ); + } + + return primary.promise(); + } +} ); + + +// These usually indicate a programmer mistake during development, +// warn about them ASAP rather than swallowing them by default. +var rerrorNames = /^(Eval|Internal|Range|Reference|Syntax|Type|URI)Error$/; + +jQuery.Deferred.exceptionHook = function( error, stack ) { + + // Support: IE 8 - 9 only + // Console exists when dev tools are open, which can happen at any time + if ( window.console && window.console.warn && error && rerrorNames.test( error.name ) ) { + window.console.warn( "jQuery.Deferred exception: " + error.message, error.stack, stack ); + } +}; + + + + +jQuery.readyException = function( error ) { + window.setTimeout( function() { + throw error; + } ); +}; + + + + +// The deferred used on DOM ready +var readyList = jQuery.Deferred(); + +jQuery.fn.ready = function( fn ) { + + readyList + .then( fn ) + + // Wrap jQuery.readyException in a function so that the lookup + // happens at the time of error handling instead of callback + // registration. + .catch( function( error ) { + jQuery.readyException( error ); + } ); + + return this; +}; + +jQuery.extend( { + + // Is the DOM ready to be used? Set to true once it occurs. + isReady: false, + + // A counter to track how many items to wait for before + // the ready event fires. See #6781 + readyWait: 1, + + // Handle when the DOM is ready + ready: function( wait ) { + + // Abort if there are pending holds or we're already ready + if ( wait === true ? --jQuery.readyWait : jQuery.isReady ) { + return; + } + + // Remember that the DOM is ready + jQuery.isReady = true; + + // If a normal DOM Ready event fired, decrement, and wait if need be + if ( wait !== true && --jQuery.readyWait > 0 ) { + return; + } + + // If there are functions bound, to execute + readyList.resolveWith( document, [ jQuery ] ); + } +} ); + +jQuery.ready.then = readyList.then; + +// The ready event handler and self cleanup method +function completed() { + document.removeEventListener( "DOMContentLoaded", completed ); + window.removeEventListener( "load", completed ); + jQuery.ready(); +} + +// Catch cases where $(document).ready() is called +// after the browser event has already occurred. +// Support: IE <=9 - 10 only +// Older IE sometimes signals "interactive" too soon +if ( document.readyState === "complete" || + ( document.readyState !== "loading" && !document.documentElement.doScroll ) ) { + + // Handle it asynchronously to allow scripts the opportunity to delay ready + window.setTimeout( jQuery.ready ); + +} else { + + // Use the handy event callback + document.addEventListener( "DOMContentLoaded", completed ); + + // A fallback to window.onload, that will always work + window.addEventListener( "load", completed ); +} + + + + +// Multifunctional method to get and set values of a collection +// The value/s can optionally be executed if it's a function +var access = function( elems, fn, key, value, chainable, emptyGet, raw ) { + var i = 0, + len = elems.length, + bulk = key == null; + + // Sets many values + if ( toType( key ) === "object" ) { + chainable = true; + for ( i in key ) { + access( elems, fn, i, key[ i ], true, emptyGet, raw ); + } + + // Sets one value + } else if ( value !== undefined ) { + chainable = true; + + if ( !isFunction( value ) ) { + raw = true; + } + + if ( bulk ) { + + // Bulk operations run against the entire set + if ( raw ) { + fn.call( elems, value ); + fn = null; + + // ...except when executing function values + } else { + bulk = fn; + fn = function( elem, _key, value ) { + return bulk.call( jQuery( elem ), value ); + }; + } + } + + if ( fn ) { + for ( ; i < len; i++ ) { + fn( + elems[ i ], key, raw ? + value : + value.call( elems[ i ], i, fn( elems[ i ], key ) ) + ); + } + } + } + + if ( chainable ) { + return elems; + } + + // Gets + if ( bulk ) { + return fn.call( elems ); + } + + return len ? fn( elems[ 0 ], key ) : emptyGet; +}; + + +// Matches dashed string for camelizing +var rmsPrefix = /^-ms-/, + rdashAlpha = /-([a-z])/g; + +// Used by camelCase as callback to replace() +function fcamelCase( _all, letter ) { + return letter.toUpperCase(); +} + +// Convert dashed to camelCase; used by the css and data modules +// Support: IE <=9 - 11, Edge 12 - 15 +// Microsoft forgot to hump their vendor prefix (#9572) +function camelCase( string ) { + return string.replace( rmsPrefix, "ms-" ).replace( rdashAlpha, fcamelCase ); +} +var acceptData = function( owner ) { + + // Accepts only: + // - Node + // - Node.ELEMENT_NODE + // - Node.DOCUMENT_NODE + // - Object + // - Any + return owner.nodeType === 1 || owner.nodeType === 9 || !( +owner.nodeType ); +}; + + + + +function Data() { + this.expando = jQuery.expando + Data.uid++; +} + +Data.uid = 1; + +Data.prototype = { + + cache: function( owner ) { + + // Check if the owner object already has a cache + var value = owner[ this.expando ]; + + // If not, create one + if ( !value ) { + value = {}; + + // We can accept data for non-element nodes in modern browsers, + // but we should not, see #8335. + // Always return an empty object. + if ( acceptData( owner ) ) { + + // If it is a node unlikely to be stringify-ed or looped over + // use plain assignment + if ( owner.nodeType ) { + owner[ this.expando ] = value; + + // Otherwise secure it in a non-enumerable property + // configurable must be true to allow the property to be + // deleted when data is removed + } else { + Object.defineProperty( owner, this.expando, { + value: value, + configurable: true + } ); + } + } + } + + return value; + }, + set: function( owner, data, value ) { + var prop, + cache = this.cache( owner ); + + // Handle: [ owner, key, value ] args + // Always use camelCase key (gh-2257) + if ( typeof data === "string" ) { + cache[ camelCase( data ) ] = value; + + // Handle: [ owner, { properties } ] args + } else { + + // Copy the properties one-by-one to the cache object + for ( prop in data ) { + cache[ camelCase( prop ) ] = data[ prop ]; + } + } + return cache; + }, + get: function( owner, key ) { + return key === undefined ? + this.cache( owner ) : + + // Always use camelCase key (gh-2257) + owner[ this.expando ] && owner[ this.expando ][ camelCase( key ) ]; + }, + access: function( owner, key, value ) { + + // In cases where either: + // + // 1. No key was specified + // 2. A string key was specified, but no value provided + // + // Take the "read" path and allow the get method to determine + // which value to return, respectively either: + // + // 1. The entire cache object + // 2. The data stored at the key + // + if ( key === undefined || + ( ( key && typeof key === "string" ) && value === undefined ) ) { + + return this.get( owner, key ); + } + + // When the key is not a string, or both a key and value + // are specified, set or extend (existing objects) with either: + // + // 1. An object of properties + // 2. A key and value + // + this.set( owner, key, value ); + + // Since the "set" path can have two possible entry points + // return the expected data based on which path was taken[*] + return value !== undefined ? value : key; + }, + remove: function( owner, key ) { + var i, + cache = owner[ this.expando ]; + + if ( cache === undefined ) { + return; + } + + if ( key !== undefined ) { + + // Support array or space separated string of keys + if ( Array.isArray( key ) ) { + + // If key is an array of keys... + // We always set camelCase keys, so remove that. + key = key.map( camelCase ); + } else { + key = camelCase( key ); + + // If a key with the spaces exists, use it. + // Otherwise, create an array by matching non-whitespace + key = key in cache ? + [ key ] : + ( key.match( rnothtmlwhite ) || [] ); + } + + i = key.length; + + while ( i-- ) { + delete cache[ key[ i ] ]; + } + } + + // Remove the expando if there's no more data + if ( key === undefined || jQuery.isEmptyObject( cache ) ) { + + // Support: Chrome <=35 - 45 + // Webkit & Blink performance suffers when deleting properties + // from DOM nodes, so set to undefined instead + // https://bugs.chromium.org/p/chromium/issues/detail?id=378607 (bug restricted) + if ( owner.nodeType ) { + owner[ this.expando ] = undefined; + } else { + delete owner[ this.expando ]; + } + } + }, + hasData: function( owner ) { + var cache = owner[ this.expando ]; + return cache !== undefined && !jQuery.isEmptyObject( cache ); + } +}; +var dataPriv = new Data(); + +var dataUser = new Data(); + + + +// Implementation Summary +// +// 1. Enforce API surface and semantic compatibility with 1.9.x branch +// 2. Improve the module's maintainability by reducing the storage +// paths to a single mechanism. +// 3. Use the same single mechanism to support "private" and "user" data. +// 4. _Never_ expose "private" data to user code (TODO: Drop _data, _removeData) +// 5. Avoid exposing implementation details on user objects (eg. expando properties) +// 6. Provide a clear path for implementation upgrade to WeakMap in 2014 + +var rbrace = /^(?:\{[\w\W]*\}|\[[\w\W]*\])$/, + rmultiDash = /[A-Z]/g; + +function getData( data ) { + if ( data === "true" ) { + return true; + } + + if ( data === "false" ) { + return false; + } + + if ( data === "null" ) { + return null; + } + + // Only convert to a number if it doesn't change the string + if ( data === +data + "" ) { + return +data; + } + + if ( rbrace.test( data ) ) { + return JSON.parse( data ); + } + + return data; +} + +function dataAttr( elem, key, data ) { + var name; + + // If nothing was found internally, try to fetch any + // data from the HTML5 data-* attribute + if ( data === undefined && elem.nodeType === 1 ) { + name = "data-" + key.replace( rmultiDash, "-$&" ).toLowerCase(); + data = elem.getAttribute( name ); + + if ( typeof data === "string" ) { + try { + data = getData( data ); + } catch ( e ) {} + + // Make sure we set the data so it isn't changed later + dataUser.set( elem, key, data ); + } else { + data = undefined; + } + } + return data; +} + +jQuery.extend( { + hasData: function( elem ) { + return dataUser.hasData( elem ) || dataPriv.hasData( elem ); + }, + + data: function( elem, name, data ) { + return dataUser.access( elem, name, data ); + }, + + removeData: function( elem, name ) { + dataUser.remove( elem, name ); + }, + + // TODO: Now that all calls to _data and _removeData have been replaced + // with direct calls to dataPriv methods, these can be deprecated. + _data: function( elem, name, data ) { + return dataPriv.access( elem, name, data ); + }, + + _removeData: function( elem, name ) { + dataPriv.remove( elem, name ); + } +} ); + +jQuery.fn.extend( { + data: function( key, value ) { + var i, name, data, + elem = this[ 0 ], + attrs = elem && elem.attributes; + + // Gets all values + if ( key === undefined ) { + if ( this.length ) { + data = dataUser.get( elem ); + + if ( elem.nodeType === 1 && !dataPriv.get( elem, "hasDataAttrs" ) ) { + i = attrs.length; + while ( i-- ) { + + // Support: IE 11 only + // The attrs elements can be null (#14894) + if ( attrs[ i ] ) { + name = attrs[ i ].name; + if ( name.indexOf( "data-" ) === 0 ) { + name = camelCase( name.slice( 5 ) ); + dataAttr( elem, name, data[ name ] ); + } + } + } + dataPriv.set( elem, "hasDataAttrs", true ); + } + } + + return data; + } + + // Sets multiple values + if ( typeof key === "object" ) { + return this.each( function() { + dataUser.set( this, key ); + } ); + } + + return access( this, function( value ) { + var data; + + // The calling jQuery object (element matches) is not empty + // (and therefore has an element appears at this[ 0 ]) and the + // `value` parameter was not undefined. An empty jQuery object + // will result in `undefined` for elem = this[ 0 ] which will + // throw an exception if an attempt to read a data cache is made. + if ( elem && value === undefined ) { + + // Attempt to get data from the cache + // The key will always be camelCased in Data + data = dataUser.get( elem, key ); + if ( data !== undefined ) { + return data; + } + + // Attempt to "discover" the data in + // HTML5 custom data-* attrs + data = dataAttr( elem, key ); + if ( data !== undefined ) { + return data; + } + + // We tried really hard, but the data doesn't exist. + return; + } + + // Set the data... + this.each( function() { + + // We always store the camelCased key + dataUser.set( this, key, value ); + } ); + }, null, value, arguments.length > 1, null, true ); + }, + + removeData: function( key ) { + return this.each( function() { + dataUser.remove( this, key ); + } ); + } +} ); + + +jQuery.extend( { + queue: function( elem, type, data ) { + var queue; + + if ( elem ) { + type = ( type || "fx" ) + "queue"; + queue = dataPriv.get( elem, type ); + + // Speed up dequeue by getting out quickly if this is just a lookup + if ( data ) { + if ( !queue || Array.isArray( data ) ) { + queue = dataPriv.access( elem, type, jQuery.makeArray( data ) ); + } else { + queue.push( data ); + } + } + return queue || []; + } + }, + + dequeue: function( elem, type ) { + type = type || "fx"; + + var queue = jQuery.queue( elem, type ), + startLength = queue.length, + fn = queue.shift(), + hooks = jQuery._queueHooks( elem, type ), + next = function() { + jQuery.dequeue( elem, type ); + }; + + // If the fx queue is dequeued, always remove the progress sentinel + if ( fn === "inprogress" ) { + fn = queue.shift(); + startLength--; + } + + if ( fn ) { + + // Add a progress sentinel to prevent the fx queue from being + // automatically dequeued + if ( type === "fx" ) { + queue.unshift( "inprogress" ); + } + + // Clear up the last queue stop function + delete hooks.stop; + fn.call( elem, next, hooks ); + } + + if ( !startLength && hooks ) { + hooks.empty.fire(); + } + }, + + // Not public - generate a queueHooks object, or return the current one + _queueHooks: function( elem, type ) { + var key = type + "queueHooks"; + return dataPriv.get( elem, key ) || dataPriv.access( elem, key, { + empty: jQuery.Callbacks( "once memory" ).add( function() { + dataPriv.remove( elem, [ type + "queue", key ] ); + } ) + } ); + } +} ); + +jQuery.fn.extend( { + queue: function( type, data ) { + var setter = 2; + + if ( typeof type !== "string" ) { + data = type; + type = "fx"; + setter--; + } + + if ( arguments.length < setter ) { + return jQuery.queue( this[ 0 ], type ); + } + + return data === undefined ? + this : + this.each( function() { + var queue = jQuery.queue( this, type, data ); + + // Ensure a hooks for this queue + jQuery._queueHooks( this, type ); + + if ( type === "fx" && queue[ 0 ] !== "inprogress" ) { + jQuery.dequeue( this, type ); + } + } ); + }, + dequeue: function( type ) { + return this.each( function() { + jQuery.dequeue( this, type ); + } ); + }, + clearQueue: function( type ) { + return this.queue( type || "fx", [] ); + }, + + // Get a promise resolved when queues of a certain type + // are emptied (fx is the type by default) + promise: function( type, obj ) { + var tmp, + count = 1, + defer = jQuery.Deferred(), + elements = this, + i = this.length, + resolve = function() { + if ( !( --count ) ) { + defer.resolveWith( elements, [ elements ] ); + } + }; + + if ( typeof type !== "string" ) { + obj = type; + type = undefined; + } + type = type || "fx"; + + while ( i-- ) { + tmp = dataPriv.get( elements[ i ], type + "queueHooks" ); + if ( tmp && tmp.empty ) { + count++; + tmp.empty.add( resolve ); + } + } + resolve(); + return defer.promise( obj ); + } +} ); +var pnum = ( /[+-]?(?:\d*\.|)\d+(?:[eE][+-]?\d+|)/ ).source; + +var rcssNum = new RegExp( "^(?:([+-])=|)(" + pnum + ")([a-z%]*)$", "i" ); + + +var cssExpand = [ "Top", "Right", "Bottom", "Left" ]; + +var documentElement = document.documentElement; + + + + var isAttached = function( elem ) { + return jQuery.contains( elem.ownerDocument, elem ); + }, + composed = { composed: true }; + + // Support: IE 9 - 11+, Edge 12 - 18+, iOS 10.0 - 10.2 only + // Check attachment across shadow DOM boundaries when possible (gh-3504) + // Support: iOS 10.0-10.2 only + // Early iOS 10 versions support `attachShadow` but not `getRootNode`, + // leading to errors. We need to check for `getRootNode`. + if ( documentElement.getRootNode ) { + isAttached = function( elem ) { + return jQuery.contains( elem.ownerDocument, elem ) || + elem.getRootNode( composed ) === elem.ownerDocument; + }; + } +var isHiddenWithinTree = function( elem, el ) { + + // isHiddenWithinTree might be called from jQuery#filter function; + // in that case, element will be second argument + elem = el || elem; + + // Inline style trumps all + return elem.style.display === "none" || + elem.style.display === "" && + + // Otherwise, check computed style + // Support: Firefox <=43 - 45 + // Disconnected elements can have computed display: none, so first confirm that elem is + // in the document. + isAttached( elem ) && + + jQuery.css( elem, "display" ) === "none"; + }; + + + +function adjustCSS( elem, prop, valueParts, tween ) { + var adjusted, scale, + maxIterations = 20, + currentValue = tween ? + function() { + return tween.cur(); + } : + function() { + return jQuery.css( elem, prop, "" ); + }, + initial = currentValue(), + unit = valueParts && valueParts[ 3 ] || ( jQuery.cssNumber[ prop ] ? "" : "px" ), + + // Starting value computation is required for potential unit mismatches + initialInUnit = elem.nodeType && + ( jQuery.cssNumber[ prop ] || unit !== "px" && +initial ) && + rcssNum.exec( jQuery.css( elem, prop ) ); + + if ( initialInUnit && initialInUnit[ 3 ] !== unit ) { + + // Support: Firefox <=54 + // Halve the iteration target value to prevent interference from CSS upper bounds (gh-2144) + initial = initial / 2; + + // Trust units reported by jQuery.css + unit = unit || initialInUnit[ 3 ]; + + // Iteratively approximate from a nonzero starting point + initialInUnit = +initial || 1; + + while ( maxIterations-- ) { + + // Evaluate and update our best guess (doubling guesses that zero out). + // Finish if the scale equals or crosses 1 (making the old*new product non-positive). + jQuery.style( elem, prop, initialInUnit + unit ); + if ( ( 1 - scale ) * ( 1 - ( scale = currentValue() / initial || 0.5 ) ) <= 0 ) { + maxIterations = 0; + } + initialInUnit = initialInUnit / scale; + + } + + initialInUnit = initialInUnit * 2; + jQuery.style( elem, prop, initialInUnit + unit ); + + // Make sure we update the tween properties later on + valueParts = valueParts || []; + } + + if ( valueParts ) { + initialInUnit = +initialInUnit || +initial || 0; + + // Apply relative offset (+=/-=) if specified + adjusted = valueParts[ 1 ] ? + initialInUnit + ( valueParts[ 1 ] + 1 ) * valueParts[ 2 ] : + +valueParts[ 2 ]; + if ( tween ) { + tween.unit = unit; + tween.start = initialInUnit; + tween.end = adjusted; + } + } + return adjusted; +} + + +var defaultDisplayMap = {}; + +function getDefaultDisplay( elem ) { + var temp, + doc = elem.ownerDocument, + nodeName = elem.nodeName, + display = defaultDisplayMap[ nodeName ]; + + if ( display ) { + return display; + } + + temp = doc.body.appendChild( doc.createElement( nodeName ) ); + display = jQuery.css( temp, "display" ); + + temp.parentNode.removeChild( temp ); + + if ( display === "none" ) { + display = "block"; + } + defaultDisplayMap[ nodeName ] = display; + + return display; +} + +function showHide( elements, show ) { + var display, elem, + values = [], + index = 0, + length = elements.length; + + // Determine new display value for elements that need to change + for ( ; index < length; index++ ) { + elem = elements[ index ]; + if ( !elem.style ) { + continue; + } + + display = elem.style.display; + if ( show ) { + + // Since we force visibility upon cascade-hidden elements, an immediate (and slow) + // check is required in this first loop unless we have a nonempty display value (either + // inline or about-to-be-restored) + if ( display === "none" ) { + values[ index ] = dataPriv.get( elem, "display" ) || null; + if ( !values[ index ] ) { + elem.style.display = ""; + } + } + if ( elem.style.display === "" && isHiddenWithinTree( elem ) ) { + values[ index ] = getDefaultDisplay( elem ); + } + } else { + if ( display !== "none" ) { + values[ index ] = "none"; + + // Remember what we're overwriting + dataPriv.set( elem, "display", display ); + } + } + } + + // Set the display of the elements in a second loop to avoid constant reflow + for ( index = 0; index < length; index++ ) { + if ( values[ index ] != null ) { + elements[ index ].style.display = values[ index ]; + } + } + + return elements; +} + +jQuery.fn.extend( { + show: function() { + return showHide( this, true ); + }, + hide: function() { + return showHide( this ); + }, + toggle: function( state ) { + if ( typeof state === "boolean" ) { + return state ? this.show() : this.hide(); + } + + return this.each( function() { + if ( isHiddenWithinTree( this ) ) { + jQuery( this ).show(); + } else { + jQuery( this ).hide(); + } + } ); + } +} ); +var rcheckableType = ( /^(?:checkbox|radio)$/i ); + +var rtagName = ( /<([a-z][^\/\0>\x20\t\r\n\f]*)/i ); + +var rscriptType = ( /^$|^module$|\/(?:java|ecma)script/i ); + + + +( function() { + var fragment = document.createDocumentFragment(), + div = fragment.appendChild( document.createElement( "div" ) ), + input = document.createElement( "input" ); + + // Support: Android 4.0 - 4.3 only + // Check state lost if the name is set (#11217) + // Support: Windows Web Apps (WWA) + // `name` and `type` must use .setAttribute for WWA (#14901) + input.setAttribute( "type", "radio" ); + input.setAttribute( "checked", "checked" ); + input.setAttribute( "name", "t" ); + + div.appendChild( input ); + + // Support: Android <=4.1 only + // Older WebKit doesn't clone checked state correctly in fragments + support.checkClone = div.cloneNode( true ).cloneNode( true ).lastChild.checked; + + // Support: IE <=11 only + // Make sure textarea (and checkbox) defaultValue is properly cloned + div.innerHTML = ""; + support.noCloneChecked = !!div.cloneNode( true ).lastChild.defaultValue; + + // Support: IE <=9 only + // IE <=9 replaces "; + support.option = !!div.lastChild; +} )(); + + +// We have to close these tags to support XHTML (#13200) +var wrapMap = { + + // XHTML parsers do not magically insert elements in the + // same way that tag soup parsers do. So we cannot shorten + // this by omitting or other required elements. + thead: [ 1, "", "
" ], + col: [ 2, "", "
" ], + tr: [ 2, "", "
" ], + td: [ 3, "", "
" ], + + _default: [ 0, "", "" ] +}; + +wrapMap.tbody = wrapMap.tfoot = wrapMap.colgroup = wrapMap.caption = wrapMap.thead; +wrapMap.th = wrapMap.td; + +// Support: IE <=9 only +if ( !support.option ) { + wrapMap.optgroup = wrapMap.option = [ 1, "" ]; +} + + +function getAll( context, tag ) { + + // Support: IE <=9 - 11 only + // Use typeof to avoid zero-argument method invocation on host objects (#15151) + var ret; + + if ( typeof context.getElementsByTagName !== "undefined" ) { + ret = context.getElementsByTagName( tag || "*" ); + + } else if ( typeof context.querySelectorAll !== "undefined" ) { + ret = context.querySelectorAll( tag || "*" ); + + } else { + ret = []; + } + + if ( tag === undefined || tag && nodeName( context, tag ) ) { + return jQuery.merge( [ context ], ret ); + } + + return ret; +} + + +// Mark scripts as having already been evaluated +function setGlobalEval( elems, refElements ) { + var i = 0, + l = elems.length; + + for ( ; i < l; i++ ) { + dataPriv.set( + elems[ i ], + "globalEval", + !refElements || dataPriv.get( refElements[ i ], "globalEval" ) + ); + } +} + + +var rhtml = /<|&#?\w+;/; + +function buildFragment( elems, context, scripts, selection, ignored ) { + var elem, tmp, tag, wrap, attached, j, + fragment = context.createDocumentFragment(), + nodes = [], + i = 0, + l = elems.length; + + for ( ; i < l; i++ ) { + elem = elems[ i ]; + + if ( elem || elem === 0 ) { + + // Add nodes directly + if ( toType( elem ) === "object" ) { + + // Support: Android <=4.0 only, PhantomJS 1 only + // push.apply(_, arraylike) throws on ancient WebKit + jQuery.merge( nodes, elem.nodeType ? [ elem ] : elem ); + + // Convert non-html into a text node + } else if ( !rhtml.test( elem ) ) { + nodes.push( context.createTextNode( elem ) ); + + // Convert html into DOM nodes + } else { + tmp = tmp || fragment.appendChild( context.createElement( "div" ) ); + + // Deserialize a standard representation + tag = ( rtagName.exec( elem ) || [ "", "" ] )[ 1 ].toLowerCase(); + wrap = wrapMap[ tag ] || wrapMap._default; + tmp.innerHTML = wrap[ 1 ] + jQuery.htmlPrefilter( elem ) + wrap[ 2 ]; + + // Descend through wrappers to the right content + j = wrap[ 0 ]; + while ( j-- ) { + tmp = tmp.lastChild; + } + + // Support: Android <=4.0 only, PhantomJS 1 only + // push.apply(_, arraylike) throws on ancient WebKit + jQuery.merge( nodes, tmp.childNodes ); + + // Remember the top-level container + tmp = fragment.firstChild; + + // Ensure the created nodes are orphaned (#12392) + tmp.textContent = ""; + } + } + } + + // Remove wrapper from fragment + fragment.textContent = ""; + + i = 0; + while ( ( elem = nodes[ i++ ] ) ) { + + // Skip elements already in the context collection (trac-4087) + if ( selection && jQuery.inArray( elem, selection ) > -1 ) { + if ( ignored ) { + ignored.push( elem ); + } + continue; + } + + attached = isAttached( elem ); + + // Append to fragment + tmp = getAll( fragment.appendChild( elem ), "script" ); + + // Preserve script evaluation history + if ( attached ) { + setGlobalEval( tmp ); + } + + // Capture executables + if ( scripts ) { + j = 0; + while ( ( elem = tmp[ j++ ] ) ) { + if ( rscriptType.test( elem.type || "" ) ) { + scripts.push( elem ); + } + } + } + } + + return fragment; +} + + +var rtypenamespace = /^([^.]*)(?:\.(.+)|)/; + +function returnTrue() { + return true; +} + +function returnFalse() { + return false; +} + +// Support: IE <=9 - 11+ +// focus() and blur() are asynchronous, except when they are no-op. +// So expect focus to be synchronous when the element is already active, +// and blur to be synchronous when the element is not already active. +// (focus and blur are always synchronous in other supported browsers, +// this just defines when we can count on it). +function expectSync( elem, type ) { + return ( elem === safeActiveElement() ) === ( type === "focus" ); +} + +// Support: IE <=9 only +// Accessing document.activeElement can throw unexpectedly +// https://bugs.jquery.com/ticket/13393 +function safeActiveElement() { + try { + return document.activeElement; + } catch ( err ) { } +} + +function on( elem, types, selector, data, fn, one ) { + var origFn, type; + + // Types can be a map of types/handlers + if ( typeof types === "object" ) { + + // ( types-Object, selector, data ) + if ( typeof selector !== "string" ) { + + // ( types-Object, data ) + data = data || selector; + selector = undefined; + } + for ( type in types ) { + on( elem, type, selector, data, types[ type ], one ); + } + return elem; + } + + if ( data == null && fn == null ) { + + // ( types, fn ) + fn = selector; + data = selector = undefined; + } else if ( fn == null ) { + if ( typeof selector === "string" ) { + + // ( types, selector, fn ) + fn = data; + data = undefined; + } else { + + // ( types, data, fn ) + fn = data; + data = selector; + selector = undefined; + } + } + if ( fn === false ) { + fn = returnFalse; + } else if ( !fn ) { + return elem; + } + + if ( one === 1 ) { + origFn = fn; + fn = function( event ) { + + // Can use an empty set, since event contains the info + jQuery().off( event ); + return origFn.apply( this, arguments ); + }; + + // Use same guid so caller can remove using origFn + fn.guid = origFn.guid || ( origFn.guid = jQuery.guid++ ); + } + return elem.each( function() { + jQuery.event.add( this, types, fn, data, selector ); + } ); +} + +/* + * Helper functions for managing events -- not part of the public interface. + * Props to Dean Edwards' addEvent library for many of the ideas. + */ +jQuery.event = { + + global: {}, + + add: function( elem, types, handler, data, selector ) { + + var handleObjIn, eventHandle, tmp, + events, t, handleObj, + special, handlers, type, namespaces, origType, + elemData = dataPriv.get( elem ); + + // Only attach events to objects that accept data + if ( !acceptData( elem ) ) { + return; + } + + // Caller can pass in an object of custom data in lieu of the handler + if ( handler.handler ) { + handleObjIn = handler; + handler = handleObjIn.handler; + selector = handleObjIn.selector; + } + + // Ensure that invalid selectors throw exceptions at attach time + // Evaluate against documentElement in case elem is a non-element node (e.g., document) + if ( selector ) { + jQuery.find.matchesSelector( documentElement, selector ); + } + + // Make sure that the handler has a unique ID, used to find/remove it later + if ( !handler.guid ) { + handler.guid = jQuery.guid++; + } + + // Init the element's event structure and main handler, if this is the first + if ( !( events = elemData.events ) ) { + events = elemData.events = Object.create( null ); + } + if ( !( eventHandle = elemData.handle ) ) { + eventHandle = elemData.handle = function( e ) { + + // Discard the second event of a jQuery.event.trigger() and + // when an event is called after a page has unloaded + return typeof jQuery !== "undefined" && jQuery.event.triggered !== e.type ? + jQuery.event.dispatch.apply( elem, arguments ) : undefined; + }; + } + + // Handle multiple events separated by a space + types = ( types || "" ).match( rnothtmlwhite ) || [ "" ]; + t = types.length; + while ( t-- ) { + tmp = rtypenamespace.exec( types[ t ] ) || []; + type = origType = tmp[ 1 ]; + namespaces = ( tmp[ 2 ] || "" ).split( "." ).sort(); + + // There *must* be a type, no attaching namespace-only handlers + if ( !type ) { + continue; + } + + // If event changes its type, use the special event handlers for the changed type + special = jQuery.event.special[ type ] || {}; + + // If selector defined, determine special event api type, otherwise given type + type = ( selector ? special.delegateType : special.bindType ) || type; + + // Update special based on newly reset type + special = jQuery.event.special[ type ] || {}; + + // handleObj is passed to all event handlers + handleObj = jQuery.extend( { + type: type, + origType: origType, + data: data, + handler: handler, + guid: handler.guid, + selector: selector, + needsContext: selector && jQuery.expr.match.needsContext.test( selector ), + namespace: namespaces.join( "." ) + }, handleObjIn ); + + // Init the event handler queue if we're the first + if ( !( handlers = events[ type ] ) ) { + handlers = events[ type ] = []; + handlers.delegateCount = 0; + + // Only use addEventListener if the special events handler returns false + if ( !special.setup || + special.setup.call( elem, data, namespaces, eventHandle ) === false ) { + + if ( elem.addEventListener ) { + elem.addEventListener( type, eventHandle ); + } + } + } + + if ( special.add ) { + special.add.call( elem, handleObj ); + + if ( !handleObj.handler.guid ) { + handleObj.handler.guid = handler.guid; + } + } + + // Add to the element's handler list, delegates in front + if ( selector ) { + handlers.splice( handlers.delegateCount++, 0, handleObj ); + } else { + handlers.push( handleObj ); + } + + // Keep track of which events have ever been used, for event optimization + jQuery.event.global[ type ] = true; + } + + }, + + // Detach an event or set of events from an element + remove: function( elem, types, handler, selector, mappedTypes ) { + + var j, origCount, tmp, + events, t, handleObj, + special, handlers, type, namespaces, origType, + elemData = dataPriv.hasData( elem ) && dataPriv.get( elem ); + + if ( !elemData || !( events = elemData.events ) ) { + return; + } + + // Once for each type.namespace in types; type may be omitted + types = ( types || "" ).match( rnothtmlwhite ) || [ "" ]; + t = types.length; + while ( t-- ) { + tmp = rtypenamespace.exec( types[ t ] ) || []; + type = origType = tmp[ 1 ]; + namespaces = ( tmp[ 2 ] || "" ).split( "." ).sort(); + + // Unbind all events (on this namespace, if provided) for the element + if ( !type ) { + for ( type in events ) { + jQuery.event.remove( elem, type + types[ t ], handler, selector, true ); + } + continue; + } + + special = jQuery.event.special[ type ] || {}; + type = ( selector ? special.delegateType : special.bindType ) || type; + handlers = events[ type ] || []; + tmp = tmp[ 2 ] && + new RegExp( "(^|\\.)" + namespaces.join( "\\.(?:.*\\.|)" ) + "(\\.|$)" ); + + // Remove matching events + origCount = j = handlers.length; + while ( j-- ) { + handleObj = handlers[ j ]; + + if ( ( mappedTypes || origType === handleObj.origType ) && + ( !handler || handler.guid === handleObj.guid ) && + ( !tmp || tmp.test( handleObj.namespace ) ) && + ( !selector || selector === handleObj.selector || + selector === "**" && handleObj.selector ) ) { + handlers.splice( j, 1 ); + + if ( handleObj.selector ) { + handlers.delegateCount--; + } + if ( special.remove ) { + special.remove.call( elem, handleObj ); + } + } + } + + // Remove generic event handler if we removed something and no more handlers exist + // (avoids potential for endless recursion during removal of special event handlers) + if ( origCount && !handlers.length ) { + if ( !special.teardown || + special.teardown.call( elem, namespaces, elemData.handle ) === false ) { + + jQuery.removeEvent( elem, type, elemData.handle ); + } + + delete events[ type ]; + } + } + + // Remove data and the expando if it's no longer used + if ( jQuery.isEmptyObject( events ) ) { + dataPriv.remove( elem, "handle events" ); + } + }, + + dispatch: function( nativeEvent ) { + + var i, j, ret, matched, handleObj, handlerQueue, + args = new Array( arguments.length ), + + // Make a writable jQuery.Event from the native event object + event = jQuery.event.fix( nativeEvent ), + + handlers = ( + dataPriv.get( this, "events" ) || Object.create( null ) + )[ event.type ] || [], + special = jQuery.event.special[ event.type ] || {}; + + // Use the fix-ed jQuery.Event rather than the (read-only) native event + args[ 0 ] = event; + + for ( i = 1; i < arguments.length; i++ ) { + args[ i ] = arguments[ i ]; + } + + event.delegateTarget = this; + + // Call the preDispatch hook for the mapped type, and let it bail if desired + if ( special.preDispatch && special.preDispatch.call( this, event ) === false ) { + return; + } + + // Determine handlers + handlerQueue = jQuery.event.handlers.call( this, event, handlers ); + + // Run delegates first; they may want to stop propagation beneath us + i = 0; + while ( ( matched = handlerQueue[ i++ ] ) && !event.isPropagationStopped() ) { + event.currentTarget = matched.elem; + + j = 0; + while ( ( handleObj = matched.handlers[ j++ ] ) && + !event.isImmediatePropagationStopped() ) { + + // If the event is namespaced, then each handler is only invoked if it is + // specially universal or its namespaces are a superset of the event's. + if ( !event.rnamespace || handleObj.namespace === false || + event.rnamespace.test( handleObj.namespace ) ) { + + event.handleObj = handleObj; + event.data = handleObj.data; + + ret = ( ( jQuery.event.special[ handleObj.origType ] || {} ).handle || + handleObj.handler ).apply( matched.elem, args ); + + if ( ret !== undefined ) { + if ( ( event.result = ret ) === false ) { + event.preventDefault(); + event.stopPropagation(); + } + } + } + } + } + + // Call the postDispatch hook for the mapped type + if ( special.postDispatch ) { + special.postDispatch.call( this, event ); + } + + return event.result; + }, + + handlers: function( event, handlers ) { + var i, handleObj, sel, matchedHandlers, matchedSelectors, + handlerQueue = [], + delegateCount = handlers.delegateCount, + cur = event.target; + + // Find delegate handlers + if ( delegateCount && + + // Support: IE <=9 + // Black-hole SVG instance trees (trac-13180) + cur.nodeType && + + // Support: Firefox <=42 + // Suppress spec-violating clicks indicating a non-primary pointer button (trac-3861) + // https://www.w3.org/TR/DOM-Level-3-Events/#event-type-click + // Support: IE 11 only + // ...but not arrow key "clicks" of radio inputs, which can have `button` -1 (gh-2343) + !( event.type === "click" && event.button >= 1 ) ) { + + for ( ; cur !== this; cur = cur.parentNode || this ) { + + // Don't check non-elements (#13208) + // Don't process clicks on disabled elements (#6911, #8165, #11382, #11764) + if ( cur.nodeType === 1 && !( event.type === "click" && cur.disabled === true ) ) { + matchedHandlers = []; + matchedSelectors = {}; + for ( i = 0; i < delegateCount; i++ ) { + handleObj = handlers[ i ]; + + // Don't conflict with Object.prototype properties (#13203) + sel = handleObj.selector + " "; + + if ( matchedSelectors[ sel ] === undefined ) { + matchedSelectors[ sel ] = handleObj.needsContext ? + jQuery( sel, this ).index( cur ) > -1 : + jQuery.find( sel, this, null, [ cur ] ).length; + } + if ( matchedSelectors[ sel ] ) { + matchedHandlers.push( handleObj ); + } + } + if ( matchedHandlers.length ) { + handlerQueue.push( { elem: cur, handlers: matchedHandlers } ); + } + } + } + } + + // Add the remaining (directly-bound) handlers + cur = this; + if ( delegateCount < handlers.length ) { + handlerQueue.push( { elem: cur, handlers: handlers.slice( delegateCount ) } ); + } + + return handlerQueue; + }, + + addProp: function( name, hook ) { + Object.defineProperty( jQuery.Event.prototype, name, { + enumerable: true, + configurable: true, + + get: isFunction( hook ) ? + function() { + if ( this.originalEvent ) { + return hook( this.originalEvent ); + } + } : + function() { + if ( this.originalEvent ) { + return this.originalEvent[ name ]; + } + }, + + set: function( value ) { + Object.defineProperty( this, name, { + enumerable: true, + configurable: true, + writable: true, + value: value + } ); + } + } ); + }, + + fix: function( originalEvent ) { + return originalEvent[ jQuery.expando ] ? + originalEvent : + new jQuery.Event( originalEvent ); + }, + + special: { + load: { + + // Prevent triggered image.load events from bubbling to window.load + noBubble: true + }, + click: { + + // Utilize native event to ensure correct state for checkable inputs + setup: function( data ) { + + // For mutual compressibility with _default, replace `this` access with a local var. + // `|| data` is dead code meant only to preserve the variable through minification. + var el = this || data; + + // Claim the first handler + if ( rcheckableType.test( el.type ) && + el.click && nodeName( el, "input" ) ) { + + // dataPriv.set( el, "click", ... ) + leverageNative( el, "click", returnTrue ); + } + + // Return false to allow normal processing in the caller + return false; + }, + trigger: function( data ) { + + // For mutual compressibility with _default, replace `this` access with a local var. + // `|| data` is dead code meant only to preserve the variable through minification. + var el = this || data; + + // Force setup before triggering a click + if ( rcheckableType.test( el.type ) && + el.click && nodeName( el, "input" ) ) { + + leverageNative( el, "click" ); + } + + // Return non-false to allow normal event-path propagation + return true; + }, + + // For cross-browser consistency, suppress native .click() on links + // Also prevent it if we're currently inside a leveraged native-event stack + _default: function( event ) { + var target = event.target; + return rcheckableType.test( target.type ) && + target.click && nodeName( target, "input" ) && + dataPriv.get( target, "click" ) || + nodeName( target, "a" ); + } + }, + + beforeunload: { + postDispatch: function( event ) { + + // Support: Firefox 20+ + // Firefox doesn't alert if the returnValue field is not set. + if ( event.result !== undefined && event.originalEvent ) { + event.originalEvent.returnValue = event.result; + } + } + } + } +}; + +// Ensure the presence of an event listener that handles manually-triggered +// synthetic events by interrupting progress until reinvoked in response to +// *native* events that it fires directly, ensuring that state changes have +// already occurred before other listeners are invoked. +function leverageNative( el, type, expectSync ) { + + // Missing expectSync indicates a trigger call, which must force setup through jQuery.event.add + if ( !expectSync ) { + if ( dataPriv.get( el, type ) === undefined ) { + jQuery.event.add( el, type, returnTrue ); + } + return; + } + + // Register the controller as a special universal handler for all event namespaces + dataPriv.set( el, type, false ); + jQuery.event.add( el, type, { + namespace: false, + handler: function( event ) { + var notAsync, result, + saved = dataPriv.get( this, type ); + + if ( ( event.isTrigger & 1 ) && this[ type ] ) { + + // Interrupt processing of the outer synthetic .trigger()ed event + // Saved data should be false in such cases, but might be a leftover capture object + // from an async native handler (gh-4350) + if ( !saved.length ) { + + // Store arguments for use when handling the inner native event + // There will always be at least one argument (an event object), so this array + // will not be confused with a leftover capture object. + saved = slice.call( arguments ); + dataPriv.set( this, type, saved ); + + // Trigger the native event and capture its result + // Support: IE <=9 - 11+ + // focus() and blur() are asynchronous + notAsync = expectSync( this, type ); + this[ type ](); + result = dataPriv.get( this, type ); + if ( saved !== result || notAsync ) { + dataPriv.set( this, type, false ); + } else { + result = {}; + } + if ( saved !== result ) { + + // Cancel the outer synthetic event + event.stopImmediatePropagation(); + event.preventDefault(); + + // Support: Chrome 86+ + // In Chrome, if an element having a focusout handler is blurred by + // clicking outside of it, it invokes the handler synchronously. If + // that handler calls `.remove()` on the element, the data is cleared, + // leaving `result` undefined. We need to guard against this. + return result && result.value; + } + + // If this is an inner synthetic event for an event with a bubbling surrogate + // (focus or blur), assume that the surrogate already propagated from triggering the + // native event and prevent that from happening again here. + // This technically gets the ordering wrong w.r.t. to `.trigger()` (in which the + // bubbling surrogate propagates *after* the non-bubbling base), but that seems + // less bad than duplication. + } else if ( ( jQuery.event.special[ type ] || {} ).delegateType ) { + event.stopPropagation(); + } + + // If this is a native event triggered above, everything is now in order + // Fire an inner synthetic event with the original arguments + } else if ( saved.length ) { + + // ...and capture the result + dataPriv.set( this, type, { + value: jQuery.event.trigger( + + // Support: IE <=9 - 11+ + // Extend with the prototype to reset the above stopImmediatePropagation() + jQuery.extend( saved[ 0 ], jQuery.Event.prototype ), + saved.slice( 1 ), + this + ) + } ); + + // Abort handling of the native event + event.stopImmediatePropagation(); + } + } + } ); +} + +jQuery.removeEvent = function( elem, type, handle ) { + + // This "if" is needed for plain objects + if ( elem.removeEventListener ) { + elem.removeEventListener( type, handle ); + } +}; + +jQuery.Event = function( src, props ) { + + // Allow instantiation without the 'new' keyword + if ( !( this instanceof jQuery.Event ) ) { + return new jQuery.Event( src, props ); + } + + // Event object + if ( src && src.type ) { + this.originalEvent = src; + this.type = src.type; + + // Events bubbling up the document may have been marked as prevented + // by a handler lower down the tree; reflect the correct value. + this.isDefaultPrevented = src.defaultPrevented || + src.defaultPrevented === undefined && + + // Support: Android <=2.3 only + src.returnValue === false ? + returnTrue : + returnFalse; + + // Create target properties + // Support: Safari <=6 - 7 only + // Target should not be a text node (#504, #13143) + this.target = ( src.target && src.target.nodeType === 3 ) ? + src.target.parentNode : + src.target; + + this.currentTarget = src.currentTarget; + this.relatedTarget = src.relatedTarget; + + // Event type + } else { + this.type = src; + } + + // Put explicitly provided properties onto the event object + if ( props ) { + jQuery.extend( this, props ); + } + + // Create a timestamp if incoming event doesn't have one + this.timeStamp = src && src.timeStamp || Date.now(); + + // Mark it as fixed + this[ jQuery.expando ] = true; +}; + +// jQuery.Event is based on DOM3 Events as specified by the ECMAScript Language Binding +// https://www.w3.org/TR/2003/WD-DOM-Level-3-Events-20030331/ecma-script-binding.html +jQuery.Event.prototype = { + constructor: jQuery.Event, + isDefaultPrevented: returnFalse, + isPropagationStopped: returnFalse, + isImmediatePropagationStopped: returnFalse, + isSimulated: false, + + preventDefault: function() { + var e = this.originalEvent; + + this.isDefaultPrevented = returnTrue; + + if ( e && !this.isSimulated ) { + e.preventDefault(); + } + }, + stopPropagation: function() { + var e = this.originalEvent; + + this.isPropagationStopped = returnTrue; + + if ( e && !this.isSimulated ) { + e.stopPropagation(); + } + }, + stopImmediatePropagation: function() { + var e = this.originalEvent; + + this.isImmediatePropagationStopped = returnTrue; + + if ( e && !this.isSimulated ) { + e.stopImmediatePropagation(); + } + + this.stopPropagation(); + } +}; + +// Includes all common event props including KeyEvent and MouseEvent specific props +jQuery.each( { + altKey: true, + bubbles: true, + cancelable: true, + changedTouches: true, + ctrlKey: true, + detail: true, + eventPhase: true, + metaKey: true, + pageX: true, + pageY: true, + shiftKey: true, + view: true, + "char": true, + code: true, + charCode: true, + key: true, + keyCode: true, + button: true, + buttons: true, + clientX: true, + clientY: true, + offsetX: true, + offsetY: true, + pointerId: true, + pointerType: true, + screenX: true, + screenY: true, + targetTouches: true, + toElement: true, + touches: true, + which: true +}, jQuery.event.addProp ); + +jQuery.each( { focus: "focusin", blur: "focusout" }, function( type, delegateType ) { + jQuery.event.special[ type ] = { + + // Utilize native event if possible so blur/focus sequence is correct + setup: function() { + + // Claim the first handler + // dataPriv.set( this, "focus", ... ) + // dataPriv.set( this, "blur", ... ) + leverageNative( this, type, expectSync ); + + // Return false to allow normal processing in the caller + return false; + }, + trigger: function() { + + // Force setup before trigger + leverageNative( this, type ); + + // Return non-false to allow normal event-path propagation + return true; + }, + + // Suppress native focus or blur as it's already being fired + // in leverageNative. + _default: function() { + return true; + }, + + delegateType: delegateType + }; +} ); + +// Create mouseenter/leave events using mouseover/out and event-time checks +// so that event delegation works in jQuery. +// Do the same for pointerenter/pointerleave and pointerover/pointerout +// +// Support: Safari 7 only +// Safari sends mouseenter too often; see: +// https://bugs.chromium.org/p/chromium/issues/detail?id=470258 +// for the description of the bug (it existed in older Chrome versions as well). +jQuery.each( { + mouseenter: "mouseover", + mouseleave: "mouseout", + pointerenter: "pointerover", + pointerleave: "pointerout" +}, function( orig, fix ) { + jQuery.event.special[ orig ] = { + delegateType: fix, + bindType: fix, + + handle: function( event ) { + var ret, + target = this, + related = event.relatedTarget, + handleObj = event.handleObj; + + // For mouseenter/leave call the handler if related is outside the target. + // NB: No relatedTarget if the mouse left/entered the browser window + if ( !related || ( related !== target && !jQuery.contains( target, related ) ) ) { + event.type = handleObj.origType; + ret = handleObj.handler.apply( this, arguments ); + event.type = fix; + } + return ret; + } + }; +} ); + +jQuery.fn.extend( { + + on: function( types, selector, data, fn ) { + return on( this, types, selector, data, fn ); + }, + one: function( types, selector, data, fn ) { + return on( this, types, selector, data, fn, 1 ); + }, + off: function( types, selector, fn ) { + var handleObj, type; + if ( types && types.preventDefault && types.handleObj ) { + + // ( event ) dispatched jQuery.Event + handleObj = types.handleObj; + jQuery( types.delegateTarget ).off( + handleObj.namespace ? + handleObj.origType + "." + handleObj.namespace : + handleObj.origType, + handleObj.selector, + handleObj.handler + ); + return this; + } + if ( typeof types === "object" ) { + + // ( types-object [, selector] ) + for ( type in types ) { + this.off( type, selector, types[ type ] ); + } + return this; + } + if ( selector === false || typeof selector === "function" ) { + + // ( types [, fn] ) + fn = selector; + selector = undefined; + } + if ( fn === false ) { + fn = returnFalse; + } + return this.each( function() { + jQuery.event.remove( this, types, fn, selector ); + } ); + } +} ); + + +var + + // Support: IE <=10 - 11, Edge 12 - 13 only + // In IE/Edge using regex groups here causes severe slowdowns. + // See https://connect.microsoft.com/IE/feedback/details/1736512/ + rnoInnerhtml = /\s*$/g; + +// Prefer a tbody over its parent table for containing new rows +function manipulationTarget( elem, content ) { + if ( nodeName( elem, "table" ) && + nodeName( content.nodeType !== 11 ? content : content.firstChild, "tr" ) ) { + + return jQuery( elem ).children( "tbody" )[ 0 ] || elem; + } + + return elem; +} + +// Replace/restore the type attribute of script elements for safe DOM manipulation +function disableScript( elem ) { + elem.type = ( elem.getAttribute( "type" ) !== null ) + "/" + elem.type; + return elem; +} +function restoreScript( elem ) { + if ( ( elem.type || "" ).slice( 0, 5 ) === "true/" ) { + elem.type = elem.type.slice( 5 ); + } else { + elem.removeAttribute( "type" ); + } + + return elem; +} + +function cloneCopyEvent( src, dest ) { + var i, l, type, pdataOld, udataOld, udataCur, events; + + if ( dest.nodeType !== 1 ) { + return; + } + + // 1. Copy private data: events, handlers, etc. + if ( dataPriv.hasData( src ) ) { + pdataOld = dataPriv.get( src ); + events = pdataOld.events; + + if ( events ) { + dataPriv.remove( dest, "handle events" ); + + for ( type in events ) { + for ( i = 0, l = events[ type ].length; i < l; i++ ) { + jQuery.event.add( dest, type, events[ type ][ i ] ); + } + } + } + } + + // 2. Copy user data + if ( dataUser.hasData( src ) ) { + udataOld = dataUser.access( src ); + udataCur = jQuery.extend( {}, udataOld ); + + dataUser.set( dest, udataCur ); + } +} + +// Fix IE bugs, see support tests +function fixInput( src, dest ) { + var nodeName = dest.nodeName.toLowerCase(); + + // Fails to persist the checked state of a cloned checkbox or radio button. + if ( nodeName === "input" && rcheckableType.test( src.type ) ) { + dest.checked = src.checked; + + // Fails to return the selected option to the default selected state when cloning options + } else if ( nodeName === "input" || nodeName === "textarea" ) { + dest.defaultValue = src.defaultValue; + } +} + +function domManip( collection, args, callback, ignored ) { + + // Flatten any nested arrays + args = flat( args ); + + var fragment, first, scripts, hasScripts, node, doc, + i = 0, + l = collection.length, + iNoClone = l - 1, + value = args[ 0 ], + valueIsFunction = isFunction( value ); + + // We can't cloneNode fragments that contain checked, in WebKit + if ( valueIsFunction || + ( l > 1 && typeof value === "string" && + !support.checkClone && rchecked.test( value ) ) ) { + return collection.each( function( index ) { + var self = collection.eq( index ); + if ( valueIsFunction ) { + args[ 0 ] = value.call( this, index, self.html() ); + } + domManip( self, args, callback, ignored ); + } ); + } + + if ( l ) { + fragment = buildFragment( args, collection[ 0 ].ownerDocument, false, collection, ignored ); + first = fragment.firstChild; + + if ( fragment.childNodes.length === 1 ) { + fragment = first; + } + + // Require either new content or an interest in ignored elements to invoke the callback + if ( first || ignored ) { + scripts = jQuery.map( getAll( fragment, "script" ), disableScript ); + hasScripts = scripts.length; + + // Use the original fragment for the last item + // instead of the first because it can end up + // being emptied incorrectly in certain situations (#8070). + for ( ; i < l; i++ ) { + node = fragment; + + if ( i !== iNoClone ) { + node = jQuery.clone( node, true, true ); + + // Keep references to cloned scripts for later restoration + if ( hasScripts ) { + + // Support: Android <=4.0 only, PhantomJS 1 only + // push.apply(_, arraylike) throws on ancient WebKit + jQuery.merge( scripts, getAll( node, "script" ) ); + } + } + + callback.call( collection[ i ], node, i ); + } + + if ( hasScripts ) { + doc = scripts[ scripts.length - 1 ].ownerDocument; + + // Reenable scripts + jQuery.map( scripts, restoreScript ); + + // Evaluate executable scripts on first document insertion + for ( i = 0; i < hasScripts; i++ ) { + node = scripts[ i ]; + if ( rscriptType.test( node.type || "" ) && + !dataPriv.access( node, "globalEval" ) && + jQuery.contains( doc, node ) ) { + + if ( node.src && ( node.type || "" ).toLowerCase() !== "module" ) { + + // Optional AJAX dependency, but won't run scripts if not present + if ( jQuery._evalUrl && !node.noModule ) { + jQuery._evalUrl( node.src, { + nonce: node.nonce || node.getAttribute( "nonce" ) + }, doc ); + } + } else { + DOMEval( node.textContent.replace( rcleanScript, "" ), node, doc ); + } + } + } + } + } + } + + return collection; +} + +function remove( elem, selector, keepData ) { + var node, + nodes = selector ? jQuery.filter( selector, elem ) : elem, + i = 0; + + for ( ; ( node = nodes[ i ] ) != null; i++ ) { + if ( !keepData && node.nodeType === 1 ) { + jQuery.cleanData( getAll( node ) ); + } + + if ( node.parentNode ) { + if ( keepData && isAttached( node ) ) { + setGlobalEval( getAll( node, "script" ) ); + } + node.parentNode.removeChild( node ); + } + } + + return elem; +} + +jQuery.extend( { + htmlPrefilter: function( html ) { + return html; + }, + + clone: function( elem, dataAndEvents, deepDataAndEvents ) { + var i, l, srcElements, destElements, + clone = elem.cloneNode( true ), + inPage = isAttached( elem ); + + // Fix IE cloning issues + if ( !support.noCloneChecked && ( elem.nodeType === 1 || elem.nodeType === 11 ) && + !jQuery.isXMLDoc( elem ) ) { + + // We eschew Sizzle here for performance reasons: https://jsperf.com/getall-vs-sizzle/2 + destElements = getAll( clone ); + srcElements = getAll( elem ); + + for ( i = 0, l = srcElements.length; i < l; i++ ) { + fixInput( srcElements[ i ], destElements[ i ] ); + } + } + + // Copy the events from the original to the clone + if ( dataAndEvents ) { + if ( deepDataAndEvents ) { + srcElements = srcElements || getAll( elem ); + destElements = destElements || getAll( clone ); + + for ( i = 0, l = srcElements.length; i < l; i++ ) { + cloneCopyEvent( srcElements[ i ], destElements[ i ] ); + } + } else { + cloneCopyEvent( elem, clone ); + } + } + + // Preserve script evaluation history + destElements = getAll( clone, "script" ); + if ( destElements.length > 0 ) { + setGlobalEval( destElements, !inPage && getAll( elem, "script" ) ); + } + + // Return the cloned set + return clone; + }, + + cleanData: function( elems ) { + var data, elem, type, + special = jQuery.event.special, + i = 0; + + for ( ; ( elem = elems[ i ] ) !== undefined; i++ ) { + if ( acceptData( elem ) ) { + if ( ( data = elem[ dataPriv.expando ] ) ) { + if ( data.events ) { + for ( type in data.events ) { + if ( special[ type ] ) { + jQuery.event.remove( elem, type ); + + // This is a shortcut to avoid jQuery.event.remove's overhead + } else { + jQuery.removeEvent( elem, type, data.handle ); + } + } + } + + // Support: Chrome <=35 - 45+ + // Assign undefined instead of using delete, see Data#remove + elem[ dataPriv.expando ] = undefined; + } + if ( elem[ dataUser.expando ] ) { + + // Support: Chrome <=35 - 45+ + // Assign undefined instead of using delete, see Data#remove + elem[ dataUser.expando ] = undefined; + } + } + } + } +} ); + +jQuery.fn.extend( { + detach: function( selector ) { + return remove( this, selector, true ); + }, + + remove: function( selector ) { + return remove( this, selector ); + }, + + text: function( value ) { + return access( this, function( value ) { + return value === undefined ? + jQuery.text( this ) : + this.empty().each( function() { + if ( this.nodeType === 1 || this.nodeType === 11 || this.nodeType === 9 ) { + this.textContent = value; + } + } ); + }, null, value, arguments.length ); + }, + + append: function() { + return domManip( this, arguments, function( elem ) { + if ( this.nodeType === 1 || this.nodeType === 11 || this.nodeType === 9 ) { + var target = manipulationTarget( this, elem ); + target.appendChild( elem ); + } + } ); + }, + + prepend: function() { + return domManip( this, arguments, function( elem ) { + if ( this.nodeType === 1 || this.nodeType === 11 || this.nodeType === 9 ) { + var target = manipulationTarget( this, elem ); + target.insertBefore( elem, target.firstChild ); + } + } ); + }, + + before: function() { + return domManip( this, arguments, function( elem ) { + if ( this.parentNode ) { + this.parentNode.insertBefore( elem, this ); + } + } ); + }, + + after: function() { + return domManip( this, arguments, function( elem ) { + if ( this.parentNode ) { + this.parentNode.insertBefore( elem, this.nextSibling ); + } + } ); + }, + + empty: function() { + var elem, + i = 0; + + for ( ; ( elem = this[ i ] ) != null; i++ ) { + if ( elem.nodeType === 1 ) { + + // Prevent memory leaks + jQuery.cleanData( getAll( elem, false ) ); + + // Remove any remaining nodes + elem.textContent = ""; + } + } + + return this; + }, + + clone: function( dataAndEvents, deepDataAndEvents ) { + dataAndEvents = dataAndEvents == null ? false : dataAndEvents; + deepDataAndEvents = deepDataAndEvents == null ? dataAndEvents : deepDataAndEvents; + + return this.map( function() { + return jQuery.clone( this, dataAndEvents, deepDataAndEvents ); + } ); + }, + + html: function( value ) { + return access( this, function( value ) { + var elem = this[ 0 ] || {}, + i = 0, + l = this.length; + + if ( value === undefined && elem.nodeType === 1 ) { + return elem.innerHTML; + } + + // See if we can take a shortcut and just use innerHTML + if ( typeof value === "string" && !rnoInnerhtml.test( value ) && + !wrapMap[ ( rtagName.exec( value ) || [ "", "" ] )[ 1 ].toLowerCase() ] ) { + + value = jQuery.htmlPrefilter( value ); + + try { + for ( ; i < l; i++ ) { + elem = this[ i ] || {}; + + // Remove element nodes and prevent memory leaks + if ( elem.nodeType === 1 ) { + jQuery.cleanData( getAll( elem, false ) ); + elem.innerHTML = value; + } + } + + elem = 0; + + // If using innerHTML throws an exception, use the fallback method + } catch ( e ) {} + } + + if ( elem ) { + this.empty().append( value ); + } + }, null, value, arguments.length ); + }, + + replaceWith: function() { + var ignored = []; + + // Make the changes, replacing each non-ignored context element with the new content + return domManip( this, arguments, function( elem ) { + var parent = this.parentNode; + + if ( jQuery.inArray( this, ignored ) < 0 ) { + jQuery.cleanData( getAll( this ) ); + if ( parent ) { + parent.replaceChild( elem, this ); + } + } + + // Force callback invocation + }, ignored ); + } +} ); + +jQuery.each( { + appendTo: "append", + prependTo: "prepend", + insertBefore: "before", + insertAfter: "after", + replaceAll: "replaceWith" +}, function( name, original ) { + jQuery.fn[ name ] = function( selector ) { + var elems, + ret = [], + insert = jQuery( selector ), + last = insert.length - 1, + i = 0; + + for ( ; i <= last; i++ ) { + elems = i === last ? this : this.clone( true ); + jQuery( insert[ i ] )[ original ]( elems ); + + // Support: Android <=4.0 only, PhantomJS 1 only + // .get() because push.apply(_, arraylike) throws on ancient WebKit + push.apply( ret, elems.get() ); + } + + return this.pushStack( ret ); + }; +} ); +var rnumnonpx = new RegExp( "^(" + pnum + ")(?!px)[a-z%]+$", "i" ); + +var getStyles = function( elem ) { + + // Support: IE <=11 only, Firefox <=30 (#15098, #14150) + // IE throws on elements created in popups + // FF meanwhile throws on frame elements through "defaultView.getComputedStyle" + var view = elem.ownerDocument.defaultView; + + if ( !view || !view.opener ) { + view = window; + } + + return view.getComputedStyle( elem ); + }; + +var swap = function( elem, options, callback ) { + var ret, name, + old = {}; + + // Remember the old values, and insert the new ones + for ( name in options ) { + old[ name ] = elem.style[ name ]; + elem.style[ name ] = options[ name ]; + } + + ret = callback.call( elem ); + + // Revert the old values + for ( name in options ) { + elem.style[ name ] = old[ name ]; + } + + return ret; +}; + + +var rboxStyle = new RegExp( cssExpand.join( "|" ), "i" ); + + + +( function() { + + // Executing both pixelPosition & boxSizingReliable tests require only one layout + // so they're executed at the same time to save the second computation. + function computeStyleTests() { + + // This is a singleton, we need to execute it only once + if ( !div ) { + return; + } + + container.style.cssText = "position:absolute;left:-11111px;width:60px;" + + "margin-top:1px;padding:0;border:0"; + div.style.cssText = + "position:relative;display:block;box-sizing:border-box;overflow:scroll;" + + "margin:auto;border:1px;padding:1px;" + + "width:60%;top:1%"; + documentElement.appendChild( container ).appendChild( div ); + + var divStyle = window.getComputedStyle( div ); + pixelPositionVal = divStyle.top !== "1%"; + + // Support: Android 4.0 - 4.3 only, Firefox <=3 - 44 + reliableMarginLeftVal = roundPixelMeasures( divStyle.marginLeft ) === 12; + + // Support: Android 4.0 - 4.3 only, Safari <=9.1 - 10.1, iOS <=7.0 - 9.3 + // Some styles come back with percentage values, even though they shouldn't + div.style.right = "60%"; + pixelBoxStylesVal = roundPixelMeasures( divStyle.right ) === 36; + + // Support: IE 9 - 11 only + // Detect misreporting of content dimensions for box-sizing:border-box elements + boxSizingReliableVal = roundPixelMeasures( divStyle.width ) === 36; + + // Support: IE 9 only + // Detect overflow:scroll screwiness (gh-3699) + // Support: Chrome <=64 + // Don't get tricked when zoom affects offsetWidth (gh-4029) + div.style.position = "absolute"; + scrollboxSizeVal = roundPixelMeasures( div.offsetWidth / 3 ) === 12; + + documentElement.removeChild( container ); + + // Nullify the div so it wouldn't be stored in the memory and + // it will also be a sign that checks already performed + div = null; + } + + function roundPixelMeasures( measure ) { + return Math.round( parseFloat( measure ) ); + } + + var pixelPositionVal, boxSizingReliableVal, scrollboxSizeVal, pixelBoxStylesVal, + reliableTrDimensionsVal, reliableMarginLeftVal, + container = document.createElement( "div" ), + div = document.createElement( "div" ); + + // Finish early in limited (non-browser) environments + if ( !div.style ) { + return; + } + + // Support: IE <=9 - 11 only + // Style of cloned element affects source element cloned (#8908) + div.style.backgroundClip = "content-box"; + div.cloneNode( true ).style.backgroundClip = ""; + support.clearCloneStyle = div.style.backgroundClip === "content-box"; + + jQuery.extend( support, { + boxSizingReliable: function() { + computeStyleTests(); + return boxSizingReliableVal; + }, + pixelBoxStyles: function() { + computeStyleTests(); + return pixelBoxStylesVal; + }, + pixelPosition: function() { + computeStyleTests(); + return pixelPositionVal; + }, + reliableMarginLeft: function() { + computeStyleTests(); + return reliableMarginLeftVal; + }, + scrollboxSize: function() { + computeStyleTests(); + return scrollboxSizeVal; + }, + + // Support: IE 9 - 11+, Edge 15 - 18+ + // IE/Edge misreport `getComputedStyle` of table rows with width/height + // set in CSS while `offset*` properties report correct values. + // Behavior in IE 9 is more subtle than in newer versions & it passes + // some versions of this test; make sure not to make it pass there! + // + // Support: Firefox 70+ + // Only Firefox includes border widths + // in computed dimensions. (gh-4529) + reliableTrDimensions: function() { + var table, tr, trChild, trStyle; + if ( reliableTrDimensionsVal == null ) { + table = document.createElement( "table" ); + tr = document.createElement( "tr" ); + trChild = document.createElement( "div" ); + + table.style.cssText = "position:absolute;left:-11111px;border-collapse:separate"; + tr.style.cssText = "border:1px solid"; + + // Support: Chrome 86+ + // Height set through cssText does not get applied. + // Computed height then comes back as 0. + tr.style.height = "1px"; + trChild.style.height = "9px"; + + // Support: Android 8 Chrome 86+ + // In our bodyBackground.html iframe, + // display for all div elements is set to "inline", + // which causes a problem only in Android 8 Chrome 86. + // Ensuring the div is display: block + // gets around this issue. + trChild.style.display = "block"; + + documentElement + .appendChild( table ) + .appendChild( tr ) + .appendChild( trChild ); + + trStyle = window.getComputedStyle( tr ); + reliableTrDimensionsVal = ( parseInt( trStyle.height, 10 ) + + parseInt( trStyle.borderTopWidth, 10 ) + + parseInt( trStyle.borderBottomWidth, 10 ) ) === tr.offsetHeight; + + documentElement.removeChild( table ); + } + return reliableTrDimensionsVal; + } + } ); +} )(); + + +function curCSS( elem, name, computed ) { + var width, minWidth, maxWidth, ret, + + // Support: Firefox 51+ + // Retrieving style before computed somehow + // fixes an issue with getting wrong values + // on detached elements + style = elem.style; + + computed = computed || getStyles( elem ); + + // getPropertyValue is needed for: + // .css('filter') (IE 9 only, #12537) + // .css('--customProperty) (#3144) + if ( computed ) { + ret = computed.getPropertyValue( name ) || computed[ name ]; + + if ( ret === "" && !isAttached( elem ) ) { + ret = jQuery.style( elem, name ); + } + + // A tribute to the "awesome hack by Dean Edwards" + // Android Browser returns percentage for some values, + // but width seems to be reliably pixels. + // This is against the CSSOM draft spec: + // https://drafts.csswg.org/cssom/#resolved-values + if ( !support.pixelBoxStyles() && rnumnonpx.test( ret ) && rboxStyle.test( name ) ) { + + // Remember the original values + width = style.width; + minWidth = style.minWidth; + maxWidth = style.maxWidth; + + // Put in the new values to get a computed value out + style.minWidth = style.maxWidth = style.width = ret; + ret = computed.width; + + // Revert the changed values + style.width = width; + style.minWidth = minWidth; + style.maxWidth = maxWidth; + } + } + + return ret !== undefined ? + + // Support: IE <=9 - 11 only + // IE returns zIndex value as an integer. + ret + "" : + ret; +} + + +function addGetHookIf( conditionFn, hookFn ) { + + // Define the hook, we'll check on the first run if it's really needed. + return { + get: function() { + if ( conditionFn() ) { + + // Hook not needed (or it's not possible to use it due + // to missing dependency), remove it. + delete this.get; + return; + } + + // Hook needed; redefine it so that the support test is not executed again. + return ( this.get = hookFn ).apply( this, arguments ); + } + }; +} + + +var cssPrefixes = [ "Webkit", "Moz", "ms" ], + emptyStyle = document.createElement( "div" ).style, + vendorProps = {}; + +// Return a vendor-prefixed property or undefined +function vendorPropName( name ) { + + // Check for vendor prefixed names + var capName = name[ 0 ].toUpperCase() + name.slice( 1 ), + i = cssPrefixes.length; + + while ( i-- ) { + name = cssPrefixes[ i ] + capName; + if ( name in emptyStyle ) { + return name; + } + } +} + +// Return a potentially-mapped jQuery.cssProps or vendor prefixed property +function finalPropName( name ) { + var final = jQuery.cssProps[ name ] || vendorProps[ name ]; + + if ( final ) { + return final; + } + if ( name in emptyStyle ) { + return name; + } + return vendorProps[ name ] = vendorPropName( name ) || name; +} + + +var + + // Swappable if display is none or starts with table + // except "table", "table-cell", or "table-caption" + // See here for display values: https://developer.mozilla.org/en-US/docs/CSS/display + rdisplayswap = /^(none|table(?!-c[ea]).+)/, + rcustomProp = /^--/, + cssShow = { position: "absolute", visibility: "hidden", display: "block" }, + cssNormalTransform = { + letterSpacing: "0", + fontWeight: "400" + }; + +function setPositiveNumber( _elem, value, subtract ) { + + // Any relative (+/-) values have already been + // normalized at this point + var matches = rcssNum.exec( value ); + return matches ? + + // Guard against undefined "subtract", e.g., when used as in cssHooks + Math.max( 0, matches[ 2 ] - ( subtract || 0 ) ) + ( matches[ 3 ] || "px" ) : + value; +} + +function boxModelAdjustment( elem, dimension, box, isBorderBox, styles, computedVal ) { + var i = dimension === "width" ? 1 : 0, + extra = 0, + delta = 0; + + // Adjustment may not be necessary + if ( box === ( isBorderBox ? "border" : "content" ) ) { + return 0; + } + + for ( ; i < 4; i += 2 ) { + + // Both box models exclude margin + if ( box === "margin" ) { + delta += jQuery.css( elem, box + cssExpand[ i ], true, styles ); + } + + // If we get here with a content-box, we're seeking "padding" or "border" or "margin" + if ( !isBorderBox ) { + + // Add padding + delta += jQuery.css( elem, "padding" + cssExpand[ i ], true, styles ); + + // For "border" or "margin", add border + if ( box !== "padding" ) { + delta += jQuery.css( elem, "border" + cssExpand[ i ] + "Width", true, styles ); + + // But still keep track of it otherwise + } else { + extra += jQuery.css( elem, "border" + cssExpand[ i ] + "Width", true, styles ); + } + + // If we get here with a border-box (content + padding + border), we're seeking "content" or + // "padding" or "margin" + } else { + + // For "content", subtract padding + if ( box === "content" ) { + delta -= jQuery.css( elem, "padding" + cssExpand[ i ], true, styles ); + } + + // For "content" or "padding", subtract border + if ( box !== "margin" ) { + delta -= jQuery.css( elem, "border" + cssExpand[ i ] + "Width", true, styles ); + } + } + } + + // Account for positive content-box scroll gutter when requested by providing computedVal + if ( !isBorderBox && computedVal >= 0 ) { + + // offsetWidth/offsetHeight is a rounded sum of content, padding, scroll gutter, and border + // Assuming integer scroll gutter, subtract the rest and round down + delta += Math.max( 0, Math.ceil( + elem[ "offset" + dimension[ 0 ].toUpperCase() + dimension.slice( 1 ) ] - + computedVal - + delta - + extra - + 0.5 + + // If offsetWidth/offsetHeight is unknown, then we can't determine content-box scroll gutter + // Use an explicit zero to avoid NaN (gh-3964) + ) ) || 0; + } + + return delta; +} + +function getWidthOrHeight( elem, dimension, extra ) { + + // Start with computed style + var styles = getStyles( elem ), + + // To avoid forcing a reflow, only fetch boxSizing if we need it (gh-4322). + // Fake content-box until we know it's needed to know the true value. + boxSizingNeeded = !support.boxSizingReliable() || extra, + isBorderBox = boxSizingNeeded && + jQuery.css( elem, "boxSizing", false, styles ) === "border-box", + valueIsBorderBox = isBorderBox, + + val = curCSS( elem, dimension, styles ), + offsetProp = "offset" + dimension[ 0 ].toUpperCase() + dimension.slice( 1 ); + + // Support: Firefox <=54 + // Return a confounding non-pixel value or feign ignorance, as appropriate. + if ( rnumnonpx.test( val ) ) { + if ( !extra ) { + return val; + } + val = "auto"; + } + + + // Support: IE 9 - 11 only + // Use offsetWidth/offsetHeight for when box sizing is unreliable. + // In those cases, the computed value can be trusted to be border-box. + if ( ( !support.boxSizingReliable() && isBorderBox || + + // Support: IE 10 - 11+, Edge 15 - 18+ + // IE/Edge misreport `getComputedStyle` of table rows with width/height + // set in CSS while `offset*` properties report correct values. + // Interestingly, in some cases IE 9 doesn't suffer from this issue. + !support.reliableTrDimensions() && nodeName( elem, "tr" ) || + + // Fall back to offsetWidth/offsetHeight when value is "auto" + // This happens for inline elements with no explicit setting (gh-3571) + val === "auto" || + + // Support: Android <=4.1 - 4.3 only + // Also use offsetWidth/offsetHeight for misreported inline dimensions (gh-3602) + !parseFloat( val ) && jQuery.css( elem, "display", false, styles ) === "inline" ) && + + // Make sure the element is visible & connected + elem.getClientRects().length ) { + + isBorderBox = jQuery.css( elem, "boxSizing", false, styles ) === "border-box"; + + // Where available, offsetWidth/offsetHeight approximate border box dimensions. + // Where not available (e.g., SVG), assume unreliable box-sizing and interpret the + // retrieved value as a content box dimension. + valueIsBorderBox = offsetProp in elem; + if ( valueIsBorderBox ) { + val = elem[ offsetProp ]; + } + } + + // Normalize "" and auto + val = parseFloat( val ) || 0; + + // Adjust for the element's box model + return ( val + + boxModelAdjustment( + elem, + dimension, + extra || ( isBorderBox ? "border" : "content" ), + valueIsBorderBox, + styles, + + // Provide the current computed size to request scroll gutter calculation (gh-3589) + val + ) + ) + "px"; +} + +jQuery.extend( { + + // Add in style property hooks for overriding the default + // behavior of getting and setting a style property + cssHooks: { + opacity: { + get: function( elem, computed ) { + if ( computed ) { + + // We should always get a number back from opacity + var ret = curCSS( elem, "opacity" ); + return ret === "" ? "1" : ret; + } + } + } + }, + + // Don't automatically add "px" to these possibly-unitless properties + cssNumber: { + "animationIterationCount": true, + "columnCount": true, + "fillOpacity": true, + "flexGrow": true, + "flexShrink": true, + "fontWeight": true, + "gridArea": true, + "gridColumn": true, + "gridColumnEnd": true, + "gridColumnStart": true, + "gridRow": true, + "gridRowEnd": true, + "gridRowStart": true, + "lineHeight": true, + "opacity": true, + "order": true, + "orphans": true, + "widows": true, + "zIndex": true, + "zoom": true + }, + + // Add in properties whose names you wish to fix before + // setting or getting the value + cssProps: {}, + + // Get and set the style property on a DOM Node + style: function( elem, name, value, extra ) { + + // Don't set styles on text and comment nodes + if ( !elem || elem.nodeType === 3 || elem.nodeType === 8 || !elem.style ) { + return; + } + + // Make sure that we're working with the right name + var ret, type, hooks, + origName = camelCase( name ), + isCustomProp = rcustomProp.test( name ), + style = elem.style; + + // Make sure that we're working with the right name. We don't + // want to query the value if it is a CSS custom property + // since they are user-defined. + if ( !isCustomProp ) { + name = finalPropName( origName ); + } + + // Gets hook for the prefixed version, then unprefixed version + hooks = jQuery.cssHooks[ name ] || jQuery.cssHooks[ origName ]; + + // Check if we're setting a value + if ( value !== undefined ) { + type = typeof value; + + // Convert "+=" or "-=" to relative numbers (#7345) + if ( type === "string" && ( ret = rcssNum.exec( value ) ) && ret[ 1 ] ) { + value = adjustCSS( elem, name, ret ); + + // Fixes bug #9237 + type = "number"; + } + + // Make sure that null and NaN values aren't set (#7116) + if ( value == null || value !== value ) { + return; + } + + // If a number was passed in, add the unit (except for certain CSS properties) + // The isCustomProp check can be removed in jQuery 4.0 when we only auto-append + // "px" to a few hardcoded values. + if ( type === "number" && !isCustomProp ) { + value += ret && ret[ 3 ] || ( jQuery.cssNumber[ origName ] ? "" : "px" ); + } + + // background-* props affect original clone's values + if ( !support.clearCloneStyle && value === "" && name.indexOf( "background" ) === 0 ) { + style[ name ] = "inherit"; + } + + // If a hook was provided, use that value, otherwise just set the specified value + if ( !hooks || !( "set" in hooks ) || + ( value = hooks.set( elem, value, extra ) ) !== undefined ) { + + if ( isCustomProp ) { + style.setProperty( name, value ); + } else { + style[ name ] = value; + } + } + + } else { + + // If a hook was provided get the non-computed value from there + if ( hooks && "get" in hooks && + ( ret = hooks.get( elem, false, extra ) ) !== undefined ) { + + return ret; + } + + // Otherwise just get the value from the style object + return style[ name ]; + } + }, + + css: function( elem, name, extra, styles ) { + var val, num, hooks, + origName = camelCase( name ), + isCustomProp = rcustomProp.test( name ); + + // Make sure that we're working with the right name. We don't + // want to modify the value if it is a CSS custom property + // since they are user-defined. + if ( !isCustomProp ) { + name = finalPropName( origName ); + } + + // Try prefixed name followed by the unprefixed name + hooks = jQuery.cssHooks[ name ] || jQuery.cssHooks[ origName ]; + + // If a hook was provided get the computed value from there + if ( hooks && "get" in hooks ) { + val = hooks.get( elem, true, extra ); + } + + // Otherwise, if a way to get the computed value exists, use that + if ( val === undefined ) { + val = curCSS( elem, name, styles ); + } + + // Convert "normal" to computed value + if ( val === "normal" && name in cssNormalTransform ) { + val = cssNormalTransform[ name ]; + } + + // Make numeric if forced or a qualifier was provided and val looks numeric + if ( extra === "" || extra ) { + num = parseFloat( val ); + return extra === true || isFinite( num ) ? num || 0 : val; + } + + return val; + } +} ); + +jQuery.each( [ "height", "width" ], function( _i, dimension ) { + jQuery.cssHooks[ dimension ] = { + get: function( elem, computed, extra ) { + if ( computed ) { + + // Certain elements can have dimension info if we invisibly show them + // but it must have a current display style that would benefit + return rdisplayswap.test( jQuery.css( elem, "display" ) ) && + + // Support: Safari 8+ + // Table columns in Safari have non-zero offsetWidth & zero + // getBoundingClientRect().width unless display is changed. + // Support: IE <=11 only + // Running getBoundingClientRect on a disconnected node + // in IE throws an error. + ( !elem.getClientRects().length || !elem.getBoundingClientRect().width ) ? + swap( elem, cssShow, function() { + return getWidthOrHeight( elem, dimension, extra ); + } ) : + getWidthOrHeight( elem, dimension, extra ); + } + }, + + set: function( elem, value, extra ) { + var matches, + styles = getStyles( elem ), + + // Only read styles.position if the test has a chance to fail + // to avoid forcing a reflow. + scrollboxSizeBuggy = !support.scrollboxSize() && + styles.position === "absolute", + + // To avoid forcing a reflow, only fetch boxSizing if we need it (gh-3991) + boxSizingNeeded = scrollboxSizeBuggy || extra, + isBorderBox = boxSizingNeeded && + jQuery.css( elem, "boxSizing", false, styles ) === "border-box", + subtract = extra ? + boxModelAdjustment( + elem, + dimension, + extra, + isBorderBox, + styles + ) : + 0; + + // Account for unreliable border-box dimensions by comparing offset* to computed and + // faking a content-box to get border and padding (gh-3699) + if ( isBorderBox && scrollboxSizeBuggy ) { + subtract -= Math.ceil( + elem[ "offset" + dimension[ 0 ].toUpperCase() + dimension.slice( 1 ) ] - + parseFloat( styles[ dimension ] ) - + boxModelAdjustment( elem, dimension, "border", false, styles ) - + 0.5 + ); + } + + // Convert to pixels if value adjustment is needed + if ( subtract && ( matches = rcssNum.exec( value ) ) && + ( matches[ 3 ] || "px" ) !== "px" ) { + + elem.style[ dimension ] = value; + value = jQuery.css( elem, dimension ); + } + + return setPositiveNumber( elem, value, subtract ); + } + }; +} ); + +jQuery.cssHooks.marginLeft = addGetHookIf( support.reliableMarginLeft, + function( elem, computed ) { + if ( computed ) { + return ( parseFloat( curCSS( elem, "marginLeft" ) ) || + elem.getBoundingClientRect().left - + swap( elem, { marginLeft: 0 }, function() { + return elem.getBoundingClientRect().left; + } ) + ) + "px"; + } + } +); + +// These hooks are used by animate to expand properties +jQuery.each( { + margin: "", + padding: "", + border: "Width" +}, function( prefix, suffix ) { + jQuery.cssHooks[ prefix + suffix ] = { + expand: function( value ) { + var i = 0, + expanded = {}, + + // Assumes a single number if not a string + parts = typeof value === "string" ? value.split( " " ) : [ value ]; + + for ( ; i < 4; i++ ) { + expanded[ prefix + cssExpand[ i ] + suffix ] = + parts[ i ] || parts[ i - 2 ] || parts[ 0 ]; + } + + return expanded; + } + }; + + if ( prefix !== "margin" ) { + jQuery.cssHooks[ prefix + suffix ].set = setPositiveNumber; + } +} ); + +jQuery.fn.extend( { + css: function( name, value ) { + return access( this, function( elem, name, value ) { + var styles, len, + map = {}, + i = 0; + + if ( Array.isArray( name ) ) { + styles = getStyles( elem ); + len = name.length; + + for ( ; i < len; i++ ) { + map[ name[ i ] ] = jQuery.css( elem, name[ i ], false, styles ); + } + + return map; + } + + return value !== undefined ? + jQuery.style( elem, name, value ) : + jQuery.css( elem, name ); + }, name, value, arguments.length > 1 ); + } +} ); + + +function Tween( elem, options, prop, end, easing ) { + return new Tween.prototype.init( elem, options, prop, end, easing ); +} +jQuery.Tween = Tween; + +Tween.prototype = { + constructor: Tween, + init: function( elem, options, prop, end, easing, unit ) { + this.elem = elem; + this.prop = prop; + this.easing = easing || jQuery.easing._default; + this.options = options; + this.start = this.now = this.cur(); + this.end = end; + this.unit = unit || ( jQuery.cssNumber[ prop ] ? "" : "px" ); + }, + cur: function() { + var hooks = Tween.propHooks[ this.prop ]; + + return hooks && hooks.get ? + hooks.get( this ) : + Tween.propHooks._default.get( this ); + }, + run: function( percent ) { + var eased, + hooks = Tween.propHooks[ this.prop ]; + + if ( this.options.duration ) { + this.pos = eased = jQuery.easing[ this.easing ]( + percent, this.options.duration * percent, 0, 1, this.options.duration + ); + } else { + this.pos = eased = percent; + } + this.now = ( this.end - this.start ) * eased + this.start; + + if ( this.options.step ) { + this.options.step.call( this.elem, this.now, this ); + } + + if ( hooks && hooks.set ) { + hooks.set( this ); + } else { + Tween.propHooks._default.set( this ); + } + return this; + } +}; + +Tween.prototype.init.prototype = Tween.prototype; + +Tween.propHooks = { + _default: { + get: function( tween ) { + var result; + + // Use a property on the element directly when it is not a DOM element, + // or when there is no matching style property that exists. + if ( tween.elem.nodeType !== 1 || + tween.elem[ tween.prop ] != null && tween.elem.style[ tween.prop ] == null ) { + return tween.elem[ tween.prop ]; + } + + // Passing an empty string as a 3rd parameter to .css will automatically + // attempt a parseFloat and fallback to a string if the parse fails. + // Simple values such as "10px" are parsed to Float; + // complex values such as "rotate(1rad)" are returned as-is. + result = jQuery.css( tween.elem, tween.prop, "" ); + + // Empty strings, null, undefined and "auto" are converted to 0. + return !result || result === "auto" ? 0 : result; + }, + set: function( tween ) { + + // Use step hook for back compat. + // Use cssHook if its there. + // Use .style if available and use plain properties where available. + if ( jQuery.fx.step[ tween.prop ] ) { + jQuery.fx.step[ tween.prop ]( tween ); + } else if ( tween.elem.nodeType === 1 && ( + jQuery.cssHooks[ tween.prop ] || + tween.elem.style[ finalPropName( tween.prop ) ] != null ) ) { + jQuery.style( tween.elem, tween.prop, tween.now + tween.unit ); + } else { + tween.elem[ tween.prop ] = tween.now; + } + } + } +}; + +// Support: IE <=9 only +// Panic based approach to setting things on disconnected nodes +Tween.propHooks.scrollTop = Tween.propHooks.scrollLeft = { + set: function( tween ) { + if ( tween.elem.nodeType && tween.elem.parentNode ) { + tween.elem[ tween.prop ] = tween.now; + } + } +}; + +jQuery.easing = { + linear: function( p ) { + return p; + }, + swing: function( p ) { + return 0.5 - Math.cos( p * Math.PI ) / 2; + }, + _default: "swing" +}; + +jQuery.fx = Tween.prototype.init; + +// Back compat <1.8 extension point +jQuery.fx.step = {}; + + + + +var + fxNow, inProgress, + rfxtypes = /^(?:toggle|show|hide)$/, + rrun = /queueHooks$/; + +function schedule() { + if ( inProgress ) { + if ( document.hidden === false && window.requestAnimationFrame ) { + window.requestAnimationFrame( schedule ); + } else { + window.setTimeout( schedule, jQuery.fx.interval ); + } + + jQuery.fx.tick(); + } +} + +// Animations created synchronously will run synchronously +function createFxNow() { + window.setTimeout( function() { + fxNow = undefined; + } ); + return ( fxNow = Date.now() ); +} + +// Generate parameters to create a standard animation +function genFx( type, includeWidth ) { + var which, + i = 0, + attrs = { height: type }; + + // If we include width, step value is 1 to do all cssExpand values, + // otherwise step value is 2 to skip over Left and Right + includeWidth = includeWidth ? 1 : 0; + for ( ; i < 4; i += 2 - includeWidth ) { + which = cssExpand[ i ]; + attrs[ "margin" + which ] = attrs[ "padding" + which ] = type; + } + + if ( includeWidth ) { + attrs.opacity = attrs.width = type; + } + + return attrs; +} + +function createTween( value, prop, animation ) { + var tween, + collection = ( Animation.tweeners[ prop ] || [] ).concat( Animation.tweeners[ "*" ] ), + index = 0, + length = collection.length; + for ( ; index < length; index++ ) { + if ( ( tween = collection[ index ].call( animation, prop, value ) ) ) { + + // We're done with this property + return tween; + } + } +} + +function defaultPrefilter( elem, props, opts ) { + var prop, value, toggle, hooks, oldfire, propTween, restoreDisplay, display, + isBox = "width" in props || "height" in props, + anim = this, + orig = {}, + style = elem.style, + hidden = elem.nodeType && isHiddenWithinTree( elem ), + dataShow = dataPriv.get( elem, "fxshow" ); + + // Queue-skipping animations hijack the fx hooks + if ( !opts.queue ) { + hooks = jQuery._queueHooks( elem, "fx" ); + if ( hooks.unqueued == null ) { + hooks.unqueued = 0; + oldfire = hooks.empty.fire; + hooks.empty.fire = function() { + if ( !hooks.unqueued ) { + oldfire(); + } + }; + } + hooks.unqueued++; + + anim.always( function() { + + // Ensure the complete handler is called before this completes + anim.always( function() { + hooks.unqueued--; + if ( !jQuery.queue( elem, "fx" ).length ) { + hooks.empty.fire(); + } + } ); + } ); + } + + // Detect show/hide animations + for ( prop in props ) { + value = props[ prop ]; + if ( rfxtypes.test( value ) ) { + delete props[ prop ]; + toggle = toggle || value === "toggle"; + if ( value === ( hidden ? "hide" : "show" ) ) { + + // Pretend to be hidden if this is a "show" and + // there is still data from a stopped show/hide + if ( value === "show" && dataShow && dataShow[ prop ] !== undefined ) { + hidden = true; + + // Ignore all other no-op show/hide data + } else { + continue; + } + } + orig[ prop ] = dataShow && dataShow[ prop ] || jQuery.style( elem, prop ); + } + } + + // Bail out if this is a no-op like .hide().hide() + propTween = !jQuery.isEmptyObject( props ); + if ( !propTween && jQuery.isEmptyObject( orig ) ) { + return; + } + + // Restrict "overflow" and "display" styles during box animations + if ( isBox && elem.nodeType === 1 ) { + + // Support: IE <=9 - 11, Edge 12 - 15 + // Record all 3 overflow attributes because IE does not infer the shorthand + // from identically-valued overflowX and overflowY and Edge just mirrors + // the overflowX value there. + opts.overflow = [ style.overflow, style.overflowX, style.overflowY ]; + + // Identify a display type, preferring old show/hide data over the CSS cascade + restoreDisplay = dataShow && dataShow.display; + if ( restoreDisplay == null ) { + restoreDisplay = dataPriv.get( elem, "display" ); + } + display = jQuery.css( elem, "display" ); + if ( display === "none" ) { + if ( restoreDisplay ) { + display = restoreDisplay; + } else { + + // Get nonempty value(s) by temporarily forcing visibility + showHide( [ elem ], true ); + restoreDisplay = elem.style.display || restoreDisplay; + display = jQuery.css( elem, "display" ); + showHide( [ elem ] ); + } + } + + // Animate inline elements as inline-block + if ( display === "inline" || display === "inline-block" && restoreDisplay != null ) { + if ( jQuery.css( elem, "float" ) === "none" ) { + + // Restore the original display value at the end of pure show/hide animations + if ( !propTween ) { + anim.done( function() { + style.display = restoreDisplay; + } ); + if ( restoreDisplay == null ) { + display = style.display; + restoreDisplay = display === "none" ? "" : display; + } + } + style.display = "inline-block"; + } + } + } + + if ( opts.overflow ) { + style.overflow = "hidden"; + anim.always( function() { + style.overflow = opts.overflow[ 0 ]; + style.overflowX = opts.overflow[ 1 ]; + style.overflowY = opts.overflow[ 2 ]; + } ); + } + + // Implement show/hide animations + propTween = false; + for ( prop in orig ) { + + // General show/hide setup for this element animation + if ( !propTween ) { + if ( dataShow ) { + if ( "hidden" in dataShow ) { + hidden = dataShow.hidden; + } + } else { + dataShow = dataPriv.access( elem, "fxshow", { display: restoreDisplay } ); + } + + // Store hidden/visible for toggle so `.stop().toggle()` "reverses" + if ( toggle ) { + dataShow.hidden = !hidden; + } + + // Show elements before animating them + if ( hidden ) { + showHide( [ elem ], true ); + } + + /* eslint-disable no-loop-func */ + + anim.done( function() { + + /* eslint-enable no-loop-func */ + + // The final step of a "hide" animation is actually hiding the element + if ( !hidden ) { + showHide( [ elem ] ); + } + dataPriv.remove( elem, "fxshow" ); + for ( prop in orig ) { + jQuery.style( elem, prop, orig[ prop ] ); + } + } ); + } + + // Per-property setup + propTween = createTween( hidden ? dataShow[ prop ] : 0, prop, anim ); + if ( !( prop in dataShow ) ) { + dataShow[ prop ] = propTween.start; + if ( hidden ) { + propTween.end = propTween.start; + propTween.start = 0; + } + } + } +} + +function propFilter( props, specialEasing ) { + var index, name, easing, value, hooks; + + // camelCase, specialEasing and expand cssHook pass + for ( index in props ) { + name = camelCase( index ); + easing = specialEasing[ name ]; + value = props[ index ]; + if ( Array.isArray( value ) ) { + easing = value[ 1 ]; + value = props[ index ] = value[ 0 ]; + } + + if ( index !== name ) { + props[ name ] = value; + delete props[ index ]; + } + + hooks = jQuery.cssHooks[ name ]; + if ( hooks && "expand" in hooks ) { + value = hooks.expand( value ); + delete props[ name ]; + + // Not quite $.extend, this won't overwrite existing keys. + // Reusing 'index' because we have the correct "name" + for ( index in value ) { + if ( !( index in props ) ) { + props[ index ] = value[ index ]; + specialEasing[ index ] = easing; + } + } + } else { + specialEasing[ name ] = easing; + } + } +} + +function Animation( elem, properties, options ) { + var result, + stopped, + index = 0, + length = Animation.prefilters.length, + deferred = jQuery.Deferred().always( function() { + + // Don't match elem in the :animated selector + delete tick.elem; + } ), + tick = function() { + if ( stopped ) { + return false; + } + var currentTime = fxNow || createFxNow(), + remaining = Math.max( 0, animation.startTime + animation.duration - currentTime ), + + // Support: Android 2.3 only + // Archaic crash bug won't allow us to use `1 - ( 0.5 || 0 )` (#12497) + temp = remaining / animation.duration || 0, + percent = 1 - temp, + index = 0, + length = animation.tweens.length; + + for ( ; index < length; index++ ) { + animation.tweens[ index ].run( percent ); + } + + deferred.notifyWith( elem, [ animation, percent, remaining ] ); + + // If there's more to do, yield + if ( percent < 1 && length ) { + return remaining; + } + + // If this was an empty animation, synthesize a final progress notification + if ( !length ) { + deferred.notifyWith( elem, [ animation, 1, 0 ] ); + } + + // Resolve the animation and report its conclusion + deferred.resolveWith( elem, [ animation ] ); + return false; + }, + animation = deferred.promise( { + elem: elem, + props: jQuery.extend( {}, properties ), + opts: jQuery.extend( true, { + specialEasing: {}, + easing: jQuery.easing._default + }, options ), + originalProperties: properties, + originalOptions: options, + startTime: fxNow || createFxNow(), + duration: options.duration, + tweens: [], + createTween: function( prop, end ) { + var tween = jQuery.Tween( elem, animation.opts, prop, end, + animation.opts.specialEasing[ prop ] || animation.opts.easing ); + animation.tweens.push( tween ); + return tween; + }, + stop: function( gotoEnd ) { + var index = 0, + + // If we are going to the end, we want to run all the tweens + // otherwise we skip this part + length = gotoEnd ? animation.tweens.length : 0; + if ( stopped ) { + return this; + } + stopped = true; + for ( ; index < length; index++ ) { + animation.tweens[ index ].run( 1 ); + } + + // Resolve when we played the last frame; otherwise, reject + if ( gotoEnd ) { + deferred.notifyWith( elem, [ animation, 1, 0 ] ); + deferred.resolveWith( elem, [ animation, gotoEnd ] ); + } else { + deferred.rejectWith( elem, [ animation, gotoEnd ] ); + } + return this; + } + } ), + props = animation.props; + + propFilter( props, animation.opts.specialEasing ); + + for ( ; index < length; index++ ) { + result = Animation.prefilters[ index ].call( animation, elem, props, animation.opts ); + if ( result ) { + if ( isFunction( result.stop ) ) { + jQuery._queueHooks( animation.elem, animation.opts.queue ).stop = + result.stop.bind( result ); + } + return result; + } + } + + jQuery.map( props, createTween, animation ); + + if ( isFunction( animation.opts.start ) ) { + animation.opts.start.call( elem, animation ); + } + + // Attach callbacks from options + animation + .progress( animation.opts.progress ) + .done( animation.opts.done, animation.opts.complete ) + .fail( animation.opts.fail ) + .always( animation.opts.always ); + + jQuery.fx.timer( + jQuery.extend( tick, { + elem: elem, + anim: animation, + queue: animation.opts.queue + } ) + ); + + return animation; +} + +jQuery.Animation = jQuery.extend( Animation, { + + tweeners: { + "*": [ function( prop, value ) { + var tween = this.createTween( prop, value ); + adjustCSS( tween.elem, prop, rcssNum.exec( value ), tween ); + return tween; + } ] + }, + + tweener: function( props, callback ) { + if ( isFunction( props ) ) { + callback = props; + props = [ "*" ]; + } else { + props = props.match( rnothtmlwhite ); + } + + var prop, + index = 0, + length = props.length; + + for ( ; index < length; index++ ) { + prop = props[ index ]; + Animation.tweeners[ prop ] = Animation.tweeners[ prop ] || []; + Animation.tweeners[ prop ].unshift( callback ); + } + }, + + prefilters: [ defaultPrefilter ], + + prefilter: function( callback, prepend ) { + if ( prepend ) { + Animation.prefilters.unshift( callback ); + } else { + Animation.prefilters.push( callback ); + } + } +} ); + +jQuery.speed = function( speed, easing, fn ) { + var opt = speed && typeof speed === "object" ? jQuery.extend( {}, speed ) : { + complete: fn || !fn && easing || + isFunction( speed ) && speed, + duration: speed, + easing: fn && easing || easing && !isFunction( easing ) && easing + }; + + // Go to the end state if fx are off + if ( jQuery.fx.off ) { + opt.duration = 0; + + } else { + if ( typeof opt.duration !== "number" ) { + if ( opt.duration in jQuery.fx.speeds ) { + opt.duration = jQuery.fx.speeds[ opt.duration ]; + + } else { + opt.duration = jQuery.fx.speeds._default; + } + } + } + + // Normalize opt.queue - true/undefined/null -> "fx" + if ( opt.queue == null || opt.queue === true ) { + opt.queue = "fx"; + } + + // Queueing + opt.old = opt.complete; + + opt.complete = function() { + if ( isFunction( opt.old ) ) { + opt.old.call( this ); + } + + if ( opt.queue ) { + jQuery.dequeue( this, opt.queue ); + } + }; + + return opt; +}; + +jQuery.fn.extend( { + fadeTo: function( speed, to, easing, callback ) { + + // Show any hidden elements after setting opacity to 0 + return this.filter( isHiddenWithinTree ).css( "opacity", 0 ).show() + + // Animate to the value specified + .end().animate( { opacity: to }, speed, easing, callback ); + }, + animate: function( prop, speed, easing, callback ) { + var empty = jQuery.isEmptyObject( prop ), + optall = jQuery.speed( speed, easing, callback ), + doAnimation = function() { + + // Operate on a copy of prop so per-property easing won't be lost + var anim = Animation( this, jQuery.extend( {}, prop ), optall ); + + // Empty animations, or finishing resolves immediately + if ( empty || dataPriv.get( this, "finish" ) ) { + anim.stop( true ); + } + }; + + doAnimation.finish = doAnimation; + + return empty || optall.queue === false ? + this.each( doAnimation ) : + this.queue( optall.queue, doAnimation ); + }, + stop: function( type, clearQueue, gotoEnd ) { + var stopQueue = function( hooks ) { + var stop = hooks.stop; + delete hooks.stop; + stop( gotoEnd ); + }; + + if ( typeof type !== "string" ) { + gotoEnd = clearQueue; + clearQueue = type; + type = undefined; + } + if ( clearQueue ) { + this.queue( type || "fx", [] ); + } + + return this.each( function() { + var dequeue = true, + index = type != null && type + "queueHooks", + timers = jQuery.timers, + data = dataPriv.get( this ); + + if ( index ) { + if ( data[ index ] && data[ index ].stop ) { + stopQueue( data[ index ] ); + } + } else { + for ( index in data ) { + if ( data[ index ] && data[ index ].stop && rrun.test( index ) ) { + stopQueue( data[ index ] ); + } + } + } + + for ( index = timers.length; index--; ) { + if ( timers[ index ].elem === this && + ( type == null || timers[ index ].queue === type ) ) { + + timers[ index ].anim.stop( gotoEnd ); + dequeue = false; + timers.splice( index, 1 ); + } + } + + // Start the next in the queue if the last step wasn't forced. + // Timers currently will call their complete callbacks, which + // will dequeue but only if they were gotoEnd. + if ( dequeue || !gotoEnd ) { + jQuery.dequeue( this, type ); + } + } ); + }, + finish: function( type ) { + if ( type !== false ) { + type = type || "fx"; + } + return this.each( function() { + var index, + data = dataPriv.get( this ), + queue = data[ type + "queue" ], + hooks = data[ type + "queueHooks" ], + timers = jQuery.timers, + length = queue ? queue.length : 0; + + // Enable finishing flag on private data + data.finish = true; + + // Empty the queue first + jQuery.queue( this, type, [] ); + + if ( hooks && hooks.stop ) { + hooks.stop.call( this, true ); + } + + // Look for any active animations, and finish them + for ( index = timers.length; index--; ) { + if ( timers[ index ].elem === this && timers[ index ].queue === type ) { + timers[ index ].anim.stop( true ); + timers.splice( index, 1 ); + } + } + + // Look for any animations in the old queue and finish them + for ( index = 0; index < length; index++ ) { + if ( queue[ index ] && queue[ index ].finish ) { + queue[ index ].finish.call( this ); + } + } + + // Turn off finishing flag + delete data.finish; + } ); + } +} ); + +jQuery.each( [ "toggle", "show", "hide" ], function( _i, name ) { + var cssFn = jQuery.fn[ name ]; + jQuery.fn[ name ] = function( speed, easing, callback ) { + return speed == null || typeof speed === "boolean" ? + cssFn.apply( this, arguments ) : + this.animate( genFx( name, true ), speed, easing, callback ); + }; +} ); + +// Generate shortcuts for custom animations +jQuery.each( { + slideDown: genFx( "show" ), + slideUp: genFx( "hide" ), + slideToggle: genFx( "toggle" ), + fadeIn: { opacity: "show" }, + fadeOut: { opacity: "hide" }, + fadeToggle: { opacity: "toggle" } +}, function( name, props ) { + jQuery.fn[ name ] = function( speed, easing, callback ) { + return this.animate( props, speed, easing, callback ); + }; +} ); + +jQuery.timers = []; +jQuery.fx.tick = function() { + var timer, + i = 0, + timers = jQuery.timers; + + fxNow = Date.now(); + + for ( ; i < timers.length; i++ ) { + timer = timers[ i ]; + + // Run the timer and safely remove it when done (allowing for external removal) + if ( !timer() && timers[ i ] === timer ) { + timers.splice( i--, 1 ); + } + } + + if ( !timers.length ) { + jQuery.fx.stop(); + } + fxNow = undefined; +}; + +jQuery.fx.timer = function( timer ) { + jQuery.timers.push( timer ); + jQuery.fx.start(); +}; + +jQuery.fx.interval = 13; +jQuery.fx.start = function() { + if ( inProgress ) { + return; + } + + inProgress = true; + schedule(); +}; + +jQuery.fx.stop = function() { + inProgress = null; +}; + +jQuery.fx.speeds = { + slow: 600, + fast: 200, + + // Default speed + _default: 400 +}; + + +// Based off of the plugin by Clint Helfers, with permission. +// https://web.archive.org/web/20100324014747/http://blindsignals.com/index.php/2009/07/jquery-delay/ +jQuery.fn.delay = function( time, type ) { + time = jQuery.fx ? jQuery.fx.speeds[ time ] || time : time; + type = type || "fx"; + + return this.queue( type, function( next, hooks ) { + var timeout = window.setTimeout( next, time ); + hooks.stop = function() { + window.clearTimeout( timeout ); + }; + } ); +}; + + +( function() { + var input = document.createElement( "input" ), + select = document.createElement( "select" ), + opt = select.appendChild( document.createElement( "option" ) ); + + input.type = "checkbox"; + + // Support: Android <=4.3 only + // Default value for a checkbox should be "on" + support.checkOn = input.value !== ""; + + // Support: IE <=11 only + // Must access selectedIndex to make default options select + support.optSelected = opt.selected; + + // Support: IE <=11 only + // An input loses its value after becoming a radio + input = document.createElement( "input" ); + input.value = "t"; + input.type = "radio"; + support.radioValue = input.value === "t"; +} )(); + + +var boolHook, + attrHandle = jQuery.expr.attrHandle; + +jQuery.fn.extend( { + attr: function( name, value ) { + return access( this, jQuery.attr, name, value, arguments.length > 1 ); + }, + + removeAttr: function( name ) { + return this.each( function() { + jQuery.removeAttr( this, name ); + } ); + } +} ); + +jQuery.extend( { + attr: function( elem, name, value ) { + var ret, hooks, + nType = elem.nodeType; + + // Don't get/set attributes on text, comment and attribute nodes + if ( nType === 3 || nType === 8 || nType === 2 ) { + return; + } + + // Fallback to prop when attributes are not supported + if ( typeof elem.getAttribute === "undefined" ) { + return jQuery.prop( elem, name, value ); + } + + // Attribute hooks are determined by the lowercase version + // Grab necessary hook if one is defined + if ( nType !== 1 || !jQuery.isXMLDoc( elem ) ) { + hooks = jQuery.attrHooks[ name.toLowerCase() ] || + ( jQuery.expr.match.bool.test( name ) ? boolHook : undefined ); + } + + if ( value !== undefined ) { + if ( value === null ) { + jQuery.removeAttr( elem, name ); + return; + } + + if ( hooks && "set" in hooks && + ( ret = hooks.set( elem, value, name ) ) !== undefined ) { + return ret; + } + + elem.setAttribute( name, value + "" ); + return value; + } + + if ( hooks && "get" in hooks && ( ret = hooks.get( elem, name ) ) !== null ) { + return ret; + } + + ret = jQuery.find.attr( elem, name ); + + // Non-existent attributes return null, we normalize to undefined + return ret == null ? undefined : ret; + }, + + attrHooks: { + type: { + set: function( elem, value ) { + if ( !support.radioValue && value === "radio" && + nodeName( elem, "input" ) ) { + var val = elem.value; + elem.setAttribute( "type", value ); + if ( val ) { + elem.value = val; + } + return value; + } + } + } + }, + + removeAttr: function( elem, value ) { + var name, + i = 0, + + // Attribute names can contain non-HTML whitespace characters + // https://html.spec.whatwg.org/multipage/syntax.html#attributes-2 + attrNames = value && value.match( rnothtmlwhite ); + + if ( attrNames && elem.nodeType === 1 ) { + while ( ( name = attrNames[ i++ ] ) ) { + elem.removeAttribute( name ); + } + } + } +} ); + +// Hooks for boolean attributes +boolHook = { + set: function( elem, value, name ) { + if ( value === false ) { + + // Remove boolean attributes when set to false + jQuery.removeAttr( elem, name ); + } else { + elem.setAttribute( name, name ); + } + return name; + } +}; + +jQuery.each( jQuery.expr.match.bool.source.match( /\w+/g ), function( _i, name ) { + var getter = attrHandle[ name ] || jQuery.find.attr; + + attrHandle[ name ] = function( elem, name, isXML ) { + var ret, handle, + lowercaseName = name.toLowerCase(); + + if ( !isXML ) { + + // Avoid an infinite loop by temporarily removing this function from the getter + handle = attrHandle[ lowercaseName ]; + attrHandle[ lowercaseName ] = ret; + ret = getter( elem, name, isXML ) != null ? + lowercaseName : + null; + attrHandle[ lowercaseName ] = handle; + } + return ret; + }; +} ); + + + + +var rfocusable = /^(?:input|select|textarea|button)$/i, + rclickable = /^(?:a|area)$/i; + +jQuery.fn.extend( { + prop: function( name, value ) { + return access( this, jQuery.prop, name, value, arguments.length > 1 ); + }, + + removeProp: function( name ) { + return this.each( function() { + delete this[ jQuery.propFix[ name ] || name ]; + } ); + } +} ); + +jQuery.extend( { + prop: function( elem, name, value ) { + var ret, hooks, + nType = elem.nodeType; + + // Don't get/set properties on text, comment and attribute nodes + if ( nType === 3 || nType === 8 || nType === 2 ) { + return; + } + + if ( nType !== 1 || !jQuery.isXMLDoc( elem ) ) { + + // Fix name and attach hooks + name = jQuery.propFix[ name ] || name; + hooks = jQuery.propHooks[ name ]; + } + + if ( value !== undefined ) { + if ( hooks && "set" in hooks && + ( ret = hooks.set( elem, value, name ) ) !== undefined ) { + return ret; + } + + return ( elem[ name ] = value ); + } + + if ( hooks && "get" in hooks && ( ret = hooks.get( elem, name ) ) !== null ) { + return ret; + } + + return elem[ name ]; + }, + + propHooks: { + tabIndex: { + get: function( elem ) { + + // Support: IE <=9 - 11 only + // elem.tabIndex doesn't always return the + // correct value when it hasn't been explicitly set + // https://web.archive.org/web/20141116233347/http://fluidproject.org/blog/2008/01/09/getting-setting-and-removing-tabindex-values-with-javascript/ + // Use proper attribute retrieval(#12072) + var tabindex = jQuery.find.attr( elem, "tabindex" ); + + if ( tabindex ) { + return parseInt( tabindex, 10 ); + } + + if ( + rfocusable.test( elem.nodeName ) || + rclickable.test( elem.nodeName ) && + elem.href + ) { + return 0; + } + + return -1; + } + } + }, + + propFix: { + "for": "htmlFor", + "class": "className" + } +} ); + +// Support: IE <=11 only +// Accessing the selectedIndex property +// forces the browser to respect setting selected +// on the option +// The getter ensures a default option is selected +// when in an optgroup +// eslint rule "no-unused-expressions" is disabled for this code +// since it considers such accessions noop +if ( !support.optSelected ) { + jQuery.propHooks.selected = { + get: function( elem ) { + + /* eslint no-unused-expressions: "off" */ + + var parent = elem.parentNode; + if ( parent && parent.parentNode ) { + parent.parentNode.selectedIndex; + } + return null; + }, + set: function( elem ) { + + /* eslint no-unused-expressions: "off" */ + + var parent = elem.parentNode; + if ( parent ) { + parent.selectedIndex; + + if ( parent.parentNode ) { + parent.parentNode.selectedIndex; + } + } + } + }; +} + +jQuery.each( [ + "tabIndex", + "readOnly", + "maxLength", + "cellSpacing", + "cellPadding", + "rowSpan", + "colSpan", + "useMap", + "frameBorder", + "contentEditable" +], function() { + jQuery.propFix[ this.toLowerCase() ] = this; +} ); + + + + + // Strip and collapse whitespace according to HTML spec + // https://infra.spec.whatwg.org/#strip-and-collapse-ascii-whitespace + function stripAndCollapse( value ) { + var tokens = value.match( rnothtmlwhite ) || []; + return tokens.join( " " ); + } + + +function getClass( elem ) { + return elem.getAttribute && elem.getAttribute( "class" ) || ""; +} + +function classesToArray( value ) { + if ( Array.isArray( value ) ) { + return value; + } + if ( typeof value === "string" ) { + return value.match( rnothtmlwhite ) || []; + } + return []; +} + +jQuery.fn.extend( { + addClass: function( value ) { + var classes, elem, cur, curValue, clazz, j, finalValue, + i = 0; + + if ( isFunction( value ) ) { + return this.each( function( j ) { + jQuery( this ).addClass( value.call( this, j, getClass( this ) ) ); + } ); + } + + classes = classesToArray( value ); + + if ( classes.length ) { + while ( ( elem = this[ i++ ] ) ) { + curValue = getClass( elem ); + cur = elem.nodeType === 1 && ( " " + stripAndCollapse( curValue ) + " " ); + + if ( cur ) { + j = 0; + while ( ( clazz = classes[ j++ ] ) ) { + if ( cur.indexOf( " " + clazz + " " ) < 0 ) { + cur += clazz + " "; + } + } + + // Only assign if different to avoid unneeded rendering. + finalValue = stripAndCollapse( cur ); + if ( curValue !== finalValue ) { + elem.setAttribute( "class", finalValue ); + } + } + } + } + + return this; + }, + + removeClass: function( value ) { + var classes, elem, cur, curValue, clazz, j, finalValue, + i = 0; + + if ( isFunction( value ) ) { + return this.each( function( j ) { + jQuery( this ).removeClass( value.call( this, j, getClass( this ) ) ); + } ); + } + + if ( !arguments.length ) { + return this.attr( "class", "" ); + } + + classes = classesToArray( value ); + + if ( classes.length ) { + while ( ( elem = this[ i++ ] ) ) { + curValue = getClass( elem ); + + // This expression is here for better compressibility (see addClass) + cur = elem.nodeType === 1 && ( " " + stripAndCollapse( curValue ) + " " ); + + if ( cur ) { + j = 0; + while ( ( clazz = classes[ j++ ] ) ) { + + // Remove *all* instances + while ( cur.indexOf( " " + clazz + " " ) > -1 ) { + cur = cur.replace( " " + clazz + " ", " " ); + } + } + + // Only assign if different to avoid unneeded rendering. + finalValue = stripAndCollapse( cur ); + if ( curValue !== finalValue ) { + elem.setAttribute( "class", finalValue ); + } + } + } + } + + return this; + }, + + toggleClass: function( value, stateVal ) { + var type = typeof value, + isValidValue = type === "string" || Array.isArray( value ); + + if ( typeof stateVal === "boolean" && isValidValue ) { + return stateVal ? this.addClass( value ) : this.removeClass( value ); + } + + if ( isFunction( value ) ) { + return this.each( function( i ) { + jQuery( this ).toggleClass( + value.call( this, i, getClass( this ), stateVal ), + stateVal + ); + } ); + } + + return this.each( function() { + var className, i, self, classNames; + + if ( isValidValue ) { + + // Toggle individual class names + i = 0; + self = jQuery( this ); + classNames = classesToArray( value ); + + while ( ( className = classNames[ i++ ] ) ) { + + // Check each className given, space separated list + if ( self.hasClass( className ) ) { + self.removeClass( className ); + } else { + self.addClass( className ); + } + } + + // Toggle whole class name + } else if ( value === undefined || type === "boolean" ) { + className = getClass( this ); + if ( className ) { + + // Store className if set + dataPriv.set( this, "__className__", className ); + } + + // If the element has a class name or if we're passed `false`, + // then remove the whole classname (if there was one, the above saved it). + // Otherwise bring back whatever was previously saved (if anything), + // falling back to the empty string if nothing was stored. + if ( this.setAttribute ) { + this.setAttribute( "class", + className || value === false ? + "" : + dataPriv.get( this, "__className__" ) || "" + ); + } + } + } ); + }, + + hasClass: function( selector ) { + var className, elem, + i = 0; + + className = " " + selector + " "; + while ( ( elem = this[ i++ ] ) ) { + if ( elem.nodeType === 1 && + ( " " + stripAndCollapse( getClass( elem ) ) + " " ).indexOf( className ) > -1 ) { + return true; + } + } + + return false; + } +} ); + + + + +var rreturn = /\r/g; + +jQuery.fn.extend( { + val: function( value ) { + var hooks, ret, valueIsFunction, + elem = this[ 0 ]; + + if ( !arguments.length ) { + if ( elem ) { + hooks = jQuery.valHooks[ elem.type ] || + jQuery.valHooks[ elem.nodeName.toLowerCase() ]; + + if ( hooks && + "get" in hooks && + ( ret = hooks.get( elem, "value" ) ) !== undefined + ) { + return ret; + } + + ret = elem.value; + + // Handle most common string cases + if ( typeof ret === "string" ) { + return ret.replace( rreturn, "" ); + } + + // Handle cases where value is null/undef or number + return ret == null ? "" : ret; + } + + return; + } + + valueIsFunction = isFunction( value ); + + return this.each( function( i ) { + var val; + + if ( this.nodeType !== 1 ) { + return; + } + + if ( valueIsFunction ) { + val = value.call( this, i, jQuery( this ).val() ); + } else { + val = value; + } + + // Treat null/undefined as ""; convert numbers to string + if ( val == null ) { + val = ""; + + } else if ( typeof val === "number" ) { + val += ""; + + } else if ( Array.isArray( val ) ) { + val = jQuery.map( val, function( value ) { + return value == null ? "" : value + ""; + } ); + } + + hooks = jQuery.valHooks[ this.type ] || jQuery.valHooks[ this.nodeName.toLowerCase() ]; + + // If set returns undefined, fall back to normal setting + if ( !hooks || !( "set" in hooks ) || hooks.set( this, val, "value" ) === undefined ) { + this.value = val; + } + } ); + } +} ); + +jQuery.extend( { + valHooks: { + option: { + get: function( elem ) { + + var val = jQuery.find.attr( elem, "value" ); + return val != null ? + val : + + // Support: IE <=10 - 11 only + // option.text throws exceptions (#14686, #14858) + // Strip and collapse whitespace + // https://html.spec.whatwg.org/#strip-and-collapse-whitespace + stripAndCollapse( jQuery.text( elem ) ); + } + }, + select: { + get: function( elem ) { + var value, option, i, + options = elem.options, + index = elem.selectedIndex, + one = elem.type === "select-one", + values = one ? null : [], + max = one ? index + 1 : options.length; + + if ( index < 0 ) { + i = max; + + } else { + i = one ? index : 0; + } + + // Loop through all the selected options + for ( ; i < max; i++ ) { + option = options[ i ]; + + // Support: IE <=9 only + // IE8-9 doesn't update selected after form reset (#2551) + if ( ( option.selected || i === index ) && + + // Don't return options that are disabled or in a disabled optgroup + !option.disabled && + ( !option.parentNode.disabled || + !nodeName( option.parentNode, "optgroup" ) ) ) { + + // Get the specific value for the option + value = jQuery( option ).val(); + + // We don't need an array for one selects + if ( one ) { + return value; + } + + // Multi-Selects return an array + values.push( value ); + } + } + + return values; + }, + + set: function( elem, value ) { + var optionSet, option, + options = elem.options, + values = jQuery.makeArray( value ), + i = options.length; + + while ( i-- ) { + option = options[ i ]; + + /* eslint-disable no-cond-assign */ + + if ( option.selected = + jQuery.inArray( jQuery.valHooks.option.get( option ), values ) > -1 + ) { + optionSet = true; + } + + /* eslint-enable no-cond-assign */ + } + + // Force browsers to behave consistently when non-matching value is set + if ( !optionSet ) { + elem.selectedIndex = -1; + } + return values; + } + } + } +} ); + +// Radios and checkboxes getter/setter +jQuery.each( [ "radio", "checkbox" ], function() { + jQuery.valHooks[ this ] = { + set: function( elem, value ) { + if ( Array.isArray( value ) ) { + return ( elem.checked = jQuery.inArray( jQuery( elem ).val(), value ) > -1 ); + } + } + }; + if ( !support.checkOn ) { + jQuery.valHooks[ this ].get = function( elem ) { + return elem.getAttribute( "value" ) === null ? "on" : elem.value; + }; + } +} ); + + + + +// Return jQuery for attributes-only inclusion + + +support.focusin = "onfocusin" in window; + + +var rfocusMorph = /^(?:focusinfocus|focusoutblur)$/, + stopPropagationCallback = function( e ) { + e.stopPropagation(); + }; + +jQuery.extend( jQuery.event, { + + trigger: function( event, data, elem, onlyHandlers ) { + + var i, cur, tmp, bubbleType, ontype, handle, special, lastElement, + eventPath = [ elem || document ], + type = hasOwn.call( event, "type" ) ? event.type : event, + namespaces = hasOwn.call( event, "namespace" ) ? event.namespace.split( "." ) : []; + + cur = lastElement = tmp = elem = elem || document; + + // Don't do events on text and comment nodes + if ( elem.nodeType === 3 || elem.nodeType === 8 ) { + return; + } + + // focus/blur morphs to focusin/out; ensure we're not firing them right now + if ( rfocusMorph.test( type + jQuery.event.triggered ) ) { + return; + } + + if ( type.indexOf( "." ) > -1 ) { + + // Namespaced trigger; create a regexp to match event type in handle() + namespaces = type.split( "." ); + type = namespaces.shift(); + namespaces.sort(); + } + ontype = type.indexOf( ":" ) < 0 && "on" + type; + + // Caller can pass in a jQuery.Event object, Object, or just an event type string + event = event[ jQuery.expando ] ? + event : + new jQuery.Event( type, typeof event === "object" && event ); + + // Trigger bitmask: & 1 for native handlers; & 2 for jQuery (always true) + event.isTrigger = onlyHandlers ? 2 : 3; + event.namespace = namespaces.join( "." ); + event.rnamespace = event.namespace ? + new RegExp( "(^|\\.)" + namespaces.join( "\\.(?:.*\\.|)" ) + "(\\.|$)" ) : + null; + + // Clean up the event in case it is being reused + event.result = undefined; + if ( !event.target ) { + event.target = elem; + } + + // Clone any incoming data and prepend the event, creating the handler arg list + data = data == null ? + [ event ] : + jQuery.makeArray( data, [ event ] ); + + // Allow special events to draw outside the lines + special = jQuery.event.special[ type ] || {}; + if ( !onlyHandlers && special.trigger && special.trigger.apply( elem, data ) === false ) { + return; + } + + // Determine event propagation path in advance, per W3C events spec (#9951) + // Bubble up to document, then to window; watch for a global ownerDocument var (#9724) + if ( !onlyHandlers && !special.noBubble && !isWindow( elem ) ) { + + bubbleType = special.delegateType || type; + if ( !rfocusMorph.test( bubbleType + type ) ) { + cur = cur.parentNode; + } + for ( ; cur; cur = cur.parentNode ) { + eventPath.push( cur ); + tmp = cur; + } + + // Only add window if we got to document (e.g., not plain obj or detached DOM) + if ( tmp === ( elem.ownerDocument || document ) ) { + eventPath.push( tmp.defaultView || tmp.parentWindow || window ); + } + } + + // Fire handlers on the event path + i = 0; + while ( ( cur = eventPath[ i++ ] ) && !event.isPropagationStopped() ) { + lastElement = cur; + event.type = i > 1 ? + bubbleType : + special.bindType || type; + + // jQuery handler + handle = ( dataPriv.get( cur, "events" ) || Object.create( null ) )[ event.type ] && + dataPriv.get( cur, "handle" ); + if ( handle ) { + handle.apply( cur, data ); + } + + // Native handler + handle = ontype && cur[ ontype ]; + if ( handle && handle.apply && acceptData( cur ) ) { + event.result = handle.apply( cur, data ); + if ( event.result === false ) { + event.preventDefault(); + } + } + } + event.type = type; + + // If nobody prevented the default action, do it now + if ( !onlyHandlers && !event.isDefaultPrevented() ) { + + if ( ( !special._default || + special._default.apply( eventPath.pop(), data ) === false ) && + acceptData( elem ) ) { + + // Call a native DOM method on the target with the same name as the event. + // Don't do default actions on window, that's where global variables be (#6170) + if ( ontype && isFunction( elem[ type ] ) && !isWindow( elem ) ) { + + // Don't re-trigger an onFOO event when we call its FOO() method + tmp = elem[ ontype ]; + + if ( tmp ) { + elem[ ontype ] = null; + } + + // Prevent re-triggering of the same event, since we already bubbled it above + jQuery.event.triggered = type; + + if ( event.isPropagationStopped() ) { + lastElement.addEventListener( type, stopPropagationCallback ); + } + + elem[ type ](); + + if ( event.isPropagationStopped() ) { + lastElement.removeEventListener( type, stopPropagationCallback ); + } + + jQuery.event.triggered = undefined; + + if ( tmp ) { + elem[ ontype ] = tmp; + } + } + } + } + + return event.result; + }, + + // Piggyback on a donor event to simulate a different one + // Used only for `focus(in | out)` events + simulate: function( type, elem, event ) { + var e = jQuery.extend( + new jQuery.Event(), + event, + { + type: type, + isSimulated: true + } + ); + + jQuery.event.trigger( e, null, elem ); + } + +} ); + +jQuery.fn.extend( { + + trigger: function( type, data ) { + return this.each( function() { + jQuery.event.trigger( type, data, this ); + } ); + }, + triggerHandler: function( type, data ) { + var elem = this[ 0 ]; + if ( elem ) { + return jQuery.event.trigger( type, data, elem, true ); + } + } +} ); + + +// Support: Firefox <=44 +// Firefox doesn't have focus(in | out) events +// Related ticket - https://bugzilla.mozilla.org/show_bug.cgi?id=687787 +// +// Support: Chrome <=48 - 49, Safari <=9.0 - 9.1 +// focus(in | out) events fire after focus & blur events, +// which is spec violation - http://www.w3.org/TR/DOM-Level-3-Events/#events-focusevent-event-order +// Related ticket - https://bugs.chromium.org/p/chromium/issues/detail?id=449857 +if ( !support.focusin ) { + jQuery.each( { focus: "focusin", blur: "focusout" }, function( orig, fix ) { + + // Attach a single capturing handler on the document while someone wants focusin/focusout + var handler = function( event ) { + jQuery.event.simulate( fix, event.target, jQuery.event.fix( event ) ); + }; + + jQuery.event.special[ fix ] = { + setup: function() { + + // Handle: regular nodes (via `this.ownerDocument`), window + // (via `this.document`) & document (via `this`). + var doc = this.ownerDocument || this.document || this, + attaches = dataPriv.access( doc, fix ); + + if ( !attaches ) { + doc.addEventListener( orig, handler, true ); + } + dataPriv.access( doc, fix, ( attaches || 0 ) + 1 ); + }, + teardown: function() { + var doc = this.ownerDocument || this.document || this, + attaches = dataPriv.access( doc, fix ) - 1; + + if ( !attaches ) { + doc.removeEventListener( orig, handler, true ); + dataPriv.remove( doc, fix ); + + } else { + dataPriv.access( doc, fix, attaches ); + } + } + }; + } ); +} +var location = window.location; + +var nonce = { guid: Date.now() }; + +var rquery = ( /\?/ ); + + + +// Cross-browser xml parsing +jQuery.parseXML = function( data ) { + var xml, parserErrorElem; + if ( !data || typeof data !== "string" ) { + return null; + } + + // Support: IE 9 - 11 only + // IE throws on parseFromString with invalid input. + try { + xml = ( new window.DOMParser() ).parseFromString( data, "text/xml" ); + } catch ( e ) {} + + parserErrorElem = xml && xml.getElementsByTagName( "parsererror" )[ 0 ]; + if ( !xml || parserErrorElem ) { + jQuery.error( "Invalid XML: " + ( + parserErrorElem ? + jQuery.map( parserErrorElem.childNodes, function( el ) { + return el.textContent; + } ).join( "\n" ) : + data + ) ); + } + return xml; +}; + + +var + rbracket = /\[\]$/, + rCRLF = /\r?\n/g, + rsubmitterTypes = /^(?:submit|button|image|reset|file)$/i, + rsubmittable = /^(?:input|select|textarea|keygen)/i; + +function buildParams( prefix, obj, traditional, add ) { + var name; + + if ( Array.isArray( obj ) ) { + + // Serialize array item. + jQuery.each( obj, function( i, v ) { + if ( traditional || rbracket.test( prefix ) ) { + + // Treat each array item as a scalar. + add( prefix, v ); + + } else { + + // Item is non-scalar (array or object), encode its numeric index. + buildParams( + prefix + "[" + ( typeof v === "object" && v != null ? i : "" ) + "]", + v, + traditional, + add + ); + } + } ); + + } else if ( !traditional && toType( obj ) === "object" ) { + + // Serialize object item. + for ( name in obj ) { + buildParams( prefix + "[" + name + "]", obj[ name ], traditional, add ); + } + + } else { + + // Serialize scalar item. + add( prefix, obj ); + } +} + +// Serialize an array of form elements or a set of +// key/values into a query string +jQuery.param = function( a, traditional ) { + var prefix, + s = [], + add = function( key, valueOrFunction ) { + + // If value is a function, invoke it and use its return value + var value = isFunction( valueOrFunction ) ? + valueOrFunction() : + valueOrFunction; + + s[ s.length ] = encodeURIComponent( key ) + "=" + + encodeURIComponent( value == null ? "" : value ); + }; + + if ( a == null ) { + return ""; + } + + // If an array was passed in, assume that it is an array of form elements. + if ( Array.isArray( a ) || ( a.jquery && !jQuery.isPlainObject( a ) ) ) { + + // Serialize the form elements + jQuery.each( a, function() { + add( this.name, this.value ); + } ); + + } else { + + // If traditional, encode the "old" way (the way 1.3.2 or older + // did it), otherwise encode params recursively. + for ( prefix in a ) { + buildParams( prefix, a[ prefix ], traditional, add ); + } + } + + // Return the resulting serialization + return s.join( "&" ); +}; + +jQuery.fn.extend( { + serialize: function() { + return jQuery.param( this.serializeArray() ); + }, + serializeArray: function() { + return this.map( function() { + + // Can add propHook for "elements" to filter or add form elements + var elements = jQuery.prop( this, "elements" ); + return elements ? jQuery.makeArray( elements ) : this; + } ).filter( function() { + var type = this.type; + + // Use .is( ":disabled" ) so that fieldset[disabled] works + return this.name && !jQuery( this ).is( ":disabled" ) && + rsubmittable.test( this.nodeName ) && !rsubmitterTypes.test( type ) && + ( this.checked || !rcheckableType.test( type ) ); + } ).map( function( _i, elem ) { + var val = jQuery( this ).val(); + + if ( val == null ) { + return null; + } + + if ( Array.isArray( val ) ) { + return jQuery.map( val, function( val ) { + return { name: elem.name, value: val.replace( rCRLF, "\r\n" ) }; + } ); + } + + return { name: elem.name, value: val.replace( rCRLF, "\r\n" ) }; + } ).get(); + } +} ); + + +var + r20 = /%20/g, + rhash = /#.*$/, + rantiCache = /([?&])_=[^&]*/, + rheaders = /^(.*?):[ \t]*([^\r\n]*)$/mg, + + // #7653, #8125, #8152: local protocol detection + rlocalProtocol = /^(?:about|app|app-storage|.+-extension|file|res|widget):$/, + rnoContent = /^(?:GET|HEAD)$/, + rprotocol = /^\/\//, + + /* Prefilters + * 1) They are useful to introduce custom dataTypes (see ajax/jsonp.js for an example) + * 2) These are called: + * - BEFORE asking for a transport + * - AFTER param serialization (s.data is a string if s.processData is true) + * 3) key is the dataType + * 4) the catchall symbol "*" can be used + * 5) execution will start with transport dataType and THEN continue down to "*" if needed + */ + prefilters = {}, + + /* Transports bindings + * 1) key is the dataType + * 2) the catchall symbol "*" can be used + * 3) selection will start with transport dataType and THEN go to "*" if needed + */ + transports = {}, + + // Avoid comment-prolog char sequence (#10098); must appease lint and evade compression + allTypes = "*/".concat( "*" ), + + // Anchor tag for parsing the document origin + originAnchor = document.createElement( "a" ); + +originAnchor.href = location.href; + +// Base "constructor" for jQuery.ajaxPrefilter and jQuery.ajaxTransport +function addToPrefiltersOrTransports( structure ) { + + // dataTypeExpression is optional and defaults to "*" + return function( dataTypeExpression, func ) { + + if ( typeof dataTypeExpression !== "string" ) { + func = dataTypeExpression; + dataTypeExpression = "*"; + } + + var dataType, + i = 0, + dataTypes = dataTypeExpression.toLowerCase().match( rnothtmlwhite ) || []; + + if ( isFunction( func ) ) { + + // For each dataType in the dataTypeExpression + while ( ( dataType = dataTypes[ i++ ] ) ) { + + // Prepend if requested + if ( dataType[ 0 ] === "+" ) { + dataType = dataType.slice( 1 ) || "*"; + ( structure[ dataType ] = structure[ dataType ] || [] ).unshift( func ); + + // Otherwise append + } else { + ( structure[ dataType ] = structure[ dataType ] || [] ).push( func ); + } + } + } + }; +} + +// Base inspection function for prefilters and transports +function inspectPrefiltersOrTransports( structure, options, originalOptions, jqXHR ) { + + var inspected = {}, + seekingTransport = ( structure === transports ); + + function inspect( dataType ) { + var selected; + inspected[ dataType ] = true; + jQuery.each( structure[ dataType ] || [], function( _, prefilterOrFactory ) { + var dataTypeOrTransport = prefilterOrFactory( options, originalOptions, jqXHR ); + if ( typeof dataTypeOrTransport === "string" && + !seekingTransport && !inspected[ dataTypeOrTransport ] ) { + + options.dataTypes.unshift( dataTypeOrTransport ); + inspect( dataTypeOrTransport ); + return false; + } else if ( seekingTransport ) { + return !( selected = dataTypeOrTransport ); + } + } ); + return selected; + } + + return inspect( options.dataTypes[ 0 ] ) || !inspected[ "*" ] && inspect( "*" ); +} + +// A special extend for ajax options +// that takes "flat" options (not to be deep extended) +// Fixes #9887 +function ajaxExtend( target, src ) { + var key, deep, + flatOptions = jQuery.ajaxSettings.flatOptions || {}; + + for ( key in src ) { + if ( src[ key ] !== undefined ) { + ( flatOptions[ key ] ? target : ( deep || ( deep = {} ) ) )[ key ] = src[ key ]; + } + } + if ( deep ) { + jQuery.extend( true, target, deep ); + } + + return target; +} + +/* Handles responses to an ajax request: + * - finds the right dataType (mediates between content-type and expected dataType) + * - returns the corresponding response + */ +function ajaxHandleResponses( s, jqXHR, responses ) { + + var ct, type, finalDataType, firstDataType, + contents = s.contents, + dataTypes = s.dataTypes; + + // Remove auto dataType and get content-type in the process + while ( dataTypes[ 0 ] === "*" ) { + dataTypes.shift(); + if ( ct === undefined ) { + ct = s.mimeType || jqXHR.getResponseHeader( "Content-Type" ); + } + } + + // Check if we're dealing with a known content-type + if ( ct ) { + for ( type in contents ) { + if ( contents[ type ] && contents[ type ].test( ct ) ) { + dataTypes.unshift( type ); + break; + } + } + } + + // Check to see if we have a response for the expected dataType + if ( dataTypes[ 0 ] in responses ) { + finalDataType = dataTypes[ 0 ]; + } else { + + // Try convertible dataTypes + for ( type in responses ) { + if ( !dataTypes[ 0 ] || s.converters[ type + " " + dataTypes[ 0 ] ] ) { + finalDataType = type; + break; + } + if ( !firstDataType ) { + firstDataType = type; + } + } + + // Or just use first one + finalDataType = finalDataType || firstDataType; + } + + // If we found a dataType + // We add the dataType to the list if needed + // and return the corresponding response + if ( finalDataType ) { + if ( finalDataType !== dataTypes[ 0 ] ) { + dataTypes.unshift( finalDataType ); + } + return responses[ finalDataType ]; + } +} + +/* Chain conversions given the request and the original response + * Also sets the responseXXX fields on the jqXHR instance + */ +function ajaxConvert( s, response, jqXHR, isSuccess ) { + var conv2, current, conv, tmp, prev, + converters = {}, + + // Work with a copy of dataTypes in case we need to modify it for conversion + dataTypes = s.dataTypes.slice(); + + // Create converters map with lowercased keys + if ( dataTypes[ 1 ] ) { + for ( conv in s.converters ) { + converters[ conv.toLowerCase() ] = s.converters[ conv ]; + } + } + + current = dataTypes.shift(); + + // Convert to each sequential dataType + while ( current ) { + + if ( s.responseFields[ current ] ) { + jqXHR[ s.responseFields[ current ] ] = response; + } + + // Apply the dataFilter if provided + if ( !prev && isSuccess && s.dataFilter ) { + response = s.dataFilter( response, s.dataType ); + } + + prev = current; + current = dataTypes.shift(); + + if ( current ) { + + // There's only work to do if current dataType is non-auto + if ( current === "*" ) { + + current = prev; + + // Convert response if prev dataType is non-auto and differs from current + } else if ( prev !== "*" && prev !== current ) { + + // Seek a direct converter + conv = converters[ prev + " " + current ] || converters[ "* " + current ]; + + // If none found, seek a pair + if ( !conv ) { + for ( conv2 in converters ) { + + // If conv2 outputs current + tmp = conv2.split( " " ); + if ( tmp[ 1 ] === current ) { + + // If prev can be converted to accepted input + conv = converters[ prev + " " + tmp[ 0 ] ] || + converters[ "* " + tmp[ 0 ] ]; + if ( conv ) { + + // Condense equivalence converters + if ( conv === true ) { + conv = converters[ conv2 ]; + + // Otherwise, insert the intermediate dataType + } else if ( converters[ conv2 ] !== true ) { + current = tmp[ 0 ]; + dataTypes.unshift( tmp[ 1 ] ); + } + break; + } + } + } + } + + // Apply converter (if not an equivalence) + if ( conv !== true ) { + + // Unless errors are allowed to bubble, catch and return them + if ( conv && s.throws ) { + response = conv( response ); + } else { + try { + response = conv( response ); + } catch ( e ) { + return { + state: "parsererror", + error: conv ? e : "No conversion from " + prev + " to " + current + }; + } + } + } + } + } + } + + return { state: "success", data: response }; +} + +jQuery.extend( { + + // Counter for holding the number of active queries + active: 0, + + // Last-Modified header cache for next request + lastModified: {}, + etag: {}, + + ajaxSettings: { + url: location.href, + type: "GET", + isLocal: rlocalProtocol.test( location.protocol ), + global: true, + processData: true, + async: true, + contentType: "application/x-www-form-urlencoded; charset=UTF-8", + + /* + timeout: 0, + data: null, + dataType: null, + username: null, + password: null, + cache: null, + throws: false, + traditional: false, + headers: {}, + */ + + accepts: { + "*": allTypes, + text: "text/plain", + html: "text/html", + xml: "application/xml, text/xml", + json: "application/json, text/javascript" + }, + + contents: { + xml: /\bxml\b/, + html: /\bhtml/, + json: /\bjson\b/ + }, + + responseFields: { + xml: "responseXML", + text: "responseText", + json: "responseJSON" + }, + + // Data converters + // Keys separate source (or catchall "*") and destination types with a single space + converters: { + + // Convert anything to text + "* text": String, + + // Text to html (true = no transformation) + "text html": true, + + // Evaluate text as a json expression + "text json": JSON.parse, + + // Parse text as xml + "text xml": jQuery.parseXML + }, + + // For options that shouldn't be deep extended: + // you can add your own custom options here if + // and when you create one that shouldn't be + // deep extended (see ajaxExtend) + flatOptions: { + url: true, + context: true + } + }, + + // Creates a full fledged settings object into target + // with both ajaxSettings and settings fields. + // If target is omitted, writes into ajaxSettings. + ajaxSetup: function( target, settings ) { + return settings ? + + // Building a settings object + ajaxExtend( ajaxExtend( target, jQuery.ajaxSettings ), settings ) : + + // Extending ajaxSettings + ajaxExtend( jQuery.ajaxSettings, target ); + }, + + ajaxPrefilter: addToPrefiltersOrTransports( prefilters ), + ajaxTransport: addToPrefiltersOrTransports( transports ), + + // Main method + ajax: function( url, options ) { + + // If url is an object, simulate pre-1.5 signature + if ( typeof url === "object" ) { + options = url; + url = undefined; + } + + // Force options to be an object + options = options || {}; + + var transport, + + // URL without anti-cache param + cacheURL, + + // Response headers + responseHeadersString, + responseHeaders, + + // timeout handle + timeoutTimer, + + // Url cleanup var + urlAnchor, + + // Request state (becomes false upon send and true upon completion) + completed, + + // To know if global events are to be dispatched + fireGlobals, + + // Loop variable + i, + + // uncached part of the url + uncached, + + // Create the final options object + s = jQuery.ajaxSetup( {}, options ), + + // Callbacks context + callbackContext = s.context || s, + + // Context for global events is callbackContext if it is a DOM node or jQuery collection + globalEventContext = s.context && + ( callbackContext.nodeType || callbackContext.jquery ) ? + jQuery( callbackContext ) : + jQuery.event, + + // Deferreds + deferred = jQuery.Deferred(), + completeDeferred = jQuery.Callbacks( "once memory" ), + + // Status-dependent callbacks + statusCode = s.statusCode || {}, + + // Headers (they are sent all at once) + requestHeaders = {}, + requestHeadersNames = {}, + + // Default abort message + strAbort = "canceled", + + // Fake xhr + jqXHR = { + readyState: 0, + + // Builds headers hashtable if needed + getResponseHeader: function( key ) { + var match; + if ( completed ) { + if ( !responseHeaders ) { + responseHeaders = {}; + while ( ( match = rheaders.exec( responseHeadersString ) ) ) { + responseHeaders[ match[ 1 ].toLowerCase() + " " ] = + ( responseHeaders[ match[ 1 ].toLowerCase() + " " ] || [] ) + .concat( match[ 2 ] ); + } + } + match = responseHeaders[ key.toLowerCase() + " " ]; + } + return match == null ? null : match.join( ", " ); + }, + + // Raw string + getAllResponseHeaders: function() { + return completed ? responseHeadersString : null; + }, + + // Caches the header + setRequestHeader: function( name, value ) { + if ( completed == null ) { + name = requestHeadersNames[ name.toLowerCase() ] = + requestHeadersNames[ name.toLowerCase() ] || name; + requestHeaders[ name ] = value; + } + return this; + }, + + // Overrides response content-type header + overrideMimeType: function( type ) { + if ( completed == null ) { + s.mimeType = type; + } + return this; + }, + + // Status-dependent callbacks + statusCode: function( map ) { + var code; + if ( map ) { + if ( completed ) { + + // Execute the appropriate callbacks + jqXHR.always( map[ jqXHR.status ] ); + } else { + + // Lazy-add the new callbacks in a way that preserves old ones + for ( code in map ) { + statusCode[ code ] = [ statusCode[ code ], map[ code ] ]; + } + } + } + return this; + }, + + // Cancel the request + abort: function( statusText ) { + var finalText = statusText || strAbort; + if ( transport ) { + transport.abort( finalText ); + } + done( 0, finalText ); + return this; + } + }; + + // Attach deferreds + deferred.promise( jqXHR ); + + // Add protocol if not provided (prefilters might expect it) + // Handle falsy url in the settings object (#10093: consistency with old signature) + // We also use the url parameter if available + s.url = ( ( url || s.url || location.href ) + "" ) + .replace( rprotocol, location.protocol + "//" ); + + // Alias method option to type as per ticket #12004 + s.type = options.method || options.type || s.method || s.type; + + // Extract dataTypes list + s.dataTypes = ( s.dataType || "*" ).toLowerCase().match( rnothtmlwhite ) || [ "" ]; + + // A cross-domain request is in order when the origin doesn't match the current origin. + if ( s.crossDomain == null ) { + urlAnchor = document.createElement( "a" ); + + // Support: IE <=8 - 11, Edge 12 - 15 + // IE throws exception on accessing the href property if url is malformed, + // e.g. http://example.com:80x/ + try { + urlAnchor.href = s.url; + + // Support: IE <=8 - 11 only + // Anchor's host property isn't correctly set when s.url is relative + urlAnchor.href = urlAnchor.href; + s.crossDomain = originAnchor.protocol + "//" + originAnchor.host !== + urlAnchor.protocol + "//" + urlAnchor.host; + } catch ( e ) { + + // If there is an error parsing the URL, assume it is crossDomain, + // it can be rejected by the transport if it is invalid + s.crossDomain = true; + } + } + + // Convert data if not already a string + if ( s.data && s.processData && typeof s.data !== "string" ) { + s.data = jQuery.param( s.data, s.traditional ); + } + + // Apply prefilters + inspectPrefiltersOrTransports( prefilters, s, options, jqXHR ); + + // If request was aborted inside a prefilter, stop there + if ( completed ) { + return jqXHR; + } + + // We can fire global events as of now if asked to + // Don't fire events if jQuery.event is undefined in an AMD-usage scenario (#15118) + fireGlobals = jQuery.event && s.global; + + // Watch for a new set of requests + if ( fireGlobals && jQuery.active++ === 0 ) { + jQuery.event.trigger( "ajaxStart" ); + } + + // Uppercase the type + s.type = s.type.toUpperCase(); + + // Determine if request has content + s.hasContent = !rnoContent.test( s.type ); + + // Save the URL in case we're toying with the If-Modified-Since + // and/or If-None-Match header later on + // Remove hash to simplify url manipulation + cacheURL = s.url.replace( rhash, "" ); + + // More options handling for requests with no content + if ( !s.hasContent ) { + + // Remember the hash so we can put it back + uncached = s.url.slice( cacheURL.length ); + + // If data is available and should be processed, append data to url + if ( s.data && ( s.processData || typeof s.data === "string" ) ) { + cacheURL += ( rquery.test( cacheURL ) ? "&" : "?" ) + s.data; + + // #9682: remove data so that it's not used in an eventual retry + delete s.data; + } + + // Add or update anti-cache param if needed + if ( s.cache === false ) { + cacheURL = cacheURL.replace( rantiCache, "$1" ); + uncached = ( rquery.test( cacheURL ) ? "&" : "?" ) + "_=" + ( nonce.guid++ ) + + uncached; + } + + // Put hash and anti-cache on the URL that will be requested (gh-1732) + s.url = cacheURL + uncached; + + // Change '%20' to '+' if this is encoded form body content (gh-2658) + } else if ( s.data && s.processData && + ( s.contentType || "" ).indexOf( "application/x-www-form-urlencoded" ) === 0 ) { + s.data = s.data.replace( r20, "+" ); + } + + // Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode. + if ( s.ifModified ) { + if ( jQuery.lastModified[ cacheURL ] ) { + jqXHR.setRequestHeader( "If-Modified-Since", jQuery.lastModified[ cacheURL ] ); + } + if ( jQuery.etag[ cacheURL ] ) { + jqXHR.setRequestHeader( "If-None-Match", jQuery.etag[ cacheURL ] ); + } + } + + // Set the correct header, if data is being sent + if ( s.data && s.hasContent && s.contentType !== false || options.contentType ) { + jqXHR.setRequestHeader( "Content-Type", s.contentType ); + } + + // Set the Accepts header for the server, depending on the dataType + jqXHR.setRequestHeader( + "Accept", + s.dataTypes[ 0 ] && s.accepts[ s.dataTypes[ 0 ] ] ? + s.accepts[ s.dataTypes[ 0 ] ] + + ( s.dataTypes[ 0 ] !== "*" ? ", " + allTypes + "; q=0.01" : "" ) : + s.accepts[ "*" ] + ); + + // Check for headers option + for ( i in s.headers ) { + jqXHR.setRequestHeader( i, s.headers[ i ] ); + } + + // Allow custom headers/mimetypes and early abort + if ( s.beforeSend && + ( s.beforeSend.call( callbackContext, jqXHR, s ) === false || completed ) ) { + + // Abort if not done already and return + return jqXHR.abort(); + } + + // Aborting is no longer a cancellation + strAbort = "abort"; + + // Install callbacks on deferreds + completeDeferred.add( s.complete ); + jqXHR.done( s.success ); + jqXHR.fail( s.error ); + + // Get transport + transport = inspectPrefiltersOrTransports( transports, s, options, jqXHR ); + + // If no transport, we auto-abort + if ( !transport ) { + done( -1, "No Transport" ); + } else { + jqXHR.readyState = 1; + + // Send global event + if ( fireGlobals ) { + globalEventContext.trigger( "ajaxSend", [ jqXHR, s ] ); + } + + // If request was aborted inside ajaxSend, stop there + if ( completed ) { + return jqXHR; + } + + // Timeout + if ( s.async && s.timeout > 0 ) { + timeoutTimer = window.setTimeout( function() { + jqXHR.abort( "timeout" ); + }, s.timeout ); + } + + try { + completed = false; + transport.send( requestHeaders, done ); + } catch ( e ) { + + // Rethrow post-completion exceptions + if ( completed ) { + throw e; + } + + // Propagate others as results + done( -1, e ); + } + } + + // Callback for when everything is done + function done( status, nativeStatusText, responses, headers ) { + var isSuccess, success, error, response, modified, + statusText = nativeStatusText; + + // Ignore repeat invocations + if ( completed ) { + return; + } + + completed = true; + + // Clear timeout if it exists + if ( timeoutTimer ) { + window.clearTimeout( timeoutTimer ); + } + + // Dereference transport for early garbage collection + // (no matter how long the jqXHR object will be used) + transport = undefined; + + // Cache response headers + responseHeadersString = headers || ""; + + // Set readyState + jqXHR.readyState = status > 0 ? 4 : 0; + + // Determine if successful + isSuccess = status >= 200 && status < 300 || status === 304; + + // Get response data + if ( responses ) { + response = ajaxHandleResponses( s, jqXHR, responses ); + } + + // Use a noop converter for missing script but not if jsonp + if ( !isSuccess && + jQuery.inArray( "script", s.dataTypes ) > -1 && + jQuery.inArray( "json", s.dataTypes ) < 0 ) { + s.converters[ "text script" ] = function() {}; + } + + // Convert no matter what (that way responseXXX fields are always set) + response = ajaxConvert( s, response, jqXHR, isSuccess ); + + // If successful, handle type chaining + if ( isSuccess ) { + + // Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode. + if ( s.ifModified ) { + modified = jqXHR.getResponseHeader( "Last-Modified" ); + if ( modified ) { + jQuery.lastModified[ cacheURL ] = modified; + } + modified = jqXHR.getResponseHeader( "etag" ); + if ( modified ) { + jQuery.etag[ cacheURL ] = modified; + } + } + + // if no content + if ( status === 204 || s.type === "HEAD" ) { + statusText = "nocontent"; + + // if not modified + } else if ( status === 304 ) { + statusText = "notmodified"; + + // If we have data, let's convert it + } else { + statusText = response.state; + success = response.data; + error = response.error; + isSuccess = !error; + } + } else { + + // Extract error from statusText and normalize for non-aborts + error = statusText; + if ( status || !statusText ) { + statusText = "error"; + if ( status < 0 ) { + status = 0; + } + } + } + + // Set data for the fake xhr object + jqXHR.status = status; + jqXHR.statusText = ( nativeStatusText || statusText ) + ""; + + // Success/Error + if ( isSuccess ) { + deferred.resolveWith( callbackContext, [ success, statusText, jqXHR ] ); + } else { + deferred.rejectWith( callbackContext, [ jqXHR, statusText, error ] ); + } + + // Status-dependent callbacks + jqXHR.statusCode( statusCode ); + statusCode = undefined; + + if ( fireGlobals ) { + globalEventContext.trigger( isSuccess ? "ajaxSuccess" : "ajaxError", + [ jqXHR, s, isSuccess ? success : error ] ); + } + + // Complete + completeDeferred.fireWith( callbackContext, [ jqXHR, statusText ] ); + + if ( fireGlobals ) { + globalEventContext.trigger( "ajaxComplete", [ jqXHR, s ] ); + + // Handle the global AJAX counter + if ( !( --jQuery.active ) ) { + jQuery.event.trigger( "ajaxStop" ); + } + } + } + + return jqXHR; + }, + + getJSON: function( url, data, callback ) { + return jQuery.get( url, data, callback, "json" ); + }, + + getScript: function( url, callback ) { + return jQuery.get( url, undefined, callback, "script" ); + } +} ); + +jQuery.each( [ "get", "post" ], function( _i, method ) { + jQuery[ method ] = function( url, data, callback, type ) { + + // Shift arguments if data argument was omitted + if ( isFunction( data ) ) { + type = type || callback; + callback = data; + data = undefined; + } + + // The url can be an options object (which then must have .url) + return jQuery.ajax( jQuery.extend( { + url: url, + type: method, + dataType: type, + data: data, + success: callback + }, jQuery.isPlainObject( url ) && url ) ); + }; +} ); + +jQuery.ajaxPrefilter( function( s ) { + var i; + for ( i in s.headers ) { + if ( i.toLowerCase() === "content-type" ) { + s.contentType = s.headers[ i ] || ""; + } + } +} ); + + +jQuery._evalUrl = function( url, options, doc ) { + return jQuery.ajax( { + url: url, + + // Make this explicit, since user can override this through ajaxSetup (#11264) + type: "GET", + dataType: "script", + cache: true, + async: false, + global: false, + + // Only evaluate the response if it is successful (gh-4126) + // dataFilter is not invoked for failure responses, so using it instead + // of the default converter is kludgy but it works. + converters: { + "text script": function() {} + }, + dataFilter: function( response ) { + jQuery.globalEval( response, options, doc ); + } + } ); +}; + + +jQuery.fn.extend( { + wrapAll: function( html ) { + var wrap; + + if ( this[ 0 ] ) { + if ( isFunction( html ) ) { + html = html.call( this[ 0 ] ); + } + + // The elements to wrap the target around + wrap = jQuery( html, this[ 0 ].ownerDocument ).eq( 0 ).clone( true ); + + if ( this[ 0 ].parentNode ) { + wrap.insertBefore( this[ 0 ] ); + } + + wrap.map( function() { + var elem = this; + + while ( elem.firstElementChild ) { + elem = elem.firstElementChild; + } + + return elem; + } ).append( this ); + } + + return this; + }, + + wrapInner: function( html ) { + if ( isFunction( html ) ) { + return this.each( function( i ) { + jQuery( this ).wrapInner( html.call( this, i ) ); + } ); + } + + return this.each( function() { + var self = jQuery( this ), + contents = self.contents(); + + if ( contents.length ) { + contents.wrapAll( html ); + + } else { + self.append( html ); + } + } ); + }, + + wrap: function( html ) { + var htmlIsFunction = isFunction( html ); + + return this.each( function( i ) { + jQuery( this ).wrapAll( htmlIsFunction ? html.call( this, i ) : html ); + } ); + }, + + unwrap: function( selector ) { + this.parent( selector ).not( "body" ).each( function() { + jQuery( this ).replaceWith( this.childNodes ); + } ); + return this; + } +} ); + + +jQuery.expr.pseudos.hidden = function( elem ) { + return !jQuery.expr.pseudos.visible( elem ); +}; +jQuery.expr.pseudos.visible = function( elem ) { + return !!( elem.offsetWidth || elem.offsetHeight || elem.getClientRects().length ); +}; + + + + +jQuery.ajaxSettings.xhr = function() { + try { + return new window.XMLHttpRequest(); + } catch ( e ) {} +}; + +var xhrSuccessStatus = { + + // File protocol always yields status code 0, assume 200 + 0: 200, + + // Support: IE <=9 only + // #1450: sometimes IE returns 1223 when it should be 204 + 1223: 204 + }, + xhrSupported = jQuery.ajaxSettings.xhr(); + +support.cors = !!xhrSupported && ( "withCredentials" in xhrSupported ); +support.ajax = xhrSupported = !!xhrSupported; + +jQuery.ajaxTransport( function( options ) { + var callback, errorCallback; + + // Cross domain only allowed if supported through XMLHttpRequest + if ( support.cors || xhrSupported && !options.crossDomain ) { + return { + send: function( headers, complete ) { + var i, + xhr = options.xhr(); + + xhr.open( + options.type, + options.url, + options.async, + options.username, + options.password + ); + + // Apply custom fields if provided + if ( options.xhrFields ) { + for ( i in options.xhrFields ) { + xhr[ i ] = options.xhrFields[ i ]; + } + } + + // Override mime type if needed + if ( options.mimeType && xhr.overrideMimeType ) { + xhr.overrideMimeType( options.mimeType ); + } + + // X-Requested-With header + // For cross-domain requests, seeing as conditions for a preflight are + // akin to a jigsaw puzzle, we simply never set it to be sure. + // (it can always be set on a per-request basis or even using ajaxSetup) + // For same-domain requests, won't change header if already provided. + if ( !options.crossDomain && !headers[ "X-Requested-With" ] ) { + headers[ "X-Requested-With" ] = "XMLHttpRequest"; + } + + // Set headers + for ( i in headers ) { + xhr.setRequestHeader( i, headers[ i ] ); + } + + // Callback + callback = function( type ) { + return function() { + if ( callback ) { + callback = errorCallback = xhr.onload = + xhr.onerror = xhr.onabort = xhr.ontimeout = + xhr.onreadystatechange = null; + + if ( type === "abort" ) { + xhr.abort(); + } else if ( type === "error" ) { + + // Support: IE <=9 only + // On a manual native abort, IE9 throws + // errors on any property access that is not readyState + if ( typeof xhr.status !== "number" ) { + complete( 0, "error" ); + } else { + complete( + + // File: protocol always yields status 0; see #8605, #14207 + xhr.status, + xhr.statusText + ); + } + } else { + complete( + xhrSuccessStatus[ xhr.status ] || xhr.status, + xhr.statusText, + + // Support: IE <=9 only + // IE9 has no XHR2 but throws on binary (trac-11426) + // For XHR2 non-text, let the caller handle it (gh-2498) + ( xhr.responseType || "text" ) !== "text" || + typeof xhr.responseText !== "string" ? + { binary: xhr.response } : + { text: xhr.responseText }, + xhr.getAllResponseHeaders() + ); + } + } + }; + }; + + // Listen to events + xhr.onload = callback(); + errorCallback = xhr.onerror = xhr.ontimeout = callback( "error" ); + + // Support: IE 9 only + // Use onreadystatechange to replace onabort + // to handle uncaught aborts + if ( xhr.onabort !== undefined ) { + xhr.onabort = errorCallback; + } else { + xhr.onreadystatechange = function() { + + // Check readyState before timeout as it changes + if ( xhr.readyState === 4 ) { + + // Allow onerror to be called first, + // but that will not handle a native abort + // Also, save errorCallback to a variable + // as xhr.onerror cannot be accessed + window.setTimeout( function() { + if ( callback ) { + errorCallback(); + } + } ); + } + }; + } + + // Create the abort callback + callback = callback( "abort" ); + + try { + + // Do send the request (this may raise an exception) + xhr.send( options.hasContent && options.data || null ); + } catch ( e ) { + + // #14683: Only rethrow if this hasn't been notified as an error yet + if ( callback ) { + throw e; + } + } + }, + + abort: function() { + if ( callback ) { + callback(); + } + } + }; + } +} ); + + + + +// Prevent auto-execution of scripts when no explicit dataType was provided (See gh-2432) +jQuery.ajaxPrefilter( function( s ) { + if ( s.crossDomain ) { + s.contents.script = false; + } +} ); + +// Install script dataType +jQuery.ajaxSetup( { + accepts: { + script: "text/javascript, application/javascript, " + + "application/ecmascript, application/x-ecmascript" + }, + contents: { + script: /\b(?:java|ecma)script\b/ + }, + converters: { + "text script": function( text ) { + jQuery.globalEval( text ); + return text; + } + } +} ); + +// Handle cache's special case and crossDomain +jQuery.ajaxPrefilter( "script", function( s ) { + if ( s.cache === undefined ) { + s.cache = false; + } + if ( s.crossDomain ) { + s.type = "GET"; + } +} ); + +// Bind script tag hack transport +jQuery.ajaxTransport( "script", function( s ) { + + // This transport only deals with cross domain or forced-by-attrs requests + if ( s.crossDomain || s.scriptAttrs ) { + var script, callback; + return { + send: function( _, complete ) { + script = jQuery( "